Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-52906 (GCVE-0-2023-52906)
Vulnerability from cvelistv5 – Published: 2024-08-21 06:10 – Updated: 2026-05-11 19:35| Vendor | Product | Version | |
|---|---|---|---|
| Linux | Linux |
Affected:
2a2ea50870baa3fb4de0872c5b60828138654ca7 , < 2b157c3c5d6b8ddca48d53c9e662032f65af8d61
(git)
Affected: 2a2ea50870baa3fb4de0872c5b60828138654ca7 , < 453277feb41c2235cf2c0de9209eef962c401457 (git) Affected: 2a2ea50870baa3fb4de0872c5b60828138654ca7 , < 9e2c38827cdc6fdd3bb375c8607fc04d289756f9 (git) Affected: 2a2ea50870baa3fb4de0872c5b60828138654ca7 , < 8a97b544b98e44f596219ebb290fd2ba2fd5d644 (git) Affected: 2a2ea50870baa3fb4de0872c5b60828138654ca7 , < 9e17f99220d111ea031b44153fdfe364b0024ff2 (git) |
|
| Linux | Linux |
Affected:
5.3
Unaffected: 0 , < 5.3 (semver) Unaffected: 5.4.229 , ≤ 5.4.* (semver) Unaffected: 5.10.164 , ≤ 5.10.* (semver) Unaffected: 5.15.89 , ≤ 5.15.* (semver) Unaffected: 6.1.7 , ≤ 6.1.* (semver) Unaffected: 6.2 , ≤ * (original_commit_for_fix) |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52906",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:03:11.641593Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-12T17:33:13.683Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2b157c3c5d6b8ddca48d53c9e662032f65af8d61",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "453277feb41c2235cf2c0de9209eef962c401457",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e2c38827cdc6fdd3bb375c8607fc04d289756f9",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "8a97b544b98e44f596219ebb290fd2ba2fd5d644",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e17f99220d111ea031b44153fdfe364b0024ff2",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.3"
},
{
"lessThan": "5.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.229",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.164",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.89",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.229",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.164",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.89",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.7",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2",
"versionStartIncluding": "5.3",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet/sched: act_mpls: Fix warning during failed attribute validation\n\nThe \u0027TCA_MPLS_LABEL\u0027 attribute is of \u0027NLA_U32\u0027 type, but has a\nvalidation type of \u0027NLA_VALIDATE_FUNCTION\u0027. This is an invalid\ncombination according to the comment above \u0027struct nla_policy\u0027:\n\n\"\nMeaning of `validate\u0027 field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0027s a union\n\"\n\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0027NLA_U32\u0027 type, the\nassociated \u0027min\u0027/\u0027max\u0027 fields in the policy are negative as they are\naliased by the \u0027validate\u0027 field.\n\nFix by changing the attribute type to \u0027NLA_BINARY\u0027 which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\n\nNo regressions in MPLS tests:\n\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\n\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u003cTASK\u003e\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd"
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:35:16.748Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61"
},
{
"url": "https://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457"
},
{
"url": "https://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9"
},
{
"url": "https://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644"
},
{
"url": "https://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2"
}
],
"title": "net/sched: act_mpls: Fix warning during failed attribute validation",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52906",
"datePublished": "2024-08-21T06:10:47.121Z",
"dateReserved": "2024-08-21T06:07:11.015Z",
"dateUpdated": "2026-05-11T19:35:16.748Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-52906",
"date": "2026-10-03",
"epss": "0.00248",
"percentile": "0.14647"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2b157c3c5d6b8ddca48d53c9e662032f65af8d61",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "453277feb41c2235cf2c0de9209eef962c401457",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e2c38827cdc6fdd3bb375c8607fc04d289756f9",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "8a97b544b98e44f596219ebb290fd2ba2fd5d644",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e17f99220d111ea031b44153fdfe364b0024ff2",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.3"
},
{
"lessThan": "5.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.229",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.164",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.89",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6B9D0314-C8F6-4538-867F-2873DF2287F2",
"versionEndExcluding": "5.4.229",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CA742E66-32D2-459E-AB19-171C4DB3B1F4",
"versionEndExcluding": "5.10.164",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E706841F-E788-4316-9B05-DA8EB60CE6B3",
"versionEndExcluding": "5.15.89",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9275C81F-AE96-4CDB-AD20-7DBD36E5D909",
"versionEndExcluding": "6.1.7",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc1:*:*:*:*:*:*",
"matchCriteriaId": "FF501633-2F44-4913-A8EE-B021929F49F6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc2:*:*:*:*:*:*",
"matchCriteriaId": "2BDA597B-CAC1-4DF0-86F0-42E142C654E9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc3:*:*:*:*:*:*",
"matchCriteriaId": "725C78C9-12CE-406F-ABE8-0813A01D66E8",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet/sched: act_mpls: Fix warning during failed attribute validation\n\nThe \u0027TCA_MPLS_LABEL\u0027 attribute is of \u0027NLA_U32\u0027 type, but has a\nvalidation type of \u0027NLA_VALIDATE_FUNCTION\u0027. This is an invalid\ncombination according to the comment above \u0027struct nla_policy\u0027:\n\n\"\nMeaning of `validate\u0027 field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0027s a union\n\"\n\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0027NLA_U32\u0027 type, the\nassociated \u0027min\u0027/\u0027max\u0027 fields in the policy are negative as they are\naliased by the \u0027validate\u0027 field.\n\nFix by changing the attribute type to \u0027NLA_BINARY\u0027 which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\n\nNo regressions in MPLS tests:\n\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\n\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u003cTASK\u003e\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: net/sched: act_mpls: Advertencia de correcci\u00f3n durante la validaci\u00f3n fallida del atributo El atributo \u0027TCA_MPLS_LABEL\u0027 es de tipo \u0027NLA_U32\u0027, pero tiene un tipo de validaci\u00f3n de \u0027NLA_VALIDATE_FUNCTION\u0027. Esta es una combinaci\u00f3n no v\u00e1lida seg\u00fan el comentario anterior \u0027struct nla_policy\u0027: \" Significado del campo `validar\u0027, util\u00edcelo a trav\u00e9s de NLA_POLICY_VALIDATE_FN: NLA_BINARY Funci\u00f3n de validaci\u00f3n llamada para el atributo. Todos los dem\u00e1s no utilizados, pero tenga en cuenta que es una uni\u00f3n \" Esto puede desencadenar la advertencia [1] en nla_get_range_unsigned() cuando falla la validaci\u00f3n del atributo. A pesar de ser del tipo \u0027NLA_U32\u0027, los campos \u0027min\u0027/\u0027max\u0027 asociados en la pol\u00edtica son negativos ya que tienen un alias del campo \u0027validate\u0027. Para solucionarlo, cambie el tipo de atributo a \u0027NLA_BINARY\u0027, que es coherente con el comentario anterior y con todos los dem\u00e1s usuarios de NLA_POLICY_VALIDATE_FN(). Como resultado, mueva la validaci\u00f3n de longitud a la funci\u00f3n de validaci\u00f3n. No hay regresiones en las pruebas MPLS: # ./tdc.py -f tc-tests/actions/mpls.json [...] # echo $? 0 [1] ADVERTENCIA: CPU: 0 PID: 17743 en lib/nlattr.c:118 nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 M\u00f3dulos vinculados en: CPU: 0 PID: 17743 Comm: syz-executor.0 No tainted 6.1.0-rc8 #3 Nombre del hardware: PC est\u00e1ndar QEMU (i440FX + PIIX, 1996), BIOS rel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 01/04/2014 RIP: 0010:nla_get_range_unsigned+0x1d8 /0x1e0 lib/nlattr.c:117 [...] Seguimiento de llamadas: __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310 netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411 netlink_ack_tlv_fill net /netlink/af_netlink.c:2454 [en l\u00ednea] netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506 netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546 rtnetlink_rcv+0x18/0x20 net/core/rtnetlink. c:6109 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [en l\u00ednea] netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921 sock_sendmsg_nosec net/socket.c :714 [en l\u00ednea] sock_sendmsg net/socket.c:734 [en l\u00ednea] ____sys_sendmsg+0x38f/0x500 net/socket.c:2482 ___sys_sendmsg net/socket.c:2536 [en l\u00ednea] __sys_sendmsg+0x197/0x230 net/socket.c: 2565 __do_sys_sendmsg net/socket.c:2574 [en l\u00ednea] __se_sys_sendmsg net/socket.c:2572 [en l\u00ednea] __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572 do_syscall_x64 arch/x86/entry/common.c:50 [en l\u00ednea] do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80 Entry_SYSCALL_64_after_hwframe+0x63/0xcd"
}
],
"id": "CVE-2023-52906",
"lastModified": "2026-06-17T06:43:54.353",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52906",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:03:11.641593Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-08-21T07:15:06.663",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2025-11-21T14:34:07+00:00",
"cve": "CVE-2023-52906",
"id": "CVE-2023-52906",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: net/sched: act_mpls: Fix warning during failed attribute validation",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-52906.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52906",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:03:11.641593Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:18.240Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2b157c3c5d6b",
"status": "affected",
"version": "2a2ea50870ba",
"versionType": "git"
},
{
"lessThan": "453277feb41c",
"status": "affected",
"version": "2a2ea50870ba",
"versionType": "git"
},
{
"lessThan": "9e2c38827cdc",
"status": "affected",
"version": "2a2ea50870ba",
"versionType": "git"
},
{
"lessThan": "8a97b544b98e",
"status": "affected",
"version": "2a2ea50870ba",
"versionType": "git"
},
{
"lessThan": "9e17f99220d1",
"status": "affected",
"version": "2a2ea50870ba",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.3"
},
{
"lessThan": "5.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.229",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.164",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.89",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet/sched: act_mpls: Fix warning during failed attribute validation\n\nThe \u0027TCA_MPLS_LABEL\u0027 attribute is of \u0027NLA_U32\u0027 type, but has a\nvalidation type of \u0027NLA_VALIDATE_FUNCTION\u0027. This is an invalid\ncombination according to the comment above \u0027struct nla_policy\u0027:\n\n\"\nMeaning of `validate\u0027 field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0027s a union\n\"\n\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0027NLA_U32\u0027 type, the\nassociated \u0027min\u0027/\u0027max\u0027 fields in the policy are negative as they are\naliased by the \u0027validate\u0027 field.\n\nFix by changing the attribute type to \u0027NLA_BINARY\u0027 which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\n\nNo regressions in MPLS tests:\n\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\n\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u003cTASK\u003e\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd"
}
],
"providerMetadata": {
"dateUpdated": "2024-11-04T14:54:57.643Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61"
},
{
"url": "https://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457"
},
{
"url": "https://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9"
},
{
"url": "https://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644"
},
{
"url": "https://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2"
}
],
"title": "net/sched: act_mpls: Fix warning during failed attribute validation",
"x_generator": {
"engine": "bippy-9e1c9544281a"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52906",
"datePublished": "2024-08-21T06:10:47.121Z",
"dateReserved": "2024-08-21T06:07:11.015Z",
"dateUpdated": "2024-11-04T14:54:57.643Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
BDU:2024-07453 (CVE-2023-52906)
Vulnerability from fstec – Published: 2024-09-24 – Updated: 2024-11-26 – View on bdu.fstec.ru Fixed- CWE-20 - Недостаточная проверка вводимых данных
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:C/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Red Hat, Inc., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "8 (Red Hat Enterprise Linux), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 7.3 (\u0420\u0415\u0414 \u041e\u0421), 9 (Red Hat Enterprise Linux), \u043e\u0442 5.5 \u0434\u043e 5.10.163 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.88 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.6 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.3 \u0434\u043e 5.4.228 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/linus/9e17f99220d111ea031b44153fdfe364b0024ff2\nhttps://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61\nhttps://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457\nhttps://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644\nhttps://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2\nhttps://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.164\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.89\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.4.229\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.7\nhttps://lore.kernel.org/linux-cve-announce/2024082114-CVE-2023-52906-7967@gregkh/\n\n\u0414\u043b\u044f \u0420\u0435\u0434\u041e\u0421: http://repo.red-soft.ru/redos/7.3c/x86_64/updates/\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-52906\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/CVE-2023-52906",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "09.01.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "26.11.2024",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "24.09.2024",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2024-07453",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-52906",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Red Hat Enterprise Linux, Debian GNU/Linux, \u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Red Hat, Inc. Red Hat Enterprise Linux 8 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.11 \u0434\u043e 5.15.89 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.16 \u0434\u043e 6.1.7 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux 6.2 rc1 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux 6.2 rc2 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux 6.2 rc3 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.3 \u0434\u043e 5.4.229 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.5 \u0434\u043e 5.10.164 ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 act_mpls \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u0441\u0432\u044f\u0437\u0430\u043d\u043d\u0430\u044f \u0441 \u043d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0439 \u043f\u0440\u043e\u0432\u0435\u0440\u043a\u043e\u0439 \u0432\u0445\u043e\u0434\u043d\u044b\u0445 \u0434\u0430\u043d\u043d\u044b\u0445, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u043f\u043e\u043b\u043d\u0438\u0442\u044c \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u043b\u044c\u043d\u044b\u0439 \u043a\u043e\u0434",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041d\u0435\u0434\u043e\u0441\u0442\u0430\u0442\u043e\u0447\u043d\u0430\u044f \u043f\u0440\u043e\u0432\u0435\u0440\u043a\u0430 \u0432\u0432\u043e\u0434\u0438\u043c\u044b\u0445 \u0434\u0430\u043d\u043d\u044b\u0445 (CWE-20)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 act_mpls \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0439 \u043f\u0440\u043e\u0432\u0435\u0440\u043a\u043e\u0439 \u0432\u0445\u043e\u0434\u043d\u044b\u0445 \u0434\u0430\u043d\u043d\u044b\u0445. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u043f\u043e\u043b\u043d\u0438\u0442\u044c \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u043b\u044c\u043d\u044b\u0439 \u043a\u043e\u0434",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u0441\u0443\u0440\u0441\u0430\u043c\u0438",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://access.redhat.com/security/cve/CVE-2023-52906\nhttps://git.kernel.org/linus/9e17f99220d111ea031b44153fdfe364b0024ff2\nhttps://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61\nhttps://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457\nhttps://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644\nhttps://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2\nhttps://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.164\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.89\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.4.229\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.7\nhttps://lore.kernel.org/linux-cve-announce/2024082114-CVE-2023-52906-7967@gregkh/\nhttps://redos.red-soft.ru/support/secure/\nhttps://security-tracker.debian.org/tracker/CVE-2023-52906\nhttps://www.cve.org/CVERecord?id=CVE-2023-52906",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-20",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 6,8)\n\u0412\u044b\u0441\u043e\u043a\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 7,8)\n\u041d\u0435\u0442 \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 4.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 0)"
}
BELL-CVE-2023-52906 (CVE-2023-52906)
Vulnerability from osv_bellsoft – Published: 2024-08-22 05:56 – Updated: 2024-08-22 05:56 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.112-r0"
},
{
"fixed": "6.6.58-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2023-52906",
"modified": "2024-08-22T05:56:31.78101Z",
"published": "2024-08-22T05:56:31.78097Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2023-52906"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2023-52906"
]
}
CERTFR-2024-AVI-0779
Vulnerability from certfr_avis - Published: 2024-09-13 - Updated: 2024-09-13
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-3610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3610"
},
{
"name": "CVE-2022-40133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40133"
},
{
"name": "CVE-2022-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38457"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26631"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26590"
},
{
"name": "CVE-2024-26812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26812"
},
{
"name": "CVE-2024-26809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26809"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2023-52489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52489"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2023-52498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52498"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26808"
},
{
"name": "CVE-2024-26835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26835"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-27024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27024"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-35902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35902"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-27403",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27403"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27049"
},
{
"name": "CVE-2024-27050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27050"
},
{
"name": "CVE-2024-27079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27079"
},
{
"name": "CVE-2024-27433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27433"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-35913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35913"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2022-48808",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48808"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36881"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38563"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42143"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-41073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41073"
},
{
"name": "CVE-2024-41096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41096"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2021-4440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4440"
},
{
"name": "CVE-2021-4441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4441"
},
{
"name": "CVE-2021-47106",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47106"
},
{
"name": "CVE-2021-47517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47517"
},
{
"name": "CVE-2022-48645",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48645"
},
{
"name": "CVE-2022-48706",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48706"
},
{
"name": "CVE-2022-48865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48865"
},
{
"name": "CVE-2022-48868",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48868"
},
{
"name": "CVE-2022-48869",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48869"
},
{
"name": "CVE-2022-48870",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48870"
},
{
"name": "CVE-2022-48871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48871"
},
{
"name": "CVE-2022-48872",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48872"
},
{
"name": "CVE-2022-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48873"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2022-48878",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48878"
},
{
"name": "CVE-2022-48880",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48880"
},
{
"name": "CVE-2022-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48881"
},
{
"name": "CVE-2022-48882",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48882"
},
{
"name": "CVE-2022-48883",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48883"
},
{
"name": "CVE-2022-48884",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48884"
},
{
"name": "CVE-2022-48885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48885"
},
{
"name": "CVE-2022-48886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48886"
},
{
"name": "CVE-2022-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48887"
},
{
"name": "CVE-2022-48888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48888"
},
{
"name": "CVE-2022-48889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48889"
},
{
"name": "CVE-2022-48890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48890"
},
{
"name": "CVE-2022-48891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48891"
},
{
"name": "CVE-2022-48893",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48893"
},
{
"name": "CVE-2022-48896",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48896"
},
{
"name": "CVE-2022-48898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48898"
},
{
"name": "CVE-2022-48899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48899"
},
{
"name": "CVE-2022-48901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48901"
},
{
"name": "CVE-2022-48903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48903"
},
{
"name": "CVE-2022-48904",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48904"
},
{
"name": "CVE-2022-48905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48905"
},
{
"name": "CVE-2022-48906",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48906"
},
{
"name": "CVE-2022-48907",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48907"
},
{
"name": "CVE-2022-48909",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48909"
},
{
"name": "CVE-2022-48910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48910"
},
{
"name": "CVE-2022-48912",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48912"
},
{
"name": "CVE-2022-48913",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48913"
},
{
"name": "CVE-2022-48914",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48914"
},
{
"name": "CVE-2022-48915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48915"
},
{
"name": "CVE-2022-48916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48916"
},
{
"name": "CVE-2022-48917",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48917"
},
{
"name": "CVE-2022-48918",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48918"
},
{
"name": "CVE-2022-48919",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48919"
},
{
"name": "CVE-2022-48920",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48920"
},
{
"name": "CVE-2022-48921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48921"
},
{
"name": "CVE-2022-48923",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48923"
},
{
"name": "CVE-2022-48924",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48924"
},
{
"name": "CVE-2022-48925",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48925"
},
{
"name": "CVE-2022-48926",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48926"
},
{
"name": "CVE-2022-48927",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48927"
},
{
"name": "CVE-2022-48928",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48928"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2022-48930",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48930"
},
{
"name": "CVE-2022-48931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48931"
},
{
"name": "CVE-2022-48932",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48932"
},
{
"name": "CVE-2022-48933",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48933"
},
{
"name": "CVE-2022-48934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48934"
},
{
"name": "CVE-2022-48935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48935"
},
{
"name": "CVE-2022-48937",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48937"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2022-48939",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48939"
},
{
"name": "CVE-2022-48940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48940"
},
{
"name": "CVE-2022-48941",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48941"
},
{
"name": "CVE-2022-48942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48942"
},
{
"name": "CVE-2022-48943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48943"
},
{
"name": "CVE-2023-52668",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52668"
},
{
"name": "CVE-2023-52688",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52688"
},
{
"name": "CVE-2023-52802",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52802"
},
{
"name": "CVE-2023-52859",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52859"
},
{
"name": "CVE-2023-52889",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52889"
},
{
"name": "CVE-2023-52893",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52893"
},
{
"name": "CVE-2023-52894",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52894"
},
{
"name": "CVE-2023-52896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52896"
},
{
"name": "CVE-2023-52898",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52898"
},
{
"name": "CVE-2023-52899",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52899"
},
{
"name": "CVE-2023-52900",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52900"
},
{
"name": "CVE-2023-52901",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52901"
},
{
"name": "CVE-2023-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52904"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2023-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52906"
},
{
"name": "CVE-2023-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52907"
},
{
"name": "CVE-2023-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52908"
},
{
"name": "CVE-2023-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52909"
},
{
"name": "CVE-2023-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52910"
},
{
"name": "CVE-2023-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52911"
},
{
"name": "CVE-2023-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52912"
},
{
"name": "CVE-2023-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52913"
},
{
"name": "CVE-2024-26637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26637"
},
{
"name": "CVE-2024-26682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26682"
},
{
"name": "CVE-2024-26683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26683"
},
{
"name": "CVE-2024-26849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26849"
},
{
"name": "CVE-2024-36907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36907"
},
{
"name": "CVE-2024-36970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36970"
},
{
"name": "CVE-2024-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38609"
},
{
"name": "CVE-2024-39486",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39486"
},
{
"name": "CVE-2024-41010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41010"
},
{
"name": "CVE-2024-41024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41024"
},
{
"name": "CVE-2024-41025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41025"
},
{
"name": "CVE-2024-41028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41028"
},
{
"name": "CVE-2024-41032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41032"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2024-41037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41037"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-41050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41050"
},
{
"name": "CVE-2024-41051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41051"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41061"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2024-41074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41074"
},
{
"name": "CVE-2024-41075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41075"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2024-41080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41080"
},
{
"name": "CVE-2024-41084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41084"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2024-41094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41094"
},
{
"name": "CVE-2024-41098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41098"
},
{
"name": "CVE-2024-42064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42064"
},
{
"name": "CVE-2024-42069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42069"
},
{
"name": "CVE-2024-42073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42073"
},
{
"name": "CVE-2024-42074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42074"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2024-42113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42113"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2024-42117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42117"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2024-42126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42126"
},
{
"name": "CVE-2024-42132",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42132"
},
{
"name": "CVE-2024-42133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42133"
},
{
"name": "CVE-2024-42136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42136"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-42141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42141"
},
{
"name": "CVE-2024-42142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42142"
},
{
"name": "CVE-2024-42144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42144"
},
{
"name": "CVE-2024-42147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42147"
},
{
"name": "CVE-2024-42155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42155"
},
{
"name": "CVE-2024-42156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42156"
},
{
"name": "CVE-2024-42158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42158"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42162"
},
{
"name": "CVE-2024-42226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42226"
},
{
"name": "CVE-2024-42227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42227"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42241"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-42250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42250"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-42259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42259"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42269"
},
{
"name": "CVE-2024-42271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42271"
},
{
"name": "CVE-2024-42274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42274"
},
{
"name": "CVE-2024-42276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42276"
},
{
"name": "CVE-2024-42277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42277"
},
{
"name": "CVE-2024-42278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42278"
},
{
"name": "CVE-2024-42279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42279"
},
{
"name": "CVE-2024-42280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42280"
},
{
"name": "CVE-2024-42281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42281"
},
{
"name": "CVE-2024-42283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42283"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-42285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42285"
},
{
"name": "CVE-2024-42286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42286"
},
{
"name": "CVE-2024-42287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42287"
},
{
"name": "CVE-2024-42288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42288"
},
{
"name": "CVE-2024-42289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42289"
},
{
"name": "CVE-2024-42290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42290"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2024-42295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42295"
},
{
"name": "CVE-2024-42298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42298"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2024-42302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42302"
},
{
"name": "CVE-2024-42303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42303"
},
{
"name": "CVE-2024-42308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42308"
},
{
"name": "CVE-2024-42309",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42309"
},
{
"name": "CVE-2024-42310",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42310"
},
{
"name": "CVE-2024-42311",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42311"
},
{
"name": "CVE-2024-42312",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42312"
},
{
"name": "CVE-2024-42313",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42313"
},
{
"name": "CVE-2024-42314",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42314"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-42318",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42318"
},
{
"name": "CVE-2024-42319",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42319"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2024-43816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43816"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43818"
},
{
"name": "CVE-2024-43819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43819"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2024-43825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43825"
},
{
"name": "CVE-2024-43826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43826"
},
{
"name": "CVE-2024-43829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43829"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2024-43831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43831"
},
{
"name": "CVE-2024-43833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43833"
},
{
"name": "CVE-2024-43834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43834"
},
{
"name": "CVE-2024-43837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43837"
},
{
"name": "CVE-2024-43839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43839"
},
{
"name": "CVE-2024-43840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43840"
},
{
"name": "CVE-2024-43841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43841"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43846"
},
{
"name": "CVE-2024-43847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43847"
},
{
"name": "CVE-2024-43849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43849"
},
{
"name": "CVE-2024-43850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43850"
},
{
"name": "CVE-2024-43851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43851"
},
{
"name": "CVE-2024-43853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43853"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43855"
},
{
"name": "CVE-2024-43856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43856"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2024-43860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43860"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-43863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43863"
},
{
"name": "CVE-2024-43864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43864"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43872"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43874"
},
{
"name": "CVE-2024-43875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43875"
},
{
"name": "CVE-2024-43876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43876"
},
{
"name": "CVE-2024-43877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43877"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-43881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43881"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-43884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43884"
},
{
"name": "CVE-2024-43885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43885"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43895"
},
{
"name": "CVE-2024-43897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43897"
},
{
"name": "CVE-2024-43899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43899"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-43902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43902"
},
{
"name": "CVE-2024-43903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43903"
},
{
"name": "CVE-2024-43904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43904"
},
{
"name": "CVE-2024-43905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43905"
},
{
"name": "CVE-2024-43906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43906"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-43909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43909"
},
{
"name": "CVE-2024-43911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43911"
},
{
"name": "CVE-2024-43912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43912"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-44939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44939"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
}
],
"initial_release_date": "2024-09-13T00:00:00",
"last_revision_date": "2024-09-13T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0779",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-13T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243189-1"
},
{
"published_at": "2024-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3195-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243195-1"
},
{
"published_at": "2024-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243190-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3225-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243225-1"
},
{
"published_at": "2024-09-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3227-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243227-1"
},
{
"published_at": "2024-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243209-1"
},
{
"published_at": "2024-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3194-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243194-1"
}
]
}
CERTFR-2024-AVI-0840
Vulnerability from certfr_avis - Published: 2024-10-04 - Updated: 2024-10-04
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-27024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27024"
},
{
"name": "CVE-2024-42274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42274"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-42155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42155"
},
{
"name": "CVE-2022-48915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48915"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42162"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-42280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42280"
},
{
"name": "CVE-2024-43819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43819"
},
{
"name": "CVE-2022-48808",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48808"
},
{
"name": "CVE-2024-42310",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42310"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2022-48914",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48914"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2023-52904",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52904"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2024-42283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42283"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2023-52900",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52900"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2022-48910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48910"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2022-48890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48890"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2022-48645",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48645"
},
{
"name": "CVE-2024-42277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42277"
},
{
"name": "CVE-2022-48869",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48869"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-42285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42285"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2022-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38457"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-42158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42158"
},
{
"name": "CVE-2022-48870",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48870"
},
{
"name": "CVE-2024-42288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42288"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-48912",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48912"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2022-48899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48899"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2022-48926",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48926"
},
{
"name": "CVE-2022-48883",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48883"
},
{
"name": "CVE-2024-43841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43841"
},
{
"name": "CVE-2022-48930",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48930"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2024-27403",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27403"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-44939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44939"
},
{
"name": "CVE-2023-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52910"
},
{
"name": "CVE-2023-52489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52489"
},
{
"name": "CVE-2022-48878",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48878"
},
{
"name": "CVE-2023-52907",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52907"
},
{
"name": "CVE-2022-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48873"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2022-48904",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48904"
},
{
"name": "CVE-2024-43834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43834"
},
{
"name": "CVE-2022-48913",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48913"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2022-40133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40133"
},
{
"name": "CVE-2022-48923",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48923"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2022-48942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48942"
},
{
"name": "CVE-2024-42308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42308"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2023-52901",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52901"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42281"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2022-48918",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48918"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-43846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43846"
},
{
"name": "CVE-2024-26631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26631"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42276"
},
{
"name": "CVE-2024-35902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35902"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-42309",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42309"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-42320",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42320"
},
{
"name": "CVE-2022-48939",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48939"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-42110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42110"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-43899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43899"
},
{
"name": "CVE-2022-48934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48934"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2022-48919",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48919"
},
{
"name": "CVE-2024-43895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43895"
},
{
"name": "CVE-2022-4382",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4382"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-43837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43837"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43903"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2022-48931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48931"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2021-4441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4441"
},
{
"name": "CVE-2022-48916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48916"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-42287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42287"
},
{
"name": "CVE-2023-52889",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52889"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2022-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48887"
},
{
"name": "CVE-2022-48924",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48924"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2022-48893",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48893"
},
{
"name": "CVE-2024-43831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43831"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2022-0854",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0854"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2023-52896",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52896"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2022-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48881"
},
{
"name": "CVE-2024-43872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43872"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2021-47106",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47106"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2022-48884",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48884"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2022-48880",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48880"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-41073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41073"
},
{
"name": "CVE-2024-41079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41079"
},
{
"name": "CVE-2022-48868",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48868"
},
{
"name": "CVE-2024-43823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43823"
},
{
"name": "CVE-2022-48921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48921"
},
{
"name": "CVE-2022-48932",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48932"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-43856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43856"
},
{
"name": "CVE-2024-41088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41088"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2024-42318",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42318"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2022-48888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48888"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-26812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26812"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-43839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43839"
},
{
"name": "CVE-2024-43853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43853"
},
{
"name": "CVE-2022-48871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48871"
},
{
"name": "CVE-2022-48885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48885"
},
{
"name": "CVE-2024-41098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41098"
},
{
"name": "CVE-2024-42286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42286"
},
{
"name": "CVE-2024-42312",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42312"
},
{
"name": "CVE-2023-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52913"
},
{
"name": "CVE-2022-48882",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48882"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-42295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42295"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2022-0500",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0500"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2023-52894",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52894"
},
{
"name": "CVE-2023-52498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52498"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2023-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52909"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2021-47517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47517"
},
{
"name": "CVE-2024-42074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42074"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2023-52899",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52899"
},
{
"name": "CVE-2022-48907",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48907"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-43816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43816"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2024-42142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42142"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-43860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43860"
},
{
"name": "CVE-2022-48943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48943"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-43863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43863"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-41036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41036"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2024-42319",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42319"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48927",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48927"
},
{
"name": "CVE-2024-42289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42289"
},
{
"name": "CVE-2024-42126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42126"
},
{
"name": "CVE-2022-48925",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48925"
},
{
"name": "CVE-2023-52912",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52912"
},
{
"name": "CVE-2024-41080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41080"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-42311",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42311"
},
{
"name": "CVE-2021-4204",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4204"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2022-48941",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48941"
},
{
"name": "CVE-2024-43849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43849"
},
{
"name": "CVE-2023-3610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3610"
},
{
"name": "CVE-2022-48901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48901"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2022-48940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48940"
},
{
"name": "CVE-2022-48909",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48909"
},
{
"name": "CVE-2022-48917",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48917"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-26808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26808"
},
{
"name": "CVE-2024-43884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43884"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2023-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52908"
},
{
"name": "CVE-2022-48928",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48928"
},
{
"name": "CVE-2023-52893",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52893"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2022-48920",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48920"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2022-48865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48865"
},
{
"name": "CVE-2023-52911",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52911"
},
{
"name": "CVE-2024-42143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42143"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
},
{
"name": "CVE-2022-48872",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48872"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-41062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41062"
},
{
"name": "CVE-2024-43904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43904"
},
{
"name": "CVE-2024-42069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42069"
},
{
"name": "CVE-2024-43829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43829"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2023-52898",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52898"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-43866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43866"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42271"
},
{
"name": "CVE-2024-42302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42302"
},
{
"name": "CVE-2022-48891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48891"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42156"
},
{
"name": "CVE-2023-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52906"
},
{
"name": "CVE-2024-42313",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42313"
},
{
"name": "CVE-2022-48889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48889"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2022-48905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48905"
},
{
"name": "CVE-2024-43909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43909"
},
{
"name": "CVE-2022-48886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48886"
},
{
"name": "CVE-2024-26835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26835"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-27079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27079"
},
{
"name": "CVE-2023-52859",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52859"
},
{
"name": "CVE-2022-48896",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48896"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-43902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43902"
},
{
"name": "CVE-2024-43818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43818"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2022-48898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48898"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2022-48903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48903"
},
{
"name": "CVE-2022-48937",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48937"
},
{
"name": "CVE-2022-23222",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23222"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-43905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43905"
},
{
"name": "CVE-2022-48706",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48706"
},
{
"name": "CVE-2022-48906",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48906"
}
],
"initial_release_date": "2024-10-04T00:00:00",
"last_revision_date": "2024-10-04T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0840",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-10-04T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-09-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3467-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243467-1"
},
{
"published_at": "2024-09-30",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3499-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243499-1"
},
{
"published_at": "2024-09-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3483-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243483-1"
},
{
"published_at": "2024-09-27",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:3468-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20243468-1"
}
]
}
CERTFR-2025-AVI-1057
Vulnerability from certfr_avis - Published: 2025-12-02 - Updated: 2025-12-02
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 16.x antérieures à 16.11.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 14.x antérieures à 14.20.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 17.x antérieures à 17.7.0 | ||
| VMware | Tanzu Kubernetes Runtime | Tanzu Hub versions antérieures à 10.3.1 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 18.x antérieures à 18.1.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 15.x antérieures à 15.15.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 13.x antérieures à 13.23.0 |
| Title | Publication Time | Tags | ||||||
|---|---|---|---|---|---|---|---|---|
|
||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Tanzu pour Postgres versions 16.x ant\u00e9rieures \u00e0 16.11.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 14.x ant\u00e9rieures \u00e0 14.20.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 17.x ant\u00e9rieures \u00e0 17.7.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Hub versions ant\u00e9rieures \u00e0 10.3.1",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 18.x ant\u00e9rieures \u00e0 18.1.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 15.x ant\u00e9rieures \u00e0 15.15.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 13.x ant\u00e9rieures \u00e0 13.23.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2019-12900",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-12900"
},
{
"name": "CVE-2019-25013",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25013"
},
{
"name": "CVE-2020-28196",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-28196"
},
{
"name": "CVE-2020-10029",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10029"
},
{
"name": "CVE-2019-18276",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-18276"
},
{
"name": "CVE-2021-3421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3421"
},
{
"name": "CVE-2021-3326",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3326"
},
{
"name": "CVE-2020-27618",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-27618"
},
{
"name": "CVE-2021-20227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20227"
},
{
"name": "CVE-2021-36222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36222"
},
{
"name": "CVE-2022-23960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23960"
},
{
"name": "CVE-2022-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37967"
},
{
"name": "CVE-2022-3629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3629"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2022-37434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37434"
},
{
"name": "CVE-2022-2309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2309"
},
{
"name": "CVE-2022-43680",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43680"
},
{
"name": "CVE-2022-29824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29824"
},
{
"name": "CVE-2022-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23308"
},
{
"name": "CVE-2022-35737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35737"
},
{
"name": "CVE-2022-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40303"
},
{
"name": "CVE-2022-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40304"
},
{
"name": "CVE-2022-42898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42898"
},
{
"name": "CVE-2022-3633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3633"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2022-32205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32205"
},
{
"name": "CVE-2022-32206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32206"
},
{
"name": "CVE-2018-25032",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-25032"
},
{
"name": "CVE-2022-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3996"
},
{
"name": "CVE-2022-3903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3903"
},
{
"name": "CVE-2022-22942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22942"
},
{
"name": "CVE-2022-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26878"
},
{
"name": "CVE-2021-20266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20266"
},
{
"name": "CVE-2022-1292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1292"
},
{
"name": "CVE-2022-1974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1974"
},
{
"name": "CVE-2021-3521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3521"
},
{
"name": "CVE-2022-27774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27774"
},
{
"name": "CVE-2022-27775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27775"
},
{
"name": "CVE-2022-22576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22576"
},
{
"name": "CVE-2022-27776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27776"
},
{
"name": "CVE-2022-2068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2068"
},
{
"name": "CVE-2022-2097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2097"
},
{
"name": "CVE-2022-20154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20154"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2021-33574",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33574"
},
{
"name": "CVE-2021-36690",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36690"
},
{
"name": "CVE-2021-37750",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37750"
},
{
"name": "CVE-2021-3999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3999"
},
{
"name": "CVE-2022-23218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23218"
},
{
"name": "CVE-2022-23219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23219"
},
{
"name": "CVE-2022-27782",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27782"
},
{
"name": "CVE-2022-32208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32208"
},
{
"name": "CVE-2022-27781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27781"
},
{
"name": "CVE-2022-32207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32207"
},
{
"name": "CVE-2022-3358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3358"
},
{
"name": "CVE-2022-1271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1271"
},
{
"name": "CVE-2022-29458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29458"
},
{
"name": "CVE-2021-39537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39537"
},
{
"name": "CVE-2022-32221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32221"
},
{
"name": "CVE-2022-42916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42916"
},
{
"name": "CVE-2022-35252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35252"
},
{
"name": "CVE-2022-42915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42915"
},
{
"name": "CVE-2022-43551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43551"
},
{
"name": "CVE-2022-43552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43552"
},
{
"name": "CVE-2022-4304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4304"
},
{
"name": "CVE-2022-4203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4203"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2023-0401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0401"
},
{
"name": "CVE-2023-0215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0215"
},
{
"name": "CVE-2023-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0217"
},
{
"name": "CVE-2023-0216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0216"
},
{
"name": "CVE-2022-4450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4450"
},
{
"name": "CVE-2022-27672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27672"
},
{
"name": "CVE-2023-0045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0045"
},
{
"name": "CVE-2023-23915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23915"
},
{
"name": "CVE-2023-23914",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23914"
},
{
"name": "CVE-2023-23916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23916"
},
{
"name": "CVE-2022-1304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1304"
},
{
"name": "CVE-2023-24329",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24329"
},
{
"name": "CVE-2023-1118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1118"
},
{
"name": "CVE-2023-0464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0464"
},
{
"name": "CVE-2023-0466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0466"
},
{
"name": "CVE-2023-0465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0465"
},
{
"name": "CVE-2023-1838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1838"
},
{
"name": "CVE-2023-28410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28410"
},
{
"name": "CVE-2023-29469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29469"
},
{
"name": "CVE-2023-28484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28484"
},
{
"name": "CVE-2023-2650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2650"
},
{
"name": "CVE-2023-27535",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27535"
},
{
"name": "CVE-2022-27779",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27779"
},
{
"name": "CVE-2023-27533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27533"
},
{
"name": "CVE-2023-27538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27538"
},
{
"name": "CVE-2023-27534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27534"
},
{
"name": "CVE-2023-27536",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27536"
},
{
"name": "CVE-2022-27780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27780"
},
{
"name": "CVE-2022-30115",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-30115"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2020-1752",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-1752"
},
{
"name": "CVE-2021-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35942"
},
{
"name": "CVE-2021-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38604"
},
{
"name": "CVE-2020-29562",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-29562"
},
{
"name": "CVE-2021-27645",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27645"
},
{
"name": "CVE-2022-3534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3534"
},
{
"name": "CVE-2023-2156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2156"
},
{
"name": "CVE-2023-3006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3006"
},
{
"name": "CVE-2023-1255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1255"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2022-46908",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46908"
},
{
"name": "CVE-2021-31239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31239"
},
{
"name": "CVE-2023-28320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28320"
},
{
"name": "CVE-2023-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28321"
},
{
"name": "CVE-2023-2975",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2975"
},
{
"name": "CVE-2022-4899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4899"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2023-28319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28319"
},
{
"name": "CVE-2023-3817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3817"
},
{
"name": "CVE-2023-4387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4387"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2023-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38545"
},
{
"name": "CVE-2023-5363",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5363"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2023-31085",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31085"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2023-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40217"
},
{
"name": "CVE-2020-22218",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22218"
},
{
"name": "CVE-2023-2603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2603"
},
{
"name": "CVE-2023-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2602"
},
{
"name": "CVE-2023-4813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4813"
},
{
"name": "CVE-2022-0563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0563"
},
{
"name": "CVE-2023-4039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4039"
},
{
"name": "CVE-2023-5156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5156"
},
{
"name": "CVE-2023-29491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29491"
},
{
"name": "CVE-2023-39615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39615"
},
{
"name": "CVE-2021-37600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37600"
},
{
"name": "CVE-2021-33294",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33294"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2023-45322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45322"
},
{
"name": "CVE-2019-17498",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-17498"
},
{
"name": "CVE-2013-4235",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-4235"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2023-48795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48795"
},
{
"name": "CVE-2023-6237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6237"
},
{
"name": "CVE-2023-36054",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36054"
},
{
"name": "CVE-2023-7104",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7104"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2023-52467",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52467"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2023-52445",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52445"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2023-52462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52462"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-26603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26603"
},
{
"name": "CVE-2023-52452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52452"
},
{
"name": "CVE-2023-52532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52532"
},
{
"name": "CVE-2019-25162",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25162"
},
{
"name": "CVE-2021-46904",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46904"
},
{
"name": "CVE-2024-24855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24855"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2024-28085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28085"
},
{
"name": "CVE-2024-2511",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2511"
},
{
"name": "CVE-2020-22916",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22916"
},
{
"name": "CVE-2024-26631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26631"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2023-52426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52426"
},
{
"name": "CVE-2023-52501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52501"
},
{
"name": "CVE-2023-52519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52519"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-26670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26670"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2023-52528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52528"
},
{
"name": "CVE-2023-52582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52582"
},
{
"name": "CVE-2021-47098",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47098"
},
{
"name": "CVE-2023-52513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52513"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2023-52520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52520"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2023-52523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52523"
},
{
"name": "CVE-2024-26803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26803"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26681"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2024-26621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26621"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-47020",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47020"
},
{
"name": "CVE-2021-47017",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47017"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2021-47071",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47071"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2024-26605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26605"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26987"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2023-52468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52468"
},
{
"name": "CVE-2023-52487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52487"
},
{
"name": "CVE-2024-26618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26618"
},
{
"name": "CVE-2023-52490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52490"
},
{
"name": "CVE-2023-52455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52455"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2023-52473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52473"
},
{
"name": "CVE-2023-52465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52465"
},
{
"name": "CVE-2007-4559",
"url": "https://www.cve.org/CVERecord?id=CVE-2007-4559"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2021-47196",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47196"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48644",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48644"
},
{
"name": "CVE-2021-47217",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47217"
},
{
"name": "CVE-2022-48653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48653"
},
{
"name": "CVE-2021-47214",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47214"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48657"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2022-48658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48658"
},
{
"name": "CVE-2021-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47210"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2022-48639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48639"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2022-48640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48640"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2021-47215",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47215"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2021-47041",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47041"
},
{
"name": "CVE-2024-27039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27039"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48690",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48690"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2022-48637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48637"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2022-48660",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48660"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2023-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52565"
},
{
"name": "CVE-2024-26892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26892"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2024-0397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0397"
},
{
"name": "CVE-2024-4030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4030"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2023-52649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52649"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-26975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26975"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2024-27079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27079"
},
{
"name": "CVE-2024-27390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27390"
},
{
"name": "CVE-2024-35787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35787"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-3596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3596"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2024-26458",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26458"
},
{
"name": "CVE-2024-26461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26461"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2023-4641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4641"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35894"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35913"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-6197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6197"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-10966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10966"
},
{
"name": "CVE-2025-59425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59425"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-12817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12817"
},
{
"name": "CVE-2025-12818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12818"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2019-14844",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14844"
},
{
"name": "CVE-2021-24031",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24031"
},
{
"name": "CVE-2021-24032",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24032"
},
{
"name": "CVE-2021-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44964"
},
{
"name": "CVE-2022-28805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28805"
},
{
"name": "CVE-2022-33099",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33099"
},
{
"name": "CVE-2025-0306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0306"
},
{
"name": "CVE-2025-52099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52099"
},
{
"name": "CVE-2025-53643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53643"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-7709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7709"
},
{
"name": "CVE-2025-9714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9714"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2021-47517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47517"
},
{
"name": "CVE-2022-48865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48865"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2022-48883",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48883"
},
{
"name": "CVE-2022-48886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48886"
},
{
"name": "CVE-2022-48889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48889"
},
{
"name": "CVE-2022-48890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48890"
},
{
"name": "CVE-2022-48896",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48896"
},
{
"name": "CVE-2022-48899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48899"
},
{
"name": "CVE-2022-48912",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48912"
},
{
"name": "CVE-2022-48913",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48913"
},
{
"name": "CVE-2022-48914",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48914"
},
{
"name": "CVE-2022-48915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48915"
},
{
"name": "CVE-2022-48921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48921"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2022-48931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48931"
},
{
"name": "CVE-2022-48934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48934"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2022-48939",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48939"
},
{
"name": "CVE-2022-48942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48942"
},
{
"name": "CVE-2023-52859",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52859"
},
{
"name": "CVE-2023-52898",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52898"
},
{
"name": "CVE-2023-52901",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52901"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2023-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52906"
},
{
"name": "CVE-2023-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52908"
},
{
"name": "CVE-2023-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52909"
},
{
"name": "CVE-2023-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52910"
},
{
"name": "CVE-2024-26637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26637"
},
{
"name": "CVE-2024-26682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26682"
},
{
"name": "CVE-2024-26683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26683"
},
{
"name": "CVE-2024-36970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36970"
},
{
"name": "CVE-2024-39486",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39486"
},
{
"name": "CVE-2024-41010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41010"
},
{
"name": "CVE-2024-41032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41032"
},
{
"name": "CVE-2024-41037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41037"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41084"
},
{
"name": "CVE-2024-41094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41094"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2024-42132",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42132"
},
{
"name": "CVE-2024-42133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42133"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-42141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42141"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42241"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42278"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-43816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43816"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2024-43826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43826"
},
{
"name": "CVE-2024-43840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43840"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43874"
},
{
"name": "CVE-2024-7264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7264"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-42243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42243"
},
{
"name": "CVE-2024-34459",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34459"
},
{
"name": "CVE-2024-8096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8096"
},
{
"name": "CVE-2024-44983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44983"
},
{
"name": "CVE-2024-44986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44986"
},
{
"name": "CVE-2024-45000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45000"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2024-45019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45019"
},
{
"name": "CVE-2024-45022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45022"
},
{
"name": "CVE-2024-45029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45029"
},
{
"name": "CVE-2024-46711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46711"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2022-48944",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48944"
},
{
"name": "CVE-2024-42294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42294"
},
{
"name": "CVE-2024-43870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43870"
},
{
"name": "CVE-2024-44967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44967"
},
{
"name": "CVE-2024-44984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44984"
},
{
"name": "CVE-2024-45001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45001"
},
{
"name": "CVE-2024-45005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45005"
},
{
"name": "CVE-2024-45012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45012"
},
{
"name": "CVE-2024-45013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45013"
},
{
"name": "CVE-2024-45017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45017"
},
{
"name": "CVE-2024-45020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45020"
},
{
"name": "CVE-2024-46672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46672"
},
{
"name": "CVE-2024-46692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46692"
},
{
"name": "CVE-2024-46706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46706"
},
{
"name": "CVE-2024-46709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46709"
},
{
"name": "CVE-2024-46710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46710"
},
{
"name": "CVE-2024-46767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46767"
},
{
"name": "CVE-2024-46786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46786"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-37370",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37370"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2024-41085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41085"
},
{
"name": "CVE-2024-26721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26721"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
},
{
"name": "CVE-2025-54121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54121"
},
{
"name": "CVE-2012-2114",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-2114"
},
{
"name": "CVE-2021-46937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46937"
},
{
"name": "CVE-2021-46999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46999"
},
{
"name": "CVE-2021-47033",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47033"
},
{
"name": "CVE-2021-47079",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47079"
},
{
"name": "CVE-2021-47092",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47092"
},
{
"name": "CVE-2021-47226",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47226"
},
{
"name": "CVE-2021-47251",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47251"
},
{
"name": "CVE-2021-47266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47266"
},
{
"name": "CVE-2021-47318",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47318"
},
{
"name": "CVE-2021-47325",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47325"
},
{
"name": "CVE-2021-47346",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47346"
},
{
"name": "CVE-2021-47349",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47349"
},
{
"name": "CVE-2021-47519",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47519"
},
{
"name": "CVE-2021-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47561"
},
{
"name": "CVE-2021-47613",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47613"
},
{
"name": "CVE-2022-1247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1247"
},
{
"name": "CVE-2022-20153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20153"
},
{
"name": "CVE-2022-48641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48641"
},
{
"name": "CVE-2022-48643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48643"
},
{
"name": "CVE-2022-48707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48707"
},
{
"name": "CVE-2022-48719",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48719"
},
{
"name": "CVE-2022-48781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48781"
},
{
"name": "CVE-2022-48819",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48819"
},
{
"name": "CVE-2022-48832",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48832"
},
{
"name": "CVE-2022-48848",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48848"
},
{
"name": "CVE-2022-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48876"
},
{
"name": "CVE-2022-48963",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48963"
},
{
"name": "CVE-2022-48974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48974"
},
{
"name": "CVE-2022-48976",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48976"
},
{
"name": "CVE-2022-48984",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48984"
},
{
"name": "CVE-2022-48986",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48986"
},
{
"name": "CVE-2022-49013",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49013"
},
{
"name": "CVE-2022-49018",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49018"
},
{
"name": "CVE-2022-49048",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49048"
},
{
"name": "CVE-2022-49049",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49049"
},
{
"name": "CVE-2022-49052",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49052"
},
{
"name": "CVE-2022-49072",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49072"
},
{
"name": "CVE-2022-49077",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49077"
},
{
"name": "CVE-2022-49094",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49094"
},
{
"name": "CVE-2022-49152",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49152"
},
{
"name": "CVE-2022-49198",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49198"
},
{
"name": "CVE-2022-49229",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49229"
},
{
"name": "CVE-2022-49231",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49231"
},
{
"name": "CVE-2022-49334",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49334"
},
{
"name": "CVE-2022-49340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49340"
},
{
"name": "CVE-2022-49374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49374"
},
{
"name": "CVE-2022-49401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49401"
},
{
"name": "CVE-2022-49403",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49403"
},
{
"name": "CVE-2022-49450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49450"
},
{
"name": "CVE-2022-49554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49554"
},
{
"name": "CVE-2022-49557",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49557"
},
{
"name": "CVE-2022-49567",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49567"
},
{
"name": "CVE-2022-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49571"
},
{
"name": "CVE-2022-49572",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49572"
},
{
"name": "CVE-2022-49573",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49573"
},
{
"name": "CVE-2022-49574",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49574"
},
{
"name": "CVE-2022-49575",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49575"
},
{
"name": "CVE-2022-49577",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49577"
},
{
"name": "CVE-2022-49580",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49580"
},
{
"name": "CVE-2022-49585",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49585"
},
{
"name": "CVE-2022-49586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49586"
},
{
"name": "CVE-2022-49587",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49587"
},
{
"name": "CVE-2022-49593",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49593"
},
{
"name": "CVE-2022-49594",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49594"
},
{
"name": "CVE-2022-49595",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49595"
},
{
"name": "CVE-2022-49596",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49596"
},
{
"name": "CVE-2022-49597",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49597"
},
{
"name": "CVE-2022-49598",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49598"
},
{
"name": "CVE-2022-49599",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49599"
},
{
"name": "CVE-2022-49600",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49600"
},
{
"name": "CVE-2022-49601",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49601"
},
{
"name": "CVE-2022-49602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49602"
},
{
"name": "CVE-2022-49604",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49604"
},
{
"name": "CVE-2022-49612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49612"
},
{
"name": "CVE-2022-49629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49629"
},
{
"name": "CVE-2022-49633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49633"
},
{
"name": "CVE-2022-49637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49637"
},
{
"name": "CVE-2022-49639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49639"
},
{
"name": "CVE-2022-49659",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49659"
},
{
"name": "CVE-2022-49662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49662"
},
{
"name": "CVE-2022-49691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49691"
},
{
"name": "CVE-2022-49744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49744"
},
{
"name": "CVE-2022-49747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49747"
},
{
"name": "CVE-2022-49752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49752"
},
{
"name": "CVE-2022-49754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49754"
},
{
"name": "CVE-2022-49760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49760"
},
{
"name": "CVE-2023-31082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31082"
},
{
"name": "CVE-2023-52516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52516"
},
{
"name": "CVE-2023-52568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52568"
},
{
"name": "CVE-2023-52570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52570"
},
{
"name": "CVE-2023-52689",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52689"
},
{
"name": "CVE-2023-52704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52704"
},
{
"name": "CVE-2023-52706",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52706"
},
{
"name": "CVE-2023-52828",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52828"
},
{
"name": "CVE-2023-52902",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52902"
},
{
"name": "CVE-2023-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52932"
},
{
"name": "CVE-2023-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52934"
},
{
"name": "CVE-2023-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52940"
},
{
"name": "CVE-2023-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52942"
},
{
"name": "CVE-2023-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52977"
},
{
"name": "CVE-2023-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52985"
},
{
"name": "CVE-2023-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52987"
},
{
"name": "CVE-2023-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52991"
},
{
"name": "CVE-2023-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53004"
},
{
"name": "CVE-2023-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53017"
},
{
"name": "CVE-2024-23196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23196"
},
{
"name": "CVE-2024-26678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26678"
},
{
"name": "CVE-2024-26725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26725"
},
{
"name": "CVE-2024-26746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26746"
},
{
"name": "CVE-2024-26918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26918"
},
{
"name": "CVE-2024-27023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27023"
},
{
"name": "CVE-2024-40907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40907"
},
{
"name": "CVE-2024-43896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43896"
},
{
"name": "CVE-2024-46748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46748"
},
{
"name": "CVE-2024-46862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46862"
},
{
"name": "CVE-2024-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53073"
},
{
"name": "CVE-2024-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53225"
},
{
"name": "CVE-2024-56668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56668"
},
{
"name": "CVE-2024-57852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57852"
},
{
"name": "CVE-2024-57914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57914"
},
{
"name": "CVE-2024-57985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57985"
},
{
"name": "CVE-2024-57989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57989"
},
{
"name": "CVE-2024-58064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58064"
},
{
"name": "CVE-2024-58075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58075"
},
{
"name": "CVE-2024-58084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58084"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-21807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21807"
},
{
"name": "CVE-2025-21817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21817"
},
{
"name": "CVE-2025-21827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21827"
},
{
"name": "CVE-2025-21851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21851"
},
{
"name": "CVE-2025-21874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21874"
},
{
"name": "CVE-2025-21907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21907"
},
{
"name": "CVE-2025-21921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21921"
},
{
"name": "CVE-2025-24357",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24357"
},
{
"name": "CVE-2025-25183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25183"
},
{
"name": "CVE-2025-29770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29770"
},
{
"name": "CVE-2025-30165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30165"
},
{
"name": "CVE-2025-30202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30202"
},
{
"name": "CVE-2025-32381",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32381"
},
{
"name": "CVE-2025-32444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32444"
},
{
"name": "CVE-2025-46570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46570"
},
{
"name": "CVE-2025-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47277"
},
{
"name": "CVE-2025-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48887"
},
{
"name": "CVE-2025-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48956"
},
{
"name": "CVE-2025-57809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-57809"
},
{
"name": "CVE-2025-62372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62372"
},
{
"name": "CVE-2025-62426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62426"
},
{
"name": "CVE-2025-65106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65106"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-43869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43869"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-46824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46824"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53070"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50226"
},
{
"name": "CVE-2024-11053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11053"
},
{
"name": "CVE-2024-44994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44994"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-42317",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42317"
},
{
"name": "CVE-2024-43820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43820"
},
{
"name": "CVE-2024-43888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43888"
},
{
"name": "CVE-2024-43910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43910"
},
{
"name": "CVE-2024-44975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44975"
},
{
"name": "CVE-2024-44996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44996"
},
{
"name": "CVE-2024-45027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45027"
},
{
"name": "CVE-2024-46697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46697"
},
{
"name": "CVE-2024-46698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46698"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46793"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47734"
},
{
"name": "CVE-2024-49856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49856"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53064"
},
{
"name": "CVE-2024-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53105"
},
{
"name": "CVE-2024-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53117"
},
{
"name": "CVE-2024-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53118"
},
{
"name": "CVE-2024-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53134"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53160"
},
{
"name": "CVE-2024-53166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53166"
},
{
"name": "CVE-2024-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53169"
},
{
"name": "CVE-2024-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53202"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53207"
},
{
"name": "CVE-2024-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53208"
},
{
"name": "CVE-2024-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53213"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53222"
},
{
"name": "CVE-2024-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53229"
},
{
"name": "CVE-2024-56549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56549"
},
{
"name": "CVE-2024-56667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56667"
},
{
"name": "CVE-2024-56752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56752"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2024-49951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49951"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2024-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53170"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2024-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53185"
},
{
"name": "CVE-2024-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53230"
},
{
"name": "CVE-2024-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53231"
},
{
"name": "CVE-2024-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53232"
},
{
"name": "CVE-2024-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53236"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-56372",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56372"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2024-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53238"
},
{
"name": "CVE-2024-56617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56617"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56632"
},
{
"name": "CVE-2024-56654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56654"
},
{
"name": "CVE-2024-56663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56663"
},
{
"name": "CVE-2024-56675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56675"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56709"
},
{
"name": "CVE-2024-56729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56729"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56760"
},
{
"name": "CVE-2024-56765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56765"
},
{
"name": "CVE-2024-57793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57793"
},
{
"name": "CVE-2024-57804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57804"
},
{
"name": "CVE-2024-57932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57932"
},
{
"name": "CVE-2024-57933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57933"
},
{
"name": "CVE-2024-57936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57936"
},
{
"name": "CVE-2025-21645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21645"
},
{
"name": "CVE-2025-21649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21649"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2025-0725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0725"
},
{
"name": "CVE-2024-46820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46820"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53047"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2024-56725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56725"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2025-21663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21663"
},
{
"name": "CVE-2025-21670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21670"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2025-21647",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21647"
},
{
"name": "CVE-2025-21668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21668"
},
{
"name": "CVE-2025-21671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21671"
},
{
"name": "CVE-2025-21681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21681"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2021-47222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47222"
},
{
"name": "CVE-2021-47223",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47223"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2024-47700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47700"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2024-49885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49885"
},
{
"name": "CVE-2024-49999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49999"
},
{
"name": "CVE-2024-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50029"
},
{
"name": "CVE-2024-50107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50107"
},
{
"name": "CVE-2024-50109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50109"
},
{
"name": "CVE-2024-50114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50114"
},
{
"name": "CVE-2024-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50120"
},
{
"name": "CVE-2024-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50152"
},
{
"name": "CVE-2024-50165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50165"
},
{
"name": "CVE-2024-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50197"
},
{
"name": "CVE-2024-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50207"
},
{
"name": "CVE-2024-50223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50223"
},
{
"name": "CVE-2024-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50294"
},
{
"name": "CVE-2024-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50303"
},
{
"name": "CVE-2024-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53044"
},
{
"name": "CVE-2024-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53109"
},
{
"name": "CVE-2024-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53167"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2024-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53189"
},
{
"name": "CVE-2024-56535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56535"
},
{
"name": "CVE-2024-56545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56545"
},
{
"name": "CVE-2024-56696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56696"
},
{
"name": "CVE-2024-56702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56702"
},
{
"name": "CVE-2024-56742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56742"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2024-56783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56783"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2022-49080",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49080"
},
{
"name": "CVE-2022-49089",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49089"
},
{
"name": "CVE-2024-57994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57994"
},
{
"name": "CVE-2025-21705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21705"
},
{
"name": "CVE-2025-21716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21716"
},
{
"name": "CVE-2025-21724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21724"
},
{
"name": "CVE-2025-21725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21725"
},
{
"name": "CVE-2025-21790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21790"
},
{
"name": "CVE-2025-21795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21795"
},
{
"name": "CVE-2022-49043",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49043"
},
{
"name": "CVE-2024-45336",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45336"
},
{
"name": "CVE-2024-45341",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45341"
},
{
"name": "CVE-2025-22866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22866"
},
{
"name": "CVE-2021-47648",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47648"
},
{
"name": "CVE-2021-47649",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47649"
},
{
"name": "CVE-2021-47650",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47650"
},
{
"name": "CVE-2021-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47659"
},
{
"name": "CVE-2022-49058",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49058"
},
{
"name": "CVE-2022-49061",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49061"
},
{
"name": "CVE-2022-49065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49065"
},
{
"name": "CVE-2022-49066",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49066"
},
{
"name": "CVE-2022-49074",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49074"
},
{
"name": "CVE-2022-49086",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49086"
},
{
"name": "CVE-2022-49090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49090"
},
{
"name": "CVE-2022-49092",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49092"
},
{
"name": "CVE-2022-49097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49097"
},
{
"name": "CVE-2022-49100",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49100"
},
{
"name": "CVE-2022-49103",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49103"
},
{
"name": "CVE-2022-49107",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49107"
},
{
"name": "CVE-2022-49118",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49118"
},
{
"name": "CVE-2022-49122",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49122"
},
{
"name": "CVE-2022-49130",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49130"
},
{
"name": "CVE-2022-49145",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49145"
},
{
"name": "CVE-2022-49147",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49147"
},
{
"name": "CVE-2022-49148",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49148"
},
{
"name": "CVE-2022-49153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49153"
},
{
"name": "CVE-2022-49154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49154"
},
{
"name": "CVE-2022-49155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49155"
},
{
"name": "CVE-2022-49156",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49156"
},
{
"name": "CVE-2022-49159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49159"
},
{
"name": "CVE-2022-49174",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49174"
},
{
"name": "CVE-2022-49175",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49175"
},
{
"name": "CVE-2022-49180",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49180"
},
{
"name": "CVE-2022-49187",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49187"
},
{
"name": "CVE-2022-49188",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49188"
},
{
"name": "CVE-2022-49206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49206"
},
{
"name": "CVE-2022-49208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49208"
},
{
"name": "CVE-2022-49216",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49216"
},
{
"name": "CVE-2022-49227",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49227"
},
{
"name": "CVE-2022-49257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49257"
},
{
"name": "CVE-2022-49259",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49259"
},
{
"name": "CVE-2022-49262",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49262"
},
{
"name": "CVE-2022-49263",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49263"
},
{
"name": "CVE-2022-49264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49264"
},
{
"name": "CVE-2022-49266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49266"
},
{
"name": "CVE-2022-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49268"
},
{
"name": "CVE-2022-49269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49269"
},
{
"name": "CVE-2022-49272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49272"
},
{
"name": "CVE-2022-49273",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49273"
},
{
"name": "CVE-2022-49279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49279"
},
{
"name": "CVE-2022-49286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49286"
},
{
"name": "CVE-2022-49290",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49290"
},
{
"name": "CVE-2022-49297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49297"
},
{
"name": "CVE-2022-49307",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49307"
},
{
"name": "CVE-2022-49308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49308"
},
{
"name": "CVE-2022-49321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49321"
},
{
"name": "CVE-2022-49322",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49322"
},
{
"name": "CVE-2022-49323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49323"
},
{
"name": "CVE-2022-49339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49339"
},
{
"name": "CVE-2022-49341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49341"
},
{
"name": "CVE-2022-49343",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49343"
},
{
"name": "CVE-2022-49345",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49345"
},
{
"name": "CVE-2022-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49350"
},
{
"name": "CVE-2022-49352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49352"
},
{
"name": "CVE-2022-49356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49356"
},
{
"name": "CVE-2022-49357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49357"
},
{
"name": "CVE-2022-49376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49376"
},
{
"name": "CVE-2022-49378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49378"
},
{
"name": "CVE-2022-49379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49379"
},
{
"name": "CVE-2022-49384",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49384"
},
{
"name": "CVE-2022-49394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49394"
},
{
"name": "CVE-2022-49400",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49400"
},
{
"name": "CVE-2022-49402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49402"
},
{
"name": "CVE-2022-49404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49404"
},
{
"name": "CVE-2022-49407",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49407"
},
{
"name": "CVE-2022-49409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49409"
},
{
"name": "CVE-2022-49422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49422"
},
{
"name": "CVE-2022-49432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49432"
},
{
"name": "CVE-2022-49433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49433"
},
{
"name": "CVE-2022-49434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49434"
},
{
"name": "CVE-2022-49441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49441"
},
{
"name": "CVE-2022-49447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49447"
},
{
"name": "CVE-2022-49455",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49455"
},
{
"name": "CVE-2022-49468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49468"
},
{
"name": "CVE-2022-49472",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49472"
},
{
"name": "CVE-2022-49475",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49475"
},
{
"name": "CVE-2022-49481",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49481"
},
{
"name": "CVE-2022-49486",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49486"
},
{
"name": "CVE-2022-49492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49492"
},
{
"name": "CVE-2022-49498",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49498"
},
{
"name": "CVE-2022-49503",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49503"
},
{
"name": "CVE-2022-49508",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49508"
},
{
"name": "CVE-2022-49515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49515"
},
{
"name": "CVE-2022-49519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49519"
},
{
"name": "CVE-2022-49520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49520"
},
{
"name": "CVE-2022-49521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49521"
},
{
"name": "CVE-2022-49523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49523"
},
{
"name": "CVE-2022-49526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49526"
},
{
"name": "CVE-2022-49532",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49532"
},
{
"name": "CVE-2022-49545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49545"
},
{
"name": "CVE-2022-49559",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49559"
},
{
"name": "CVE-2022-49581",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49581"
},
{
"name": "CVE-2022-49583",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49583"
},
{
"name": "CVE-2022-49584",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49584"
},
{
"name": "CVE-2022-49592",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49592"
},
{
"name": "CVE-2022-49603",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49603"
},
{
"name": "CVE-2022-49605",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49605"
},
{
"name": "CVE-2022-49606",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49606"
},
{
"name": "CVE-2022-49607",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49607"
},
{
"name": "CVE-2022-49611",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49611"
},
{
"name": "CVE-2022-49613",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49613"
},
{
"name": "CVE-2022-49625",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49625"
},
{
"name": "CVE-2022-49627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49627"
},
{
"name": "CVE-2022-49631",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49631"
},
{
"name": "CVE-2022-49634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49634"
},
{
"name": "CVE-2022-49640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49640"
},
{
"name": "CVE-2022-49641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49641"
},
{
"name": "CVE-2022-49642",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49642"
},
{
"name": "CVE-2022-49643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49643"
},
{
"name": "CVE-2022-49646",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49646"
},
{
"name": "CVE-2022-49648",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49648"
},
{
"name": "CVE-2022-49653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49653"
},
{
"name": "CVE-2022-49656",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49656"
},
{
"name": "CVE-2022-49657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49657"
},
{
"name": "CVE-2022-49663",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49663"
},
{
"name": "CVE-2022-49670",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49670"
},
{
"name": "CVE-2022-49671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49671"
},
{
"name": "CVE-2022-49672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49672"
},
{
"name": "CVE-2022-49673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49673"
},
{
"name": "CVE-2022-49674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49674"
},
{
"name": "CVE-2022-49675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49675"
},
{
"name": "CVE-2022-49679",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49679"
},
{
"name": "CVE-2022-49688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49688"
},
{
"name": "CVE-2022-49699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49699"
},
{
"name": "CVE-2022-49707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49707"
},
{
"name": "CVE-2022-49708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49708"
},
{
"name": "CVE-2022-49710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49710"
},
{
"name": "CVE-2022-49716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49716"
},
{
"name": "CVE-2022-49721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49721"
},
{
"name": "CVE-2022-49723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49723"
},
{
"name": "CVE-2022-49726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49726"
},
{
"name": "CVE-2022-49731",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49731"
},
{
"name": "CVE-2024-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48876"
},
{
"name": "CVE-2024-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53681"
},
{
"name": "CVE-2024-54460",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54460"
},
{
"name": "CVE-2024-55642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55642"
},
{
"name": "CVE-2024-56613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56613"
},
{
"name": "CVE-2024-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56624"
},
{
"name": "CVE-2024-56638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56638"
},
{
"name": "CVE-2024-56653",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56653"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56669"
},
{
"name": "CVE-2024-56710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56710"
},
{
"name": "CVE-2024-56714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56714"
},
{
"name": "CVE-2024-56772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56772"
},
{
"name": "CVE-2024-56773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56773"
},
{
"name": "CVE-2024-57878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57878"
},
{
"name": "CVE-2024-57879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57879"
},
{
"name": "CVE-2024-57885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57885"
},
{
"name": "CVE-2025-21644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21644"
},
{
"name": "CVE-2025-21659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21659"
},
{
"name": "CVE-2024-56171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56171"
},
{
"name": "CVE-2025-27113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27113"
},
{
"name": "CVE-2024-57993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57993"
},
{
"name": "CVE-2024-58009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58009"
},
{
"name": "CVE-2024-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58061"
},
{
"name": "CVE-2024-58068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58068"
},
{
"name": "CVE-2024-58077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58077"
},
{
"name": "CVE-2025-21706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21706"
},
{
"name": "CVE-2025-21707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21707"
},
{
"name": "CVE-2025-21829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21829"
},
{
"name": "CVE-2025-21830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21830"
},
{
"name": "CVE-2025-21832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21832"
},
{
"name": "CVE-2022-49057",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49057"
},
{
"name": "CVE-2022-49062",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49062"
},
{
"name": "CVE-2022-49064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49064"
},
{
"name": "CVE-2022-49070",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49070"
},
{
"name": "CVE-2022-49139",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49139"
},
{
"name": "CVE-2022-49204",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49204"
},
{
"name": "CVE-2022-49205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49205"
},
{
"name": "CVE-2022-49207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49207"
},
{
"name": "CVE-2022-49209",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49209"
},
{
"name": "CVE-2022-49225",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49225"
},
{
"name": "CVE-2022-49228",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49228"
},
{
"name": "CVE-2022-49237",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49237"
},
{
"name": "CVE-2022-49330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49330"
},
{
"name": "CVE-2022-49353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49353"
},
{
"name": "CVE-2022-49406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49406"
},
{
"name": "CVE-2022-49436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49436"
},
{
"name": "CVE-2022-49446",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49446"
},
{
"name": "CVE-2022-49476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49476"
},
{
"name": "CVE-2022-49511",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49511"
},
{
"name": "CVE-2022-49518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49518"
},
{
"name": "CVE-2022-49538",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49538"
},
{
"name": "CVE-2022-49548",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49548"
},
{
"name": "CVE-2022-49552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49552"
},
{
"name": "CVE-2022-49560",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49560"
},
{
"name": "CVE-2022-49565",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49565"
},
{
"name": "CVE-2022-49624",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49624"
},
{
"name": "CVE-2022-49638",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49638"
},
{
"name": "CVE-2022-49655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49655"
},
{
"name": "CVE-2022-49658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49658"
},
{
"name": "CVE-2022-49697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49697"
},
{
"name": "CVE-2022-49732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49732"
},
{
"name": "CVE-2022-49739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49739"
},
{
"name": "CVE-2022-49746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49746"
},
{
"name": "CVE-2022-49759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49759"
},
{
"name": "CVE-2023-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52933"
},
{
"name": "CVE-2023-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52941"
},
{
"name": "CVE-2023-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52976"
},
{
"name": "CVE-2023-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52984"
},
{
"name": "CVE-2023-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52992"
},
{
"name": "CVE-2023-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52993"
},
{
"name": "CVE-2023-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53006"
},
{
"name": "CVE-2023-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53007"
},
{
"name": "CVE-2023-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53015"
},
{
"name": "CVE-2023-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53016"
},
{
"name": "CVE-2023-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53019"
},
{
"name": "CVE-2023-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53026"
},
{
"name": "CVE-2023-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53029"
},
{
"name": "CVE-2023-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53030"
},
{
"name": "CVE-2023-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53033"
},
{
"name": "CVE-2024-46736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46736"
},
{
"name": "CVE-2024-46796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46796"
},
{
"name": "CVE-2024-57990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57990"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2024-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58057"
},
{
"name": "CVE-2024-58078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58078"
},
{
"name": "CVE-2024-58079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58079"
},
{
"name": "CVE-2025-21723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21723"
},
{
"name": "CVE-2025-21732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21732"
},
{
"name": "CVE-2025-21810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21810"
},
{
"name": "CVE-2025-21825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21825"
},
{
"name": "CVE-2025-21828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21828"
},
{
"name": "CVE-2025-21844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21844"
},
{
"name": "CVE-2025-21847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21847"
},
{
"name": "CVE-2025-21856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21856"
},
{
"name": "CVE-2025-21857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21857"
},
{
"name": "CVE-2025-21864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21864"
},
{
"name": "CVE-2025-21869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21869"
},
{
"name": "CVE-2025-21870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21870"
},
{
"name": "CVE-2025-21876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21876"
},
{
"name": "CVE-2025-21883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21883"
},
{
"name": "CVE-2025-21886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21886"
},
{
"name": "CVE-2025-21888",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21888"
},
{
"name": "CVE-2025-21890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21890"
},
{
"name": "CVE-2024-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8176"
},
{
"name": "CVE-2025-24928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24928"
},
{
"name": "CVE-2025-21913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21913"
},
{
"name": "CVE-2025-21916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21916"
},
{
"name": "CVE-2025-21918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21918"
},
{
"name": "CVE-2025-21924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21924"
},
{
"name": "CVE-2025-21936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21936"
},
{
"name": "CVE-2025-21938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21938"
},
{
"name": "CVE-2025-21962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21962"
},
{
"name": "CVE-2025-21963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21963"
},
{
"name": "CVE-2025-21964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21964"
},
{
"name": "CVE-2025-21978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21978"
},
{
"name": "CVE-2025-21979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21979"
},
{
"name": "CVE-2025-21986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21986"
},
{
"name": "CVE-2022-49220",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49220"
},
{
"name": "CVE-2022-49372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49372"
},
{
"name": "CVE-2022-49578",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49578"
},
{
"name": "CVE-2022-49589",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49589"
},
{
"name": "CVE-2022-49620",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49620"
},
{
"name": "CVE-2023-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52997"
},
{
"name": "CVE-2023-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53031"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-21691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21691"
},
{
"name": "CVE-2025-27516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27516"
},
{
"name": "CVE-2025-21953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21953"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2025-32414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32414"
},
{
"name": "CVE-2025-32415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32415"
},
{
"name": "CVE-2022-49171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49171"
},
{
"name": "CVE-2022-49197",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49197"
},
{
"name": "CVE-2022-49561",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49561"
},
{
"name": "CVE-2022-49590",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49590"
},
{
"name": "CVE-2023-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52928"
},
{
"name": "CVE-2023-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52937"
},
{
"name": "CVE-2023-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52938"
},
{
"name": "CVE-2023-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52981"
},
{
"name": "CVE-2023-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52982"
},
{
"name": "CVE-2023-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52986"
},
{
"name": "CVE-2023-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53009"
},
{
"name": "CVE-2023-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53032"
},
{
"name": "CVE-2024-58070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58070"
},
{
"name": "CVE-2024-58088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58088"
},
{
"name": "CVE-2025-21808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21808"
},
{
"name": "CVE-2025-21836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21836"
},
{
"name": "CVE-2025-21854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21854"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-21889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21889"
},
{
"name": "CVE-2025-21895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21895"
},
{
"name": "CVE-2025-21906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21906"
},
{
"name": "CVE-2025-21908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21908"
},
{
"name": "CVE-2025-21930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21930"
},
{
"name": "CVE-2025-21961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21961"
},
{
"name": "CVE-2025-21966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21966"
},
{
"name": "CVE-2025-4947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4947"
},
{
"name": "CVE-2025-5025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5025"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-1390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1390"
},
{
"name": "CVE-2025-29088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29088"
},
{
"name": "CVE-2025-32434",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32434"
},
{
"name": "CVE-2025-43859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-43859"
},
{
"name": "CVE-2024-58074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58074"
},
{
"name": "CVE-2025-21974",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21974"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2022-49636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49636"
},
{
"name": "CVE-2025-21939",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21939"
},
{
"name": "CVE-2024-47081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47081"
},
{
"name": "CVE-2025-3576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3576"
},
{
"name": "CVE-2024-57987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57987"
},
{
"name": "CVE-2024-57988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57988"
},
{
"name": "CVE-2024-57995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57995"
},
{
"name": "CVE-2024-58015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58015"
},
{
"name": "CVE-2024-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58062"
},
{
"name": "CVE-2025-21713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21713"
},
{
"name": "CVE-2025-21770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21770"
},
{
"name": "CVE-2025-21880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21880"
},
{
"name": "CVE-2021-3995",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3995"
},
{
"name": "CVE-2021-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3996"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2025-21809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21809"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2025-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50182"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2021-32256",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32256"
},
{
"name": "CVE-2024-25260",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25260"
},
{
"name": "CVE-2025-1371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1371"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2025-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1377"
},
{
"name": "CVE-2025-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49794"
},
{
"name": "CVE-2025-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49796"
},
{
"name": "CVE-2024-54456",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54456"
},
{
"name": "CVE-2025-21783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21783"
},
{
"name": "CVE-2025-6965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6965"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2024-26462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26462"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2025-1365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1365"
},
{
"name": "CVE-2025-1372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1372"
},
{
"name": "CVE-2025-27587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27587"
},
{
"name": "CVE-2025-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49795"
},
{
"name": "CVE-2025-6170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6170"
},
{
"name": "CVE-2025-8732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8732"
},
{
"name": "CVE-2025-9086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9086"
},
{
"name": "CVE-2025-41248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41248"
}
],
"initial_release_date": "2025-12-02T00:00:00",
"last_revision_date": "2025-12-02T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1057",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-12-02T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36560",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36560"
},
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36564",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36564"
}
]
}
EUVD-2026-311753
European Vulnerability Database identifier assigned by ENISA{
"assigner": "ENISA",
"date_reserved": "2026-10-02T07:19:08.594005+00:00",
"id": "EUVD-2026-311753"
}
FKIE_CVE-2023-52906
Vulnerability from fkie_nvd - Published: 2024-08-21 07:15 - Updated: 2026-06-17 06:43| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2b157c3c5d6b8ddca48d53c9e662032f65af8d61",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "453277feb41c2235cf2c0de9209eef962c401457",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e2c38827cdc6fdd3bb375c8607fc04d289756f9",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "8a97b544b98e44f596219ebb290fd2ba2fd5d644",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
},
{
"lessThan": "9e17f99220d111ea031b44153fdfe364b0024ff2",
"status": "affected",
"version": "2a2ea50870baa3fb4de0872c5b60828138654ca7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/sched/act_mpls.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.3"
},
{
"lessThan": "5.3",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.229",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.164",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.89",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6B9D0314-C8F6-4538-867F-2873DF2287F2",
"versionEndExcluding": "5.4.229",
"versionStartIncluding": "5.3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CA742E66-32D2-459E-AB19-171C4DB3B1F4",
"versionEndExcluding": "5.10.164",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E706841F-E788-4316-9B05-DA8EB60CE6B3",
"versionEndExcluding": "5.15.89",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9275C81F-AE96-4CDB-AD20-7DBD36E5D909",
"versionEndExcluding": "6.1.7",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc1:*:*:*:*:*:*",
"matchCriteriaId": "FF501633-2F44-4913-A8EE-B021929F49F6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc2:*:*:*:*:*:*",
"matchCriteriaId": "2BDA597B-CAC1-4DF0-86F0-42E142C654E9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc3:*:*:*:*:*:*",
"matchCriteriaId": "725C78C9-12CE-406F-ABE8-0813A01D66E8",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet/sched: act_mpls: Fix warning during failed attribute validation\n\nThe \u0027TCA_MPLS_LABEL\u0027 attribute is of \u0027NLA_U32\u0027 type, but has a\nvalidation type of \u0027NLA_VALIDATE_FUNCTION\u0027. This is an invalid\ncombination according to the comment above \u0027struct nla_policy\u0027:\n\n\"\nMeaning of `validate\u0027 field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0027s a union\n\"\n\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0027NLA_U32\u0027 type, the\nassociated \u0027min\u0027/\u0027max\u0027 fields in the policy are negative as they are\naliased by the \u0027validate\u0027 field.\n\nFix by changing the attribute type to \u0027NLA_BINARY\u0027 which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\n\nNo regressions in MPLS tests:\n\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\n\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u003cTASK\u003e\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: net/sched: act_mpls: Advertencia de correcci\u00f3n durante la validaci\u00f3n fallida del atributo El atributo \u0027TCA_MPLS_LABEL\u0027 es de tipo \u0027NLA_U32\u0027, pero tiene un tipo de validaci\u00f3n de \u0027NLA_VALIDATE_FUNCTION\u0027. Esta es una combinaci\u00f3n no v\u00e1lida seg\u00fan el comentario anterior \u0027struct nla_policy\u0027: \" Significado del campo `validar\u0027, util\u00edcelo a trav\u00e9s de NLA_POLICY_VALIDATE_FN: NLA_BINARY Funci\u00f3n de validaci\u00f3n llamada para el atributo. Todos los dem\u00e1s no utilizados, pero tenga en cuenta que es una uni\u00f3n \" Esto puede desencadenar la advertencia [1] en nla_get_range_unsigned() cuando falla la validaci\u00f3n del atributo. A pesar de ser del tipo \u0027NLA_U32\u0027, los campos \u0027min\u0027/\u0027max\u0027 asociados en la pol\u00edtica son negativos ya que tienen un alias del campo \u0027validate\u0027. Para solucionarlo, cambie el tipo de atributo a \u0027NLA_BINARY\u0027, que es coherente con el comentario anterior y con todos los dem\u00e1s usuarios de NLA_POLICY_VALIDATE_FN(). Como resultado, mueva la validaci\u00f3n de longitud a la funci\u00f3n de validaci\u00f3n. No hay regresiones en las pruebas MPLS: # ./tdc.py -f tc-tests/actions/mpls.json [...] # echo $? 0 [1] ADVERTENCIA: CPU: 0 PID: 17743 en lib/nlattr.c:118 nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 M\u00f3dulos vinculados en: CPU: 0 PID: 17743 Comm: syz-executor.0 No tainted 6.1.0-rc8 #3 Nombre del hardware: PC est\u00e1ndar QEMU (i440FX + PIIX, 1996), BIOS rel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 01/04/2014 RIP: 0010:nla_get_range_unsigned+0x1d8 /0x1e0 lib/nlattr.c:117 [...] Seguimiento de llamadas: __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310 netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411 netlink_ack_tlv_fill net /netlink/af_netlink.c:2454 [en l\u00ednea] netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506 netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546 rtnetlink_rcv+0x18/0x20 net/core/rtnetlink. c:6109 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [en l\u00ednea] netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921 sock_sendmsg_nosec net/socket.c :714 [en l\u00ednea] sock_sendmsg net/socket.c:734 [en l\u00ednea] ____sys_sendmsg+0x38f/0x500 net/socket.c:2482 ___sys_sendmsg net/socket.c:2536 [en l\u00ednea] __sys_sendmsg+0x197/0x230 net/socket.c: 2565 __do_sys_sendmsg net/socket.c:2574 [en l\u00ednea] __se_sys_sendmsg net/socket.c:2572 [en l\u00ednea] __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572 do_syscall_x64 arch/x86/entry/common.c:50 [en l\u00ednea] do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80 Entry_SYSCALL_64_after_hwframe+0x63/0xcd"
}
],
"id": "CVE-2023-52906",
"lastModified": "2026-06-17T06:43:54.353",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52906",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T16:03:11.641593Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-08-21T07:15:06.663",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-9W85-68H7-C4C7
Vulnerability from github – Published: 2024-08-21 09:31 – Updated: 2024-09-13 15:31In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_mpls: Fix warning during failed attribute validation
The 'TCA_MPLS_LABEL' attribute is of 'NLA_U32' type, but has a validation type of 'NLA_VALIDATE_FUNCTION'. This is an invalid combination according to the comment above 'struct nla_policy':
" Meaning of `validate' field, use via NLA_POLICY_VALIDATE_FN: NLA_BINARY Validation function called for the attribute. All other Unused - but note that it's a union "
This can trigger the warning [1] in nla_get_range_unsigned() when validation of the attribute fails. Despite being of 'NLA_U32' type, the associated 'min'/'max' fields in the policy are negative as they are aliased by the 'validate' field.
Fix by changing the attribute type to 'NLA_BINARY' which is consistent with the above comment and all other users of NLA_POLICY_VALIDATE_FN(). As a result, move the length validation to the validation function.
No regressions in MPLS tests:
# ./tdc.py -f tc-tests/actions/mpls.json [...] # echo $? 0
[1] WARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118 nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 Modules linked in: CPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014 RIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 [...] Call Trace: __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310 netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411 netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline] netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506 netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546 rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921 sock_sendmsg_nosec net/socket.c:714 [inline] sock_sendmsg net/socket.c:734 [inline] _syssendmsg+0x38f/0x500 net/socket.c:2482 _sys_sendmsg net/socket.c:2536 [inline] __sys_sendmsg+0x197/0x230 net/socket.c:2565 __do_sys_sendmsg net/socket.c:2574 [inline] __se_sys_sendmsg net/socket.c:2572 [inline] __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd
{
"affected": [],
"aliases": [
"CVE-2023-52906"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-08-21T07:15:06Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nnet/sched: act_mpls: Fix warning during failed attribute validation\n\nThe \u0027TCA_MPLS_LABEL\u0027 attribute is of \u0027NLA_U32\u0027 type, but has a\nvalidation type of \u0027NLA_VALIDATE_FUNCTION\u0027. This is an invalid\ncombination according to the comment above \u0027struct nla_policy\u0027:\n\n\"\nMeaning of `validate\u0027 field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0027s a union\n\"\n\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0027NLA_U32\u0027 type, the\nassociated \u0027min\u0027/\u0027max\u0027 fields in the policy are negative as they are\naliased by the \u0027validate\u0027 field.\n\nFix by changing the attribute type to \u0027NLA_BINARY\u0027 which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\n\nNo regressions in MPLS tests:\n\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\n\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u003cTASK\u003e\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd",
"id": "GHSA-9w85-68h7-c4c7",
"modified": "2024-09-13T15:31:31Z",
"published": "2024-08-21T09:31:32Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52906"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2b157c3c5d6b8ddca48d53c9e662032f65af8d61"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/453277feb41c2235cf2c0de9209eef962c401457"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8a97b544b98e44f596219ebb290fd2ba2fd5d644"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/9e17f99220d111ea031b44153fdfe364b0024ff2"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/9e2c38827cdc6fdd3bb375c8607fc04d289756f9"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-2106 (CVE-2022-48811)
Vulnerability from osv_openeuler – Published: 2024-09-06 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ibmvnic: don't release napi in __ibmvnic_open()
If __ibmvnic_open() encounters an error such as when setting link state, it calls release_resources() which frees the napi structures needlessly. Instead, have __ibmvnic_open() only clean up the work it did so far (i.e. disable napi and irqs) and leave the rest to the callers.
If caller of __ibmvnic_open() is ibmvnic_open(), it should release the resources immediately. If the caller is do_reset() or do_hard_reset(), they will release the resources on the next reset.
This fixes following crash that occurred when running the drmgr command several times to add/remove a vnic interface:
[102056] ibmvnic 30000003 env3: Disabling rx_scrq[6] irq
[102056] ibmvnic 30000003 env3: Disabling rx_scrq[7] irq
[102056] ibmvnic 30000003 env3: Replenished 8 pools
Kernel attempted to read user page (10) - exploit attempt? (uid: 0)
BUG: Kernel NULL pointer dereference on read at 0x00000010
Faulting instruction address: 0xc000000000a3c840
Oops: Kernel access of bad area, sig: 11 [#1]
LE PAGE_SIZE=64K MMU=Radix SMP NR_CPUS=2048 NUMA pSeries
...
CPU: 9 PID: 102056 Comm: kworker/9:2 Kdump: loaded Not tainted 5.16.0-rc5-autotest-g6441998e2e37 #1
Workqueue: events_long __ibmvnic_reset [ibmvnic]
NIP: c000000000a3c840 LR: c0080000029b5378 CTR: c000000000a3c820
REGS: c0000000548e37e0 TRAP: 0300 Not tainted (5.16.0-rc5-autotest-g6441998e2e37)
MSR: 8000000000009033 <SF,EE,ME,IR,DR,RI,LE> CR: 28248484 XER: 00000004
CFAR: c0080000029bdd24 DAR: 0000000000000010 DSISR: 40000000 IRQMASK: 0
GPR00: c0080000029b55d0 c0000000548e3a80 c0000000028f0200 0000000000000000
...
NIP [c000000000a3c840] napi_enable+0x20/0xc0
LR [c0080000029b5378] __ibmvnic_open+0xf0/0x430 [ibmvnic]
Call Trace:
[c0000000548e3a80] [0000000000000006] 0x6 (unreliable)
[c0000000548e3ab0] [c0080000029b55d0] __ibmvnic_open+0x348/0x430 [ibmvnic]
[c0000000548e3b40] [c0080000029bcc28] __ibmvnic_reset+0x500/0xdf0 [ibmvnic]
[c0000000548e3c60] [c000000000176228] process_one_work+0x288/0x570
[c0000000548e3d00] [c000000000176588] worker_thread+0x78/0x660
[c0000000548e3da0] [c0000000001822f0] kthread+0x1c0/0x1d0
[c0000000548e3e10] [c00000000000cf64] ret_from_kernel_thread+0x5c/0x64
Instruction dump:
7d2948f8 792307e0 4e800020 60000000 3c4c01eb 384239e0 f821ffd1 39430010
38a0fff6 e92d1100 f9210028 39200000 <e9030010> f9010020 60420000 e9210020
---[ end trace 5f8033b08fd27706 ]---(CVE-2022-48811)
In the Linux kernel, the following vulnerability has been resolved:
tty: serial: qcom-geni-serial: fix slab-out-of-bounds on RX FIFO buffer
Driver's probe allocates memory for RX FIFO (port->rx_fifo) based on default RX FIFO depth, e.g. 16. Later during serial startup the qcom_geni_serial_port_setup() updates the RX FIFO depth (port->rx_fifo_depth) to match real device capabilities, e.g. to 32.
The RX UART handle code will read "port->rx_fifo_depth" number of words into "port->rx_fifo" buffer, thus exceeding the bounds. This can be observed in certain configurations with Qualcomm Bluetooth HCI UART device and KASAN:
Bluetooth: hci0: QCA Product ID :0x00000010 Bluetooth: hci0: QCA SOC Version :0x400a0200 Bluetooth: hci0: QCA ROM Version :0x00000200 Bluetooth: hci0: QCA Patch Version:0x00000d2b Bluetooth: hci0: QCA controller version 0x02000200 Bluetooth: hci0: QCA Downloading qca/htbtfw20.tlv bluetooth hci0: Direct firmware load for qca/htbtfw20.tlv failed with error -2 Bluetooth: hci0: QCA Failed to request file: qca/htbtfw20.tlv (-2) Bluetooth: hci0: QCA Failed to download patch (-2) ================================================================== BUG: KASAN: slab-out-of-bounds in handle_rx_uart+0xa8/0x18c Write of size 4 at addr ffff279347d578c0 by task swapper/0/0
CPU: 0 PID: 0 Comm: swapper/0 Not tainted 6.1.0-rt5-00350-gb2450b7e00be-dirty #26 Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT) Call trace: dump_backtrace.part.0+0xe0/0xf0 show_stack+0x18/0x40 dump_stack_lvl+0x8c/0xb8 print_report+0x188/0x488 kasan_report+0xb4/0x100 __asan_store4+0x80/0xa4 handle_rx_uart+0xa8/0x18c qcom_geni_serial_handle_rx+0x84/0x9c qcom_geni_serial_isr+0x24c/0x760 __handle_irq_event_percpu+0x108/0x500 handle_irq_event+0x6c/0x110 handle_fasteoi_irq+0x138/0x2cc generic_handle_domain_irq+0x48/0x64
If the RX FIFO depth changes after probe, be sure to resize the buffer.(CVE-2022-48871)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mac80211: sdata can be NULL during AMPDU start
ieee80211_tx_ba_session_handle_start() may get NULL for sdata when a deauthentication is ongoing.
Here a trace triggering the race with the hostapd test multi_ap_fronthaul_on_ap:
(gdb) list *drv_ampdu_action+0x46 0x8b16 is in drv_ampdu_action (net/mac80211/driver-ops.c:396). 391 int ret = -EOPNOTSUPP; 392 393 might_sleep(); 394 395 sdata = get_bss_sdata(sdata); 396 if (!check_sdata_in_driver(sdata)) 397 return -EIO; 398 399 trace_drv_ampdu_action(local, sdata, params); 400
wlan0: moving STA 02:00:00:00:03:00 to state 3 wlan0: associated wlan0: deauthenticating from 02:00:00:00:03:00 by local choice (Reason: 3=DEAUTH_LEAVING) wlan3.sta1: Open BA session requested for 02:00:00:00:00:00 tid 0 wlan3.sta1: dropped frame to 02:00:00:00:00:00 (unauthorized port) wlan0: moving STA 02:00:00:00:03:00 to state 2 wlan0: moving STA 02:00:00:00:03:00 to state 1 wlan0: Removed STA 02:00:00:00:03:00 wlan0: Destroyed STA 02:00:00:00:03:00 BUG: unable to handle page fault for address: fffffffffffffb48 PGD 11814067 P4D 11814067 PUD 11816067 PMD 0 Oops: 0000 [#1] PREEMPT SMP PTI CPU: 2 PID: 133397 Comm: kworker/u16:1 Tainted: G W 6.1.0-rc8-wt+ #59 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.0-20220807_005459-localhost 04/01/2014 Workqueue: phy3 ieee80211_ba_session_work [mac80211] RIP: 0010:drv_ampdu_action+0x46/0x280 [mac80211] Code: 53 48 89 f3 be 89 01 00 00 e8 d6 43 bf ef e8 21 46 81 f0 83 bb a0 1b 00 00 04 75 0e 48 8b 9b 28 0d 00 00 48 81 eb 10 0e 00 00 <8b> 93 58 09 00 00 f6 c2 20 0f 84 3b 01 00 00 8b 05 dd 1c 0f 00 85 RSP: 0018:ffffc900025ebd20 EFLAGS: 00010287 RAX: 0000000000000000 RBX: fffffffffffff1f0 RCX: ffff888102228240 RDX: 0000000080000000 RSI: ffffffff918c5de0 RDI: ffff888102228b40 RBP: ffffc900025ebd40 R08: 0000000000000001 R09: 0000000000000001 R10: 0000000000000001 R11: 0000000000000000 R12: ffff888118c18ec0 R13: 0000000000000000 R14: ffffc900025ebd60 R15: ffff888018b7efb8 FS: 0000000000000000(0000) GS:ffff88817a600000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: fffffffffffffb48 CR3: 0000000105228006 CR4: 0000000000170ee0 Call Trace: <TASK> ieee80211_tx_ba_session_handle_start+0xd0/0x190 [mac80211] ieee80211_ba_session_work+0xff/0x2e0 [mac80211] process_one_work+0x29f/0x620 worker_thread+0x4d/0x3d0 ? process_one_work+0x620/0x620 kthread+0xfb/0x120 ? kthread_complete_and_exit+0x20/0x20 ret_from_fork+0x22/0x30 </TASK>(CVE-2022-48875)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: let's avoid panic if extent_tree is not created
This patch avoids the below panic.
pc : __lookup_extent_tree+0xd8/0x760 lr : f2fs_do_write_data_page+0x104/0x87c sp : ffffffc010cbb3c0 x29: ffffffc010cbb3e0 x28: 0000000000000000 x27: ffffff8803e7f020 x26: ffffff8803e7ed40 x25: ffffff8803e7f020 x24: ffffffc010cbb460 x23: ffffffc010cbb480 x22: 0000000000000000 x21: 0000000000000000 x20: ffffffff22e90900 x19: 0000000000000000 x18: ffffffc010c5d080 x17: 0000000000000000 x16: 0000000000000020 x15: ffffffdb1acdbb88 x14: ffffff888759e2b0 x13: 0000000000000000 x12: ffffff802da49000 x11: 000000000a001200 x10: ffffff8803e7ed40 x9 : ffffff8023195800 x8 : ffffff802da49078 x7 : 0000000000000001 x6 : 0000000000000000 x5 : 0000000000000006 x4 : ffffffc010cbba28 x3 : 0000000000000000 x2 : ffffffc010cbb480 x1 : 0000000000000000 x0 : ffffff8803e7ed40 Call trace: __lookup_extent_tree+0xd8/0x760 f2fs_do_write_data_page+0x104/0x87c f2fs_write_single_data_page+0x420/0xb60 f2fs_write_cache_pages+0x418/0xb1c __f2fs_write_data_pages+0x428/0x58c f2fs_write_data_pages+0x30/0x40 do_writepages+0x88/0x190 __writeback_single_inode+0x48/0x448 writeback_sb_inodes+0x468/0x9e8 __writeback_inodes_wb+0xb8/0x2a4 wb_writeback+0x33c/0x740 wb_do_writeback+0x2b4/0x400 wb_workfn+0xe4/0x34c process_one_work+0x24c/0x5bc worker_thread+0x3e8/0xa50 kthread+0x150/0x1b4(CVE-2022-48877)
In the Linux kernel, the following vulnerability has been resolved:
regulator: da9211: Use irq handler when ready
If the system does not come from reset (like when it is kexec()), the regulator might have an IRQ waiting for us.
If we enable the IRQ handler before its structures are ready, we crash.
This patch fixes:
[ 1.141839] Unable to handle kernel read from unreadable memory at virtual address 0000000000000078 [ 1.316096] Call trace: [ 1.316101] blocking_notifier_call_chain+0x20/0xa8 [ 1.322757] cpu cpu0: dummy supplies not allowed for exclusive requests [ 1.327823] regulator_notifier_call_chain+0x1c/0x2c [ 1.327825] da9211_irq_handler+0x68/0xf8 [ 1.327829] irq_thread+0x11c/0x234 [ 1.327833] kthread+0x13c/0x154(CVE-2022-48891)
In the Linux kernel, the following vulnerability has been resolved:
apparmor: Fix null pointer deref when receiving skb during sock creation
The panic below is observed when receiving ICMP packets with secmark set while an ICMP raw socket is being created. SK_CTX(sk)->label is updated in apparmor_socket_post_create(), but the packet is delivered to the socket before that, causing the null pointer dereference. Drop the packet if label context is not set.
BUG: kernel NULL pointer dereference, address: 000000000000004c
#PF: supervisor read access in kernel mode
#PF: error_code(0x0000) - not-present page
PGD 0 P4D 0
Oops: 0000 [#1] PREEMPT SMP NOPTI
CPU: 0 PID: 407 Comm: a.out Not tainted 6.4.12-arch1-1 #1 3e6fa2753a2d75925c34ecb78e22e85a65d083df
Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 05/28/2020
RIP: 0010:aa_label_next_confined+0xb/0x40
Code: 00 00 48 89 ef e8 d5 25 0c 00 e9 66 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 66 0f 1f 00 0f 1f 44 00 00 89 f0 <8b> 77 4c 39 c6 7e 1f 48 63 d0 48 8d 14 d7 eb 0b 83 c0 01 48 83 c2
RSP: 0018:ffffa92940003b08 EFLAGS: 00010246
RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000000000000e
RDX: ffffa92940003be8 RSI: 0000000000000000 RDI: 0000000000000000
RBP: ffff8b57471e7800 R08: ffff8b574c642400 R09: 0000000000000002
R10: ffffffffbd820eeb R11: ffffffffbeb7ff00 R12: ffff8b574c642400
R13: 0000000000000001 R14: 0000000000000001 R15: 0000000000000000
FS: 00007fb092ea7640(0000) GS:ffff8b577bc00000(0000) knlGS:0000000000000000
CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033
CR2: 000000000000004c CR3: 00000001020f2005 CR4: 00000000007706f0
PKRU: 55555554
Call Trace:
<IRQ>
? __die+0x23/0x70
? page_fault_oops+0x171/0x4e0
? exc_page_fault+0x7f/0x180
? asm_exc_page_fault+0x26/0x30
? aa_label_next_confined+0xb/0x40
apparmor_secmark_check+0xec/0x330
security_sock_rcv_skb+0x35/0x50
sk_filter_trim_cap+0x47/0x250
sock_queue_rcv_skb_reason+0x20/0x60
raw_rcv+0x13c/0x210
raw_local_deliver+0x1f3/0x250
ip_protocol_deliver_rcu+0x4f/0x2f0
ip_local_deliver_finish+0x76/0xa0
__netif_receive_skb_one_core+0x89/0xa0
netif_receive_skb+0x119/0x170
? __netdev_alloc_skb+0x3d/0x140
vmxnet3_rq_rx_complete+0xb23/0x1010 [vmxnet3 56a84f9c97178c57a43a24ec073b45a9d6f01f3a]
vmxnet3_poll_rx_only+0x36/0xb0 [vmxnet3 56a84f9c97178c57a43a24ec073b45a9d6f01f3a]
__napi_poll+0x28/0x1b0
net_rx_action+0x2a4/0x380
__do_softirq+0xd1/0x2c8
__irq_exit_rcu+0xbb/0xf0
common_interrupt+0x86/0xa0
</IRQ>
<TASK>
asm_common_interrupt+0x26/0x40
RIP: 0010:apparmor_socket_post_create+0xb/0x200
Code: 08 48 85 ff 75 a1 eb b1 0f 1f 80 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 0f 1f 44 00 00 41 54 <55> 48 89 fd 53 45 85 c0 0f 84 b2 00 00 00 48 8b 1d 80 56 3f 02 48
RSP: 0018:ffffa92940ce7e50 EFLAGS: 00000286
RAX: ffffffffbc756440 RBX: 0000000000000000 RCX: 0000000000000001
RDX: 0000000000000003 RSI: 0000000000000002 RDI: ffff8b574eaab740
RBP: 0000000000000001 R08: 0000000000000000 R09: 0000000000000000
R10: ffff8b57444cec70 R11: 0000000000000000 R12: 0000000000000003
R13: 0000000000000002 R14: ffff8b574eaab740 R15: ffffffffbd8e4748
? __pfx_apparmor_socket_post_create+0x10/0x10
security_socket_post_create+0x4b/0x80
__sock_create+0x176/0x1f0
__sys_socket+0x89/0x100
__x64_sys_socket+0x17/0x20
do_syscall_64+0x5d/0x90
? do_syscall_64+0x6c/0x90
? do_syscall_64+0x6c/0x90
? do_syscall_64+0x6c/0x90
entry_SYSCALL_64_after_hwframe+0x72/0xdc(CVE-2023-52889)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix race between quota rescan and disable leading to NULL pointer deref
If we have one task trying to start the quota rescan worker while another one is trying to disable quotas, we can end up hitting a race that results in the quota rescan worker doing a NULL pointer dereference. The steps for this are the following:
1) Quotas are enabled;
2) Task A calls the quota rescan ioctl and enters btrfs_qgroup_rescan(). It calls qgroup_rescan_init() which returns 0 (success) and then joins a transaction and commits it;
3) Task B calls the quota disable ioctl and enters btrfs_quota_disable(). It clears the bit BTRFS_FS_QUOTA_ENABLED from fs_info->flags and calls btrfs_qgroup_wait_for_completion(), which returns immediately since the rescan worker is not yet running. Then it starts a transaction and locks fs_info->qgroup_ioctl_lock;
4) Task A queues the rescan worker, by calling btrfs_queue_work();
5) The rescan worker starts, and calls rescan_should_stop() at the start of its while loop, which results in 0 iterations of the loop, since the flag BTRFS_FS_QUOTA_ENABLED was cleared from fs_info->flags by task B at step 3);
6) Task B sets fs_info->quota_root to NULL;
7) The rescan worker tries to start a transaction and uses fs_info->quota_root as the root argument for btrfs_start_transaction(). This results in a NULL pointer dereference down the call chain of btrfs_start_transaction(). The stack trace is something like the one reported in Link tag below:
general protection fault, probably for non-canonical address 0xdffffc0000000041: 0000 [#1] PREEMPT SMP KASAN KASAN: null-ptr-deref in range [0x0000000000000208-0x000000000000020f] CPU: 1 PID: 34 Comm: kworker/u4:2 Not tainted 6.1.0-syzkaller-13872-gb6bb9676f216 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 10/26/2022 Workqueue: btrfs-qgroup-rescan btrfs_work_helper RIP: 0010:start_transaction+0x48/0x10f0 fs/btrfs/transaction.c:564 Code: 48 89 fb 48 (...) RSP: 0018:ffffc90000ab7ab0 EFLAGS: 00010206 RAX: 0000000000000041 RBX: 0000000000000208 RCX: ffff88801779ba80 RDX: 0000000000000000 RSI: 0000000000000001 RDI: 0000000000000000 RBP: dffffc0000000000 R08: 0000000000000001 R09: fffff52000156f5d R10: fffff52000156f5d R11: 1ffff92000156f5c R12: 0000000000000000 R13: 0000000000000001 R14: 0000000000000001 R15: 0000000000000003 FS: 0000000000000000(0000) GS:ffff8880b9900000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f2bea75b718 CR3: 000000001d0cc000 CR4: 00000000003506e0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> btrfs_qgroup_rescan_worker+0x3bb/0x6a0 fs/btrfs/qgroup.c:3402 btrfs_work_helper+0x312/0x850 fs/btrfs/async-thread.c:280 process_one_work+0x877/0xdb0 kernel/workqueue.c:2289 worker_thread+0xb14/0x1330 kernel/workqueue.c:2436 kthread+0x266/0x300 kernel/kthread.c:376 ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308 </TASK> Modules linked in:
So fix this by having the rescan worker function not attempt to start a transaction if it didn't do any rescan work.(CVE-2023-52896)
In the Linux kernel, the following vulnerability has been resolved:
Add exception protection processing for vd in axi_chan_handle_err function
Since there is no protection for vd, a kernel panic will be triggered here in exceptional cases.
You can refer to the processing of axi_chan_block_xfer_complete function
The triggered kernel panic is as follows:
[ 67.848444] Unable to handle kernel NULL pointer dereference at virtual address 0000000000000060 [ 67.848447] Mem abort info: [ 67.848449] ESR = 0x96000004 [ 67.848451] EC = 0x25: DABT (current EL), IL = 32 bits [ 67.848454] SET = 0, FnV = 0 [ 67.848456] EA = 0, S1PTW = 0 [ 67.848458] Data abort info: [ 67.848460] ISV = 0, ISS = 0x00000004 [ 67.848462] CM = 0, WnR = 0 [ 67.848465] user pgtable: 4k pages, 48-bit VAs, pgdp=00000800c4c0b000 [ 67.848468] [0000000000000060] pgd=0000000000000000, p4d=0000000000000000 [ 67.848472] Internal error: Oops: 96000004 [#1] SMP [ 67.848475] Modules linked in: dmatest [ 67.848479] CPU: 0 PID: 0 Comm: swapper/0 Not tainted 5.10.100-emu_x2rc+ #11 [ 67.848483] pstate: 62000085 (nZCv daIf -PAN -UAO +TCO BTYPE=--) [ 67.848487] pc : axi_chan_handle_err+0xc4/0x230 [ 67.848491] lr : axi_chan_handle_err+0x30/0x230 [ 67.848493] sp : ffff0803fe55ae50 [ 67.848495] x29: ffff0803fe55ae50 x28: ffff800011212200 [ 67.848500] x27: ffff0800c42c0080 x26: ffff0800c097c080 [ 67.848504] x25: ffff800010d33880 x24: ffff80001139d850 [ 67.848508] x23: ffff0800c097c168 x22: 0000000000000000 [ 67.848512] x21: 0000000000000080 x20: 0000000000002000 [ 67.848517] x19: ffff0800c097c080 x18: 0000000000000000 [ 67.848521] x17: 0000000000000000 x16: 0000000000000000 [ 67.848525] x15: 0000000000000000 x14: 0000000000000000 [ 67.848529] x13: 0000000000000000 x12: 0000000000000040 [ 67.848533] x11: ffff0800c0400248 x10: ffff0800c040024a [ 67.848538] x9 : ffff800010576cd4 x8 : ffff0800c0400270 [ 67.848542] x7 : 0000000000000000 x6 : ffff0800c04003e0 [ 67.848546] x5 : ffff0800c0400248 x4 : ffff0800c4294480 [ 67.848550] x3 : dead000000000100 x2 : dead000000000122 [ 67.848555] x1 : 0000000000000100 x0 : ffff0800c097c168 [ 67.848559] Call trace: [ 67.848562] axi_chan_handle_err+0xc4/0x230 [ 67.848566] dw_axi_dma_interrupt+0xf4/0x590 [ 67.848569] __handle_irq_event_percpu+0x60/0x220 [ 67.848573] handle_irq_event+0x64/0x120 [ 67.848576] handle_fasteoi_irq+0xc4/0x220 [ 67.848580] __handle_domain_irq+0x80/0xe0 [ 67.848583] gic_handle_irq+0xc0/0x138 [ 67.848585] el1_irq+0xc8/0x180 [ 67.848588] arch_cpu_idle+0x14/0x2c [ 67.848591] default_idle_call+0x40/0x16c [ 67.848594] do_idle+0x1f0/0x250 [ 67.848597] cpu_startup_entry+0x2c/0x60 [ 67.848600] rest_init+0xc0/0xcc [ 67.848603] arch_call_rest_init+0x14/0x1c [ 67.848606] start_kernel+0x4cc/0x500 [ 67.848610] Code: eb0002ff 9a9f12d6 f2fbd5a2 f2fbd5a3 (a94602c1) [ 67.848613] ---[ end trace 585a97036f88203a ]---(CVE-2023-52899)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_mpls: Fix warning during failed attribute validation
The 'TCA_MPLS_LABEL' attribute is of 'NLA_U32' type, but has a validation type of 'NLA_VALIDATE_FUNCTION'. This is an invalid combination according to the comment above 'struct nla_policy':
" Meaning of `validate' field, use via NLA_POLICY_VALIDATE_FN: NLA_BINARY Validation function called for the attribute. All other Unused - but note that it's a union "
This can trigger the warning [1] in nla_get_range_unsigned() when validation of the attribute fails. Despite being of 'NLA_U32' type, the associated 'min'/'max' fields in the policy are negative as they are aliased by the 'validate' field.
Fix by changing the attribute type to 'NLA_BINARY' which is consistent with the above comment and all other users of NLA_POLICY_VALIDATE_FN(). As a result, move the length validation to the validation function.
No regressions in MPLS tests:
# ./tdc.py -f tc-tests/actions/mpls.json [...] # echo $? 0
[1] WARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118 nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 Modules linked in: CPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014 RIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117 [...] Call Trace: <TASK> __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310 netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411 netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline] netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506 netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546 rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921 sock_sendmsg_nosec net/socket.c:714 [inline] sock_sendmsg net/socket.c:734 [inline] _syssendmsg+0x38f/0x500 net/socket.c:2482 _sys_sendmsg net/socket.c:2536 [inline] __sys_sendmsg+0x197/0x230 net/socket.c:2565 __do_sys_sendmsg net/socket.c:2574 [inline] __se_sys_sendmsg net/socket.c:2572 [inline] __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd(CVE-2023-52906)
In the Linux kernel, the following vulnerability has been resolved:
scsi: mpt3sas: Avoid test/set_bit() operating in non-allocated memory
There is a potential out-of-bounds access when using test_bit() on a single word. The test_bit() and set_bit() functions operate on long values, and when testing or setting a single word, they can exceed the word boundary. KASAN detects this issue and produces a dump:
BUG: KASAN: slab-out-of-bounds in _scsih_add_device.constprop.0 (./arch/x86/include/asm/bitops.h:60 ./include/asm-generic/bitops/instrumented-atomic.h:29 drivers/scsi/mpt3sas/mpt3sas_scsih.c:7331) mpt3sas
Write of size 8 at addr ffff8881d26e3c60 by task kworker/u1536:2/2965
For full log, please look at [1].
Make the allocation at least the size of sizeof(unsigned long) so that set_bit() and test_bit() have sufficient room for read/write operations without overwriting unallocated memory.
[1] Link: https://lore.kernel.org/all/ZkNcALr3W3KGYYJG@gmail.com/(CVE-2024-40901)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: change vm->task_info handling
This patch changes the handling and lifecycle of vm->task_info object. The major changes are: - vm->task_info is a dynamically allocated ptr now, and its uasge is reference counted. - introducing two new helper funcs for task_info lifecycle management - amdgpu_vm_get_task_info: reference counts up task_info before returning this info - amdgpu_vm_put_task_info: reference counts down task_info - last put to task_info() frees task_info from the vm.
This patch also does logistical changes required for existing usage of vm->task_info.
V2: Do not block all the prints when task_info not found (Felix)
V3: Fixed review comments from Felix - Fix wrong indentation - No debug message for -ENOMEM - Add NULL check for task_info - Do not duplicate the debug messages (ti vs no ti) - Get first reference of task_info in vm_init(), put last in vm_fini()
V4: Fixed review comments from Felix - fix double reference increment in create_task_info - change amdgpu_vm_get_task_info_pasid - additional changes in amdgpu_gem.c while porting(CVE-2024-41008)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: strict bound check before memcmp in ocfs2_xattr_find_entry()
xattr in ocfs2 maybe 'non-indexed', which saved with additional space requested. It's better to check if the memory is out of bound before memcmp, although this possibility mainly comes from crafted poisonous images.(CVE-2024-41016)
In the Linux kernel, the following vulnerability has been resolved:
drm/radeon: check bo_va->bo is non-NULL before using it
The call to radeon_vm_clear_freed might clear bo_va->bo, so we have to check it before dereferencing it.(CVE-2024-41060)
In the Linux kernel, the following vulnerability has been resolved:
nvme-fabrics: use reserved tag for reg read/write command
In some scenarios, if too many commands are issued by nvme command in the same time by user tasks, this may exhaust all tags of admin_q. If a reset (nvme reset or IO timeout) occurs before these commands finish, reconnect routine may fail to update nvme regs due to insufficient tags, which will cause kernel hang forever. In order to workaround this issue, maybe we can let reg_read32()/reg_read64()/reg_write32() use reserved tags. This maybe safe for nvmf:
- For the disable ctrl path, we will not issue connect command
- For the enable ctrl / fw activate path, since connect and reg_xx() are called serially.
So the reserved tags may still be enough while reg_xx() use reserved tags.(CVE-2024-41082)
In the Linux kernel, the following vulnerability has been resolved:
i2c: pnx: Fix potential deadlock warning from del_timer_sync() call in isr
When del_timer_sync() is called in an interrupt context it throws a warning because of potential deadlock. The timer is used only to exit from wait_for_completion() after a timeout so replacing the call with wait_for_completion_timeout() allows to remove the problematic timer and its related functions altogether.(CVE-2024-42153)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/pseries: Fix scv instruction crash with kexec
kexec on pseries disables AIL (reloc_on_exc), required for scv instruction support, before other CPUs have been shut down. This means they can execute scv instructions after AIL is disabled, which causes an interrupt at an unexpected entry location that crashes the kernel.
Change the kexec sequence to disable AIL after other CPUs have been brought down.
As a refresher, the real-mode scv interrupt vector is 0x17000, and the fixed-location head code probably couldn't easily deal with implementing such high addresses so it was just decided not to support that interrupt at all.(CVE-2024-42230)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla2xxx: validate nvme_local_port correctly
The driver load failed with error message,
qla2xxx [0000:04:00.0]-ffff:0: register_localport failed: ret=ffffffef
and with a kernel crash,
BUG: unable to handle kernel NULL pointer dereference at 0000000000000070
Workqueue: events_unbound qla_register_fcport_fn [qla2xxx]
RIP: 0010:nvme_fc_register_remoteport+0x16/0x430 [nvme_fc]
RSP: 0018:ffffaaa040eb3d98 EFLAGS: 00010282
RAX: 0000000000000000 RBX: ffff9dfb46b78c00 RCX: 0000000000000000
RDX: ffff9dfb46b78da8 RSI: ffffaaa040eb3e08 RDI: 0000000000000000
RBP: ffff9dfb612a0a58 R08: ffffffffaf1d6270 R09: 3a34303a30303030
R10: 34303a303030305b R11: 2078787832616c71 R12: ffff9dfb46b78dd4
R13: ffff9dfb46b78c24 R14: ffff9dfb41525300 R15: ffff9dfb46b78da8
FS: 0000000000000000(0000) GS:ffff9dfc67c00000(0000) knlGS:0000000000000000
CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033
CR2: 0000000000000070 CR3: 000000018da10004 CR4: 00000000000206f0
Call Trace:
qla_nvme_register_remote+0xeb/0x1f0 [qla2xxx]
? qla2x00_dfs_create_rport+0x231/0x270 [qla2xxx]
qla2x00_update_fcport+0x2a1/0x3c0 [qla2xxx]
qla_register_fcport_fn+0x54/0xc0 [qla2xxx]
Exit the qla_nvme_register_remote() function when qla_nvme_register_hba() fails and correctly validate nvme_local_port.(CVE-2024-42286)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla2xxx: Fix for possible memory corruption
Init Control Block is dereferenced incorrectly. Correctly dereference ICB(CVE-2024-42288)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: handle inconsistent state in nilfs_btnode_create_block()
Syzbot reported that a buffer state inconsistency was detected in nilfs_btnode_create_block(), triggering a kernel bug.
It is not appropriate to treat this inconsistency as a bug; it can occur if the argument block address (the buffer index of the newly created block) is a virtual block number and has been reallocated due to corruption of the bitmap used to manage its allocation state.
So, modify nilfs_btnode_create_block() and its callers to treat it as a possible filesystem error, rather than triggering a kernel bug.(CVE-2024-42295)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Update log->page_{mask,bits} if log->page_size changed
If an NTFS file system is mounted to another system with different PAGE_SIZE from the original system, log->page_size will change in log_replay(), but log->page_{mask,bits} don't change correspondingly. This will cause a panic because "u32 bytes = log->page_size - page_off" will get a negative value in the later read_log_page().(CVE-2024-42299)
In the Linux kernel, the following vulnerability has been resolved:
sysctl: always initialize i_uid/i_gid
Always initialize i_uid/i_gid inside the sysfs core so set_ownership() can safely skip setting them.
Commit 5ec27ec735ba ("fs/proc/proc_sysctl.c: fix the default values of i_uid/i_gid on /proc/sys inodes.") added defaults for i_uid/i_gid when set_ownership() was not implemented. It also missed adjusting net_ctl_set_ownership() to use the same default values in case the computation of a better value failed.(CVE-2024-42312)
In the Linux kernel, the following vulnerability has been resolved:
PCI: endpoint: pci-epf-test: Make use of cached 'epc_features' in pci_epf_test_core_init()
Instead of getting the epc_features from pci_epc_get_features() API, use the cached pci_epf_test::epc_features value to avoid the NULL check. Since the NULL check is already performed in pci_epf_test_bind(), having one more check in pci_epf_test_core_init() is redundant and it is not possible to hit the NULL pointer dereference.
Also with commit a01e7214bef9 ("PCI: endpoint: Remove "core_init_notifier" flag"), 'epc_features' got dereferenced without the NULL check, leading to the following false positive Smatch warning:
drivers/pci/endpoint/functions/pci-epf-test.c:784 pci_epf_test_core_init() error: we previously assumed 'epc_features' could be null (see line 747)
Thus, remove the redundant NULL check and also use the epc_features:: {msix_capable/msi_capable} flags directly to avoid local variables.
In the Linux kernel, the following vulnerability has been resolved:
xdp: fix invalid wait context of page_pool_destroy()
If the driver uses a page pool, it creates a page pool with page_pool_create(). The reference count of page pool is 1 as default. A page pool will be destroyed only when a reference count reaches 0. page_pool_destroy() is used to destroy page pool, it decreases a reference count. When a page pool is destroyed, ->disconnect() is called, which is mem_allocator_disconnect(). This function internally acquires mutex_lock().
If the driver uses XDP, it registers a memory model with xdp_rxq_info_reg_mem_model(). The xdp_rxq_info_reg_mem_model() internally increases a page pool reference count if a memory model is a page pool. Now the reference count is 2.
To destroy a page pool, the driver should call both page_pool_destroy() and xdp_unreg_mem_model(). The xdp_unreg_mem_model() internally calls page_pool_destroy(). Only page_pool_destroy() decreases a reference count.
If a driver calls page_pool_destroy() then xdp_unreg_mem_model(), we will face an invalid wait context warning. Because xdp_unreg_mem_model() calls page_pool_destroy() with rcu_read_lock(). The page_pool_destroy() internally acquires mutex_lock().
Splat looks like:
[ BUG: Invalid wait context ] 6.10.0-rc6+ #4 Tainted: G W
ethtool/1806 is trying to lock: ffffffff90387b90 (mem_id_lock){+.+.}-{4:4}, at: mem_allocator_disconnect+0x73/0x150 other info that might help us debug this: context-{5:5} 3 locks held by ethtool/1806: stack backtrace: CPU: 0 PID: 1806 Comm: ethtool Tainted: G W 6.10.0-rc6+ #4 f916f41f172891c800f2fed Hardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021 Call Trace: <TASK> dump_stack_lvl+0x7e/0xc0 __lock_acquire+0x1681/0x4de0 ? _printk+0x64/0xe0 ? __pfx_mark_lock.part.0+0x10/0x10 ? __pfxlockacquire+0x10/0x10 lock_acquire+0x1b3/0x580 ? mem_allocator_disconnect+0x73/0x150 ? wake_up_klogd.part.0+0x16/0xc0 ? __pfx_lock_acquire+0x10/0x10 ? dump_stack_lvl+0x91/0xc0 __mutex_lock+0x15c/0x1690 ? mem_allocator_disconnect+0x73/0x150 ? __pfx_prb_read_valid+0x10/0x10 ? mem_allocator_disconnect+0x73/0x150 ? __pfx_llist_add_batch+0x10/0x10 ? console_unlock+0x193/0x1b0 ? lockdep_hardirqs_on+0xbe/0x140 ? __pfxmutexlock+0x10/0x10 ? tick_nohz_tick_stopped+0x16/0x90 ? irq_work_queue_local+0x1e5/0x330 ? irq_work_queue+0x39/0x50 ? __wake_up_klogd.part.0+0x79/0xc0 ? mem_allocator_disconnect+0x73/0x150 mem_allocator_disconnect+0x73/0x150 ? __pfx_mem_allocator_disconnect+0x10/0x10 ? mark_held_locks+0xa5/0xf0 ? rcu_is_watching+0x11/0xb0 page_pool_release+0x36e/0x6d0 page_pool_destroy+0xd7/0x440 xdp_unreg_mem_model+0x1a7/0x2a0 ? __pfx_xdp_unreg_mem_model+0x10/0x10 ? kfree+0x125/0x370 ? bnxt_free_ring.isra.0+0x2eb/0x500 ? bnxt_free_mem+0x5ac/0x2500 xdp_rxq_info_unreg+0x4a/0xd0 bnxt_free_mem+0x1356/0x2500 bnxt_close_nic+0xf0/0x3b0 ? __pfx_bnxt_close_nic+0x10/0x10 ? ethnl_parse_bit+0x2c6/0x6d0 ? __pfxnlavalidate_parse+0x10/0x10 ? pfx_ethnl_parse_bit+0x10/0x10 bnxt_set_features+0x2a8/0x3e0 __netdev_update_features+0x4dc/0x1370 ? ethnl_parse_bitset+0x4ff/0x750 ? __pfx_ethnl_parse_bitset+0x10/0x10 ? __pfxnetdevupdate_features+0x10/0x10 ? mark_held_locks+0xa5/0xf0 ? _raw_spin_unlock_irqrestore+0x42/0x70 ? pm_runtime_resume+0x7d/0x110 ethnl_set_features+0x32d/0xa20
To fix this problem, it uses rhashtable_lookup_fast() instead of rhashtable_lookup() with rcu_read_lock(). Using xa without rcu_read_lock() here is safe. xa is freed by __xdp_mem_allocator_rcu_free() and this is called by call_rcu() of mem_xa_remove(). The mem_xa_remove() is called by page_pool_destroy() if a reference count reaches 0. The xa is already protected by the reference count mechanism well in the control plane. So removing rcu_read_lock() for page_pool_destroy() is safe.(CVE-2024-43834)
In the Linux kernel, the following vulnerability has been resolved:
block: initialize integrity buffer to zero before writing it to media
Metadata added by bio_integrity_prep is using plain kmalloc, which leads to random kernel memory being written media. For PI metadata this is limited to the app tag that isn't used by kernel generated metadata, but for non-PI metadata the entire buffer leaks kernel memory.
Fix this by adding the __GFP_ZERO flag to allocations for writes.(CVE-2024-43854)
In the Linux kernel, the following vulnerability has been resolved:
usb: vhci-hcd: Do not drop references before new references are gained
At a few places the driver carries stale pointers to references that can still be used. Make sure that does not happen. This strictly speaking closes ZDI-CAN-22273, though there may be similar races in the driver.(CVE-2024-43883)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: MGMT: Add error handling to pair_device()
hci_conn_params_add() never checks for a NULL value and could lead to a NULL pointer dereference causing a crash.
Fixed by adding error handling in the function.(CVE-2024-43884)
In the Linux kernel, the following vulnerability has been resolved:
padata: Fix possible divide-by-0 panic in padata_mt_helper()
We are hit with a not easily reproducible divide-by-0 panic in padata.c at bootup time.
[ 10.017908] Oops: divide error: 0000 1 PREEMPT SMP NOPTI [ 10.017908] CPU: 26 PID: 2627 Comm: kworker/u1666:1 Not tainted 6.10.0-15.el10.x86_64 #1 [ 10.017908] Hardware name: Lenovo ThinkSystem SR950 [7X12CTO1WW]/[7X12CTO1WW], BIOS [PSE140J-2.30] 07/20/2021 [ 10.017908] Workqueue: events_unbound padata_mt_helper [ 10.017908] RIP: 0010:padata_mt_helper+0x39/0xb0 : [ 10.017963] Call Trace: [ 10.017968] <TASK> [ 10.018004] ? padata_mt_helper+0x39/0xb0 [ 10.018084] process_one_work+0x174/0x330 [ 10.018093] worker_thread+0x266/0x3a0 [ 10.018111] kthread+0xcf/0x100 [ 10.018124] ret_from_fork+0x31/0x50 [ 10.018138] ret_from_fork_asm+0x1a/0x30 [ 10.018147] </TASK>
Looking at the padata_mt_helper() function, the only way a divide-by-0 panic can happen is when ps->chunk_size is 0. The way that chunk_size is initialized in padata_do_multithreaded(), chunk_size can be 0 when the min_chunk in the passed-in padata_mt_job structure is 0.
Fix this divide-by-0 panic by making sure that chunk_size will be at least 1 no matter what the input parameters are.(CVE-2024-43889)
In the Linux kernel, the following vulnerability has been resolved:
tracing: Fix overflow in get_free_elt()
"tracing_map->next_elt" in get_free_elt() is at risk of overflowing.
Once it overflows, new elements can still be inserted into the tracing_map
even though the maximum number of elements (max_elts) has been reached.
Continuing to insert elements after the overflow could result in the
tracing_map containing "tracing_map->max_size" elements, leaving no empty
entries.
If any attempt is made to insert an element into a full tracing_map using
__tracing_map_insert(), it will cause an infinite loop with preemption
disabled, leading to a CPU hang problem.
Fix this by preventing any further increments to "tracing_map->next_elt" once it reaches "tracing_map->max_elt".(CVE-2024-43890)
In the Linux kernel, the following vulnerability has been resolved:
ext4: sanity check for NULL pointer after ext4_force_shutdown
Test case: 2 threads write short inline data to a file. In ext4_page_mkwrite the resulting inline data is converted. Handling ext4_grp_locked_error with description "block bitmap and bg descriptor inconsistent: X vs Y free clusters" calls ext4_force_shutdown. The conversion clears EXT4_STATE_MAY_INLINE_DATA but fails for ext4_destroy_inline_data_nolock and ext4_mark_iloc_dirty due to ext4_forced_shutdown. The restoration of inline data fails for the same reason not setting EXT4_STATE_MAY_INLINE_DATA. Without the flag set a regular process path in ext4_da_write_end follows trying to dereference page folio private pointer that has not been set. The fix calls early return with -EIO error shall the pointer to private be NULL.
Sample crash report:
Unable to handle kernel paging request at virtual address dfff800000000004 KASAN: null-ptr-deref in range [0x0000000000000020-0x0000000000000027] Mem abort info: ESR = 0x0000000096000005 EC = 0x25: DABT (current EL), IL = 32 bits SET = 0, FnV = 0 EA = 0, S1PTW = 0 FSC = 0x05: level 1 translation fault Data abort info: ISV = 0, ISS = 0x00000005, ISS2 = 0x00000000 CM = 0, WnR = 0, TnD = 0, TagAccess = 0 GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0 [dfff800000000004] address between user and kernel address ranges Internal error: Oops: 0000000096000005 [#1] PREEMPT SMP Modules linked in: CPU: 1 PID: 20274 Comm: syz-executor185 Not tainted 6.9.0-rc7-syzkaller-gfda5695d692c #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 pstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : __block_commit_write+0x64/0x2b0 fs/buffer.c:2167 lr : __block_commit_write+0x3c/0x2b0 fs/buffer.c:2160 sp : ffff8000a1957600 x29: ffff8000a1957610 x28: dfff800000000000 x27: ffff0000e30e34b0 x26: 0000000000000000 x25: dfff800000000000 x24: dfff800000000000 x23: fffffdffc397c9e0 x22: 0000000000000020 x21: 0000000000000020 x20: 0000000000000040 x19: fffffdffc397c9c0 x18: 1fffe000367bd196 x17: ffff80008eead000 x16: ffff80008ae89e3c x15: 00000000200000c0 x14: 1fffe0001cbe4e04 x13: 0000000000000000 x12: 0000000000000000 x11: 0000000000000001 x10: 0000000000ff0100 x9 : 0000000000000000 x8 : 0000000000000004 x7 : 0000000000000000 x6 : 0000000000000000 x5 : fffffdffc397c9c0 x4 : 0000000000000020 x3 : 0000000000000020 x2 : 0000000000000040 x1 : 0000000000000020 x0 : fffffdffc397c9c0 Call trace: __block_commit_write+0x64/0x2b0 fs/buffer.c:2167 block_write_end+0xb4/0x104 fs/buffer.c:2253 ext4_da_do_write_end fs/ext4/inode.c:2955 [inline] ext4_da_write_end+0x2c4/0xa40 fs/ext4/inode.c:3028 generic_perform_write+0x394/0x588 mm/filemap.c:3985 ext4_buffered_write_iter+0x2c0/0x4ec fs/ext4/file.c:299 ext4_file_write_iter+0x188/0x1780 call_write_iter include/linux/fs.h:2110 [inline] new_sync_write fs/read_write.c:497 [inline] vfs_write+0x968/0xc3c fs/read_write.c:590 ksys_write+0x15c/0x26c fs/read_write.c:643 __do_sys_write fs/read_write.c:655 [inline] __se_sys_write fs/read_write.c:652 [inline] __arm64_sys_write+0x7c/0x90 fs/read_write.c:652 __invoke_syscall arch/arm64/kernel/syscall.c:34 [inline] invoke_syscall+0x98/0x2b8 arch/arm64/kernel/syscall.c:48 el0_svc_common+0x130/0x23c arch/arm64/kernel/syscall.c:133 do_el0_svc+0x48/0x58 arch/arm64/kernel/syscall.c:152 el0_svc+0x54/0x168 arch/arm64/kernel/entry-common.c:712 el0t_64_sync_handler+0x84/0xfc arch/arm64/kernel/entry-common.c:730 el0t_64_sync+0x190/0x194 arch/arm64/kernel/entry.S:598 Code: 97f85911 f94002da 91008356 d343fec8 (38796908) ---[ end trace 0000000000000000 ]---
Code disassembly (best guess): 0: 97f85911 bl 0xffffffffffe16444 4: f94002da ldr x26, [x22] 8: 91008356 add x22, x26, #0x20 c: d343fec8 lsr x8, x22, #3 * 10: 38796908 ldrb w8, [x8, x25] <-- trapping instruction(CVE-2024-43898)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/pm: Fix the null pointer dereference for vega10_hwmgr
Check return value and conduct null pointer handling to avoid null pointer dereference.(CVE-2024-43905)
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: Fix the null pointer dereference to ras_manager
Check ras_manager before using it(CVE-2024-43908)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: mcast: wait for previous gc cycles when removing port
syzbot hit a use-after-free[1] which is caused because the bridge doesn't make sure that all previous garbage has been collected when removing a port. What happens is: CPU 1 CPU 2 start gc cycle remove port acquire gc lock first wait for lock call br_multicasg_gc() directly acquire lock now but free port the port can be freed while grp timers still running
Make sure all previous gc cycles have finished by using flush_work before freeing the port.
[1] BUG: KASAN: slab-use-after-free in br_multicast_port_group_expired+0x4c0/0x550 net/bridge/br_multicast.c:861 Read of size 8 at addr ffff888071d6d000 by task syz.5.1232/9699
CPU: 1 PID: 9699 Comm: syz.5.1232 Not tainted 6.10.0-rc5-syzkaller-00021-g24ca36a562d6 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 06/07/2024 Call Trace: <IRQ> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x116/0x1f0 lib/dump_stack.c:114 print_address_description mm/kasan/report.c:377 [inline] print_report+0xc3/0x620 mm/kasan/report.c:488 kasan_report+0xd9/0x110 mm/kasan/report.c:601 br_multicast_port_group_expired+0x4c0/0x550 net/bridge/br_multicast.c:861 call_timer_fn+0x1a3/0x610 kernel/time/timer.c:1792 expire_timers kernel/time/timer.c:1843 [inline] __run_timers+0x74b/0xaf0 kernel/time/timer.c:2417 __run_timer_base kernel/time/timer.c:2428 [inline] __run_timer_base kernel/time/timer.c:2421 [inline] run_timer_base+0x111/0x190 kernel/time/timer.c:2437(CVE-2024-44934)
In the Linux kernel, the following vulnerability has been resolved:
jfs: Fix shift-out-of-bounds in dbDiscardAG
When searching for the next smaller log2 block, BLKSTOL2() returned 0, causing shift exponent -1 to be negative.
This patch fixes the issue by exiting the loop directly when negative shift is found.(CVE-2024-44938)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: ctnetlink: use helper function to calculate expect ID
Delete expectation path is missing a call to the nf_expect_get_id() helper function to calculate the expectation ID, otherwise LSB of the expectation object address is leaked to userspace.(CVE-2024-44944)
In the Linux kernel, the following vulnerability has been resolved:
kcm: Serialise kcm_sendmsg() for the same socket.
syzkaller reported UAF in kcm_release(). [0]
The scenario is
-
Thread A builds a skb with MSG_MORE and sets kcm->seq_skb.
-
Thread A resumes building skb from kcm->seq_skb but is blocked by sk_stream_wait_memory()
-
Thread B calls sendmsg() concurrently, finishes building kcm->seq_skb and puts the skb to the write queue
-
Thread A faces an error and finally frees skb that is already in the write queue
-
kcm_release() does double-free the skb in the write queue
When a thread is building a MSG_MORE skb, another thread must not touch it.
Let's add a per-sk mutex and serialise kcm_sendmsg().
[0]: BUG: KASAN: slab-use-after-free in __skb_unlink include/linux/skbuff.h:2366 [inline] BUG: KASAN: slab-use-after-free in __skb_dequeue include/linux/skbuff.h:2385 [inline] BUG: KASAN: slab-use-after-free in __skb_queue_purge_reason include/linux/skbuff.h:3175 [inline] BUG: KASAN: slab-use-after-free in __skb_queue_purge include/linux/skbuff.h:3181 [inline] BUG: KASAN: slab-use-after-free in kcm_release+0x170/0x4c8 net/kcm/kcmsock.c:1691 Read of size 8 at addr ffff0000ced0fc80 by task syz-executor329/6167
CPU: 1 PID: 6167 Comm: syz-executor329 Tainted: G B 6.8.0-rc5-syzkaller-g9abbc24128bc #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024 Call trace: dump_backtrace+0x1b8/0x1e4 arch/arm64/kernel/stacktrace.c:291 show_stack+0x2c/0x3c arch/arm64/kernel/stacktrace.c:298 __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0xd0/0x124 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:377 [inline] print_report+0x178/0x518 mm/kasan/report.c:488 kasan_report+0xd8/0x138 mm/kasan/report.c:601 __asan_report_load8_noabort+0x20/0x2c mm/kasan/report_generic.c:381 __skb_unlink include/linux/skbuff.h:2366 [inline] __skb_dequeue include/linux/skbuff.h:2385 [inline] __skb_queue_purge_reason include/linux/skbuff.h:3175 [inline] __skb_queue_purge include/linux/skbuff.h:3181 [inline] kcm_release+0x170/0x4c8 net/kcm/kcmsock.c:1691 __sock_release net/socket.c:659 [inline] sock_close+0xa4/0x1e8 net/socket.c:1421 __fput+0x30c/0x738 fs/file_table.c:376 ____fput+0x20/0x30 fs/file_table.c:404 task_work_run+0x230/0x2e0 kernel/task_work.c:180 exit_task_work include/linux/task_work.h:38 [inline] do_exit+0x618/0x1f64 kernel/exit.c:871 do_group_exit+0x194/0x22c kernel/exit.c:1020 get_signal+0x1500/0x15ec kernel/signal.c:2893 do_signal+0x23c/0x3b44 arch/arm64/kernel/signal.c:1249 do_notify_resume+0x74/0x1f4 arch/arm64/kernel/entry-common.c:148 exit_to_user_mode_prepare arch/arm64/kernel/entry-common.c:169 [inline] exit_to_user_mode arch/arm64/kernel/entry-common.c:178 [inline] el0_svc+0xac/0x168 arch/arm64/kernel/entry-common.c:713 el0t_64_sync_handler+0x84/0xfc arch/arm64/kernel/entry-common.c:730 el0t_64_sync+0x190/0x194 arch/arm64/kernel/entry.S:598
Allocated by task 6166: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x40/0x78 mm/kasan/common.c:68 kasan_save_alloc_info+0x70/0x84 mm/kasan/generic.c:626 unpoison_slab_object mm/kasan/common.c:314 [inline] __kasan_slab_alloc+0x74/0x8c mm/kasan/common.c:340 kasan_slab_alloc include/linux/kasan.h:201 [inline] slab_post_alloc_hook mm/slub.c:3813 [inline] slab_alloc_node mm/slub.c:3860 [inline] kmem_cache_alloc_node+0x204/0x4c0 mm/slub.c:3903 __alloc_skb+0x19c/0x3d8 net/core/skbuff.c:641 alloc_skb include/linux/skbuff.h:1296 [inline] kcm_sendmsg+0x1d3c/0x2124 net/kcm/kcmsock.c:783 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] sock_sendmsg+0x220/0x2c0 net/socket.c:768 splice_to_socket+0x7cc/0xd58 fs/splice.c:889 do_splice_from fs/splice.c:941 [inline] direct_splice_actor+0xec/0x1d8 fs/splice.c:1164 splice_direct_to_actor+0x438/0xa0c fs/splice.c:1108 do_splice_direct_actor ---truncated---(CVE-2024-44946)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.92.0.173.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.92.0.173.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.92.0.173.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.92.0.173.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nibmvnic: don\u0026apos;t release napi in __ibmvnic_open()\r\n\r\nIf __ibmvnic_open() encounters an error such as when setting link state,\nit calls release_resources() which frees the napi structures needlessly.\nInstead, have __ibmvnic_open() only clean up the work it did so far (i.e.\ndisable napi and irqs) and leave the rest to the callers.\r\n\r\nIf caller of __ibmvnic_open() is ibmvnic_open(), it should release the\nresources immediately. If the caller is do_reset() or do_hard_reset(),\nthey will release the resources on the next reset.\r\n\r\nThis fixes following crash that occurred when running the drmgr command\nseveral times to add/remove a vnic interface:\r\n\r\n\t[102056] ibmvnic 30000003 env3: Disabling rx_scrq[6] irq\n\t[102056] ibmvnic 30000003 env3: Disabling rx_scrq[7] irq\n\t[102056] ibmvnic 30000003 env3: Replenished 8 pools\n\tKernel attempted to read user page (10) - exploit attempt? (uid: 0)\n\tBUG: Kernel NULL pointer dereference on read at 0x00000010\n\tFaulting instruction address: 0xc000000000a3c840\n\tOops: Kernel access of bad area, sig: 11 [#1]\n\tLE PAGE_SIZE=64K MMU=Radix SMP NR_CPUS=2048 NUMA pSeries\n\t...\n\tCPU: 9 PID: 102056 Comm: kworker/9:2 Kdump: loaded Not tainted 5.16.0-rc5-autotest-g6441998e2e37 #1\n\tWorkqueue: events_long __ibmvnic_reset [ibmvnic]\n\tNIP: c000000000a3c840 LR: c0080000029b5378 CTR: c000000000a3c820\n\tREGS: c0000000548e37e0 TRAP: 0300 Not tainted (5.16.0-rc5-autotest-g6441998e2e37)\n\tMSR: 8000000000009033 \u0026lt;SF,EE,ME,IR,DR,RI,LE\u0026gt; CR: 28248484 XER: 00000004\n\tCFAR: c0080000029bdd24 DAR: 0000000000000010 DSISR: 40000000 IRQMASK: 0\n\tGPR00: c0080000029b55d0 c0000000548e3a80 c0000000028f0200 0000000000000000\n\t...\n\tNIP [c000000000a3c840] napi_enable+0x20/0xc0\n\tLR [c0080000029b5378] __ibmvnic_open+0xf0/0x430 [ibmvnic]\n\tCall Trace:\n\t[c0000000548e3a80] [0000000000000006] 0x6 (unreliable)\n\t[c0000000548e3ab0] [c0080000029b55d0] __ibmvnic_open+0x348/0x430 [ibmvnic]\n\t[c0000000548e3b40] [c0080000029bcc28] __ibmvnic_reset+0x500/0xdf0 [ibmvnic]\n\t[c0000000548e3c60] [c000000000176228] process_one_work+0x288/0x570\n\t[c0000000548e3d00] [c000000000176588] worker_thread+0x78/0x660\n\t[c0000000548e3da0] [c0000000001822f0] kthread+0x1c0/0x1d0\n\t[c0000000548e3e10] [c00000000000cf64] ret_from_kernel_thread+0x5c/0x64\n\tInstruction dump:\n\t7d2948f8 792307e0 4e800020 60000000 3c4c01eb 384239e0 f821ffd1 39430010\n\t38a0fff6 e92d1100 f9210028 39200000 \u0026lt;e9030010\u0026gt; f9010020 60420000 e9210020\n\t---[ end trace 5f8033b08fd27706 ]---(CVE-2022-48811)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntty: serial: qcom-geni-serial: fix slab-out-of-bounds on RX FIFO buffer\r\n\r\nDriver\u0026apos;s probe allocates memory for RX FIFO (port-\u0026gt;rx_fifo) based on\ndefault RX FIFO depth, e.g. 16. Later during serial startup the\nqcom_geni_serial_port_setup() updates the RX FIFO depth\n(port-\u0026gt;rx_fifo_depth) to match real device capabilities, e.g. to 32.\r\n\r\nThe RX UART handle code will read \u0026quot;port-\u0026gt;rx_fifo_depth\u0026quot; number of words\ninto \u0026quot;port-\u0026gt;rx_fifo\u0026quot; buffer, thus exceeding the bounds. This can be\nobserved in certain configurations with Qualcomm Bluetooth HCI UART\ndevice and KASAN:\r\n\r\n Bluetooth: hci0: QCA Product ID :0x00000010\n Bluetooth: hci0: QCA SOC Version :0x400a0200\n Bluetooth: hci0: QCA ROM Version :0x00000200\n Bluetooth: hci0: QCA Patch Version:0x00000d2b\n Bluetooth: hci0: QCA controller version 0x02000200\n Bluetooth: hci0: QCA Downloading qca/htbtfw20.tlv\n bluetooth hci0: Direct firmware load for qca/htbtfw20.tlv failed with error -2\n Bluetooth: hci0: QCA Failed to request file: qca/htbtfw20.tlv (-2)\n Bluetooth: hci0: QCA Failed to download patch (-2)\n ==================================================================\n BUG: KASAN: slab-out-of-bounds in handle_rx_uart+0xa8/0x18c\n Write of size 4 at addr ffff279347d578c0 by task swapper/0/0\r\n\r\n CPU: 0 PID: 0 Comm: swapper/0 Not tainted 6.1.0-rt5-00350-gb2450b7e00be-dirty #26\n Hardware name: Qualcomm Technologies, Inc. Robotics RB5 (DT)\n Call trace:\n dump_backtrace.part.0+0xe0/0xf0\n show_stack+0x18/0x40\n dump_stack_lvl+0x8c/0xb8\n print_report+0x188/0x488\n kasan_report+0xb4/0x100\n __asan_store4+0x80/0xa4\n handle_rx_uart+0xa8/0x18c\n qcom_geni_serial_handle_rx+0x84/0x9c\n qcom_geni_serial_isr+0x24c/0x760\n __handle_irq_event_percpu+0x108/0x500\n handle_irq_event+0x6c/0x110\n handle_fasteoi_irq+0x138/0x2cc\n generic_handle_domain_irq+0x48/0x64\r\n\r\nIf the RX FIFO depth changes after probe, be sure to resize the buffer.(CVE-2022-48871)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: mac80211: sdata can be NULL during AMPDU start\r\n\r\nieee80211_tx_ba_session_handle_start() may get NULL for sdata when a\ndeauthentication is ongoing.\r\n\r\nHere a trace triggering the race with the hostapd test\nmulti_ap_fronthaul_on_ap:\r\n\r\n(gdb) list *drv_ampdu_action+0x46\n0x8b16 is in drv_ampdu_action (net/mac80211/driver-ops.c:396).\n391 int ret = -EOPNOTSUPP;\n392\n393 might_sleep();\n394\n395 sdata = get_bss_sdata(sdata);\n396 if (!check_sdata_in_driver(sdata))\n397 return -EIO;\n398\n399 trace_drv_ampdu_action(local, sdata, params);\n400\r\n\r\nwlan0: moving STA 02:00:00:00:03:00 to state 3\nwlan0: associated\nwlan0: deauthenticating from 02:00:00:00:03:00 by local choice (Reason: 3=DEAUTH_LEAVING)\nwlan3.sta1: Open BA session requested for 02:00:00:00:00:00 tid 0\nwlan3.sta1: dropped frame to 02:00:00:00:00:00 (unauthorized port)\nwlan0: moving STA 02:00:00:00:03:00 to state 2\nwlan0: moving STA 02:00:00:00:03:00 to state 1\nwlan0: Removed STA 02:00:00:00:03:00\nwlan0: Destroyed STA 02:00:00:00:03:00\nBUG: unable to handle page fault for address: fffffffffffffb48\nPGD 11814067 P4D 11814067 PUD 11816067 PMD 0\nOops: 0000 [#1] PREEMPT SMP PTI\nCPU: 2 PID: 133397 Comm: kworker/u16:1 Tainted: G W 6.1.0-rc8-wt+ #59\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.0-20220807_005459-localhost 04/01/2014\nWorkqueue: phy3 ieee80211_ba_session_work [mac80211]\nRIP: 0010:drv_ampdu_action+0x46/0x280 [mac80211]\nCode: 53 48 89 f3 be 89 01 00 00 e8 d6 43 bf ef e8 21 46 81 f0 83 bb a0 1b 00 00 04 75 0e 48 8b 9b 28 0d 00 00 48 81 eb 10 0e 00 00 \u0026lt;8b\u0026gt; 93 58 09 00 00 f6 c2 20 0f 84 3b 01 00 00 8b 05 dd 1c 0f 00 85\nRSP: 0018:ffffc900025ebd20 EFLAGS: 00010287\nRAX: 0000000000000000 RBX: fffffffffffff1f0 RCX: ffff888102228240\nRDX: 0000000080000000 RSI: ffffffff918c5de0 RDI: ffff888102228b40\nRBP: ffffc900025ebd40 R08: 0000000000000001 R09: 0000000000000001\nR10: 0000000000000001 R11: 0000000000000000 R12: ffff888118c18ec0\nR13: 0000000000000000 R14: ffffc900025ebd60 R15: ffff888018b7efb8\nFS: 0000000000000000(0000) GS:ffff88817a600000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: fffffffffffffb48 CR3: 0000000105228006 CR4: 0000000000170ee0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n ieee80211_tx_ba_session_handle_start+0xd0/0x190 [mac80211]\n ieee80211_ba_session_work+0xff/0x2e0 [mac80211]\n process_one_work+0x29f/0x620\n worker_thread+0x4d/0x3d0\n ? process_one_work+0x620/0x620\n kthread+0xfb/0x120\n ? kthread_complete_and_exit+0x20/0x20\n ret_from_fork+0x22/0x30\n \u0026lt;/TASK\u0026gt;(CVE-2022-48875)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: let\u0026apos;s avoid panic if extent_tree is not created\r\n\r\nThis patch avoids the below panic.\r\n\r\npc : __lookup_extent_tree+0xd8/0x760\nlr : f2fs_do_write_data_page+0x104/0x87c\nsp : ffffffc010cbb3c0\nx29: ffffffc010cbb3e0 x28: 0000000000000000\nx27: ffffff8803e7f020 x26: ffffff8803e7ed40\nx25: ffffff8803e7f020 x24: ffffffc010cbb460\nx23: ffffffc010cbb480 x22: 0000000000000000\nx21: 0000000000000000 x20: ffffffff22e90900\nx19: 0000000000000000 x18: ffffffc010c5d080\nx17: 0000000000000000 x16: 0000000000000020\nx15: ffffffdb1acdbb88 x14: ffffff888759e2b0\nx13: 0000000000000000 x12: ffffff802da49000\nx11: 000000000a001200 x10: ffffff8803e7ed40\nx9 : ffffff8023195800 x8 : ffffff802da49078\nx7 : 0000000000000001 x6 : 0000000000000000\nx5 : 0000000000000006 x4 : ffffffc010cbba28\nx3 : 0000000000000000 x2 : ffffffc010cbb480\nx1 : 0000000000000000 x0 : ffffff8803e7ed40\nCall trace:\n __lookup_extent_tree+0xd8/0x760\n f2fs_do_write_data_page+0x104/0x87c\n f2fs_write_single_data_page+0x420/0xb60\n f2fs_write_cache_pages+0x418/0xb1c\n __f2fs_write_data_pages+0x428/0x58c\n f2fs_write_data_pages+0x30/0x40\n do_writepages+0x88/0x190\n __writeback_single_inode+0x48/0x448\n writeback_sb_inodes+0x468/0x9e8\n __writeback_inodes_wb+0xb8/0x2a4\n wb_writeback+0x33c/0x740\n wb_do_writeback+0x2b4/0x400\n wb_workfn+0xe4/0x34c\n process_one_work+0x24c/0x5bc\n worker_thread+0x3e8/0xa50\n kthread+0x150/0x1b4(CVE-2022-48877)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nregulator: da9211: Use irq handler when ready\r\n\r\nIf the system does not come from reset (like when it is kexec()), the\nregulator might have an IRQ waiting for us.\r\n\r\nIf we enable the IRQ handler before its structures are ready, we crash.\r\n\r\nThis patch fixes:\r\n\r\n[ 1.141839] Unable to handle kernel read from unreadable memory at virtual address 0000000000000078\n[ 1.316096] Call trace:\n[ 1.316101] blocking_notifier_call_chain+0x20/0xa8\n[ 1.322757] cpu cpu0: dummy supplies not allowed for exclusive requests\n[ 1.327823] regulator_notifier_call_chain+0x1c/0x2c\n[ 1.327825] da9211_irq_handler+0x68/0xf8\n[ 1.327829] irq_thread+0x11c/0x234\n[ 1.327833] kthread+0x13c/0x154(CVE-2022-48891)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\napparmor: Fix null pointer deref when receiving skb during sock creation\r\n\r\nThe panic below is observed when receiving ICMP packets with secmark set\nwhile an ICMP raw socket is being created. SK_CTX(sk)-\u0026gt;label is updated\nin apparmor_socket_post_create(), but the packet is delivered to the\nsocket before that, causing the null pointer dereference.\nDrop the packet if label context is not set.\r\n\r\n BUG: kernel NULL pointer dereference, address: 000000000000004c\n #PF: supervisor read access in kernel mode\n #PF: error_code(0x0000) - not-present page\n PGD 0 P4D 0\n Oops: 0000 [#1] PREEMPT SMP NOPTI\n CPU: 0 PID: 407 Comm: a.out Not tainted 6.4.12-arch1-1 #1 3e6fa2753a2d75925c34ecb78e22e85a65d083df\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 05/28/2020\n RIP: 0010:aa_label_next_confined+0xb/0x40\n Code: 00 00 48 89 ef e8 d5 25 0c 00 e9 66 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 66 0f 1f 00 0f 1f 44 00 00 89 f0 \u0026lt;8b\u0026gt; 77 4c 39 c6 7e 1f 48 63 d0 48 8d 14 d7 eb 0b 83 c0 01 48 83 c2\n RSP: 0018:ffffa92940003b08 EFLAGS: 00010246\n RAX: 0000000000000000 RBX: 0000000000000000 RCX: 000000000000000e\n RDX: ffffa92940003be8 RSI: 0000000000000000 RDI: 0000000000000000\n RBP: ffff8b57471e7800 R08: ffff8b574c642400 R09: 0000000000000002\n R10: ffffffffbd820eeb R11: ffffffffbeb7ff00 R12: ffff8b574c642400\n R13: 0000000000000001 R14: 0000000000000001 R15: 0000000000000000\n FS: 00007fb092ea7640(0000) GS:ffff8b577bc00000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 000000000000004c CR3: 00000001020f2005 CR4: 00000000007706f0\n PKRU: 55555554\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __die+0x23/0x70\n ? page_fault_oops+0x171/0x4e0\n ? exc_page_fault+0x7f/0x180\n ? asm_exc_page_fault+0x26/0x30\n ? aa_label_next_confined+0xb/0x40\n apparmor_secmark_check+0xec/0x330\n security_sock_rcv_skb+0x35/0x50\n sk_filter_trim_cap+0x47/0x250\n sock_queue_rcv_skb_reason+0x20/0x60\n raw_rcv+0x13c/0x210\n raw_local_deliver+0x1f3/0x250\n ip_protocol_deliver_rcu+0x4f/0x2f0\n ip_local_deliver_finish+0x76/0xa0\n __netif_receive_skb_one_core+0x89/0xa0\n netif_receive_skb+0x119/0x170\n ? __netdev_alloc_skb+0x3d/0x140\n vmxnet3_rq_rx_complete+0xb23/0x1010 [vmxnet3 56a84f9c97178c57a43a24ec073b45a9d6f01f3a]\n vmxnet3_poll_rx_only+0x36/0xb0 [vmxnet3 56a84f9c97178c57a43a24ec073b45a9d6f01f3a]\n __napi_poll+0x28/0x1b0\n net_rx_action+0x2a4/0x380\n __do_softirq+0xd1/0x2c8\n __irq_exit_rcu+0xbb/0xf0\n common_interrupt+0x86/0xa0\n \u0026lt;/IRQ\u0026gt;\n \u0026lt;TASK\u0026gt;\n asm_common_interrupt+0x26/0x40\n RIP: 0010:apparmor_socket_post_create+0xb/0x200\n Code: 08 48 85 ff 75 a1 eb b1 0f 1f 80 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 0f 1f 44 00 00 41 54 \u0026lt;55\u0026gt; 48 89 fd 53 45 85 c0 0f 84 b2 00 00 00 48 8b 1d 80 56 3f 02 48\n RSP: 0018:ffffa92940ce7e50 EFLAGS: 00000286\n RAX: ffffffffbc756440 RBX: 0000000000000000 RCX: 0000000000000001\n RDX: 0000000000000003 RSI: 0000000000000002 RDI: ffff8b574eaab740\n RBP: 0000000000000001 R08: 0000000000000000 R09: 0000000000000000\n R10: ffff8b57444cec70 R11: 0000000000000000 R12: 0000000000000003\n R13: 0000000000000002 R14: ffff8b574eaab740 R15: ffffffffbd8e4748\n ? __pfx_apparmor_socket_post_create+0x10/0x10\n security_socket_post_create+0x4b/0x80\n __sock_create+0x176/0x1f0\n __sys_socket+0x89/0x100\n __x64_sys_socket+0x17/0x20\n do_syscall_64+0x5d/0x90\n ? do_syscall_64+0x6c/0x90\n ? do_syscall_64+0x6c/0x90\n ? do_syscall_64+0x6c/0x90\n entry_SYSCALL_64_after_hwframe+0x72/0xdc(CVE-2023-52889)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: fix race between quota rescan and disable leading to NULL pointer deref\r\n\r\nIf we have one task trying to start the quota rescan worker while another\none is trying to disable quotas, we can end up hitting a race that results\nin the quota rescan worker doing a NULL pointer dereference. The steps for\nthis are the following:\r\n\r\n1) Quotas are enabled;\r\n\r\n2) Task A calls the quota rescan ioctl and enters btrfs_qgroup_rescan().\n It calls qgroup_rescan_init() which returns 0 (success) and then joins a\n transaction and commits it;\r\n\r\n3) Task B calls the quota disable ioctl and enters btrfs_quota_disable().\n It clears the bit BTRFS_FS_QUOTA_ENABLED from fs_info-\u0026gt;flags and calls\n btrfs_qgroup_wait_for_completion(), which returns immediately since the\n rescan worker is not yet running.\n Then it starts a transaction and locks fs_info-\u0026gt;qgroup_ioctl_lock;\r\n\r\n4) Task A queues the rescan worker, by calling btrfs_queue_work();\r\n\r\n5) The rescan worker starts, and calls rescan_should_stop() at the start\n of its while loop, which results in 0 iterations of the loop, since\n the flag BTRFS_FS_QUOTA_ENABLED was cleared from fs_info-\u0026gt;flags by\n task B at step 3);\r\n\r\n6) Task B sets fs_info-\u0026gt;quota_root to NULL;\r\n\r\n7) The rescan worker tries to start a transaction and uses\n fs_info-\u0026gt;quota_root as the root argument for btrfs_start_transaction().\n This results in a NULL pointer dereference down the call chain of\n btrfs_start_transaction(). The stack trace is something like the one\n reported in Link tag below:\r\n\r\n general protection fault, probably for non-canonical address 0xdffffc0000000041: 0000 [#1] PREEMPT SMP KASAN\n KASAN: null-ptr-deref in range [0x0000000000000208-0x000000000000020f]\n CPU: 1 PID: 34 Comm: kworker/u4:2 Not tainted 6.1.0-syzkaller-13872-gb6bb9676f216 #0\n Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 10/26/2022\n Workqueue: btrfs-qgroup-rescan btrfs_work_helper\n RIP: 0010:start_transaction+0x48/0x10f0 fs/btrfs/transaction.c:564\n Code: 48 89 fb 48 (...)\n RSP: 0018:ffffc90000ab7ab0 EFLAGS: 00010206\n RAX: 0000000000000041 RBX: 0000000000000208 RCX: ffff88801779ba80\n RDX: 0000000000000000 RSI: 0000000000000001 RDI: 0000000000000000\n RBP: dffffc0000000000 R08: 0000000000000001 R09: fffff52000156f5d\n R10: fffff52000156f5d R11: 1ffff92000156f5c R12: 0000000000000000\n R13: 0000000000000001 R14: 0000000000000001 R15: 0000000000000003\n FS: 0000000000000000(0000) GS:ffff8880b9900000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f2bea75b718 CR3: 000000001d0cc000 CR4: 00000000003506e0\n DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n Call Trace:\n \u0026lt;TASK\u0026gt;\n btrfs_qgroup_rescan_worker+0x3bb/0x6a0 fs/btrfs/qgroup.c:3402\n btrfs_work_helper+0x312/0x850 fs/btrfs/async-thread.c:280\n process_one_work+0x877/0xdb0 kernel/workqueue.c:2289\n worker_thread+0xb14/0x1330 kernel/workqueue.c:2436\n kthread+0x266/0x300 kernel/kthread.c:376\n ret_from_fork+0x1f/0x30 arch/x86/entry/entry_64.S:308\n \u0026lt;/TASK\u0026gt;\n Modules linked in:\r\n\r\nSo fix this by having the rescan worker function not attempt to start a\ntransaction if it didn\u0026apos;t do any rescan work.(CVE-2023-52896)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nAdd exception protection processing for vd in axi_chan_handle_err function\r\n\r\nSince there is no protection for vd, a kernel panic will be\ntriggered here in exceptional cases.\r\n\r\nYou can refer to the processing of axi_chan_block_xfer_complete function\r\n\r\nThe triggered kernel panic is as follows:\r\n\r\n[ 67.848444] Unable to handle kernel NULL pointer dereference at virtual address 0000000000000060\n[ 67.848447] Mem abort info:\n[ 67.848449] ESR = 0x96000004\n[ 67.848451] EC = 0x25: DABT (current EL), IL = 32 bits\n[ 67.848454] SET = 0, FnV = 0\n[ 67.848456] EA = 0, S1PTW = 0\n[ 67.848458] Data abort info:\n[ 67.848460] ISV = 0, ISS = 0x00000004\n[ 67.848462] CM = 0, WnR = 0\n[ 67.848465] user pgtable: 4k pages, 48-bit VAs, pgdp=00000800c4c0b000\n[ 67.848468] [0000000000000060] pgd=0000000000000000, p4d=0000000000000000\n[ 67.848472] Internal error: Oops: 96000004 [#1] SMP\n[ 67.848475] Modules linked in: dmatest\n[ 67.848479] CPU: 0 PID: 0 Comm: swapper/0 Not tainted 5.10.100-emu_x2rc+ #11\n[ 67.848483] pstate: 62000085 (nZCv daIf -PAN -UAO +TCO BTYPE=--)\n[ 67.848487] pc : axi_chan_handle_err+0xc4/0x230\n[ 67.848491] lr : axi_chan_handle_err+0x30/0x230\n[ 67.848493] sp : ffff0803fe55ae50\n[ 67.848495] x29: ffff0803fe55ae50 x28: ffff800011212200\n[ 67.848500] x27: ffff0800c42c0080 x26: ffff0800c097c080\n[ 67.848504] x25: ffff800010d33880 x24: ffff80001139d850\n[ 67.848508] x23: ffff0800c097c168 x22: 0000000000000000\n[ 67.848512] x21: 0000000000000080 x20: 0000000000002000\n[ 67.848517] x19: ffff0800c097c080 x18: 0000000000000000\n[ 67.848521] x17: 0000000000000000 x16: 0000000000000000\n[ 67.848525] x15: 0000000000000000 x14: 0000000000000000\n[ 67.848529] x13: 0000000000000000 x12: 0000000000000040\n[ 67.848533] x11: ffff0800c0400248 x10: ffff0800c040024a\n[ 67.848538] x9 : ffff800010576cd4 x8 : ffff0800c0400270\n[ 67.848542] x7 : 0000000000000000 x6 : ffff0800c04003e0\n[ 67.848546] x5 : ffff0800c0400248 x4 : ffff0800c4294480\n[ 67.848550] x3 : dead000000000100 x2 : dead000000000122\n[ 67.848555] x1 : 0000000000000100 x0 : ffff0800c097c168\n[ 67.848559] Call trace:\n[ 67.848562] axi_chan_handle_err+0xc4/0x230\n[ 67.848566] dw_axi_dma_interrupt+0xf4/0x590\n[ 67.848569] __handle_irq_event_percpu+0x60/0x220\n[ 67.848573] handle_irq_event+0x64/0x120\n[ 67.848576] handle_fasteoi_irq+0xc4/0x220\n[ 67.848580] __handle_domain_irq+0x80/0xe0\n[ 67.848583] gic_handle_irq+0xc0/0x138\n[ 67.848585] el1_irq+0xc8/0x180\n[ 67.848588] arch_cpu_idle+0x14/0x2c\n[ 67.848591] default_idle_call+0x40/0x16c\n[ 67.848594] do_idle+0x1f0/0x250\n[ 67.848597] cpu_startup_entry+0x2c/0x60\n[ 67.848600] rest_init+0xc0/0xcc\n[ 67.848603] arch_call_rest_init+0x14/0x1c\n[ 67.848606] start_kernel+0x4cc/0x500\n[ 67.848610] Code: eb0002ff 9a9f12d6 f2fbd5a2 f2fbd5a3 (a94602c1)\n[ 67.848613] ---[ end trace 585a97036f88203a ]---(CVE-2023-52899)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_mpls: Fix warning during failed attribute validation\r\n\r\nThe \u0026apos;TCA_MPLS_LABEL\u0026apos; attribute is of \u0026apos;NLA_U32\u0026apos; type, but has a\nvalidation type of \u0026apos;NLA_VALIDATE_FUNCTION\u0026apos;. This is an invalid\ncombination according to the comment above \u0026apos;struct nla_policy\u0026apos;:\r\n\r\n\u0026quot;\nMeaning of `validate\u0026apos; field, use via NLA_POLICY_VALIDATE_FN:\n NLA_BINARY Validation function called for the attribute.\n All other Unused - but note that it\u0026apos;s a union\n\u0026quot;\r\n\r\nThis can trigger the warning [1] in nla_get_range_unsigned() when\nvalidation of the attribute fails. Despite being of \u0026apos;NLA_U32\u0026apos; type, the\nassociated \u0026apos;min\u0026apos;/\u0026apos;max\u0026apos; fields in the policy are negative as they are\naliased by the \u0026apos;validate\u0026apos; field.\r\n\r\nFix by changing the attribute type to \u0026apos;NLA_BINARY\u0026apos; which is consistent\nwith the above comment and all other users of NLA_POLICY_VALIDATE_FN().\nAs a result, move the length validation to the validation function.\r\n\r\nNo regressions in MPLS tests:\r\n\r\n # ./tdc.py -f tc-tests/actions/mpls.json\n [...]\n # echo $?\n 0\r\n\r\n[1]\nWARNING: CPU: 0 PID: 17743 at lib/nlattr.c:118\nnla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\nModules linked in:\nCPU: 0 PID: 17743 Comm: syz-executor.0 Not tainted 6.1.0-rc8 #3\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS\nrel-1.13.0-48-gd9c812dda519-prebuilt.qemu.org 04/01/2014\nRIP: 0010:nla_get_range_unsigned+0x1d8/0x1e0 lib/nlattr.c:117\n[...]\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __netlink_policy_dump_write_attr+0x23d/0x990 net/netlink/policy.c:310\n netlink_policy_dump_write_attr+0x22/0x30 net/netlink/policy.c:411\n netlink_ack_tlv_fill net/netlink/af_netlink.c:2454 [inline]\n netlink_ack+0x546/0x760 net/netlink/af_netlink.c:2506\n netlink_rcv_skb+0x1b7/0x240 net/netlink/af_netlink.c:2546\n rtnetlink_rcv+0x18/0x20 net/core/rtnetlink.c:6109\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x5e9/0x6b0 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x739/0x860 net/netlink/af_netlink.c:1921\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n ____sys_sendmsg+0x38f/0x500 net/socket.c:2482\n ___sys_sendmsg net/socket.c:2536 [inline]\n __sys_sendmsg+0x197/0x230 net/socket.c:2565\n __do_sys_sendmsg net/socket.c:2574 [inline]\n __se_sys_sendmsg net/socket.c:2572 [inline]\n __x64_sys_sendmsg+0x42/0x50 net/socket.c:2572\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x2b/0x70 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd(CVE-2023-52906)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: mpt3sas: Avoid test/set_bit() operating in non-allocated memory\r\n\r\nThere is a potential out-of-bounds access when using test_bit() on a single\nword. The test_bit() and set_bit() functions operate on long values, and\nwhen testing or setting a single word, they can exceed the word\nboundary. KASAN detects this issue and produces a dump:\r\n\r\n\t BUG: KASAN: slab-out-of-bounds in _scsih_add_device.constprop.0 (./arch/x86/include/asm/bitops.h:60 ./include/asm-generic/bitops/instrumented-atomic.h:29 drivers/scsi/mpt3sas/mpt3sas_scsih.c:7331) mpt3sas\r\n\r\n\t Write of size 8 at addr ffff8881d26e3c60 by task kworker/u1536:2/2965\r\n\r\nFor full log, please look at [1].\r\n\r\nMake the allocation at least the size of sizeof(unsigned long) so that\nset_bit() and test_bit() have sufficient room for read/write operations\nwithout overwriting unallocated memory.\r\n\r\n[1] Link: https://lore.kernel.org/all/ZkNcALr3W3KGYYJG@gmail.com/(CVE-2024-40901)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: change vm-\u0026gt;task_info handling\r\n\r\nThis patch changes the handling and lifecycle of vm-\u0026gt;task_info object.\nThe major changes are:\n- vm-\u0026gt;task_info is a dynamically allocated ptr now, and its uasge is\n reference counted.\n- introducing two new helper funcs for task_info lifecycle management\n - amdgpu_vm_get_task_info: reference counts up task_info before\n returning this info\n - amdgpu_vm_put_task_info: reference counts down task_info\n- last put to task_info() frees task_info from the vm.\r\n\r\nThis patch also does logistical changes required for existing usage\nof vm-\u0026gt;task_info.\r\n\r\nV2: Do not block all the prints when task_info not found (Felix)\r\n\r\nV3: Fixed review comments from Felix\n - Fix wrong indentation\n - No debug message for -ENOMEM\n - Add NULL check for task_info\n - Do not duplicate the debug messages (ti vs no ti)\n - Get first reference of task_info in vm_init(), put last\n in vm_fini()\r\n\r\nV4: Fixed review comments from Felix\n - fix double reference increment in create_task_info\n - change amdgpu_vm_get_task_info_pasid\n - additional changes in amdgpu_gem.c while porting(CVE-2024-41008)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: strict bound check before memcmp in ocfs2_xattr_find_entry()\r\n\r\nxattr in ocfs2 maybe \u0026apos;non-indexed\u0026apos;, which saved with additional space\nrequested. It\u0026apos;s better to check if the memory is out of bound before\nmemcmp, although this possibility mainly comes from crafted poisonous\nimages.(CVE-2024-41016)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/radeon: check bo_va-\u0026gt;bo is non-NULL before using it\r\n\r\nThe call to radeon_vm_clear_freed might clear bo_va-\u0026gt;bo, so\nwe have to check it before dereferencing it.(CVE-2024-41060)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnvme-fabrics: use reserved tag for reg read/write command\r\n\r\nIn some scenarios, if too many commands are issued by nvme command in\nthe same time by user tasks, this may exhaust all tags of admin_q. If\na reset (nvme reset or IO timeout) occurs before these commands finish,\nreconnect routine may fail to update nvme regs due to insufficient tags,\nwhich will cause kernel hang forever. In order to workaround this issue,\nmaybe we can let reg_read32()/reg_read64()/reg_write32() use reserved\ntags. This maybe safe for nvmf:\r\n\r\n1. For the disable ctrl path, we will not issue connect command\n2. For the enable ctrl / fw activate path, since connect and reg_xx()\n are called serially.\r\n\r\nSo the reserved tags may still be enough while reg_xx() use reserved tags.(CVE-2024-41082)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: pnx: Fix potential deadlock warning from del_timer_sync() call in isr\r\n\r\nWhen del_timer_sync() is called in an interrupt context it throws a warning\nbecause of potential deadlock. The timer is used only to exit from\nwait_for_completion() after a timeout so replacing the call with\nwait_for_completion_timeout() allows to remove the problematic timer and\nits related functions altogether.(CVE-2024-42153)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/pseries: Fix scv instruction crash with kexec\r\n\r\nkexec on pseries disables AIL (reloc_on_exc), required for scv\ninstruction support, before other CPUs have been shut down. This means\nthey can execute scv instructions after AIL is disabled, which causes an\ninterrupt at an unexpected entry location that crashes the kernel.\r\n\r\nChange the kexec sequence to disable AIL after other CPUs have been\nbrought down.\r\n\r\nAs a refresher, the real-mode scv interrupt vector is 0x17000, and the\nfixed-location head code probably couldn\u0026apos;t easily deal with implementing\nsuch high addresses so it was just decided not to support that interrupt\nat all.(CVE-2024-42230)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: qla2xxx: validate nvme_local_port correctly\r\n\r\nThe driver load failed with error message,\r\n\r\nqla2xxx [0000:04:00.0]-ffff:0: register_localport failed: ret=ffffffef\r\n\r\nand with a kernel crash,\r\n\r\n\tBUG: unable to handle kernel NULL pointer dereference at 0000000000000070\n\tWorkqueue: events_unbound qla_register_fcport_fn [qla2xxx]\n\tRIP: 0010:nvme_fc_register_remoteport+0x16/0x430 [nvme_fc]\n\tRSP: 0018:ffffaaa040eb3d98 EFLAGS: 00010282\n\tRAX: 0000000000000000 RBX: ffff9dfb46b78c00 RCX: 0000000000000000\n\tRDX: ffff9dfb46b78da8 RSI: ffffaaa040eb3e08 RDI: 0000000000000000\n\tRBP: ffff9dfb612a0a58 R08: ffffffffaf1d6270 R09: 3a34303a30303030\n\tR10: 34303a303030305b R11: 2078787832616c71 R12: ffff9dfb46b78dd4\n\tR13: ffff9dfb46b78c24 R14: ffff9dfb41525300 R15: ffff9dfb46b78da8\n\tFS: 0000000000000000(0000) GS:ffff9dfc67c00000(0000) knlGS:0000000000000000\n\tCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n\tCR2: 0000000000000070 CR3: 000000018da10004 CR4: 00000000000206f0\n\tCall Trace:\n\tqla_nvme_register_remote+0xeb/0x1f0 [qla2xxx]\n\t? qla2x00_dfs_create_rport+0x231/0x270 [qla2xxx]\n\tqla2x00_update_fcport+0x2a1/0x3c0 [qla2xxx]\n\tqla_register_fcport_fn+0x54/0xc0 [qla2xxx]\r\n\r\nExit the qla_nvme_register_remote() function when qla_nvme_register_hba()\nfails and correctly validate nvme_local_port.(CVE-2024-42286)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: qla2xxx: Fix for possible memory corruption\r\n\r\nInit Control Block is dereferenced incorrectly. Correctly dereference ICB(CVE-2024-42288)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: handle inconsistent state in nilfs_btnode_create_block()\r\n\r\nSyzbot reported that a buffer state inconsistency was detected in\nnilfs_btnode_create_block(), triggering a kernel bug.\r\n\r\nIt is not appropriate to treat this inconsistency as a bug; it can occur\nif the argument block address (the buffer index of the newly created\nblock) is a virtual block number and has been reallocated due to\ncorruption of the bitmap used to manage its allocation state.\r\n\r\nSo, modify nilfs_btnode_create_block() and its callers to treat it as a\npossible filesystem error, rather than triggering a kernel bug.(CVE-2024-42295)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/ntfs3: Update log-\u0026gt;page_{mask,bits} if log-\u0026gt;page_size changed\r\n\r\nIf an NTFS file system is mounted to another system with different\nPAGE_SIZE from the original system, log-\u0026gt;page_size will change in\nlog_replay(), but log-\u0026gt;page_{mask,bits} don\u0026apos;t change correspondingly.\nThis will cause a panic because \u0026quot;u32 bytes = log-\u0026gt;page_size - page_off\u0026quot;\nwill get a negative value in the later read_log_page().(CVE-2024-42299)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsysctl: always initialize i_uid/i_gid\r\n\r\nAlways initialize i_uid/i_gid inside the sysfs core so set_ownership()\ncan safely skip setting them.\r\n\r\nCommit 5ec27ec735ba (\u0026quot;fs/proc/proc_sysctl.c: fix the default values of\ni_uid/i_gid on /proc/sys inodes.\u0026quot;) added defaults for i_uid/i_gid when\nset_ownership() was not implemented. It also missed adjusting\nnet_ctl_set_ownership() to use the same default values in case the\ncomputation of a better value failed.(CVE-2024-42312)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nPCI: endpoint: pci-epf-test: Make use of cached \u0026apos;epc_features\u0026apos; in pci_epf_test_core_init()\r\n\r\nInstead of getting the epc_features from pci_epc_get_features() API, use\nthe cached pci_epf_test::epc_features value to avoid the NULL check. Since\nthe NULL check is already performed in pci_epf_test_bind(), having one more\ncheck in pci_epf_test_core_init() is redundant and it is not possible to\nhit the NULL pointer dereference.\r\n\r\nAlso with commit a01e7214bef9 (\u0026quot;PCI: endpoint: Remove \u0026quot;core_init_notifier\u0026quot;\nflag\u0026quot;), \u0026apos;epc_features\u0026apos; got dereferenced without the NULL check, leading to\nthe following false positive Smatch warning:\r\n\r\n drivers/pci/endpoint/functions/pci-epf-test.c:784 pci_epf_test_core_init() error: we previously assumed \u0026apos;epc_features\u0026apos; could be null (see line 747)\r\n\r\nThus, remove the redundant NULL check and also use the epc_features::\n{msix_capable/msi_capable} flags directly to avoid local variables.\r\n\r\n[kwilczynski: commit log](CVE-2024-43824)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxdp: fix invalid wait context of page_pool_destroy()\r\n\r\nIf the driver uses a page pool, it creates a page pool with\npage_pool_create().\nThe reference count of page pool is 1 as default.\nA page pool will be destroyed only when a reference count reaches 0.\npage_pool_destroy() is used to destroy page pool, it decreases a\nreference count.\nWhen a page pool is destroyed, -\u0026gt;disconnect() is called, which is\nmem_allocator_disconnect().\nThis function internally acquires mutex_lock().\r\n\r\nIf the driver uses XDP, it registers a memory model with\nxdp_rxq_info_reg_mem_model().\nThe xdp_rxq_info_reg_mem_model() internally increases a page pool\nreference count if a memory model is a page pool.\nNow the reference count is 2.\r\n\r\nTo destroy a page pool, the driver should call both page_pool_destroy()\nand xdp_unreg_mem_model().\nThe xdp_unreg_mem_model() internally calls page_pool_destroy().\nOnly page_pool_destroy() decreases a reference count.\r\n\r\nIf a driver calls page_pool_destroy() then xdp_unreg_mem_model(), we\nwill face an invalid wait context warning.\nBecause xdp_unreg_mem_model() calls page_pool_destroy() with\nrcu_read_lock().\nThe page_pool_destroy() internally acquires mutex_lock().\r\n\r\nSplat looks like:\n=============================\n[ BUG: Invalid wait context ]\n6.10.0-rc6+ #4 Tainted: G W\n-----------------------------\nethtool/1806 is trying to lock:\nffffffff90387b90 (mem_id_lock){+.+.}-{4:4}, at: mem_allocator_disconnect+0x73/0x150\nother info that might help us debug this:\ncontext-{5:5}\n3 locks held by ethtool/1806:\nstack backtrace:\nCPU: 0 PID: 1806 Comm: ethtool Tainted: G W 6.10.0-rc6+ #4 f916f41f172891c800f2fed\nHardware name: ASUS System Product Name/PRIME Z690-P D4, BIOS 0603 11/01/2021\nCall Trace:\n\u0026lt;TASK\u0026gt;\ndump_stack_lvl+0x7e/0xc0\n__lock_acquire+0x1681/0x4de0\n? _printk+0x64/0xe0\n? __pfx_mark_lock.part.0+0x10/0x10\n? __pfx___lock_acquire+0x10/0x10\nlock_acquire+0x1b3/0x580\n? mem_allocator_disconnect+0x73/0x150\n? __wake_up_klogd.part.0+0x16/0xc0\n? __pfx_lock_acquire+0x10/0x10\n? dump_stack_lvl+0x91/0xc0\n__mutex_lock+0x15c/0x1690\n? mem_allocator_disconnect+0x73/0x150\n? __pfx_prb_read_valid+0x10/0x10\n? mem_allocator_disconnect+0x73/0x150\n? __pfx_llist_add_batch+0x10/0x10\n? console_unlock+0x193/0x1b0\n? lockdep_hardirqs_on+0xbe/0x140\n? __pfx___mutex_lock+0x10/0x10\n? tick_nohz_tick_stopped+0x16/0x90\n? __irq_work_queue_local+0x1e5/0x330\n? irq_work_queue+0x39/0x50\n? __wake_up_klogd.part.0+0x79/0xc0\n? mem_allocator_disconnect+0x73/0x150\nmem_allocator_disconnect+0x73/0x150\n? __pfx_mem_allocator_disconnect+0x10/0x10\n? mark_held_locks+0xa5/0xf0\n? rcu_is_watching+0x11/0xb0\npage_pool_release+0x36e/0x6d0\npage_pool_destroy+0xd7/0x440\nxdp_unreg_mem_model+0x1a7/0x2a0\n? __pfx_xdp_unreg_mem_model+0x10/0x10\n? kfree+0x125/0x370\n? bnxt_free_ring.isra.0+0x2eb/0x500\n? bnxt_free_mem+0x5ac/0x2500\nxdp_rxq_info_unreg+0x4a/0xd0\nbnxt_free_mem+0x1356/0x2500\nbnxt_close_nic+0xf0/0x3b0\n? __pfx_bnxt_close_nic+0x10/0x10\n? ethnl_parse_bit+0x2c6/0x6d0\n? __pfx___nla_validate_parse+0x10/0x10\n? __pfx_ethnl_parse_bit+0x10/0x10\nbnxt_set_features+0x2a8/0x3e0\n__netdev_update_features+0x4dc/0x1370\n? ethnl_parse_bitset+0x4ff/0x750\n? __pfx_ethnl_parse_bitset+0x10/0x10\n? __pfx___netdev_update_features+0x10/0x10\n? mark_held_locks+0xa5/0xf0\n? _raw_spin_unlock_irqrestore+0x42/0x70\n? __pm_runtime_resume+0x7d/0x110\nethnl_set_features+0x32d/0xa20\r\n\r\nTo fix this problem, it uses rhashtable_lookup_fast() instead of\nrhashtable_lookup() with rcu_read_lock().\nUsing xa without rcu_read_lock() here is safe.\nxa is freed by __xdp_mem_allocator_rcu_free() and this is called by\ncall_rcu() of mem_xa_remove().\nThe mem_xa_remove() is called by page_pool_destroy() if a reference\ncount reaches 0.\nThe xa is already protected by the reference count mechanism well in the\ncontrol plane.\nSo removing rcu_read_lock() for page_pool_destroy() is safe.(CVE-2024-43834)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblock: initialize integrity buffer to zero before writing it to media\r\n\r\nMetadata added by bio_integrity_prep is using plain kmalloc, which leads\nto random kernel memory being written media. For PI metadata this is\nlimited to the app tag that isn\u0026apos;t used by kernel generated metadata,\nbut for non-PI metadata the entire buffer leaks kernel memory.\r\n\r\nFix this by adding the __GFP_ZERO flag to allocations for writes.(CVE-2024-43854)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: vhci-hcd: Do not drop references before new references are gained\r\n\r\nAt a few places the driver carries stale pointers\nto references that can still be used. Make sure that does not happen.\nThis strictly speaking closes ZDI-CAN-22273, though there may be\nsimilar races in the driver.(CVE-2024-43883)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: MGMT: Add error handling to pair_device()\r\n\r\nhci_conn_params_add() never checks for a NULL value and could lead to a NULL\npointer dereference causing a crash.\r\n\r\nFixed by adding error handling in the function.(CVE-2024-43884)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npadata: Fix possible divide-by-0 panic in padata_mt_helper()\r\n\r\nWe are hit with a not easily reproducible divide-by-0 panic in padata.c at\nbootup time.\r\n\r\n [ 10.017908] Oops: divide error: 0000 1 PREEMPT SMP NOPTI\n [ 10.017908] CPU: 26 PID: 2627 Comm: kworker/u1666:1 Not tainted 6.10.0-15.el10.x86_64 #1\n [ 10.017908] Hardware name: Lenovo ThinkSystem SR950 [7X12CTO1WW]/[7X12CTO1WW], BIOS [PSE140J-2.30] 07/20/2021\n [ 10.017908] Workqueue: events_unbound padata_mt_helper\n [ 10.017908] RIP: 0010:padata_mt_helper+0x39/0xb0\n :\n [ 10.017963] Call Trace:\n [ 10.017968] \u0026lt;TASK\u0026gt;\n [ 10.018004] ? padata_mt_helper+0x39/0xb0\n [ 10.018084] process_one_work+0x174/0x330\n [ 10.018093] worker_thread+0x266/0x3a0\n [ 10.018111] kthread+0xcf/0x100\n [ 10.018124] ret_from_fork+0x31/0x50\n [ 10.018138] ret_from_fork_asm+0x1a/0x30\n [ 10.018147] \u0026lt;/TASK\u0026gt;\r\n\r\nLooking at the padata_mt_helper() function, the only way a divide-by-0\npanic can happen is when ps-\u0026gt;chunk_size is 0. The way that chunk_size is\ninitialized in padata_do_multithreaded(), chunk_size can be 0 when the\nmin_chunk in the passed-in padata_mt_job structure is 0.\r\n\r\nFix this divide-by-0 panic by making sure that chunk_size will be at least\n1 no matter what the input parameters are.(CVE-2024-43889)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntracing: Fix overflow in get_free_elt()\r\n\r\n\u0026quot;tracing_map-\u0026gt;next_elt\u0026quot; in get_free_elt() is at risk of overflowing.\r\n\r\nOnce it overflows, new elements can still be inserted into the tracing_map\neven though the maximum number of elements (`max_elts`) has been reached.\nContinuing to insert elements after the overflow could result in the\ntracing_map containing \u0026quot;tracing_map-\u0026gt;max_size\u0026quot; elements, leaving no empty\nentries.\nIf any attempt is made to insert an element into a full tracing_map using\n`__tracing_map_insert()`, it will cause an infinite loop with preemption\ndisabled, leading to a CPU hang problem.\r\n\r\nFix this by preventing any further increments to \u0026quot;tracing_map-\u0026gt;next_elt\u0026quot;\nonce it reaches \u0026quot;tracing_map-\u0026gt;max_elt\u0026quot;.(CVE-2024-43890)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: sanity check for NULL pointer after ext4_force_shutdown\r\n\r\nTest case: 2 threads write short inline data to a file.\nIn ext4_page_mkwrite the resulting inline data is converted.\nHandling ext4_grp_locked_error with description \u0026quot;block bitmap\nand bg descriptor inconsistent: X vs Y free clusters\u0026quot; calls\next4_force_shutdown. The conversion clears\nEXT4_STATE_MAY_INLINE_DATA but fails for\next4_destroy_inline_data_nolock and ext4_mark_iloc_dirty due\nto ext4_forced_shutdown. The restoration of inline data fails\nfor the same reason not setting EXT4_STATE_MAY_INLINE_DATA.\nWithout the flag set a regular process path in ext4_da_write_end\nfollows trying to dereference page folio private pointer that has\nnot been set. The fix calls early return with -EIO error shall the\npointer to private be NULL.\r\n\r\nSample crash report:\r\n\r\nUnable to handle kernel paging request at virtual address dfff800000000004\nKASAN: null-ptr-deref in range [0x0000000000000020-0x0000000000000027]\nMem abort info:\n ESR = 0x0000000096000005\n EC = 0x25: DABT (current EL), IL = 32 bits\n SET = 0, FnV = 0\n EA = 0, S1PTW = 0\n FSC = 0x05: level 1 translation fault\nData abort info:\n ISV = 0, ISS = 0x00000005, ISS2 = 0x00000000\n CM = 0, WnR = 0, TnD = 0, TagAccess = 0\n GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0\n[dfff800000000004] address between user and kernel address ranges\nInternal error: Oops: 0000000096000005 [#1] PREEMPT SMP\nModules linked in:\nCPU: 1 PID: 20274 Comm: syz-executor185 Not tainted 6.9.0-rc7-syzkaller-gfda5695d692c #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\npstate: 80400005 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\npc : __block_commit_write+0x64/0x2b0 fs/buffer.c:2167\nlr : __block_commit_write+0x3c/0x2b0 fs/buffer.c:2160\nsp : ffff8000a1957600\nx29: ffff8000a1957610 x28: dfff800000000000 x27: ffff0000e30e34b0\nx26: 0000000000000000 x25: dfff800000000000 x24: dfff800000000000\nx23: fffffdffc397c9e0 x22: 0000000000000020 x21: 0000000000000020\nx20: 0000000000000040 x19: fffffdffc397c9c0 x18: 1fffe000367bd196\nx17: ffff80008eead000 x16: ffff80008ae89e3c x15: 00000000200000c0\nx14: 1fffe0001cbe4e04 x13: 0000000000000000 x12: 0000000000000000\nx11: 0000000000000001 x10: 0000000000ff0100 x9 : 0000000000000000\nx8 : 0000000000000004 x7 : 0000000000000000 x6 : 0000000000000000\nx5 : fffffdffc397c9c0 x4 : 0000000000000020 x3 : 0000000000000020\nx2 : 0000000000000040 x1 : 0000000000000020 x0 : fffffdffc397c9c0\nCall trace:\n __block_commit_write+0x64/0x2b0 fs/buffer.c:2167\n block_write_end+0xb4/0x104 fs/buffer.c:2253\n ext4_da_do_write_end fs/ext4/inode.c:2955 [inline]\n ext4_da_write_end+0x2c4/0xa40 fs/ext4/inode.c:3028\n generic_perform_write+0x394/0x588 mm/filemap.c:3985\n ext4_buffered_write_iter+0x2c0/0x4ec fs/ext4/file.c:299\n ext4_file_write_iter+0x188/0x1780\n call_write_iter include/linux/fs.h:2110 [inline]\n new_sync_write fs/read_write.c:497 [inline]\n vfs_write+0x968/0xc3c fs/read_write.c:590\n ksys_write+0x15c/0x26c fs/read_write.c:643\n __do_sys_write fs/read_write.c:655 [inline]\n __se_sys_write fs/read_write.c:652 [inline]\n __arm64_sys_write+0x7c/0x90 fs/read_write.c:652\n __invoke_syscall arch/arm64/kernel/syscall.c:34 [inline]\n invoke_syscall+0x98/0x2b8 arch/arm64/kernel/syscall.c:48\n el0_svc_common+0x130/0x23c arch/arm64/kernel/syscall.c:133\n do_el0_svc+0x48/0x58 arch/arm64/kernel/syscall.c:152\n el0_svc+0x54/0x168 arch/arm64/kernel/entry-common.c:712\n el0t_64_sync_handler+0x84/0xfc arch/arm64/kernel/entry-common.c:730\n el0t_64_sync+0x190/0x194 arch/arm64/kernel/entry.S:598\nCode: 97f85911 f94002da 91008356 d343fec8 (38796908)\n---[ end trace 0000000000000000 ]---\n----------------\nCode disassembly (best guess):\n 0:\t97f85911 \tbl\t0xffffffffffe16444\n 4:\tf94002da \tldr\tx26, [x22]\n 8:\t91008356 \tadd\tx22, x26, #0x20\n c:\td343fec8 \tlsr\tx8, x22, #3\n* 10:\t38796908 \tldrb\tw8, [x8, x25] \u0026lt;-- trapping instruction(CVE-2024-43898)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/pm: Fix the null pointer dereference for vega10_hwmgr\r\n\r\nCheck return value and conduct null pointer handling to avoid null pointer dereference.(CVE-2024-43905)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: Fix the null pointer dereference to ras_manager\r\n\r\nCheck ras_manager before using it(CVE-2024-43908)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: mcast: wait for previous gc cycles when removing port\r\n\r\nsyzbot hit a use-after-free[1] which is caused because the bridge doesn\u0026apos;t\nmake sure that all previous garbage has been collected when removing a\nport. What happens is:\n CPU 1 CPU 2\n start gc cycle remove port\n acquire gc lock first\n wait for lock\n call br_multicasg_gc() directly\n acquire lock now but free port\n the port can be freed\n while grp timers still\n running\r\n\r\nMake sure all previous gc cycles have finished by using flush_work before\nfreeing the port.\r\n\r\n[1]\n BUG: KASAN: slab-use-after-free in br_multicast_port_group_expired+0x4c0/0x550 net/bridge/br_multicast.c:861\n Read of size 8 at addr ffff888071d6d000 by task syz.5.1232/9699\r\n\r\n CPU: 1 PID: 9699 Comm: syz.5.1232 Not tainted 6.10.0-rc5-syzkaller-00021-g24ca36a562d6 #0\n Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 06/07/2024\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x116/0x1f0 lib/dump_stack.c:114\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0xc3/0x620 mm/kasan/report.c:488\n kasan_report+0xd9/0x110 mm/kasan/report.c:601\n br_multicast_port_group_expired+0x4c0/0x550 net/bridge/br_multicast.c:861\n call_timer_fn+0x1a3/0x610 kernel/time/timer.c:1792\n expire_timers kernel/time/timer.c:1843 [inline]\n __run_timers+0x74b/0xaf0 kernel/time/timer.c:2417\n __run_timer_base kernel/time/timer.c:2428 [inline]\n __run_timer_base kernel/time/timer.c:2421 [inline]\n run_timer_base+0x111/0x190 kernel/time/timer.c:2437(CVE-2024-44934)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\njfs: Fix shift-out-of-bounds in dbDiscardAG\r\n\r\nWhen searching for the next smaller log2 block, BLKSTOL2() returned 0,\ncausing shift exponent -1 to be negative.\r\n\r\nThis patch fixes the issue by exiting the loop directly when negative\nshift is found.(CVE-2024-44938)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: ctnetlink: use helper function to calculate expect ID\r\n\r\nDelete expectation path is missing a call to the nf_expect_get_id()\nhelper function to calculate the expectation ID, otherwise LSB of the\nexpectation object address is leaked to userspace.(CVE-2024-44944)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nkcm: Serialise kcm_sendmsg() for the same socket.\r\n\r\nsyzkaller reported UAF in kcm_release(). [0]\r\n\r\nThe scenario is\r\n\r\n 1. Thread A builds a skb with MSG_MORE and sets kcm-\u0026gt;seq_skb.\r\n\r\n 2. Thread A resumes building skb from kcm-\u0026gt;seq_skb but is blocked\n by sk_stream_wait_memory()\r\n\r\n 3. Thread B calls sendmsg() concurrently, finishes building kcm-\u0026gt;seq_skb\n and puts the skb to the write queue\r\n\r\n 4. Thread A faces an error and finally frees skb that is already in the\n write queue\r\n\r\n 5. kcm_release() does double-free the skb in the write queue\r\n\r\nWhen a thread is building a MSG_MORE skb, another thread must not touch it.\r\n\r\nLet\u0026apos;s add a per-sk mutex and serialise kcm_sendmsg().\r\n\r\n[0]:\nBUG: KASAN: slab-use-after-free in __skb_unlink include/linux/skbuff.h:2366 [inline]\nBUG: KASAN: slab-use-after-free in __skb_dequeue include/linux/skbuff.h:2385 [inline]\nBUG: KASAN: slab-use-after-free in __skb_queue_purge_reason include/linux/skbuff.h:3175 [inline]\nBUG: KASAN: slab-use-after-free in __skb_queue_purge include/linux/skbuff.h:3181 [inline]\nBUG: KASAN: slab-use-after-free in kcm_release+0x170/0x4c8 net/kcm/kcmsock.c:1691\nRead of size 8 at addr ffff0000ced0fc80 by task syz-executor329/6167\r\n\r\nCPU: 1 PID: 6167 Comm: syz-executor329 Tainted: G B 6.8.0-rc5-syzkaller-g9abbc24128bc #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024\nCall trace:\n dump_backtrace+0x1b8/0x1e4 arch/arm64/kernel/stacktrace.c:291\n show_stack+0x2c/0x3c arch/arm64/kernel/stacktrace.c:298\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0xd0/0x124 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x178/0x518 mm/kasan/report.c:488\n kasan_report+0xd8/0x138 mm/kasan/report.c:601\n __asan_report_load8_noabort+0x20/0x2c mm/kasan/report_generic.c:381\n __skb_unlink include/linux/skbuff.h:2366 [inline]\n __skb_dequeue include/linux/skbuff.h:2385 [inline]\n __skb_queue_purge_reason include/linux/skbuff.h:3175 [inline]\n __skb_queue_purge include/linux/skbuff.h:3181 [inline]\n kcm_release+0x170/0x4c8 net/kcm/kcmsock.c:1691\n __sock_release net/socket.c:659 [inline]\n sock_close+0xa4/0x1e8 net/socket.c:1421\n __fput+0x30c/0x738 fs/file_table.c:376\n ____fput+0x20/0x30 fs/file_table.c:404\n task_work_run+0x230/0x2e0 kernel/task_work.c:180\n exit_task_work include/linux/task_work.h:38 [inline]\n do_exit+0x618/0x1f64 kernel/exit.c:871\n do_group_exit+0x194/0x22c kernel/exit.c:1020\n get_signal+0x1500/0x15ec kernel/signal.c:2893\n do_signal+0x23c/0x3b44 arch/arm64/kernel/signal.c:1249\n do_notify_resume+0x74/0x1f4 arch/arm64/kernel/entry-common.c:148\n exit_to_user_mode_prepare arch/arm64/kernel/entry-common.c:169 [inline]\n exit_to_user_mode arch/arm64/kernel/entry-common.c:178 [inline]\n el0_svc+0xac/0x168 arch/arm64/kernel/entry-common.c:713\n el0t_64_sync_handler+0x84/0xfc arch/arm64/kernel/entry-common.c:730\n el0t_64_sync+0x190/0x194 arch/arm64/kernel/entry.S:598\r\n\r\nAllocated by task 6166:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x40/0x78 mm/kasan/common.c:68\n kasan_save_alloc_info+0x70/0x84 mm/kasan/generic.c:626\n unpoison_slab_object mm/kasan/common.c:314 [inline]\n __kasan_slab_alloc+0x74/0x8c mm/kasan/common.c:340\n kasan_slab_alloc include/linux/kasan.h:201 [inline]\n slab_post_alloc_hook mm/slub.c:3813 [inline]\n slab_alloc_node mm/slub.c:3860 [inline]\n kmem_cache_alloc_node+0x204/0x4c0 mm/slub.c:3903\n __alloc_skb+0x19c/0x3d8 net/core/skbuff.c:641\n alloc_skb include/linux/skbuff.h:1296 [inline]\n kcm_sendmsg+0x1d3c/0x2124 net/kcm/kcmsock.c:783\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg net/socket.c:745 [inline]\n sock_sendmsg+0x220/0x2c0 net/socket.c:768\n splice_to_socket+0x7cc/0xd58 fs/splice.c:889\n do_splice_from fs/splice.c:941 [inline]\n direct_splice_actor+0xec/0x1d8 fs/splice.c:1164\n splice_direct_to_actor+0x438/0xa0c fs/splice.c:1108\n do_splice_direct_actor \n---truncated---(CVE-2024-44946)",
"id": "OESA-2024-2106",
"modified": "2026-08-06T11:07:34Z",
"published": "2024-09-06T11:07:34Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-2106"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48871"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48875"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48877"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48891"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52889"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52896"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52899"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52906"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40901"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41008"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41016"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41060"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-41082"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42153"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42230"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42286"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42288"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42295"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42299"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-42312"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43824"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43834"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43854"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43883"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43884"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43889"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43890"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43898"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43905"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-43908"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44934"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44938"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44944"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-44946"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-48811",
"CVE-2022-48871",
"CVE-2022-48875",
"CVE-2022-48877",
"CVE-2022-48891",
"CVE-2023-52889",
"CVE-2023-52896",
"CVE-2023-52899",
"CVE-2023-52906",
"CVE-2024-40901",
"CVE-2024-41008",
"CVE-2024-41016",
"CVE-2024-41060",
"CVE-2024-41082",
"CVE-2024-42153",
"CVE-2024-42230",
"CVE-2024-42286",
"CVE-2024-42288",
"CVE-2024-42295",
"CVE-2024-42299",
"CVE-2024-42312",
"CVE-2024-43824",
"CVE-2024-43834",
"CVE-2024-43854",
"CVE-2024-43883",
"CVE-2024-43884",
"CVE-2024-43889",
"CVE-2024-43890",
"CVE-2024-43898",
"CVE-2024-43905",
"CVE-2024-43908",
"CVE-2024-44934",
"CVE-2024-44938",
"CVE-2024-44944",
"CVE-2024-44946"
]
}
SUSE-SU-2024:3190-1
Vulnerability from csaf_suse - Published: 2024-09-10 08:46 - Updated: 2026-09-20 16:58Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.