Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-52739 (GCVE-0-2023-52739)
Vulnerability from cvelistv5 – Published: 2024-05-21 15:23 – Updated: 2026-08-05 09:11| Vendor | Product | Version | |
|---|---|---|---|
| Linux | Linux |
Affected:
e320d3012d25b1fb5f3df4edb7bd44a1c362ec10 , < 0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23
(git)
Affected: e320d3012d25b1fb5f3df4edb7bd44a1c362ec10 , < 3af734f3eac6f70ef8e272a80da40544b9d0f2b5 (git) Affected: e320d3012d25b1fb5f3df4edb7bd44a1c362ec10 , < 3b4c045a98f53a8890a94bb5846a390c8e39e673 (git) Affected: e320d3012d25b1fb5f3df4edb7bd44a1c362ec10 , < 462a8e08e0e6287e5ce13187257edbf24213ed03 (git) Affected: 830b103831a924a23af48562c4d274696e75ab4f (git) Affected: 5.9.2 , < 5.10 (semver) |
|
| Linux | Linux |
Affected:
5.10
Unaffected: 0 , < 5.10 (semver) Unaffected: 5.10.168 , ≤ 5.10.* (semver) Unaffected: 5.15.94 , ≤ 5.15.* (semver) Unaffected: 6.1.12 , ≤ 6.1.* (semver) Unaffected: 6.2 , ≤ * (original_commit_for_fix) |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.988Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52739",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T15:37:31.888561Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T17:33:35.029Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3af734f3eac6f70ef8e272a80da40544b9d0f2b5",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3b4c045a98f53a8890a94bb5846a390c8e39e673",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "462a8e08e0e6287e5ce13187257edbf24213ed03",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"status": "affected",
"version": "830b103831a924a23af48562c4d274696e75ab4f",
"versionType": "git"
},
{
"lessThan": "5.10",
"status": "affected",
"version": "5.9.2",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.168",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.94",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.168",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.94",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.12",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionStartIncluding": "5.9.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nFix page corruption caused by racy check in __free_pages\n\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\n\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\n\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\n\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\"mm/page_alloc.c: fix freeing non-compound pages\"):\n\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u003e 0)\n\t\t\tfree_the_page(page + (1 \u003c\u003c order), order);\n\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The bug is in core MM `__free_pages` (mm/page_alloc.c), reached through local allocation/free paths (SLUB compound frees, dma-buf system heap release, AF_PACKET PACKET_MMAP ring teardown, etc.), not by parsing remote network protocol data.\nAC:L - An unprivileged attacker can drive both sides\u2014compound-page `__free_pages` (e.g. repeated dma-buf/AF_PACKET ring alloc-free) and concurrent extra refs/put_page via file I/O and memory pressure\u2014and the race was observed consistently under load despite a narrow instruction window.\nPR:L - Triggering requires only an ordinary local account (file I/O for speculative refs plus compound-page churn via dma-buf heaps or CAP_NET_RAW in a user namespace for AF_PACKET); no init-namespace root is required.\nUI:N - The attacker performs the alloc/free and I/O activity themselves; no separate victim action such as mounting a filesystem or opening a crafted file is required.\nS:U - Impact is host-kernel buddy-allocator corruption and privilege escalation within the same OS security authority, with no VM escape or IOMMU boundary crossed.\nC:H - The race double-frees compound tail pages into the buddy allocator, yielding page UAF/freelist corruption that can disclose arbitrary kernel or cross-process memory once pages are reused.\nI:H - The same double-free corrupts buddy freelist metadata and enables page reuse while stale references remain, giving a write primitive suitable for control-flow hijacking and privilege escalation.\nA:H - The fix documents bad-page-state BUGs, freelist pointer corruption, and kernel crashes/oopses when the corrupted pages are later allocated."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T09:11:09.430Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"title": "Fix page corruption caused by racy check in __free_pages",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52739",
"datePublished": "2024-05-21T15:23:02.545Z",
"dateReserved": "2024-05-21T15:19:24.233Z",
"dateUpdated": "2026-08-05T09:11:09.430Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-52739",
"date": "2026-10-03",
"epss": "0.00262",
"percentile": "0.16365"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3af734f3eac6f70ef8e272a80da40544b9d0f2b5",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3b4c045a98f53a8890a94bb5846a390c8e39e673",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "462a8e08e0e6287e5ce13187257edbf24213ed03",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"status": "affected",
"version": "830b103831a924a23af48562c4d274696e75ab4f",
"versionType": "git"
},
{
"lessThan": "5.10",
"status": "affected",
"version": "5.9.2",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.168",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.94",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6183C570-1A8F-4914-9A33-750629FF5558",
"versionEndExcluding": "5.10.168",
"versionStartIncluding": "5.9.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "55EC7465-CE9A-4B9C-B0FA-97394061A77F",
"versionEndExcluding": "5.15.94",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "63F0738E-F1B2-47A2-9329-E2B8BC87708A",
"versionEndExcluding": "6.1.12",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc1:*:*:*:*:*:*",
"matchCriteriaId": "FF501633-2F44-4913-A8EE-B021929F49F6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc2:*:*:*:*:*:*",
"matchCriteriaId": "2BDA597B-CAC1-4DF0-86F0-42E142C654E9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc3:*:*:*:*:*:*",
"matchCriteriaId": "725C78C9-12CE-406F-ABE8-0813A01D66E8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc4:*:*:*:*:*:*",
"matchCriteriaId": "A127C155-689C-4F67-B146-44A57F4BFD85",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc5:*:*:*:*:*:*",
"matchCriteriaId": "D34127CC-68F5-4703-A5F6-5006F803E4AE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc6:*:*:*:*:*:*",
"matchCriteriaId": "4AB8D555-648E-4F2F-98BD-3E7F45BD12A8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc7:*:*:*:*:*:*",
"matchCriteriaId": "C64BDD9D-C663-4E75-AE06-356EDC392B82",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nFix page corruption caused by racy check in __free_pages\n\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\n\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\n\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\n\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\"mm/page_alloc.c: fix freeing non-compound pages\"):\n\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u003e 0)\n\t\t\tfree_the_page(page + (1 \u003c\u003c order), order);\n\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: Repare la corrupci\u00f3n de la p\u00e1gina causada por el control racy en __free_pages. Cuando actualizamos nuestro kernel, comenzamos a ver algunos da\u00f1os en la p\u00e1gina como los siguientes de manera consistente: ERROR: Estado incorrecto de la p\u00e1gina en el proceso ganesha.nfsd pfn: 1304ca p\u00e1gina:0000000022261c55 refcount:0 mapcount:-128 mapeo:0000000000000000 \u00edndice:0x0 pfn:0x1304ca banderas: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 24b35ec08 0000000000000000 raw: 00000000000000000 0000000000000001 00000000ffffff7f 00000000000000000 p\u00e1gina volcada porque: recuento de mapas distinto de cero CPU: 0 PID: 15567 Comm : ganesha.nfsd Kdump: cargado Contaminado: PBO 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Nombre del hardware: VMware, Inc. Plataforma virtual VMware/Plataforma de referencia de escritorio 440BX, BIOS 6.00 05/04/2016 Seguimiento de llamadas : dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ... A veces, tambi\u00e9n aparecer\u00eda como corrupci\u00f3n en el puntero de la lista libre y provocar\u00eda fallos. Despu\u00e9s de dividir el problema en dos, encontramos que el problema comenz\u00f3 desde la confirmaci\u00f3n e320d3012d25 (\"mm/page_alloc.c: corrige la liberaci\u00f3n de p\u00e1ginas no compuestas\"): if (put_page_testzero(page)) free_the_page(page, order); else if (!PageHead(p\u00e1gina)) while (orden-- \u0026gt; 0) free_the_page(p\u00e1gina + (1 \u0026lt;\u0026lt; orden), orden); Entonces, el problema es que la verificaci\u00f3n PageHead es picante porque en este punto ya eliminamos nuestra referencia a la p\u00e1gina. Entonces, incluso si ingresamos con una p\u00e1gina compuesta, la p\u00e1gina ya se puede liberar y PageHead puede devolver falso y terminaremos liberando todas las p\u00e1ginas finales causando un double free."
}
],
"id": "CVE-2023-52739",
"lastModified": "2026-08-04T10:18:39.070",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52739",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T15:37:31.888561Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:13.820",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-08-04T19:25:16+00:00",
"cve": "CVE-2023-52739",
"id": "CVE-2023-52739",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: Fix page corruption caused by racy check in __free_pages",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-52739.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.988Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52739",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T15:37:31.888561Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-09-11T12:42:17.455Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3af734f3eac6f70ef8e272a80da40544b9d0f2b5",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3b4c045a98f53a8890a94bb5846a390c8e39e673",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "462a8e08e0e6287e5ce13187257edbf24213ed03",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"status": "affected",
"version": "830b103831a924a23af48562c4d274696e75ab4f",
"versionType": "git"
},
{
"lessThan": "5.10",
"status": "affected",
"version": "5.9.2",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.168",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.94",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.168",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.94",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.12",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2",
"versionStartIncluding": "5.10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionStartIncluding": "5.9.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nFix page corruption caused by racy check in __free_pages\n\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\n\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\n\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\n\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\"mm/page_alloc.c: fix freeing non-compound pages\"):\n\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u003e 0)\n\t\t\tfree_the_page(page + (1 \u003c\u003c order), order);\n\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The bug is in core MM `__free_pages` (mm/page_alloc.c), reached through local allocation/free paths (SLUB compound frees, dma-buf system heap release, AF_PACKET PACKET_MMAP ring teardown, etc.), not by parsing remote network protocol data.\nAC:L - An unprivileged attacker can drive both sides\u2014compound-page `__free_pages` (e.g. repeated dma-buf/AF_PACKET ring alloc-free) and concurrent extra refs/put_page via file I/O and memory pressure\u2014and the race was observed consistently under load despite a narrow instruction window.\nPR:L - Triggering requires only an ordinary local account (file I/O for speculative refs plus compound-page churn via dma-buf heaps or CAP_NET_RAW in a user namespace for AF_PACKET); no init-namespace root is required.\nUI:N - The attacker performs the alloc/free and I/O activity themselves; no separate victim action such as mounting a filesystem or opening a crafted file is required.\nS:U - Impact is host-kernel buddy-allocator corruption and privilege escalation within the same OS security authority, with no VM escape or IOMMU boundary crossed.\nC:H - The race double-frees compound tail pages into the buddy allocator, yielding page UAF/freelist corruption that can disclose arbitrary kernel or cross-process memory once pages are reused.\nI:H - The same double-free corrupts buddy freelist metadata and enables page reuse while stale references remain, giving a write primitive suitable for control-flow hijacking and privilege escalation.\nA:H - The fix documents bad-page-state BUGs, freelist pointer corruption, and kernel crashes/oopses when the corrupted pages are later allocated."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T09:11:09.430Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"title": "Fix page corruption caused by racy check in __free_pages",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52739",
"datePublished": "2024-05-21T15:23:02.545Z",
"dateReserved": "2024-05-21T15:19:24.233Z",
"dateUpdated": "2026-08-05T09:11:09.430Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
BDU:2024-10373 (CVE-2023-52739)
Vulnerability from fstec – Published: 2024-11-26 – Updated: 2024-11-26 – View on bdu.fstec.ru Fixed- CWE-415 - Повторное освобождение
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Red Hat, Inc., Canonical Ltd., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "8 (Red Hat Enterprise Linux), 20.04 LTS (Ubuntu), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 7.3 (\u0420\u0415\u0414 \u041e\u0421), 22.04 LTS (Ubuntu), 9 (Red Hat Enterprise Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.11 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.93 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.9.2 \u0434\u043e 5.10.167 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\n\u0414\u043b\u044f Linux:\nhttps://lore.kernel.org/linux-cve-announce/2024052101-CVE-2023-52739-46c6@gregkh/\nhttps://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23\t\nhttps://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5\t\nhttps://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673\t\nhttps://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03\t\n\n\u0414\u043b\u044f \u0420\u0435\u0434\u041e\u0421: \nhttp://repo.red-soft.ru/redos/7.3c/x86_64/updates/\n\n\u0414\u043b\u044f Ubuntu:\nhttps://ubuntu.com/security/CVE-2023-52739\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/cve-2023-52739\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-52739",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "12.02.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "26.11.2024",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "26.11.2024",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2024-10373",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-52739",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Red Hat Enterprise Linux, Ubuntu, Debian GNU/Linux, \u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Red Hat, Inc. Red Hat Enterprise Linux 8 , Canonical Ltd. Ubuntu 20.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Canonical Ltd. Ubuntu 22.04 LTS , Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux 6.2 rc1 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.15 \u0434\u043e 5.15.94 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.1 \u0434\u043e 6.1.12 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.10 \u0434\u043e 5.10.168 ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 __free_pages \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041f\u043e\u0432\u0442\u043e\u0440\u043d\u043e\u0435 \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u0435 (CWE-415)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 __free_pages \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043e\u0448\u0438\u0431\u043a\u043e\u0439 \u043f\u043e\u0432\u0442\u043e\u0440\u043d\u043e\u0433\u043e \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u044f \u043f\u0430\u043c\u044f\u0442\u0438 \u0432 \u0444\u0443\u043d\u043a\u0446\u0438\u0438 free_the_page(). \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "http://repo.red-soft.ru/redos/7.3c/x86_64/updates/\nhttps://access.redhat.com/security/cve/cve-2023-52739\nhttps://git.kernel.org/linus/462a8e08e0e6287e5ce13187257edbf24213ed03\nhttps://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23\nhttps://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5\nhttps://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673\nhttps://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.168\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.94\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.12\nhttps://lore.kernel.org/linux-cve-announce/2024052101-CVE-2023-52739-46c6@gregkh/\nhttps://security-tracker.debian.org/tracker/CVE-2023-52739\nhttps://ubuntu.com/security/CVE-2023-52739\nhttps://www.cve.org/CVERecord?id=CVE-2023-52739",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-415",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)\n\u041d\u0435\u0442 \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 4.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 0)"
}
BELL-CVE-2023-52739 (CVE-2023-52739)
Vulnerability from osv_bellsoft – Published: 2024-05-23 05:57 – Updated: 2024-05-23 05:57 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.112-r0"
},
{
"fixed": "6.6.58-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2023-52739",
"modified": "2024-05-23T05:57:57.861580Z",
"published": "2024-05-23T05:57:57.861576Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2023-52739"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2023-52739"
]
}
CERTFR-2024-AVI-0496
Vulnerability from certfr_avis - Published: 2024-06-14 - Updated: 2024-06-14
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | Basesystem Module | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP4 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-42327",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42327"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
}
],
"initial_release_date": "2024-06-14T00:00:00",
"last_revision_date": "2024-06-14T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0496",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1979-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241979-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1990-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241990-1"
},
{
"published_at": "2024-06-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2019-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242019-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1983-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241983-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2011-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242011-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2010-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242010-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1978-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241978-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2008-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242008-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2005-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242005-1"
}
]
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: 2024-06-28 - Updated: 2024-06-28
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"initial_release_date": "2024-06-28T00:00:00",
"last_revision_date": "2024-06-28T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
CERTFR-2025-AVI-1057
Vulnerability from certfr_avis - Published: 2025-12-02 - Updated: 2025-12-02
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 16.x antérieures à 16.11.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 14.x antérieures à 14.20.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 17.x antérieures à 17.7.0 | ||
| VMware | Tanzu Kubernetes Runtime | Tanzu Hub versions antérieures à 10.3.1 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 18.x antérieures à 18.1.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 15.x antérieures à 15.15.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 13.x antérieures à 13.23.0 |
| Title | Publication Time | Tags | ||||||
|---|---|---|---|---|---|---|---|---|
|
||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Tanzu pour Postgres versions 16.x ant\u00e9rieures \u00e0 16.11.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 14.x ant\u00e9rieures \u00e0 14.20.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 17.x ant\u00e9rieures \u00e0 17.7.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Hub versions ant\u00e9rieures \u00e0 10.3.1",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 18.x ant\u00e9rieures \u00e0 18.1.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 15.x ant\u00e9rieures \u00e0 15.15.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 13.x ant\u00e9rieures \u00e0 13.23.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2019-12900",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-12900"
},
{
"name": "CVE-2019-25013",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25013"
},
{
"name": "CVE-2020-28196",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-28196"
},
{
"name": "CVE-2020-10029",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10029"
},
{
"name": "CVE-2019-18276",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-18276"
},
{
"name": "CVE-2021-3421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3421"
},
{
"name": "CVE-2021-3326",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3326"
},
{
"name": "CVE-2020-27618",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-27618"
},
{
"name": "CVE-2021-20227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20227"
},
{
"name": "CVE-2021-36222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36222"
},
{
"name": "CVE-2022-23960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23960"
},
{
"name": "CVE-2022-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37967"
},
{
"name": "CVE-2022-3629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3629"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2022-37434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37434"
},
{
"name": "CVE-2022-2309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2309"
},
{
"name": "CVE-2022-43680",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43680"
},
{
"name": "CVE-2022-29824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29824"
},
{
"name": "CVE-2022-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23308"
},
{
"name": "CVE-2022-35737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35737"
},
{
"name": "CVE-2022-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40303"
},
{
"name": "CVE-2022-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40304"
},
{
"name": "CVE-2022-42898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42898"
},
{
"name": "CVE-2022-3633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3633"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2022-32205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32205"
},
{
"name": "CVE-2022-32206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32206"
},
{
"name": "CVE-2018-25032",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-25032"
},
{
"name": "CVE-2022-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3996"
},
{
"name": "CVE-2022-3903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3903"
},
{
"name": "CVE-2022-22942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22942"
},
{
"name": "CVE-2022-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26878"
},
{
"name": "CVE-2021-20266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20266"
},
{
"name": "CVE-2022-1292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1292"
},
{
"name": "CVE-2022-1974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1974"
},
{
"name": "CVE-2021-3521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3521"
},
{
"name": "CVE-2022-27774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27774"
},
{
"name": "CVE-2022-27775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27775"
},
{
"name": "CVE-2022-22576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22576"
},
{
"name": "CVE-2022-27776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27776"
},
{
"name": "CVE-2022-2068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2068"
},
{
"name": "CVE-2022-2097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2097"
},
{
"name": "CVE-2022-20154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20154"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2021-33574",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33574"
},
{
"name": "CVE-2021-36690",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36690"
},
{
"name": "CVE-2021-37750",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37750"
},
{
"name": "CVE-2021-3999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3999"
},
{
"name": "CVE-2022-23218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23218"
},
{
"name": "CVE-2022-23219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23219"
},
{
"name": "CVE-2022-27782",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27782"
},
{
"name": "CVE-2022-32208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32208"
},
{
"name": "CVE-2022-27781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27781"
},
{
"name": "CVE-2022-32207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32207"
},
{
"name": "CVE-2022-3358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3358"
},
{
"name": "CVE-2022-1271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1271"
},
{
"name": "CVE-2022-29458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29458"
},
{
"name": "CVE-2021-39537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39537"
},
{
"name": "CVE-2022-32221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32221"
},
{
"name": "CVE-2022-42916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42916"
},
{
"name": "CVE-2022-35252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35252"
},
{
"name": "CVE-2022-42915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42915"
},
{
"name": "CVE-2022-43551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43551"
},
{
"name": "CVE-2022-43552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43552"
},
{
"name": "CVE-2022-4304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4304"
},
{
"name": "CVE-2022-4203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4203"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2023-0401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0401"
},
{
"name": "CVE-2023-0215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0215"
},
{
"name": "CVE-2023-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0217"
},
{
"name": "CVE-2023-0216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0216"
},
{
"name": "CVE-2022-4450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4450"
},
{
"name": "CVE-2022-27672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27672"
},
{
"name": "CVE-2023-0045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0045"
},
{
"name": "CVE-2023-23915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23915"
},
{
"name": "CVE-2023-23914",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23914"
},
{
"name": "CVE-2023-23916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23916"
},
{
"name": "CVE-2022-1304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1304"
},
{
"name": "CVE-2023-24329",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24329"
},
{
"name": "CVE-2023-1118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1118"
},
{
"name": "CVE-2023-0464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0464"
},
{
"name": "CVE-2023-0466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0466"
},
{
"name": "CVE-2023-0465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0465"
},
{
"name": "CVE-2023-1838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1838"
},
{
"name": "CVE-2023-28410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28410"
},
{
"name": "CVE-2023-29469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29469"
},
{
"name": "CVE-2023-28484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28484"
},
{
"name": "CVE-2023-2650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2650"
},
{
"name": "CVE-2023-27535",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27535"
},
{
"name": "CVE-2022-27779",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27779"
},
{
"name": "CVE-2023-27533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27533"
},
{
"name": "CVE-2023-27538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27538"
},
{
"name": "CVE-2023-27534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27534"
},
{
"name": "CVE-2023-27536",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27536"
},
{
"name": "CVE-2022-27780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27780"
},
{
"name": "CVE-2022-30115",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-30115"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2020-1752",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-1752"
},
{
"name": "CVE-2021-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35942"
},
{
"name": "CVE-2021-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38604"
},
{
"name": "CVE-2020-29562",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-29562"
},
{
"name": "CVE-2021-27645",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27645"
},
{
"name": "CVE-2022-3534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3534"
},
{
"name": "CVE-2023-2156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2156"
},
{
"name": "CVE-2023-3006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3006"
},
{
"name": "CVE-2023-1255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1255"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2022-46908",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46908"
},
{
"name": "CVE-2021-31239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31239"
},
{
"name": "CVE-2023-28320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28320"
},
{
"name": "CVE-2023-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28321"
},
{
"name": "CVE-2023-2975",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2975"
},
{
"name": "CVE-2022-4899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4899"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2023-28319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28319"
},
{
"name": "CVE-2023-3817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3817"
},
{
"name": "CVE-2023-4387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4387"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2023-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38545"
},
{
"name": "CVE-2023-5363",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5363"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2023-31085",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31085"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2023-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40217"
},
{
"name": "CVE-2020-22218",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22218"
},
{
"name": "CVE-2023-2603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2603"
},
{
"name": "CVE-2023-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2602"
},
{
"name": "CVE-2023-4813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4813"
},
{
"name": "CVE-2022-0563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0563"
},
{
"name": "CVE-2023-4039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4039"
},
{
"name": "CVE-2023-5156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5156"
},
{
"name": "CVE-2023-29491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29491"
},
{
"name": "CVE-2023-39615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39615"
},
{
"name": "CVE-2021-37600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37600"
},
{
"name": "CVE-2021-33294",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33294"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2023-45322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45322"
},
{
"name": "CVE-2019-17498",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-17498"
},
{
"name": "CVE-2013-4235",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-4235"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2023-48795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48795"
},
{
"name": "CVE-2023-6237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6237"
},
{
"name": "CVE-2023-36054",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36054"
},
{
"name": "CVE-2023-7104",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7104"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2023-52467",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52467"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2023-52445",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52445"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2023-52462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52462"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-26603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26603"
},
{
"name": "CVE-2023-52452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52452"
},
{
"name": "CVE-2023-52532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52532"
},
{
"name": "CVE-2019-25162",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25162"
},
{
"name": "CVE-2021-46904",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46904"
},
{
"name": "CVE-2024-24855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24855"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2024-28085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28085"
},
{
"name": "CVE-2024-2511",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2511"
},
{
"name": "CVE-2020-22916",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22916"
},
{
"name": "CVE-2024-26631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26631"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2023-52426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52426"
},
{
"name": "CVE-2023-52501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52501"
},
{
"name": "CVE-2023-52519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52519"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-26670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26670"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2023-52528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52528"
},
{
"name": "CVE-2023-52582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52582"
},
{
"name": "CVE-2021-47098",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47098"
},
{
"name": "CVE-2023-52513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52513"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2023-52520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52520"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2023-52523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52523"
},
{
"name": "CVE-2024-26803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26803"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26681"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2024-26621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26621"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-47020",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47020"
},
{
"name": "CVE-2021-47017",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47017"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2021-47071",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47071"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2024-26605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26605"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26987"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2023-52468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52468"
},
{
"name": "CVE-2023-52487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52487"
},
{
"name": "CVE-2024-26618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26618"
},
{
"name": "CVE-2023-52490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52490"
},
{
"name": "CVE-2023-52455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52455"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2023-52473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52473"
},
{
"name": "CVE-2023-52465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52465"
},
{
"name": "CVE-2007-4559",
"url": "https://www.cve.org/CVERecord?id=CVE-2007-4559"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2021-47196",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47196"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48644",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48644"
},
{
"name": "CVE-2021-47217",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47217"
},
{
"name": "CVE-2022-48653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48653"
},
{
"name": "CVE-2021-47214",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47214"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48657"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2022-48658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48658"
},
{
"name": "CVE-2021-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47210"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2022-48639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48639"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2022-48640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48640"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2021-47215",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47215"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2021-47041",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47041"
},
{
"name": "CVE-2024-27039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27039"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48690",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48690"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2022-48637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48637"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2022-48660",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48660"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2023-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52565"
},
{
"name": "CVE-2024-26892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26892"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2024-0397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0397"
},
{
"name": "CVE-2024-4030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4030"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2023-52649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52649"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-26975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26975"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2024-27079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27079"
},
{
"name": "CVE-2024-27390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27390"
},
{
"name": "CVE-2024-35787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35787"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-3596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3596"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2024-26458",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26458"
},
{
"name": "CVE-2024-26461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26461"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2023-4641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4641"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35894"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35913"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-6197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6197"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-10966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10966"
},
{
"name": "CVE-2025-59425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59425"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-12817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12817"
},
{
"name": "CVE-2025-12818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12818"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2019-14844",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14844"
},
{
"name": "CVE-2021-24031",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24031"
},
{
"name": "CVE-2021-24032",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24032"
},
{
"name": "CVE-2021-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44964"
},
{
"name": "CVE-2022-28805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28805"
},
{
"name": "CVE-2022-33099",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33099"
},
{
"name": "CVE-2025-0306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0306"
},
{
"name": "CVE-2025-52099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52099"
},
{
"name": "CVE-2025-53643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53643"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-7709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7709"
},
{
"name": "CVE-2025-9714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9714"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2021-47517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47517"
},
{
"name": "CVE-2022-48865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48865"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2022-48883",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48883"
},
{
"name": "CVE-2022-48886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48886"
},
{
"name": "CVE-2022-48889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48889"
},
{
"name": "CVE-2022-48890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48890"
},
{
"name": "CVE-2022-48896",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48896"
},
{
"name": "CVE-2022-48899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48899"
},
{
"name": "CVE-2022-48912",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48912"
},
{
"name": "CVE-2022-48913",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48913"
},
{
"name": "CVE-2022-48914",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48914"
},
{
"name": "CVE-2022-48915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48915"
},
{
"name": "CVE-2022-48921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48921"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2022-48931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48931"
},
{
"name": "CVE-2022-48934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48934"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2022-48939",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48939"
},
{
"name": "CVE-2022-48942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48942"
},
{
"name": "CVE-2023-52859",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52859"
},
{
"name": "CVE-2023-52898",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52898"
},
{
"name": "CVE-2023-52901",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52901"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2023-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52906"
},
{
"name": "CVE-2023-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52908"
},
{
"name": "CVE-2023-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52909"
},
{
"name": "CVE-2023-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52910"
},
{
"name": "CVE-2024-26637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26637"
},
{
"name": "CVE-2024-26682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26682"
},
{
"name": "CVE-2024-26683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26683"
},
{
"name": "CVE-2024-36970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36970"
},
{
"name": "CVE-2024-39486",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39486"
},
{
"name": "CVE-2024-41010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41010"
},
{
"name": "CVE-2024-41032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41032"
},
{
"name": "CVE-2024-41037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41037"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41084"
},
{
"name": "CVE-2024-41094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41094"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2024-42132",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42132"
},
{
"name": "CVE-2024-42133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42133"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-42141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42141"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42241"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42278"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-43816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43816"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2024-43826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43826"
},
{
"name": "CVE-2024-43840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43840"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43874"
},
{
"name": "CVE-2024-7264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7264"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-42243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42243"
},
{
"name": "CVE-2024-34459",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34459"
},
{
"name": "CVE-2024-8096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8096"
},
{
"name": "CVE-2024-44983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44983"
},
{
"name": "CVE-2024-44986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44986"
},
{
"name": "CVE-2024-45000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45000"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2024-45019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45019"
},
{
"name": "CVE-2024-45022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45022"
},
{
"name": "CVE-2024-45029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45029"
},
{
"name": "CVE-2024-46711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46711"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2022-48944",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48944"
},
{
"name": "CVE-2024-42294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42294"
},
{
"name": "CVE-2024-43870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43870"
},
{
"name": "CVE-2024-44967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44967"
},
{
"name": "CVE-2024-44984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44984"
},
{
"name": "CVE-2024-45001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45001"
},
{
"name": "CVE-2024-45005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45005"
},
{
"name": "CVE-2024-45012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45012"
},
{
"name": "CVE-2024-45013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45013"
},
{
"name": "CVE-2024-45017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45017"
},
{
"name": "CVE-2024-45020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45020"
},
{
"name": "CVE-2024-46672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46672"
},
{
"name": "CVE-2024-46692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46692"
},
{
"name": "CVE-2024-46706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46706"
},
{
"name": "CVE-2024-46709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46709"
},
{
"name": "CVE-2024-46710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46710"
},
{
"name": "CVE-2024-46767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46767"
},
{
"name": "CVE-2024-46786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46786"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-37370",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37370"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2024-41085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41085"
},
{
"name": "CVE-2024-26721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26721"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
},
{
"name": "CVE-2025-54121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54121"
},
{
"name": "CVE-2012-2114",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-2114"
},
{
"name": "CVE-2021-46937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46937"
},
{
"name": "CVE-2021-46999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46999"
},
{
"name": "CVE-2021-47033",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47033"
},
{
"name": "CVE-2021-47079",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47079"
},
{
"name": "CVE-2021-47092",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47092"
},
{
"name": "CVE-2021-47226",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47226"
},
{
"name": "CVE-2021-47251",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47251"
},
{
"name": "CVE-2021-47266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47266"
},
{
"name": "CVE-2021-47318",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47318"
},
{
"name": "CVE-2021-47325",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47325"
},
{
"name": "CVE-2021-47346",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47346"
},
{
"name": "CVE-2021-47349",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47349"
},
{
"name": "CVE-2021-47519",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47519"
},
{
"name": "CVE-2021-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47561"
},
{
"name": "CVE-2021-47613",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47613"
},
{
"name": "CVE-2022-1247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1247"
},
{
"name": "CVE-2022-20153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20153"
},
{
"name": "CVE-2022-48641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48641"
},
{
"name": "CVE-2022-48643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48643"
},
{
"name": "CVE-2022-48707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48707"
},
{
"name": "CVE-2022-48719",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48719"
},
{
"name": "CVE-2022-48781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48781"
},
{
"name": "CVE-2022-48819",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48819"
},
{
"name": "CVE-2022-48832",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48832"
},
{
"name": "CVE-2022-48848",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48848"
},
{
"name": "CVE-2022-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48876"
},
{
"name": "CVE-2022-48963",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48963"
},
{
"name": "CVE-2022-48974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48974"
},
{
"name": "CVE-2022-48976",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48976"
},
{
"name": "CVE-2022-48984",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48984"
},
{
"name": "CVE-2022-48986",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48986"
},
{
"name": "CVE-2022-49013",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49013"
},
{
"name": "CVE-2022-49018",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49018"
},
{
"name": "CVE-2022-49048",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49048"
},
{
"name": "CVE-2022-49049",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49049"
},
{
"name": "CVE-2022-49052",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49052"
},
{
"name": "CVE-2022-49072",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49072"
},
{
"name": "CVE-2022-49077",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49077"
},
{
"name": "CVE-2022-49094",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49094"
},
{
"name": "CVE-2022-49152",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49152"
},
{
"name": "CVE-2022-49198",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49198"
},
{
"name": "CVE-2022-49229",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49229"
},
{
"name": "CVE-2022-49231",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49231"
},
{
"name": "CVE-2022-49334",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49334"
},
{
"name": "CVE-2022-49340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49340"
},
{
"name": "CVE-2022-49374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49374"
},
{
"name": "CVE-2022-49401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49401"
},
{
"name": "CVE-2022-49403",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49403"
},
{
"name": "CVE-2022-49450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49450"
},
{
"name": "CVE-2022-49554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49554"
},
{
"name": "CVE-2022-49557",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49557"
},
{
"name": "CVE-2022-49567",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49567"
},
{
"name": "CVE-2022-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49571"
},
{
"name": "CVE-2022-49572",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49572"
},
{
"name": "CVE-2022-49573",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49573"
},
{
"name": "CVE-2022-49574",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49574"
},
{
"name": "CVE-2022-49575",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49575"
},
{
"name": "CVE-2022-49577",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49577"
},
{
"name": "CVE-2022-49580",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49580"
},
{
"name": "CVE-2022-49585",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49585"
},
{
"name": "CVE-2022-49586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49586"
},
{
"name": "CVE-2022-49587",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49587"
},
{
"name": "CVE-2022-49593",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49593"
},
{
"name": "CVE-2022-49594",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49594"
},
{
"name": "CVE-2022-49595",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49595"
},
{
"name": "CVE-2022-49596",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49596"
},
{
"name": "CVE-2022-49597",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49597"
},
{
"name": "CVE-2022-49598",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49598"
},
{
"name": "CVE-2022-49599",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49599"
},
{
"name": "CVE-2022-49600",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49600"
},
{
"name": "CVE-2022-49601",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49601"
},
{
"name": "CVE-2022-49602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49602"
},
{
"name": "CVE-2022-49604",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49604"
},
{
"name": "CVE-2022-49612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49612"
},
{
"name": "CVE-2022-49629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49629"
},
{
"name": "CVE-2022-49633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49633"
},
{
"name": "CVE-2022-49637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49637"
},
{
"name": "CVE-2022-49639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49639"
},
{
"name": "CVE-2022-49659",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49659"
},
{
"name": "CVE-2022-49662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49662"
},
{
"name": "CVE-2022-49691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49691"
},
{
"name": "CVE-2022-49744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49744"
},
{
"name": "CVE-2022-49747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49747"
},
{
"name": "CVE-2022-49752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49752"
},
{
"name": "CVE-2022-49754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49754"
},
{
"name": "CVE-2022-49760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49760"
},
{
"name": "CVE-2023-31082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31082"
},
{
"name": "CVE-2023-52516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52516"
},
{
"name": "CVE-2023-52568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52568"
},
{
"name": "CVE-2023-52570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52570"
},
{
"name": "CVE-2023-52689",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52689"
},
{
"name": "CVE-2023-52704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52704"
},
{
"name": "CVE-2023-52706",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52706"
},
{
"name": "CVE-2023-52828",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52828"
},
{
"name": "CVE-2023-52902",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52902"
},
{
"name": "CVE-2023-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52932"
},
{
"name": "CVE-2023-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52934"
},
{
"name": "CVE-2023-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52940"
},
{
"name": "CVE-2023-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52942"
},
{
"name": "CVE-2023-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52977"
},
{
"name": "CVE-2023-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52985"
},
{
"name": "CVE-2023-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52987"
},
{
"name": "CVE-2023-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52991"
},
{
"name": "CVE-2023-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53004"
},
{
"name": "CVE-2023-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53017"
},
{
"name": "CVE-2024-23196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23196"
},
{
"name": "CVE-2024-26678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26678"
},
{
"name": "CVE-2024-26725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26725"
},
{
"name": "CVE-2024-26746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26746"
},
{
"name": "CVE-2024-26918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26918"
},
{
"name": "CVE-2024-27023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27023"
},
{
"name": "CVE-2024-40907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40907"
},
{
"name": "CVE-2024-43896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43896"
},
{
"name": "CVE-2024-46748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46748"
},
{
"name": "CVE-2024-46862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46862"
},
{
"name": "CVE-2024-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53073"
},
{
"name": "CVE-2024-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53225"
},
{
"name": "CVE-2024-56668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56668"
},
{
"name": "CVE-2024-57852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57852"
},
{
"name": "CVE-2024-57914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57914"
},
{
"name": "CVE-2024-57985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57985"
},
{
"name": "CVE-2024-57989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57989"
},
{
"name": "CVE-2024-58064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58064"
},
{
"name": "CVE-2024-58075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58075"
},
{
"name": "CVE-2024-58084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58084"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-21807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21807"
},
{
"name": "CVE-2025-21817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21817"
},
{
"name": "CVE-2025-21827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21827"
},
{
"name": "CVE-2025-21851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21851"
},
{
"name": "CVE-2025-21874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21874"
},
{
"name": "CVE-2025-21907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21907"
},
{
"name": "CVE-2025-21921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21921"
},
{
"name": "CVE-2025-24357",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24357"
},
{
"name": "CVE-2025-25183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25183"
},
{
"name": "CVE-2025-29770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29770"
},
{
"name": "CVE-2025-30165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30165"
},
{
"name": "CVE-2025-30202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30202"
},
{
"name": "CVE-2025-32381",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32381"
},
{
"name": "CVE-2025-32444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32444"
},
{
"name": "CVE-2025-46570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46570"
},
{
"name": "CVE-2025-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47277"
},
{
"name": "CVE-2025-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48887"
},
{
"name": "CVE-2025-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48956"
},
{
"name": "CVE-2025-57809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-57809"
},
{
"name": "CVE-2025-62372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62372"
},
{
"name": "CVE-2025-62426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62426"
},
{
"name": "CVE-2025-65106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65106"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-43869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43869"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-46824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46824"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53070"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50226"
},
{
"name": "CVE-2024-11053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11053"
},
{
"name": "CVE-2024-44994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44994"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-42317",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42317"
},
{
"name": "CVE-2024-43820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43820"
},
{
"name": "CVE-2024-43888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43888"
},
{
"name": "CVE-2024-43910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43910"
},
{
"name": "CVE-2024-44975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44975"
},
{
"name": "CVE-2024-44996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44996"
},
{
"name": "CVE-2024-45027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45027"
},
{
"name": "CVE-2024-46697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46697"
},
{
"name": "CVE-2024-46698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46698"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46793"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47734"
},
{
"name": "CVE-2024-49856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49856"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53064"
},
{
"name": "CVE-2024-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53105"
},
{
"name": "CVE-2024-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53117"
},
{
"name": "CVE-2024-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53118"
},
{
"name": "CVE-2024-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53134"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53160"
},
{
"name": "CVE-2024-53166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53166"
},
{
"name": "CVE-2024-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53169"
},
{
"name": "CVE-2024-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53202"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53207"
},
{
"name": "CVE-2024-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53208"
},
{
"name": "CVE-2024-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53213"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53222"
},
{
"name": "CVE-2024-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53229"
},
{
"name": "CVE-2024-56549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56549"
},
{
"name": "CVE-2024-56667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56667"
},
{
"name": "CVE-2024-56752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56752"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2024-49951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49951"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2024-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53170"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2024-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53185"
},
{
"name": "CVE-2024-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53230"
},
{
"name": "CVE-2024-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53231"
},
{
"name": "CVE-2024-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53232"
},
{
"name": "CVE-2024-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53236"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-56372",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56372"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2024-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53238"
},
{
"name": "CVE-2024-56617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56617"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56632"
},
{
"name": "CVE-2024-56654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56654"
},
{
"name": "CVE-2024-56663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56663"
},
{
"name": "CVE-2024-56675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56675"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56709"
},
{
"name": "CVE-2024-56729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56729"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56760"
},
{
"name": "CVE-2024-56765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56765"
},
{
"name": "CVE-2024-57793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57793"
},
{
"name": "CVE-2024-57804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57804"
},
{
"name": "CVE-2024-57932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57932"
},
{
"name": "CVE-2024-57933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57933"
},
{
"name": "CVE-2024-57936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57936"
},
{
"name": "CVE-2025-21645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21645"
},
{
"name": "CVE-2025-21649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21649"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2025-0725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0725"
},
{
"name": "CVE-2024-46820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46820"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53047"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2024-56725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56725"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2025-21663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21663"
},
{
"name": "CVE-2025-21670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21670"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2025-21647",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21647"
},
{
"name": "CVE-2025-21668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21668"
},
{
"name": "CVE-2025-21671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21671"
},
{
"name": "CVE-2025-21681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21681"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2021-47222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47222"
},
{
"name": "CVE-2021-47223",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47223"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2024-47700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47700"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2024-49885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49885"
},
{
"name": "CVE-2024-49999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49999"
},
{
"name": "CVE-2024-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50029"
},
{
"name": "CVE-2024-50107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50107"
},
{
"name": "CVE-2024-50109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50109"
},
{
"name": "CVE-2024-50114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50114"
},
{
"name": "CVE-2024-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50120"
},
{
"name": "CVE-2024-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50152"
},
{
"name": "CVE-2024-50165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50165"
},
{
"name": "CVE-2024-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50197"
},
{
"name": "CVE-2024-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50207"
},
{
"name": "CVE-2024-50223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50223"
},
{
"name": "CVE-2024-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50294"
},
{
"name": "CVE-2024-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50303"
},
{
"name": "CVE-2024-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53044"
},
{
"name": "CVE-2024-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53109"
},
{
"name": "CVE-2024-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53167"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2024-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53189"
},
{
"name": "CVE-2024-56535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56535"
},
{
"name": "CVE-2024-56545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56545"
},
{
"name": "CVE-2024-56696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56696"
},
{
"name": "CVE-2024-56702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56702"
},
{
"name": "CVE-2024-56742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56742"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2024-56783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56783"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2022-49080",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49080"
},
{
"name": "CVE-2022-49089",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49089"
},
{
"name": "CVE-2024-57994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57994"
},
{
"name": "CVE-2025-21705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21705"
},
{
"name": "CVE-2025-21716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21716"
},
{
"name": "CVE-2025-21724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21724"
},
{
"name": "CVE-2025-21725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21725"
},
{
"name": "CVE-2025-21790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21790"
},
{
"name": "CVE-2025-21795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21795"
},
{
"name": "CVE-2022-49043",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49043"
},
{
"name": "CVE-2024-45336",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45336"
},
{
"name": "CVE-2024-45341",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45341"
},
{
"name": "CVE-2025-22866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22866"
},
{
"name": "CVE-2021-47648",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47648"
},
{
"name": "CVE-2021-47649",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47649"
},
{
"name": "CVE-2021-47650",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47650"
},
{
"name": "CVE-2021-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47659"
},
{
"name": "CVE-2022-49058",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49058"
},
{
"name": "CVE-2022-49061",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49061"
},
{
"name": "CVE-2022-49065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49065"
},
{
"name": "CVE-2022-49066",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49066"
},
{
"name": "CVE-2022-49074",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49074"
},
{
"name": "CVE-2022-49086",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49086"
},
{
"name": "CVE-2022-49090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49090"
},
{
"name": "CVE-2022-49092",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49092"
},
{
"name": "CVE-2022-49097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49097"
},
{
"name": "CVE-2022-49100",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49100"
},
{
"name": "CVE-2022-49103",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49103"
},
{
"name": "CVE-2022-49107",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49107"
},
{
"name": "CVE-2022-49118",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49118"
},
{
"name": "CVE-2022-49122",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49122"
},
{
"name": "CVE-2022-49130",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49130"
},
{
"name": "CVE-2022-49145",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49145"
},
{
"name": "CVE-2022-49147",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49147"
},
{
"name": "CVE-2022-49148",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49148"
},
{
"name": "CVE-2022-49153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49153"
},
{
"name": "CVE-2022-49154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49154"
},
{
"name": "CVE-2022-49155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49155"
},
{
"name": "CVE-2022-49156",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49156"
},
{
"name": "CVE-2022-49159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49159"
},
{
"name": "CVE-2022-49174",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49174"
},
{
"name": "CVE-2022-49175",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49175"
},
{
"name": "CVE-2022-49180",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49180"
},
{
"name": "CVE-2022-49187",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49187"
},
{
"name": "CVE-2022-49188",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49188"
},
{
"name": "CVE-2022-49206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49206"
},
{
"name": "CVE-2022-49208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49208"
},
{
"name": "CVE-2022-49216",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49216"
},
{
"name": "CVE-2022-49227",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49227"
},
{
"name": "CVE-2022-49257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49257"
},
{
"name": "CVE-2022-49259",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49259"
},
{
"name": "CVE-2022-49262",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49262"
},
{
"name": "CVE-2022-49263",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49263"
},
{
"name": "CVE-2022-49264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49264"
},
{
"name": "CVE-2022-49266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49266"
},
{
"name": "CVE-2022-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49268"
},
{
"name": "CVE-2022-49269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49269"
},
{
"name": "CVE-2022-49272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49272"
},
{
"name": "CVE-2022-49273",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49273"
},
{
"name": "CVE-2022-49279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49279"
},
{
"name": "CVE-2022-49286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49286"
},
{
"name": "CVE-2022-49290",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49290"
},
{
"name": "CVE-2022-49297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49297"
},
{
"name": "CVE-2022-49307",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49307"
},
{
"name": "CVE-2022-49308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49308"
},
{
"name": "CVE-2022-49321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49321"
},
{
"name": "CVE-2022-49322",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49322"
},
{
"name": "CVE-2022-49323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49323"
},
{
"name": "CVE-2022-49339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49339"
},
{
"name": "CVE-2022-49341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49341"
},
{
"name": "CVE-2022-49343",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49343"
},
{
"name": "CVE-2022-49345",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49345"
},
{
"name": "CVE-2022-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49350"
},
{
"name": "CVE-2022-49352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49352"
},
{
"name": "CVE-2022-49356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49356"
},
{
"name": "CVE-2022-49357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49357"
},
{
"name": "CVE-2022-49376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49376"
},
{
"name": "CVE-2022-49378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49378"
},
{
"name": "CVE-2022-49379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49379"
},
{
"name": "CVE-2022-49384",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49384"
},
{
"name": "CVE-2022-49394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49394"
},
{
"name": "CVE-2022-49400",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49400"
},
{
"name": "CVE-2022-49402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49402"
},
{
"name": "CVE-2022-49404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49404"
},
{
"name": "CVE-2022-49407",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49407"
},
{
"name": "CVE-2022-49409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49409"
},
{
"name": "CVE-2022-49422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49422"
},
{
"name": "CVE-2022-49432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49432"
},
{
"name": "CVE-2022-49433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49433"
},
{
"name": "CVE-2022-49434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49434"
},
{
"name": "CVE-2022-49441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49441"
},
{
"name": "CVE-2022-49447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49447"
},
{
"name": "CVE-2022-49455",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49455"
},
{
"name": "CVE-2022-49468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49468"
},
{
"name": "CVE-2022-49472",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49472"
},
{
"name": "CVE-2022-49475",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49475"
},
{
"name": "CVE-2022-49481",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49481"
},
{
"name": "CVE-2022-49486",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49486"
},
{
"name": "CVE-2022-49492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49492"
},
{
"name": "CVE-2022-49498",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49498"
},
{
"name": "CVE-2022-49503",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49503"
},
{
"name": "CVE-2022-49508",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49508"
},
{
"name": "CVE-2022-49515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49515"
},
{
"name": "CVE-2022-49519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49519"
},
{
"name": "CVE-2022-49520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49520"
},
{
"name": "CVE-2022-49521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49521"
},
{
"name": "CVE-2022-49523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49523"
},
{
"name": "CVE-2022-49526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49526"
},
{
"name": "CVE-2022-49532",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49532"
},
{
"name": "CVE-2022-49545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49545"
},
{
"name": "CVE-2022-49559",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49559"
},
{
"name": "CVE-2022-49581",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49581"
},
{
"name": "CVE-2022-49583",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49583"
},
{
"name": "CVE-2022-49584",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49584"
},
{
"name": "CVE-2022-49592",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49592"
},
{
"name": "CVE-2022-49603",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49603"
},
{
"name": "CVE-2022-49605",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49605"
},
{
"name": "CVE-2022-49606",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49606"
},
{
"name": "CVE-2022-49607",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49607"
},
{
"name": "CVE-2022-49611",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49611"
},
{
"name": "CVE-2022-49613",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49613"
},
{
"name": "CVE-2022-49625",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49625"
},
{
"name": "CVE-2022-49627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49627"
},
{
"name": "CVE-2022-49631",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49631"
},
{
"name": "CVE-2022-49634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49634"
},
{
"name": "CVE-2022-49640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49640"
},
{
"name": "CVE-2022-49641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49641"
},
{
"name": "CVE-2022-49642",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49642"
},
{
"name": "CVE-2022-49643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49643"
},
{
"name": "CVE-2022-49646",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49646"
},
{
"name": "CVE-2022-49648",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49648"
},
{
"name": "CVE-2022-49653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49653"
},
{
"name": "CVE-2022-49656",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49656"
},
{
"name": "CVE-2022-49657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49657"
},
{
"name": "CVE-2022-49663",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49663"
},
{
"name": "CVE-2022-49670",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49670"
},
{
"name": "CVE-2022-49671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49671"
},
{
"name": "CVE-2022-49672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49672"
},
{
"name": "CVE-2022-49673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49673"
},
{
"name": "CVE-2022-49674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49674"
},
{
"name": "CVE-2022-49675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49675"
},
{
"name": "CVE-2022-49679",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49679"
},
{
"name": "CVE-2022-49688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49688"
},
{
"name": "CVE-2022-49699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49699"
},
{
"name": "CVE-2022-49707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49707"
},
{
"name": "CVE-2022-49708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49708"
},
{
"name": "CVE-2022-49710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49710"
},
{
"name": "CVE-2022-49716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49716"
},
{
"name": "CVE-2022-49721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49721"
},
{
"name": "CVE-2022-49723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49723"
},
{
"name": "CVE-2022-49726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49726"
},
{
"name": "CVE-2022-49731",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49731"
},
{
"name": "CVE-2024-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48876"
},
{
"name": "CVE-2024-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53681"
},
{
"name": "CVE-2024-54460",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54460"
},
{
"name": "CVE-2024-55642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55642"
},
{
"name": "CVE-2024-56613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56613"
},
{
"name": "CVE-2024-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56624"
},
{
"name": "CVE-2024-56638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56638"
},
{
"name": "CVE-2024-56653",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56653"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56669"
},
{
"name": "CVE-2024-56710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56710"
},
{
"name": "CVE-2024-56714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56714"
},
{
"name": "CVE-2024-56772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56772"
},
{
"name": "CVE-2024-56773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56773"
},
{
"name": "CVE-2024-57878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57878"
},
{
"name": "CVE-2024-57879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57879"
},
{
"name": "CVE-2024-57885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57885"
},
{
"name": "CVE-2025-21644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21644"
},
{
"name": "CVE-2025-21659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21659"
},
{
"name": "CVE-2024-56171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56171"
},
{
"name": "CVE-2025-27113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27113"
},
{
"name": "CVE-2024-57993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57993"
},
{
"name": "CVE-2024-58009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58009"
},
{
"name": "CVE-2024-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58061"
},
{
"name": "CVE-2024-58068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58068"
},
{
"name": "CVE-2024-58077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58077"
},
{
"name": "CVE-2025-21706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21706"
},
{
"name": "CVE-2025-21707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21707"
},
{
"name": "CVE-2025-21829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21829"
},
{
"name": "CVE-2025-21830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21830"
},
{
"name": "CVE-2025-21832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21832"
},
{
"name": "CVE-2022-49057",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49057"
},
{
"name": "CVE-2022-49062",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49062"
},
{
"name": "CVE-2022-49064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49064"
},
{
"name": "CVE-2022-49070",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49070"
},
{
"name": "CVE-2022-49139",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49139"
},
{
"name": "CVE-2022-49204",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49204"
},
{
"name": "CVE-2022-49205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49205"
},
{
"name": "CVE-2022-49207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49207"
},
{
"name": "CVE-2022-49209",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49209"
},
{
"name": "CVE-2022-49225",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49225"
},
{
"name": "CVE-2022-49228",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49228"
},
{
"name": "CVE-2022-49237",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49237"
},
{
"name": "CVE-2022-49330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49330"
},
{
"name": "CVE-2022-49353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49353"
},
{
"name": "CVE-2022-49406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49406"
},
{
"name": "CVE-2022-49436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49436"
},
{
"name": "CVE-2022-49446",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49446"
},
{
"name": "CVE-2022-49476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49476"
},
{
"name": "CVE-2022-49511",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49511"
},
{
"name": "CVE-2022-49518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49518"
},
{
"name": "CVE-2022-49538",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49538"
},
{
"name": "CVE-2022-49548",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49548"
},
{
"name": "CVE-2022-49552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49552"
},
{
"name": "CVE-2022-49560",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49560"
},
{
"name": "CVE-2022-49565",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49565"
},
{
"name": "CVE-2022-49624",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49624"
},
{
"name": "CVE-2022-49638",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49638"
},
{
"name": "CVE-2022-49655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49655"
},
{
"name": "CVE-2022-49658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49658"
},
{
"name": "CVE-2022-49697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49697"
},
{
"name": "CVE-2022-49732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49732"
},
{
"name": "CVE-2022-49739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49739"
},
{
"name": "CVE-2022-49746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49746"
},
{
"name": "CVE-2022-49759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49759"
},
{
"name": "CVE-2023-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52933"
},
{
"name": "CVE-2023-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52941"
},
{
"name": "CVE-2023-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52976"
},
{
"name": "CVE-2023-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52984"
},
{
"name": "CVE-2023-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52992"
},
{
"name": "CVE-2023-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52993"
},
{
"name": "CVE-2023-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53006"
},
{
"name": "CVE-2023-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53007"
},
{
"name": "CVE-2023-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53015"
},
{
"name": "CVE-2023-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53016"
},
{
"name": "CVE-2023-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53019"
},
{
"name": "CVE-2023-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53026"
},
{
"name": "CVE-2023-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53029"
},
{
"name": "CVE-2023-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53030"
},
{
"name": "CVE-2023-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53033"
},
{
"name": "CVE-2024-46736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46736"
},
{
"name": "CVE-2024-46796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46796"
},
{
"name": "CVE-2024-57990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57990"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2024-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58057"
},
{
"name": "CVE-2024-58078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58078"
},
{
"name": "CVE-2024-58079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58079"
},
{
"name": "CVE-2025-21723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21723"
},
{
"name": "CVE-2025-21732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21732"
},
{
"name": "CVE-2025-21810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21810"
},
{
"name": "CVE-2025-21825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21825"
},
{
"name": "CVE-2025-21828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21828"
},
{
"name": "CVE-2025-21844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21844"
},
{
"name": "CVE-2025-21847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21847"
},
{
"name": "CVE-2025-21856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21856"
},
{
"name": "CVE-2025-21857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21857"
},
{
"name": "CVE-2025-21864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21864"
},
{
"name": "CVE-2025-21869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21869"
},
{
"name": "CVE-2025-21870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21870"
},
{
"name": "CVE-2025-21876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21876"
},
{
"name": "CVE-2025-21883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21883"
},
{
"name": "CVE-2025-21886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21886"
},
{
"name": "CVE-2025-21888",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21888"
},
{
"name": "CVE-2025-21890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21890"
},
{
"name": "CVE-2024-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8176"
},
{
"name": "CVE-2025-24928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24928"
},
{
"name": "CVE-2025-21913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21913"
},
{
"name": "CVE-2025-21916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21916"
},
{
"name": "CVE-2025-21918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21918"
},
{
"name": "CVE-2025-21924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21924"
},
{
"name": "CVE-2025-21936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21936"
},
{
"name": "CVE-2025-21938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21938"
},
{
"name": "CVE-2025-21962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21962"
},
{
"name": "CVE-2025-21963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21963"
},
{
"name": "CVE-2025-21964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21964"
},
{
"name": "CVE-2025-21978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21978"
},
{
"name": "CVE-2025-21979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21979"
},
{
"name": "CVE-2025-21986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21986"
},
{
"name": "CVE-2022-49220",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49220"
},
{
"name": "CVE-2022-49372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49372"
},
{
"name": "CVE-2022-49578",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49578"
},
{
"name": "CVE-2022-49589",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49589"
},
{
"name": "CVE-2022-49620",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49620"
},
{
"name": "CVE-2023-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52997"
},
{
"name": "CVE-2023-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53031"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-21691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21691"
},
{
"name": "CVE-2025-27516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27516"
},
{
"name": "CVE-2025-21953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21953"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2025-32414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32414"
},
{
"name": "CVE-2025-32415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32415"
},
{
"name": "CVE-2022-49171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49171"
},
{
"name": "CVE-2022-49197",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49197"
},
{
"name": "CVE-2022-49561",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49561"
},
{
"name": "CVE-2022-49590",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49590"
},
{
"name": "CVE-2023-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52928"
},
{
"name": "CVE-2023-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52937"
},
{
"name": "CVE-2023-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52938"
},
{
"name": "CVE-2023-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52981"
},
{
"name": "CVE-2023-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52982"
},
{
"name": "CVE-2023-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52986"
},
{
"name": "CVE-2023-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53009"
},
{
"name": "CVE-2023-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53032"
},
{
"name": "CVE-2024-58070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58070"
},
{
"name": "CVE-2024-58088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58088"
},
{
"name": "CVE-2025-21808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21808"
},
{
"name": "CVE-2025-21836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21836"
},
{
"name": "CVE-2025-21854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21854"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-21889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21889"
},
{
"name": "CVE-2025-21895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21895"
},
{
"name": "CVE-2025-21906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21906"
},
{
"name": "CVE-2025-21908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21908"
},
{
"name": "CVE-2025-21930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21930"
},
{
"name": "CVE-2025-21961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21961"
},
{
"name": "CVE-2025-21966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21966"
},
{
"name": "CVE-2025-4947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4947"
},
{
"name": "CVE-2025-5025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5025"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-1390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1390"
},
{
"name": "CVE-2025-29088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29088"
},
{
"name": "CVE-2025-32434",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32434"
},
{
"name": "CVE-2025-43859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-43859"
},
{
"name": "CVE-2024-58074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58074"
},
{
"name": "CVE-2025-21974",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21974"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2022-49636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49636"
},
{
"name": "CVE-2025-21939",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21939"
},
{
"name": "CVE-2024-47081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47081"
},
{
"name": "CVE-2025-3576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3576"
},
{
"name": "CVE-2024-57987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57987"
},
{
"name": "CVE-2024-57988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57988"
},
{
"name": "CVE-2024-57995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57995"
},
{
"name": "CVE-2024-58015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58015"
},
{
"name": "CVE-2024-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58062"
},
{
"name": "CVE-2025-21713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21713"
},
{
"name": "CVE-2025-21770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21770"
},
{
"name": "CVE-2025-21880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21880"
},
{
"name": "CVE-2021-3995",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3995"
},
{
"name": "CVE-2021-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3996"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2025-21809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21809"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2025-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50182"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2021-32256",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32256"
},
{
"name": "CVE-2024-25260",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25260"
},
{
"name": "CVE-2025-1371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1371"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2025-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1377"
},
{
"name": "CVE-2025-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49794"
},
{
"name": "CVE-2025-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49796"
},
{
"name": "CVE-2024-54456",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54456"
},
{
"name": "CVE-2025-21783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21783"
},
{
"name": "CVE-2025-6965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6965"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2024-26462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26462"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2025-1365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1365"
},
{
"name": "CVE-2025-1372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1372"
},
{
"name": "CVE-2025-27587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27587"
},
{
"name": "CVE-2025-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49795"
},
{
"name": "CVE-2025-6170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6170"
},
{
"name": "CVE-2025-8732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8732"
},
{
"name": "CVE-2025-9086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9086"
},
{
"name": "CVE-2025-41248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41248"
}
],
"initial_release_date": "2025-12-02T00:00:00",
"last_revision_date": "2025-12-02T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1057",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-12-02T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36560",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36560"
},
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36564",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36564"
}
]
}
EUVD-2026-345051
European Vulnerability Database identifier assigned by ENISA{
"assigner": "ENISA",
"date_reserved": "2026-10-02T07:59:24.955926+00:00",
"id": "EUVD-2026-345051"
}
FKIE_CVE-2023-52739
Vulnerability from fkie_nvd - Published: 2024-05-21 16:15 - Updated: 2026-08-04 10:185.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 | |
| linux | linux_kernel | 6.2 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3af734f3eac6f70ef8e272a80da40544b9d0f2b5",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "3b4c045a98f53a8890a94bb5846a390c8e39e673",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"lessThan": "462a8e08e0e6287e5ce13187257edbf24213ed03",
"status": "affected",
"version": "e320d3012d25b1fb5f3df4edb7bd44a1c362ec10",
"versionType": "git"
},
{
"status": "affected",
"version": "830b103831a924a23af48562c4d274696e75ab4f",
"versionType": "git"
},
{
"lessThan": "5.10",
"status": "affected",
"version": "5.9.2",
"versionType": "semver"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"mm/page_alloc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.10"
},
{
"lessThan": "5.10",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.168",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.94",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.2",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6183C570-1A8F-4914-9A33-750629FF5558",
"versionEndExcluding": "5.10.168",
"versionStartIncluding": "5.9.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "55EC7465-CE9A-4B9C-B0FA-97394061A77F",
"versionEndExcluding": "5.15.94",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "63F0738E-F1B2-47A2-9329-E2B8BC87708A",
"versionEndExcluding": "6.1.12",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc1:*:*:*:*:*:*",
"matchCriteriaId": "FF501633-2F44-4913-A8EE-B021929F49F6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc2:*:*:*:*:*:*",
"matchCriteriaId": "2BDA597B-CAC1-4DF0-86F0-42E142C654E9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc3:*:*:*:*:*:*",
"matchCriteriaId": "725C78C9-12CE-406F-ABE8-0813A01D66E8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc4:*:*:*:*:*:*",
"matchCriteriaId": "A127C155-689C-4F67-B146-44A57F4BFD85",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc5:*:*:*:*:*:*",
"matchCriteriaId": "D34127CC-68F5-4703-A5F6-5006F803E4AE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc6:*:*:*:*:*:*",
"matchCriteriaId": "4AB8D555-648E-4F2F-98BD-3E7F45BD12A8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.2:rc7:*:*:*:*:*:*",
"matchCriteriaId": "C64BDD9D-C663-4E75-AE06-356EDC392B82",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nFix page corruption caused by racy check in __free_pages\n\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\n\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\n\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\n\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\"mm/page_alloc.c: fix freeing non-compound pages\"):\n\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u003e 0)\n\t\t\tfree_the_page(page + (1 \u003c\u003c order), order);\n\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: Repare la corrupci\u00f3n de la p\u00e1gina causada por el control racy en __free_pages. Cuando actualizamos nuestro kernel, comenzamos a ver algunos da\u00f1os en la p\u00e1gina como los siguientes de manera consistente: ERROR: Estado incorrecto de la p\u00e1gina en el proceso ganesha.nfsd pfn: 1304ca p\u00e1gina:0000000022261c55 refcount:0 mapcount:-128 mapeo:0000000000000000 \u00edndice:0x0 pfn:0x1304ca banderas: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 24b35ec08 0000000000000000 raw: 00000000000000000 0000000000000001 00000000ffffff7f 00000000000000000 p\u00e1gina volcada porque: recuento de mapas distinto de cero CPU: 0 PID: 15567 Comm : ganesha.nfsd Kdump: cargado Contaminado: PBO 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Nombre del hardware: VMware, Inc. Plataforma virtual VMware/Plataforma de referencia de escritorio 440BX, BIOS 6.00 05/04/2016 Seguimiento de llamadas : dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ... A veces, tambi\u00e9n aparecer\u00eda como corrupci\u00f3n en el puntero de la lista libre y provocar\u00eda fallos. Despu\u00e9s de dividir el problema en dos, encontramos que el problema comenz\u00f3 desde la confirmaci\u00f3n e320d3012d25 (\"mm/page_alloc.c: corrige la liberaci\u00f3n de p\u00e1ginas no compuestas\"): if (put_page_testzero(page)) free_the_page(page, order); else if (!PageHead(p\u00e1gina)) while (orden-- \u0026gt; 0) free_the_page(p\u00e1gina + (1 \u0026lt;\u0026lt; orden), orden); Entonces, el problema es que la verificaci\u00f3n PageHead es picante porque en este punto ya eliminamos nuestra referencia a la p\u00e1gina. Entonces, incluso si ingresamos con una p\u00e1gina compuesta, la p\u00e1gina ya se puede liberar y PageHead puede devolver falso y terminaremos liberando todas las p\u00e1ginas finales causando un double free."
}
],
"id": "CVE-2023-52739",
"lastModified": "2026-08-04T10:18:39.070",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52739",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-09-10T15:37:31.888561Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:13.820",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-8J29-HRG8-7MVC
Vulnerability from github – Published: 2024-05-21 18:31 – Updated: 2025-09-23 21:30In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.
{
"affected": [],
"aliases": [
"CVE-2023-52739"
],
"database_specific": {
"cwe_ids": [
"CWE-415"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-05-21T16:15:13Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nFix page corruption caused by racy check in __free_pages\n\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\n\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\n\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\n\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\"mm/page_alloc.c: fix freeing non-compound pages\"):\n\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u003e 0)\n\t\t\tfree_the_page(page + (1 \u003c\u003c order), order);\n\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.",
"id": "GHSA-8j29-hrg8-7mvc",
"modified": "2025-09-23T21:30:53Z",
"published": "2024-05-21T18:31:19Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/0a626e27f984dfbe96bd8e4fd08f20a2ede3ea23"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3af734f3eac6f70ef8e272a80da40544b9d0f2b5"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3b4c045a98f53a8890a94bb5846a390c8e39e673"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/462a8e08e0e6287e5ce13187257edbf24213ed03"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1737 (CVE-2021-47366)
Vulnerability from osv_openeuler – Published: 2024-06-21 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
afs: Fix corruption in reads at fpos 2G-4G from an OpenAFS server
AFS-3 has two data fetch RPC variants, FS.FetchData and FS.FetchData64, and Linux's afs client switches between them when talking to a non-YFS server if the read size, the file position or the sum of the two have the upper 32 bits set of the 64-bit value.
This is a problem, however, since the file position and length fields of FS.FetchData are signed 32-bit values.
Fix this by capturing the capability bits obtained from the fileserver when it's sent an FS.GetCapabilities RPC, rather than just discarding them, and then picking out the VICED_CAPABILITY_64BITFILES flag. This can then be used to decide whether to use FS.FetchData or FS.FetchData64 - and also FS.StoreData or FS.StoreData64 - rather than using upper_32_bits() to switch on the parameter values.
This capabilities flag could also be used to limit the maximum size of the file, but all servers must be checked for that.
Note that the issue does not exist with FS.StoreData - that uses unsigned 32-bit values. It's also not a problem with Auristor servers as its YFS.FetchData64 op uses unsigned 64-bit values.
This can be tested by cloning a git repo through an OpenAFS client to an OpenAFS server and then doing "git status" on it from a Linux afs client1. Provided the clone has a pack file that's in the 2G-4G range, the git status will show errors like:
error: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index
error: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index
This can be observed in the server's FileLog with something like the following appearing:
Sun Aug 29 19:31:39 2021 SRXAFS_FetchData, Fid = 2303380852.491776.3263114, Host 192.168.11.201:7001, Id 1001 Sun Aug 29 19:31:39 2021 CheckRights: len=0, for host=192.168.11.201:7001 Sun Aug 29 19:31:39 2021 FetchData_RXStyle: Pos 18446744071815340032, Len 3154 Sun Aug 29 19:31:39 2021 FetchData_RXStyle: file size 2400758866 ... Sun Aug 29 19:31:40 2021 SRXAFS_FetchData returns 5
Note the file position of 18446744071815340032. This is the requested file position sign-extended.(CVE-2021-47366)
In the Linux kernel, the following vulnerability has been resolved:
net/smc: Fix possible access to freed memory in link clear
After modifying the QP to the Error state, all RX WR would be completed with WC in IB_WC_WR_FLUSH_ERR status. Current implementation does not wait for it is done, but destroy the QP and free the link group directly. So there is a risk that accessing the freed memory in tasklet context.
Here is a crash example:
BUG: unable to handle page fault for address: ffffffff8f220860 #PF: supervisor write access in kernel mode #PF: error_code(0x0002) - not-present page PGD f7300e067 P4D f7300e067 PUD f7300f063 PMD 8c4e45063 PTE 800ffff08c9df060 Oops: 0002 [#1] SMP PTI CPU: 1 PID: 0 Comm: swapper/1 Kdump: loaded Tainted: G S OE 5.10.0-0607+ #23 Hardware name: Inspur NF5280M4/YZMB-00689-101, BIOS 4.1.20 07/09/2018 RIP: 0010:native_queued_spin_lock_slowpath+0x176/0x1b0 Code: f3 90 48 8b 32 48 85 f6 74 f6 eb d5 c1 ee 12 83 e0 03 83 ee 01 48 c1 e0 05 48 63 f6 48 05 00 c8 02 00 48 03 04 f5 00 09 98 8e <48> 89 10 8b 42 08 85 c0 75 09 f3 90 8b 42 08 85 c0 74 f7 48 8b 32 RSP: 0018:ffffb3b6c001ebd8 EFLAGS: 00010086 RAX: ffffffff8f220860 RBX: 0000000000000246 RCX: 0000000000080000 RDX: ffff91db1f86c800 RSI: 000000000000173c RDI: ffff91db62bace00 RBP: ffff91db62bacc00 R08: 0000000000000000 R09: c00000010000028b R10: 0000000000055198 R11: ffffb3b6c001ea58 R12: ffff91db80e05010 R13: 000000000000000a R14: 0000000000000006 R15: 0000000000000040 FS: 0000000000000000(0000) GS:ffff91db1f840000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: ffffffff8f220860 CR3: 00000001f9580004 CR4: 00000000003706e0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <IRQ> _raw_spin_lock_irqsave+0x30/0x40 mlx5_ib_poll_cq+0x4c/0xc50 [mlx5_ib] smc_wr_rx_tasklet_fn+0x56/0xa0 [smc] tasklet_action_common.isra.21+0x66/0x100 __do_softirq+0xd5/0x29c asm_call_irq_on_stack+0x12/0x20 </IRQ> do_softirq_own_stack+0x37/0x40 irq_exit_rcu+0x9d/0xa0 sysvec_call_function_single+0x34/0x80 asm_sysvec_call_function_single+0x12/0x20(CVE-2022-48673)
In the Linux kernel, the following vulnerability has been resolved:
soc: brcmstb: pm-arm: Fix refcount leak and __iomem leak bugs
In brcmstb_pm_probe(), there are two kinds of leak bugs:
(1) we need to add of_node_put() when for_each__matching_node() breaks (2) we need to add iounmap() for each iomap in fail path(CVE-2022-48693)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
pipe: wakeup wr_wait after setting max_usage
Commit c73be61cede5 ("pipe: Add general notification queue support") a regression was introduced that would lock up resized pipes under certain conditions. See the reproducer in 1.
The commit resizing the pipe ring size was moved to a different function, doing that moved the wakeup for pipe->wr_wait before actually raising pipe->max_usage. If a pipe was full before the resize occured it would result in the wakeup never actually triggering pipe_write.
Set @max_usage and @nr_accounted before waking writers if this isn't a watch queue.
Christian Brauner <brauner@kernel.org>: rewrite to account for watch queues
In the Linux kernel, the following vulnerability has been resolved:
ACPI: video: check for error while searching for backlight device parent
If acpi_get_parent() called in acpi_video_dev_register_backlight() fails, for example, because acpi_ut_acquire_mutex() fails inside acpi_get_parent), this can lead to incorrect (uninitialized) acpi_parent handle being passed to acpi_get_pci_dev() for detecting the parent pci device.
Check acpi_get_parent() result and set parent device only in case of success.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2023-52693)
In the Linux kernel, the following vulnerability has been resolved:
mmc: mmc_spi: fix error handling in mmc_spi_probe()
If mmc_add_host() fails, it doesn't need to call mmc_remove_host(), or it will cause null-ptr-deref, because of deleting a not added device in mmc_remove_host().
To fix this, goto label 'fail_glue_init', if mmc_add_host() fails, and change the label 'fail_add_host' to 'fail_gpiod_request'.(CVE-2023-52708)
In the Linux kernel, the following vulnerability has been resolved:
ceph: blocklist the kclient when receiving corrupted snap trace
When received corrupted snap trace we don't know what exactly has happened in MDS side. And we shouldn't continue IOs and metadatas access to MDS, which may corrupt or get incorrect contents.
This patch will just block all the further IO/MDS requests immediately and then evict the kclient itself.
The reason why we still need to evict the kclient just after blocking all the further IOs is that the MDS could revoke the caps faster.(CVE-2023-52732)
In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)
In the Linux kernel, the following vulnerability has been resolved:
IB/hfi1: Restore allocated resources on failed copyout
Fix a resource leak if an error occurs.(CVE-2023-52747)
In the Linux kernel, the following vulnerability has been resolved:
virtio-blk: fix implicit overflow on virtio_max_dma_size
The following codes have an implicit conversion from size_t to u32: (u32)max_size = (size_t)virtio_max_dma_size(vdev);
This may lead overflow, Ex (size_t)4G -> (u32)0. Once virtio_max_dma_size() has a larger size than U32_MAX, use U32_MAX instead.(CVE-2023-52762)
In the Linux kernel, the following vulnerability has been resolved:
fs/jfs: Add check for negative db_l2nbperpage
l2nbperpage is log2(number of blks per page), and the minimum legal value should be 0, not negative.
In the case of l2nbperpage being negative, an error will occur when subsequently used as shift exponent.
Syzbot reported this bug:
UBSAN: shift-out-of-bounds in fs/jfs/jfs_dmap.c:799:12 shift exponent -16777216 is negative(CVE-2023-52810)
In the Linux kernel, the following vulnerability has been resolved:
drm/panel: fix a possible null pointer dereference
In versatile_panel_get_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a NULL pointer dereference on failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2023-52821)
In the Linux kernel, the following vulnerability has been resolved:
media: vidtv: mux: Add check and kfree for kstrdup
Add check for the return value of kstrdup() and return the error if it fails in order to avoid NULL pointer dereference. Moreover, use kfree() in the later error handling in order to avoid memory leak.(CVE-2023-52841)
In the Linux kernel, the following vulnerability has been resolved:
hsr: Prevent use after free in prp_create_tagged_frame()
The prp_fill_rct() function can fail. In that situation, it frees the skb and returns NULL. Meanwhile on the success path, it returns the original skb. So it's straight forward to fix bug by using the returned value.(CVE-2023-52846)
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change
While PLL CPUX clock rate change when CPU is running from it works in vast majority of cases, now and then it causes instability. This leads to system crashes and other undefined behaviour. After a lot of testing (30+ hours) while also doing a lot of frequency switches, we can't observe any instability issues anymore when doing reparenting to stable clock like 24 MHz oscillator.(CVE-2023-52882)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: validate request buffer size in smb2_allocate_rsp_buf()
The response buffer should be allocated in smb2_allocate_rsp_buf before validating request. But the fields in payload as well as smb2 header is used in smb2_allocate_rsp_buf(). This patch add simple buffer size validation to avoid potencial out-of-bounds in request buffer.(CVE-2024-26936)
In the Linux kernel, the following vulnerability has been resolved:
ARM: 9359/1: flush: check if the folio is reserved for no-mapping addresses
Since commit a4d5613c4dc6 ("arm: extend pfn_valid to take into account freed memory map alignment") changes the semantics of pfn_valid() to check presence of the memory map for a PFN. A valid page for an address which is reserved but not mapped by the kernel1, the system crashed during some uio test with the following memory layout:
node 0: [mem 0x00000000c0a00000-0x00000000cc8fffff] node 0: [mem 0x00000000d0000000-0x00000000da1fffff] the uio layout is:0xc0900000, 0x100000
the crash backtrace like:
Unable to handle kernel paging request at virtual address bff00000 [...] CPU: 1 PID: 465 Comm: startapp.bin Tainted: G O 5.10.0 #1 Hardware name: Generic DT based system PC is at b15_flush_kern_dcache_area+0x24/0x3c LR is at __sync_icache_dcache+0x6c/0x98 [...] (b15_flush_kern_dcache_area) from (__sync_icache_dcache+0x6c/0x98) (__sync_icache_dcache) from (set_pte_at+0x28/0x54) (set_pte_at) from (remap_pfn_range+0x1a0/0x274) (remap_pfn_range) from (uio_mmap+0x184/0x1b8 [uio]) (uio_mmap [uio]) from (__mmap_region+0x264/0x5f4) (__mmap_region) from (__do_mmap_mm+0x3ec/0x440) (__do_mmap_mm) from (do_mmap+0x50/0x58) (do_mmap) from (vm_mmap_pgoff+0xfc/0x188) (vm_mmap_pgoff) from (ksys_mmap_pgoff+0xac/0xc4) (ksys_mmap_pgoff) from (ret_fast_syscall+0x0/0x5c) Code: e0801001 e2423001 e1c00003 f57ff04f (ee070f3e) ---[ end trace 09cf0734c3805d52 ]--- Kernel panic - not syncing: Fatal exception
So check if PG_reserved was set to solve this issue.
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix slab-out-of-bounds in smb_strndup_from_utf16()
If ->NameOffset of smb2_create_req is smaller than Buffer offset of smb2_create_req, slab-out-of-bounds read can happen from smb2_open. This patch set the minimum value of the name offset to the buffer offset to validate name length of smb2_create_req().(CVE-2024-26954)
In the Linux kernel, the following vulnerability has been resolved:
mm: swap: fix race between free_swap_and_cache() and swapoff()
There was previously a theoretical window where swapoff() could run and teardown a swap_info_struct while a call to free_swap_and_cache() was running in another thread. This could cause, amongst other bad possibilities, swap_page_trans_huge_swapped() (called by free_swap_and_cache()) to access the freed memory for swap_map.
This is a theoretical problem and I haven't been able to provoke it from a test case. But there has been agreement based on code review that this is possible (see link below).
Fix it by using get_swap_device()/put_swap_device(), which will stall swapoff(). There was an extra check in _swap_info_get() to confirm that the swap entry was not free. This isn't present in get_swap_device() because it doesn't make sense in general due to the race between getting the reference and swapoff. So I've added an equivalent check directly in free_swap_and_cache().
Details of how to provoke one possible issue (thanks to David Hildenbrand for deriving this):
--8<-----
__swap_entry_free() might be the last user and result in "count == SWAP_HAS_CACHE".
swapoff->try_to_unuse() will stop as soon as soon as si->inuse_pages==0.
So the question is: could someone reclaim the folio and turn si->inuse_pages==0, before we completed swap_page_trans_huge_swapped().
Imagine the following: 2 MiB folio in the swapcache. Only 2 subpages are still references by swap entries.
Process 1 still references subpage 0 via swap entry. Process 2 still references subpage 1 via swap entry.
Process 1 quits. Calls free_swap_and_cache(). -> count == SWAP_HAS_CACHE [then, preempted in the hypervisor etc.]
Process 2 quits. Calls free_swap_and_cache(). -> count == SWAP_HAS_CACHE
Process 2 goes ahead, passes swap_page_trans_huge_swapped(), and calls __try_to_reclaim_swap().
__try_to_reclaim_swap()->folio_free_swap()->delete_from_swap_cache()-> put_swap_folio()->free_swap_slot()->swapcache_free_entries()-> swap_entry_free()->swap_range_free()-> ... WRITE_ONCE(si->inuse_pages, si->inuse_pages - nr_entries);
What stops swapoff to succeed after process 2 reclaimed the swap cache but before process1 finished its call to swap_page_trans_huge_swapped()?
--8<-----(CVE-2024-26960)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Prevent deadlock while disabling aRFS
When disabling aRFS under the priv->state_lock, any scheduled
aRFS works are canceled using the cancel_work_sync function,
which waits for the work to end if it has already started.
However, while waiting for the work handler, the handler will
try to acquire the state_lock which is already acquired.
The worker acquires the lock to delete the rules if the state is down, which is not the worker's responsibility since disabling aRFS deletes the rules.
Add an aRFS state variable, which indicates whether the aRFS is enabled and prevent adding rules when the aRFS is disabled.
Kernel log:
====================================================== WARNING: possible circular locking dependency detected 6.7.0-rc4_net_next_mlx5_5483eb2 #1 Tainted: G I
ethtool/386089 is trying to acquire lock: ffff88810f21ce68 ((work_completion)(&rule->arfs_work)){+.+.}-{0:0}, at: __flush_work+0x74/0x4e0
but task is already holding lock: ffff8884a1808cc0 (&priv->state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]
which lock already depends on the new lock.
the existing dependency chain (in reverse order) is:
-> #1 (&priv->state_lock){+.+.}-{3:3}: __mutex_lock+0x80/0xc90 arfs_handle_work+0x4b/0x3b0 [mlx5_core] process_one_work+0x1dc/0x4a0 worker_thread+0x1bf/0x3c0 kthread+0xd7/0x100 ret_from_fork+0x2d/0x50 ret_from_fork_asm+0x11/0x20
-> #0 ((work_completion)(&rule->arfs_work)){+.+.}-{0:0}: __lock_acquire+0x17b4/0x2c80 lock_acquire+0xd0/0x2b0 __flush_work+0x7a/0x4e0 __cancel_work_timer+0x131/0x1c0 arfs_del_rules+0x143/0x1e0 [mlx5_core] mlx5e_arfs_disable+0x1b/0x30 [mlx5_core] mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core] ethnl_set_channels+0x28f/0x3b0 ethnl_default_set_doit+0xec/0x240 genl_family_rcv_msg_doit+0xd0/0x120 genl_rcv_msg+0x188/0x2c0 netlink_rcv_skb+0x54/0x100 genl_rcv+0x24/0x40 netlink_unicast+0x1a1/0x270 netlink_sendmsg+0x214/0x460 __sock_sendmsg+0x38/0x60 __sys_sendto+0x113/0x170 __x64_sys_sendto+0x20/0x30 do_syscall_64+0x40/0xe0 entry_SYSCALL_64_after_hwframe+0x46/0x4e
other info that might help us debug this:
Possible unsafe locking scenario:
CPU0 CPU1
---- ----
lock(&priv->state_lock); lock((work_completion)(&rule->arfs_work)); lock(&priv->state_lock); lock((work_completion)(&rule->arfs_work));
*** DEADLOCK ***
3 locks held by ethtool/386089: #0: ffffffff82ea7210 (cb_lock){++++}-{3:3}, at: genl_rcv+0x15/0x40 #1: ffffffff82e94c88 (rtnl_mutex){+.+.}-{3:3}, at: ethnl_default_set_doit+0xd3/0x240 #2: ffff8884a1808cc0 (&priv->state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]
stack backtrace: CPU: 15 PID: 386089 Comm: ethtool Tainted: G I 6.7.0-rc4_net_next_mlx5_5483eb2 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 Call Trace: <TASK> dump_stack_lvl+0x60/0xa0 check_noncircular+0x144/0x160 __lock_acquire+0x17b4/0x2c80 lock_acquire+0xd0/0x2b0 ? __flush_work+0x74/0x4e0 ? save_trace+0x3e/0x360 ? __flush_work+0x74/0x4e0 __flush_work+0x7a/0x4e0 ? __flush_work+0x74/0x4e0 ? __lock_acquire+0xa78/0x2c80 ? lock_acquire+0xd0/0x2b0 ? mark_held_locks+0x49/0x70 __cancel_work_timer+0x131/0x1c0 ? mark_held_locks+0x49/0x70 arfs_del_rules+0x143/0x1e0 [mlx5_core] mlx5e_arfs_disable+0x1b/0x30 [mlx5_core] mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core] ethnl_set_channels+0x28f/0x3b0 ethnl_default_set_doit+0xec/0x240 genl_family_rcv_msg_doit+0xd0/0x120 genl_rcv_msg+0x188/0x2c0 ? ethn ---truncated---(CVE-2024-27014)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: Fix potential data-race in __nft_obj_type_get()
nft_unregister_obj() can concurrent with __nft_obj_type_get(), and there is not any protection when iterate over nf_tables_objects list in __nft_obj_type_get(). Therefore, there is potential data-race of nf_tables_objects list entry.
Use list_for_each_entry_rcu() to iterate over nf_tables_objects list in __nft_obj_type_get(), and use rcu_read_lock() in the caller nft_obj_type_get() to protect the entire type query process.(CVE-2024-27019)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential NULL pointer dereferences in 'dcn10_set_output_transfer_func()'
The 'stream' pointer is used in dcn10_set_output_transfer_func() before the check if 'stream' is NULL.
Fixes the below: drivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn10/dcn10_hwseq.c:1892 dcn10_set_output_transfer_func() warn: variable dereferenced before check 'stream' (see line 1875)(CVE-2024-27044)
In the Linux kernel, the following vulnerability has been resolved:
net: ll_temac: platform_get_resource replaced by wrong function
The function platform_get_resource was replaced with devm_platform_ioremap_resource_byname and is called using 0 as name.
This eventually ends up in platform_get_resource_byname in the call stack, where it causes a null pointer in strcmp.
if (type == resource_type(r) && !strcmp(r->name, name))
It should have been replaced with devm_platform_ioremap_resource.(CVE-2024-35796)
In the Linux kernel, the following vulnerability has been resolved:
fs/aio: Check IOCB_AIO_RW before the struct aio_kiocb conversion
The first kiocb_set_cancel_fn() argument may point at a struct kiocb that is not embedded inside struct aio_kiocb. With the current code, depending on the compiler, the req->ki_ctx read happens either before the IOCB_AIO_RW test or after that test. Move the req->ki_ctx read such that it is guaranteed that the IOCB_AIO_RW test happens first.(CVE-2024-35815)
In the Linux kernel, the following vulnerability has been resolved:
soc: fsl: qbman: Use raw spinlock for cgr_lock
smp_call_function always runs its callback in hard IRQ context, even on PREEMPT_RT, where spinlocks can sleep. So we need to use a raw spinlock for cgr_lock to ensure we aren't waiting on a sleeping task.
Although this bug has existed for a while, it was not apparent until commit ef2a8d5478b9 ("net: dpaa: Adjust queue depth on rate change") which invokes smp_call_function_single via qman_update_cgr_safe every time a link goes up or down.(CVE-2024-35819)
In the Linux kernel, the following vulnerability has been resolved:
wifi: libertas: fix some memleaks in lbs_allocate_cmd_buffer()
In the for statement of lbs_allocate_cmd_buffer(), if the allocation of cmdarray[i].cmdbuf fails, both cmdarray and cmdarray[i].cmdbuf needs to be freed. Otherwise, there will be memleaks in lbs_allocate_cmd_buffer().(CVE-2024-35828)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: bridge: replace physindev with physinif in nf_bridge_info
An skb can be added to a neigh->arp_queue while waiting for an arp reply. Where original skb's skb->dev can be different to neigh's neigh->dev. For instance in case of bridging dnated skb from one veth to another, the skb would be added to a neigh->arp_queue of the bridge.
As skb->dev can be reset back to nf_bridge->physindev and used, and as there is no explicit mechanism that prevents this physindev from been freed under us (for instance neigh_flush_dev doesn't cleanup skbs from different device's neigh queue) we can crash on e.g. this stack:
arp_process neigh_update skb = __skb_dequeue(&neigh->arp_queue) neigh_resolve_output(..., skb) ... br_nf_dev_xmit br_nf_pre_routing_finish_bridge_slow skb->dev = nf_bridge->physindev br_handle_frame_finish
Let's use plain ifindex instead of net_device link. To peek into the original net_device we will use dev_get_by_index_rcu(). Thus either we get device and are safe to use it or we don't get it and drop skb.(CVE-2024-35839)
In the Linux kernel, the following vulnerability has been resolved:
smb: client: fix UAF in smb2_reconnect_server()
The UAF bug is due to smb2_reconnect_server() accessing a session that is already being teared down by another thread that is executing __cifs_put_smb_ses(). This can happen when (a) the client has connection to the server but no session or (b) another thread ends up setting @ses->ses_status again to something different than SES_EXITING.
To fix this, we need to make sure to unconditionally set @ses->ses_status to SES_EXITING and prevent any other threads from setting a new status while we're still tearing it down.
The following can be reproduced by adding some delay to right after the ipc is freed in __cifs_put_smb_ses() - which will give smb2_reconnect_server() worker a chance to run and then accessing @ses->ipc:
kinit ... mount.cifs //srv/share /mnt/1 -o sec=krb5,nohandlecache,echo_interval=10 [disconnect srv] ls /mnt/1 &>/dev/null sleep 30 kdestroy [reconnect srv] sleep 10 umount /mnt/1 ... CIFS: VFS: Verify user has a krb5 ticket and keyutils is installed CIFS: VFS: \srv Send error in SessSetup = -126 CIFS: VFS: Verify user has a krb5 ticket and keyutils is installed CIFS: VFS: \srv Send error in SessSetup = -126 general protection fault, probably for non-canonical address 0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI CPU: 3 PID: 50 Comm: kworker/3:1 Not tainted 6.9.0-rc2 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-1.fc39 04/01/2014 Workqueue: cifsiod smb2_reconnect_server [cifs] RIP: 0010:__list_del_entry_valid_or_report+0x33/0xf0 Code: 4f 08 48 85 d2 74 42 48 85 c9 74 59 48 b8 00 01 00 00 00 00 ad de 48 39 c2 74 61 48 b8 22 01 00 00 00 00 74 69 <48> 8b 01 48 39 f8 75 7b 48 8b 72 08 48 39 c6 0f 85 88 00 00 00 b8 RSP: 0018:ffffc900001bfd70 EFLAGS: 00010a83 RAX: dead000000000122 RBX: ffff88810da53838 RCX: 6b6b6b6b6b6b6b6b RDX: 6b6b6b6b6b6b6b6b RSI: ffffffffc02f6878 RDI: ffff88810da53800 RBP: ffff88810da53800 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000001 R12: ffff88810c064000 R13: 0000000000000001 R14: ffff88810c064000 R15: ffff8881039cc000 FS: 0000000000000000(0000) GS:ffff888157c00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fe3728b1000 CR3: 000000010caa4000 CR4: 0000000000750ef0 PKRU: 55555554 Call Trace: <TASK> ? die_addr+0x36/0x90 ? exc_general_protection+0x1c1/0x3f0 ? asm_exc_general_protection+0x26/0x30 ? __list_del_entry_valid_or_report+0x33/0xf0 __cifs_put_smb_ses+0x1ae/0x500 [cifs] smb2_reconnect_server+0x4ed/0x710 [cifs] process_one_work+0x205/0x6b0 worker_thread+0x191/0x360 ? __pfx_worker_thread+0x10/0x10 kthread+0xe2/0x110 ? __pfx_kthread+0x10/0x10 ret_from_fork+0x34/0x50 ? __pfx_kthread+0x10/0x10 ret_from_fork_asm+0x1a/0x30 </TASK>(CVE-2024-35870)
In the Linux kernel, the following vulnerability has been resolved:
ax25: fix use-after-free bugs caused by ax25_ds_del_timer
When the ax25 device is detaching, the ax25_dev_device_down() calls ax25_ds_del_timer() to cleanup the slave_timer. When the timer handler is running, the ax25_ds_del_timer() that calls del_timer() in it will return directly. As a result, the use-after-free bugs could happen, one of the scenarios is shown below:
(Thread 1) | (Thread 2)
| ax25_ds_timeout()
ax25_dev_device_down() | ax25_ds_del_timer() | del_timer() | ax25_dev_put() //FREE | | ax25_dev-> //USE
In order to mitigate bugs, when the device is detaching, use timer_shutdown_sync() to stop the timer.(CVE-2024-35887)
In the Linux kernel, the following vulnerability has been resolved:
tcp: properly terminate timers for kernel sockets
We had various syzbot reports about tcp timers firing after the corresponding netns has been dismantled.
Fortunately Josef Bacik could trigger the issue more often, and could test a patch I wrote two years ago.
When TCP sockets are closed, we call inet_csk_clear_xmit_timers() to 'stop' the timers.
inet_csk_clear_xmit_timers() can be called from any context, including when socket lock is held. This is the reason it uses sk_stop_timer(), aka del_timer(). This means that ongoing timers might finish much later.
For user sockets, this is fine because each running timer holds a reference on the socket, and the user socket holds a reference on the netns.
For kernel sockets, we risk that the netns is freed before timer can complete, because kernel sockets do not hold reference on the netns.
This patch adds inet_csk_clear_xmit_timers_sync() function that using sk_stop_timer_sync() to make sure all timers are terminated before the kernel socket is released. Modules using kernel sockets close them in their netns exit() handler.
Also add sock_not_owned_by_me() helper to get LOCKDEP support : inet_csk_clear_xmit_timers_sync() must not be called while socket lock is held.
It is very possible we can revert in the future commit 3a58f13a881e ("net: rds: acquire refcount on TCP sockets") which attempted to solve the issue in rds only. (net/smc/af_smc.c and net/mptcp/subflow.c have similar code)
We probably can remove the check_net() tests from tcp_out_of_resources() and __tcp_close() in the future.(CVE-2024-35910)
In the Linux kernel, the following vulnerability has been resolved:
drm/vc4: don't check if plane->state->fb == state->fb
Currently, when using non-blocking commits, we can see the following kernel warning:
[ 110.908514] ------------[ cut here ]------------ [ 110.908529] refcount_t: underflow; use-after-free. [ 110.908620] WARNING: CPU: 0 PID: 1866 at lib/refcount.c:87 refcount_dec_not_one+0xb8/0xc0 [ 110.908664] Modules linked in: rfcomm snd_seq_dummy snd_hrtimer snd_seq snd_seq_device cmac algif_hash aes_arm64 aes_generic algif_skcipher af_alg bnep hid_logitech_hidpp vc4 brcmfmac hci_uart btbcm brcmutil bluetooth snd_soc_hdmi_codec cfg80211 cec drm_display_helper drm_dma_helper drm_kms_helper snd_soc_core snd_compress snd_pcm_dmaengine fb_sys_fops sysimgblt syscopyarea sysfillrect raspberrypi_hwmon ecdh_generic ecc rfkill libaes i2c_bcm2835 binfmt_misc joydev snd_bcm2835(C) bcm2835_codec(C) bcm2835_isp(C) v4l2_mem2mem videobuf2_dma_contig snd_pcm bcm2835_v4l2(C) raspberrypi_gpiomem bcm2835_mmal_vchiq(C) videobuf2_v4l2 snd_timer videobuf2_vmalloc videobuf2_memops videobuf2_common snd videodev vc_sm_cma(C) mc hid_logitech_dj uio_pdrv_genirq uio i2c_dev drm fuse dm_mod drm_panel_orientation_quirks backlight ip_tables x_tables ipv6 [ 110.909086] CPU: 0 PID: 1866 Comm: kodi.bin Tainted: G C 6.1.66-v8+ #32 [ 110.909104] Hardware name: Raspberry Pi 3 Model B Rev 1.2 (DT) [ 110.909114] pstate: 60000005 (nZCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) [ 110.909132] pc : refcount_dec_not_one+0xb8/0xc0 [ 110.909152] lr : refcount_dec_not_one+0xb4/0xc0 [ 110.909170] sp : ffffffc00913b9c0 [ 110.909177] x29: ffffffc00913b9c0 x28: 000000556969bbb0 x27: 000000556990df60 [ 110.909205] x26: 0000000000000002 x25: 0000000000000004 x24: ffffff8004448480 [ 110.909230] x23: ffffff800570b500 x22: ffffff802e03a7bc x21: ffffffecfca68c78 [ 110.909257] x20: ffffff8002b42000 x19: ffffff802e03a600 x18: 0000000000000000 [ 110.909283] x17: 0000000000000011 x16: ffffffffffffffff x15: 0000000000000004 [ 110.909308] x14: 0000000000000fff x13: ffffffed577e47e0 x12: 0000000000000003 [ 110.909333] x11: 0000000000000000 x10: 0000000000000027 x9 : c912d0d083728c00 [ 110.909359] x8 : c912d0d083728c00 x7 : 65646e75203a745f x6 : 746e756f63666572 [ 110.909384] x5 : ffffffed579f62ee x4 : ffffffed579eb01e x3 : 0000000000000000 [ 110.909409] x2 : 0000000000000000 x1 : ffffffc00913b750 x0 : 0000000000000001 [ 110.909434] Call trace: [ 110.909441] refcount_dec_not_one+0xb8/0xc0 [ 110.909461] vc4_bo_dec_usecnt+0x4c/0x1b0 [vc4] [ 110.909903] vc4_cleanup_fb+0x44/0x50 [vc4] [ 110.910315] drm_atomic_helper_cleanup_planes+0x88/0xa4 [drm_kms_helper] [ 110.910669] vc4_atomic_commit_tail+0x390/0x9dc [vc4] [ 110.911079] commit_tail+0xb0/0x164 [drm_kms_helper] [ 110.911397] drm_atomic_helper_commit+0x1d0/0x1f0 [drm_kms_helper] [ 110.911716] drm_atomic_commit+0xb0/0xdc [drm] [ 110.912569] drm_mode_atomic_ioctl+0x348/0x4b8 [drm] [ 110.913330] drm_ioctl_kernel+0xec/0x15c [drm] [ 110.914091] drm_ioctl+0x24c/0x3b0 [drm] [ 110.914850] __arm64_sys_ioctl+0x9c/0xd4 [ 110.914873] invoke_syscall+0x4c/0x114 [ 110.914897] el0_svc_common+0xd0/0x118 [ 110.914917] do_el0_svc+0x38/0xd0 [ 110.914936] el0_svc+0x30/0x8c [ 110.914958] el0t_64_sync_handler+0x84/0xf0 [ 110.914979] el0t_64_sync+0x18c/0x190 [ 110.914996] ---[ end trace 0000000000000000 ]---
This happens because, although prepare_fb and cleanup_fb are
perfectly balanced, we cannot guarantee consistency in the check
plane->state->fb == state->fb. This means that sometimes we can increase
the refcount in prepare_fb and don't decrease it in cleanup_fb. The
opposite can also be true.
In fact, the struct drm_plane .state shouldn't be accessed directly
but instead, the drm_atomic_get_new_plane_state() helper function should
be used. So, we could stick to this check, but using
drm_atomic_get_new_plane_state(). But actually, this check is not re
---truncated---(CVE-2024-35932)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: send: handle path ref underflow in header iterate_inode_ref()
Change BUG_ON to proper error handling if building the path buffer fails. The pointers are not printed so we don't accidentally leak kernel addresses.(CVE-2024-35935)
In the Linux kernel, the following vulnerability has been resolved:
wifi: cfg80211: check A-MSDU format more carefully
If it looks like there's another subframe in the A-MSDU but the header isn't fully there, we can end up reading data out of bounds, only to discard later. Make this a bit more careful and check if the subframe header can even be present.(CVE-2024-35937)
In the Linux kernel, the following vulnerability has been resolved:
drm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()
Subject: [PATCH] drm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()
If some the pages or sgt allocation failed, we shouldn't release the pages ref we got earlier, otherwise we will end up with unbalanced get/put_pages() calls. We should instead leave everything in place and let the BO release function deal with extra cleanup when the object is destroyed, or let the fault handler try again next time it's called.(CVE-2024-35951)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix not validating setsockopt user input
Check user input length before copying data.(CVE-2024-35965)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: RFCOMM: Fix not validating setsockopt user input
syzbot reported rfcomm_sock_setsockopt_old() is copying data without checking user input length.
BUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset include/linux/sockptr.h:49 [inline] BUG: KASAN: slab-out-of-bounds in copy_from_sockptr include/linux/sockptr.h:55 [inline] BUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt_old net/bluetooth/rfcomm/sock.c:632 [inline] BUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt+0x893/0xa70 net/bluetooth/rfcomm/sock.c:673 Read of size 4 at addr ffff8880209a8bc3 by task syz-executor632/5064(CVE-2024-35966)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: Avoid infinite loop trying to resize local TT
If the MTU of one of an attached interface becomes too small to transmit the local translation table then it must be resized to fit inside all fragments (when enabled) or a single packet.
But if the MTU becomes too low to transmit even the header + the VLAN specific part then the resizing of the local TT will never succeed. This can for example happen when the usable space is 110 bytes and 11 VLANs are on top of batman-adv. In this case, at least 116 byte would be needed. There will just be an endless spam of
batman_adv: batadv0: Forced to purge local tt entries to fit new maximum fragment MTU (110)
in the log but the function will never finish. Problem here is that the timeout will be halved all the time and will then stagnate at 0 and therefore never be able to reduce the table even more.
There are other scenarios possible with a similar result. The number of BATADV_TT_CLIENT_NOPURGE entries in the local TT can for example be too high to fit inside a packet. Such a scenario can therefore happen also with only a single VLAN + 7 non-purgable addresses - requiring at least 120 bytes.
While this should be handled proactively when:
- interface with too low MTU is added
- VLAN is added
- non-purgeable local mac is added
- MTU of an attached interface is reduced
- fragmentation setting gets disabled (which most likely requires dropping attached interfaces)
not all of these scenarios can be prevented because batman-adv is only consuming events without the the possibility to prevent these actions (non-purgable MAC address added, MTU of an attached interface is reduced). It is therefore necessary to also make sure that the code is able to handle also the situations when there were already incompatible system configuration are present.(CVE-2024-35982)
In the Linux kernel, the following vulnerability has been resolved:
tty: n_gsm: fix possible out-of-bounds in gsm0_receive()
Assuming the following: - side A configures the n_gsm in basic option mode - side B sends the header of a basic option mode frame with data length 1 - side A switches to advanced option mode - side B sends 2 data bytes which exceeds gsm->len Reason: gsm->len is not used in advanced option mode. - side A switches to basic option mode - side B keeps sending until gsm0_receive() writes past gsm->buf Reason: Neither gsm->state nor gsm->len have been reset after reconfiguration.
Fix this by changing gsm->count to gsm->len comparison from equal to less than. Also add upper limit checks against the constant MAX_MRU in gsm0_receive() and gsm1_receive() to harden against memory corruption of gsm->len and gsm->mru.
All other checks remain as we still need to limit the data according to the user configuration and actual payload size.(CVE-2024-36016)
In the Linux kernel, the following vulnerability has been resolved:
blk-iocost: avoid out of bounds shift
UBSAN catches undefined behavior in blk-iocost, where sometimes iocg->delay is shifted right by a number that is too large, resulting in undefined behavior on some architectures.
[ 186.556576] ------------[ cut here ]------------ UBSAN: shift-out-of-bounds in block/blk-iocost.c:1366:23 shift exponent 64 is too large for 64-bit type 'u64' (aka 'unsigned long long') CPU: 16 PID: 0 Comm: swapper/16 Tainted: G S E N 6.9.0-0_fbk700_debug_rc2_kbuilder_0_gc85af715cac0 #1 Hardware name: Quanta Twin Lakes MP/Twin Lakes Passive MP, BIOS F09_3A23 12/08/2020 Call Trace: <IRQ> dump_stack_lvl+0x8f/0xe0 __ubsan_handle_shift_out_of_bounds+0x22c/0x280 iocg_kick_delay+0x30b/0x310 ioc_timer_fn+0x2fb/0x1f80 __run_timer_base+0x1b6/0x250 ...
Avoid that undefined behavior by simply taking the "delay = 0" branch if the shift is too large.
I am not sure what the symptoms of an undefined value delay will be, but I suspect it could be more than a little annoying to debug.(CVE-2024-36916)
In the Linux kernel, the following vulnerability has been resolved:
block: fix overflow in blk_ioctl_discard()
There is no check for overflow of 'start + len' in blk_ioctl_discard(). Hung task occurs if submit an discard ioctl with the following param: start = 0x80000000000ff000, len = 0x8000000000fff000; Add the overflow validation now.(CVE-2024-36917)
In the Linux kernel, the following vulnerability has been resolved:
scsi: bnx2fc: Remove spin_lock_bh while releasing resources after upload
The session resources are used by FW and driver when session is offloaded, once session is uploaded these resources are not used. The lock is not required as these fields won't be used any longer. The offload and upload calls are sequential, hence lock is not required.
This will suppress following BUG_ON():
[ 449.843143] ------------[ cut here ]------------ [ 449.848302] kernel BUG at mm/vmalloc.c:2727! [ 449.853072] invalid opcode: 0000 [#1] PREEMPT SMP PTI [ 449.858712] CPU: 5 PID: 1996 Comm: kworker/u24:2 Not tainted 5.14.0-118.el9.x86_64 #1 Rebooting. [ 449.867454] Hardware name: Dell Inc. PowerEdge R730/0WCJNT, BIOS 2.3.4 11/08/2016 [ 449.876966] Workqueue: fc_rport_eq fc_rport_work [libfc] [ 449.882910] RIP: 0010:vunmap+0x2e/0x30 [ 449.887098] Code: 00 65 8b 05 14 a2 f0 4a a9 00 ff ff 00 75 1b 55 48 89 fd e8 34 36 79 00 48 85 ed 74 0b 48 89 ef 31 f6 5d e9 14 fc ff ff 5d c3 <0f> 0b 0f 1f 44 00 00 41 57 41 56 49 89 ce 41 55 49 89 fd 41 54 41 [ 449.908054] RSP: 0018:ffffb83d878b3d68 EFLAGS: 00010206 [ 449.913887] RAX: 0000000080000201 RBX: ffff8f4355133550 RCX: 000000000d400005 [ 449.921843] RDX: 0000000000000001 RSI: 0000000000001000 RDI: ffffb83da53f5000 [ 449.929808] RBP: ffff8f4ac6675800 R08: ffffb83d878b3d30 R09: 00000000000efbdf [ 449.937774] R10: 0000000000000003 R11: ffff8f434573e000 R12: 0000000000001000 [ 449.945736] R13: 0000000000001000 R14: ffffb83da53f5000 R15: ffff8f43d4ea3ae0 [ 449.953701] FS: 0000000000000000(0000) GS:ffff8f529fc80000(0000) knlGS:0000000000000000 [ 449.962732] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 449.969138] CR2: 00007f8cf993e150 CR3: 0000000efbe10003 CR4: 00000000003706e0 [ 449.977102] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 449.985065] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 449.993028] Call Trace: [ 449.995756] __iommu_dma_free+0x96/0x100 [ 450.000139] bnx2fc_free_session_resc+0x67/0x240 [bnx2fc] [ 450.006171] bnx2fc_upload_session+0xce/0x100 [bnx2fc] [ 450.011910] bnx2fc_rport_event_handler+0x9f/0x240 [bnx2fc] [ 450.018136] fc_rport_work+0x103/0x5b0 [libfc] [ 450.023103] process_one_work+0x1e8/0x3c0 [ 450.027581] worker_thread+0x50/0x3b0 [ 450.031669] ? rescuer_thread+0x370/0x370 [ 450.036143] kthread+0x149/0x170 [ 450.039744] ? set_kthread_struct+0x40/0x40 [ 450.044411] ret_from_fork+0x22/0x30 [ 450.048404] Modules linked in: vfat msdos fat xfs nfs_layout_nfsv41_files rpcsec_gss_krb5 auth_rpcgss nfsv4 dns_resolver dm_service_time qedf qed crc8 bnx2fc libfcoe libfc scsi_transport_fc intel_rapl_msr intel_rapl_common x86_pkg_temp_thermal intel_powerclamp dcdbas rapl intel_cstate intel_uncore mei_me pcspkr mei ipmi_ssif lpc_ich ipmi_si fuse zram ext4 mbcache jbd2 loop nfsv3 nfs_acl nfs lockd grace fscache netfs irdma ice sd_mod t10_pi sg ib_uverbs ib_core 8021q garp mrp stp llc mgag200 i2c_algo_bit drm_kms_helper syscopyarea sysfillrect sysimgblt mxm_wmi fb_sys_fops cec crct10dif_pclmul ahci crc32_pclmul bnx2x drm ghash_clmulni_intel libahci rfkill i40e libata megaraid_sas mdio wmi sunrpc lrw dm_crypt dm_round_robin dm_multipath dm_snapshot dm_bufio dm_mirror dm_region_hash dm_log dm_zero dm_mod linear raid10 raid456 async_raid6_recov async_memcpy async_pq async_xor async_tx raid6_pq libcrc32c crc32c_intel raid1 raid0 iscsi_ibft squashfs be2iscsi bnx2i cnic uio cxgb4i cxgb4 tls [ 450.048497] libcxgbi libcxgb qla4xxx iscsi_boot_sysfs iscsi_tcp libiscsi_tcp libiscsi scsi_transport_iscsi edd ipmi_devintf ipmi_msghandler [ 450.159753] ---[ end trace 712de2c57c64abc8 ]---(CVE-2024-36919)
In the Linux kernel, the following vulnerability has been resolved:
s390/qeth: Fix kernel panic after setting hsuid
Symptom: When the hsuid attribute is set for the first time on an IQD Layer3 device while the corresponding network interface is already UP, the kernel will try to execute a napi function pointer that is NULL.
Example:
[ 2057.572696] illegal operation: 0001 ilc:1 [#1] SMP [ 2057.572702] Modules linked in: af_iucv qeth_l3 zfcp scsi_transport_fc sunrpc nft_fib_inet nft_fib_ipv4 nft_fib_ipv6 nft_fib nft_reject_inet nf_reject_ipv4 nf_reject_ipv6 nft_reject nft_ct nf_tables_set nft_chain_nat nf_nat nf_conntrack nf_defrag_ipv6 nf_defrag_ipv4 ip_set nf_tables libcrc32c nfnetlink ghash_s390 prng xts aes_s390 des_s390 de s_generic sha3_512_s390 sha3_256_s390 sha512_s390 vfio_ccw vfio_mdev mdev vfio_iommu_type1 eadm_sch vfio ext4 mbcache jbd2 qeth_l2 bridge stp llc dasd_eckd_mod qeth dasd_mod qdio ccwgroup pkey zcrypt [ 2057.572739] CPU: 6 PID: 60182 Comm: stress_client Kdump: loaded Not tainted 4.18.0-541.el8.s390x #1 [ 2057.572742] Hardware name: IBM 3931 A01 704 (LPAR) [ 2057.572744] Krnl PSW : 0704f00180000000 0000000000000002 (0x2) [ 2057.572748] R:0 T:1 IO:1 EX:1 Key:0 M:1 W:0 P:0 AS:3 CC:3 PM:0 RI:0 EA:3 [ 2057.572751] Krnl GPRS: 0000000000000004 0000000000000000 00000000a3b008d8 0000000000000000 [ 2057.572754] 00000000a3b008d8 cb923a29c779abc5 0000000000000000 00000000814cfd80 [ 2057.572756] 000000000000012c 0000000000000000 00000000a3b008d8 00000000a3b008d8 [ 2057.572758] 00000000bab6d500 00000000814cfd80 0000000091317e46 00000000814cfc68 [ 2057.572762] Krnl Code:#0000000000000000: 0000 illegal >0000000000000002: 0000 illegal 0000000000000004: 0000 illegal 0000000000000006: 0000 illegal 0000000000000008: 0000 illegal 000000000000000a: 0000 illegal 000000000000000c: 0000 illegal 000000000000000e: 0000 illegal [ 2057.572800] Call Trace: [ 2057.572801] ([<00000000ec639700>] 0xec639700) [ 2057.572803] [<00000000913183e2>] net_rx_action+0x2ba/0x398 [ 2057.572809] [<0000000091515f76>] __do_softirq+0x11e/0x3a0 [ 2057.572813] [<0000000090ce160c>] do_softirq_own_stack+0x3c/0x58 [ 2057.572817] ([<0000000090d2cbd6>] do_softirq.part.1+0x56/0x60) [ 2057.572822] [<0000000090d2cc60>] __local_bh_enable_ip+0x80/0x98 [ 2057.572825] [<0000000091314706>] __dev_queue_xmit+0x2be/0xd70 [ 2057.572827] [<000003ff803dd6d6>] afiucv_hs_send+0x24e/0x300 [af_iucv] [ 2057.572830] [<000003ff803dd88a>] iucv_send_ctrl+0x102/0x138 [af_iucv] [ 2057.572833] [<000003ff803de72a>] iucv_sock_connect+0x37a/0x468 [af_iucv] [ 2057.572835] [<00000000912e7e90>] __sys_connect+0xa0/0xd8 [ 2057.572839] [<00000000912e9580>] sys_socketcall+0x228/0x348 [ 2057.572841] [<0000000091514e1a>] system_call+0x2a6/0x2c8 [ 2057.572843] Last Breaking-Event-Address: [ 2057.572844] [<0000000091317e44>] __napi_poll+0x4c/0x1d8 [ 2057.572846] [ 2057.572847] Kernel panic - not syncing: Fatal exception in interrupt
Analysis: There is one napi structure per out_q: card->qdio.out_qs[i].napi The napi.poll functions are set during qeth_open().
Since commit 1cfef80d4c2b ("s390/qeth: Don't call dev_close/dev_open (DOWN/UP)") qeth_set_offline()/qeth_set_online() no longer call dev_close()/ dev_open(). So if qeth_free_qdio_queues() cleared card->qdio.out_qs[i].napi.poll while the network interface was UP and the card was offline, they are not set again.
Reproduction: chzdev -e $devno layer2=0 ip link set dev $network_interface up echo 0 > /sys/bus/ccw ---truncated---(CVE-2024-36928)
In the Linux kernel, the following vulnerability has been resolved:
scsi: lpfc: Move NPIV's transport unregistration to after resource clean up
There are cases after NPIV deletion where the fabric switch still believes the NPIV is logged into the fabric. This occurs when a vport is unregistered before the Remove All DA_ID CT and LOGO ELS are sent to the fabric.
Currently fc_remove_host(), which calls dev_loss_tmo for all D_IDs including the fabric D_ID, removes the last ndlp reference and frees the ndlp rport object. This sometimes causes the race condition where the final DA_ID and LOGO are skipped from being sent to the fabric switch.
Fix by moving the fc_remove_host() and scsi_remove_host() calls after DA_ID and LOGO are sent.(CVE-2024-36952)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix a possible memleak in tipc_buf_append
__skb_linearize() doesn't free the skb when it fails, so move '*buf = NULL' after __skb_linearize(), so that the skb can be freed on the err path.(CVE-2024-36954)
In the Linux kernel, the following vulnerability has been resolved:
drm/vmwgfx: Fix invalid reads in fence signaled events
Correctly set the length of the drm_event to the size of the structure that's actually used.
The length of the drm_event was set to the parent structure instead of to the drm_vmw_event_fence which is supposed to be read. drm_read uses the length parameter to copy the event to the user space thus resuling in oob reads.(CVE-2024-36960)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix div-by-zero in l2cap_le_flowctl_init()
l2cap_le_flowctl_init() can cause both div-by-zero and an integer overflow since hdev->le_mtu may not fall in the valid range.
Move MTU from hci_dev to hci_conn to validate MTU and stop the connection process earlier if MTU is invalid. Also, add a missing validation in read_buffer_size() and make it return an error value if the validation fails. Now hci_conn_add() returns ERR_PTR() as it can fail due to the both a kzalloc failure and invalid MTU value.
divide error: 0000 [#1] PREEMPT SMP KASAN NOPTI CPU: 0 PID: 67 Comm: kworker/u5:0 Tainted: G W 6.9.0-rc5+ #20 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 Workqueue: hci0 hci_rx_work RIP: 0010:l2cap_le_flowctl_init+0x19e/0x3f0 net/bluetooth/l2cap_core.c:547 Code: e8 17 17 0c 00 66 41 89 9f 84 00 00 00 bf 01 00 00 00 41 b8 02 00 00 00 4c 89 fe 4c 89 e2 89 d9 e8 27 17 0c 00 44 89 f0 31 d2 <66> f7 f3 89 c3 ff c3 4d 8d b7 88 00 00 00 4c 89 f0 48 c1 e8 03 42 RSP: 0018:ffff88810bc0f858 EFLAGS: 00010246 RAX: 00000000000002a0 RBX: 0000000000000000 RCX: dffffc0000000000 RDX: 0000000000000000 RSI: ffff88810bc0f7c0 RDI: ffffc90002dcb66f RBP: ffff88810bc0f880 R08: aa69db2dda70ff01 R09: 0000ffaaaaaaaaaa R10: 0084000000ffaaaa R11: 0000000000000000 R12: ffff88810d65a084 R13: dffffc0000000000 R14: 00000000000002a0 R15: ffff88810d65a000 FS: 0000000000000000(0000) GS:ffff88811ac00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000020000100 CR3: 0000000103268003 CR4: 0000000000770ef0 PKRU: 55555554 Call Trace: <TASK> l2cap_le_connect_req net/bluetooth/l2cap_core.c:4902 [inline] l2cap_le_sig_cmd net/bluetooth/l2cap_core.c:5420 [inline] l2cap_le_sig_channel net/bluetooth/l2cap_core.c:5486 [inline] l2cap_recv_frame+0xe59d/0x11710 net/bluetooth/l2cap_core.c:6809 l2cap_recv_acldata+0x544/0x10a0 net/bluetooth/l2cap_core.c:7506 hci_acldata_packet net/bluetooth/hci_core.c:3939 [inline] hci_rx_work+0x5e5/0xb20 net/bluetooth/hci_core.c:4176 process_one_work kernel/workqueue.c:3254 [inline] process_scheduled_works+0x90f/0x1530 kernel/workqueue.c:3335 worker_thread+0x926/0xe70 kernel/workqueue.c:3416 kthread+0x2e3/0x380 kernel/kthread.c:388 ret_from_fork+0x5c/0x90 arch/x86/kernel/process.c:147 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244 </TASK> Modules linked in: ---[ end trace 0000000000000000 ]---(CVE-2024-36968)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-source-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.80.0.160.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.80.0.160.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-tools-debuginfo-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.80.0.160.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.80.0.160.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nafs: Fix corruption in reads at fpos 2G-4G from an OpenAFS server\r\n\r\nAFS-3 has two data fetch RPC variants, FS.FetchData and FS.FetchData64, and\nLinux\u0026apos;s afs client switches between them when talking to a non-YFS server\nif the read size, the file position or the sum of the two have the upper 32\nbits set of the 64-bit value.\r\n\r\nThis is a problem, however, since the file position and length fields of\nFS.FetchData are *signed* 32-bit values.\r\n\r\nFix this by capturing the capability bits obtained from the fileserver when\nit\u0026apos;s sent an FS.GetCapabilities RPC, rather than just discarding them, and\nthen picking out the VICED_CAPABILITY_64BITFILES flag. This can then be\nused to decide whether to use FS.FetchData or FS.FetchData64 - and also\nFS.StoreData or FS.StoreData64 - rather than using upper_32_bits() to\nswitch on the parameter values.\r\n\r\nThis capabilities flag could also be used to limit the maximum size of the\nfile, but all servers must be checked for that.\r\n\r\nNote that the issue does not exist with FS.StoreData - that uses *unsigned*\n32-bit values. It\u0026apos;s also not a problem with Auristor servers as its\nYFS.FetchData64 op uses unsigned 64-bit values.\r\n\r\nThis can be tested by cloning a git repo through an OpenAFS client to an\nOpenAFS server and then doing \u0026quot;git status\u0026quot; on it from a Linux afs\nclient[1]. Provided the clone has a pack file that\u0026apos;s in the 2G-4G range,\nthe git status will show errors like:\r\n\r\n\terror: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index\n\terror: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index\r\n\r\nThis can be observed in the server\u0026apos;s FileLog with something like the\nfollowing appearing:\r\n\r\nSun Aug 29 19:31:39 2021 SRXAFS_FetchData, Fid = 2303380852.491776.3263114, Host 192.168.11.201:7001, Id 1001\nSun Aug 29 19:31:39 2021 CheckRights: len=0, for host=192.168.11.201:7001\nSun Aug 29 19:31:39 2021 FetchData_RXStyle: Pos 18446744071815340032, Len 3154\nSun Aug 29 19:31:39 2021 FetchData_RXStyle: file size 2400758866\n...\nSun Aug 29 19:31:40 2021 SRXAFS_FetchData returns 5\r\n\r\nNote the file position of 18446744071815340032. This is the requested file\nposition sign-extended.(CVE-2021-47366)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/smc: Fix possible access to freed memory in link clear\r\n\r\nAfter modifying the QP to the Error state, all RX WR would be completed\nwith WC in IB_WC_WR_FLUSH_ERR status. Current implementation does not\nwait for it is done, but destroy the QP and free the link group directly.\nSo there is a risk that accessing the freed memory in tasklet context.\r\n\r\nHere is a crash example:\r\n\r\n BUG: unable to handle page fault for address: ffffffff8f220860\n #PF: supervisor write access in kernel mode\n #PF: error_code(0x0002) - not-present page\n PGD f7300e067 P4D f7300e067 PUD f7300f063 PMD 8c4e45063 PTE 800ffff08c9df060\n Oops: 0002 [#1] SMP PTI\n CPU: 1 PID: 0 Comm: swapper/1 Kdump: loaded Tainted: G S OE 5.10.0-0607+ #23\n Hardware name: Inspur NF5280M4/YZMB-00689-101, BIOS 4.1.20 07/09/2018\n RIP: 0010:native_queued_spin_lock_slowpath+0x176/0x1b0\n Code: f3 90 48 8b 32 48 85 f6 74 f6 eb d5 c1 ee 12 83 e0 03 83 ee 01 48 c1 e0 05 48 63 f6 48 05 00 c8 02 00 48 03 04 f5 00 09 98 8e \u0026lt;48\u0026gt; 89 10 8b 42 08 85 c0 75 09 f3 90 8b 42 08 85 c0 74 f7 48 8b 32\n RSP: 0018:ffffb3b6c001ebd8 EFLAGS: 00010086\n RAX: ffffffff8f220860 RBX: 0000000000000246 RCX: 0000000000080000\n RDX: ffff91db1f86c800 RSI: 000000000000173c RDI: ffff91db62bace00\n RBP: ffff91db62bacc00 R08: 0000000000000000 R09: c00000010000028b\n R10: 0000000000055198 R11: ffffb3b6c001ea58 R12: ffff91db80e05010\n R13: 000000000000000a R14: 0000000000000006 R15: 0000000000000040\n FS: 0000000000000000(0000) GS:ffff91db1f840000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: ffffffff8f220860 CR3: 00000001f9580004 CR4: 00000000003706e0\n DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n _raw_spin_lock_irqsave+0x30/0x40\n mlx5_ib_poll_cq+0x4c/0xc50 [mlx5_ib]\n smc_wr_rx_tasklet_fn+0x56/0xa0 [smc]\n tasklet_action_common.isra.21+0x66/0x100\n __do_softirq+0xd5/0x29c\n asm_call_irq_on_stack+0x12/0x20\n \u0026lt;/IRQ\u0026gt;\n do_softirq_own_stack+0x37/0x40\n irq_exit_rcu+0x9d/0xa0\n sysvec_call_function_single+0x34/0x80\n asm_sysvec_call_function_single+0x12/0x20(CVE-2022-48673)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsoc: brcmstb: pm-arm: Fix refcount leak and __iomem leak bugs\r\n\r\nIn brcmstb_pm_probe(), there are two kinds of leak bugs:\r\n\r\n(1) we need to add of_node_put() when for_each__matching_node() breaks\n(2) we need to add iounmap() for each iomap in fail path(CVE-2022-48693)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npipe: wakeup wr_wait after setting max_usage\r\n\r\nCommit c73be61cede5 (\u0026quot;pipe: Add general notification queue support\u0026quot;) a\nregression was introduced that would lock up resized pipes under certain\nconditions. See the reproducer in [1].\r\n\r\nThe commit resizing the pipe ring size was moved to a different\nfunction, doing that moved the wakeup for pipe-\u0026gt;wr_wait before actually\nraising pipe-\u0026gt;max_usage. If a pipe was full before the resize occured it\nwould result in the wakeup never actually triggering pipe_write.\r\n\r\nSet @max_usage and @nr_accounted before waking writers if this isn\u0026apos;t a\nwatch queue.\r\n\r\n[Christian Brauner \u0026lt;brauner@kernel.org\u0026gt;: rewrite to account for watch queues](CVE-2023-52672)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nACPI: video: check for error while searching for backlight device parent\r\n\r\nIf acpi_get_parent() called in acpi_video_dev_register_backlight()\nfails, for example, because acpi_ut_acquire_mutex() fails inside\nacpi_get_parent), this can lead to incorrect (uninitialized)\nacpi_parent handle being passed to acpi_get_pci_dev() for detecting\nthe parent pci device.\r\n\r\nCheck acpi_get_parent() result and set parent device only in case of success.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2023-52693)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmmc: mmc_spi: fix error handling in mmc_spi_probe()\r\n\r\nIf mmc_add_host() fails, it doesn\u0026apos;t need to call mmc_remove_host(),\nor it will cause null-ptr-deref, because of deleting a not added\ndevice in mmc_remove_host().\r\n\r\nTo fix this, goto label \u0026apos;fail_glue_init\u0026apos;, if mmc_add_host() fails,\nand change the label \u0026apos;fail_add_host\u0026apos; to \u0026apos;fail_gpiod_request\u0026apos;.(CVE-2023-52708)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nceph: blocklist the kclient when receiving corrupted snap trace\r\n\r\nWhen received corrupted snap trace we don\u0026apos;t know what exactly has\nhappened in MDS side. And we shouldn\u0026apos;t continue IOs and metadatas\naccess to MDS, which may corrupt or get incorrect contents.\r\n\r\nThis patch will just block all the further IO/MDS requests\nimmediately and then evict the kclient itself.\r\n\r\nThe reason why we still need to evict the kclient just after\nblocking all the further IOs is that the MDS could revoke the caps\nfaster.(CVE-2023-52732)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nFix page corruption caused by racy check in __free_pages\r\n\r\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\r\n\r\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\r\n\r\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\r\n\r\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\u0026quot;mm/page_alloc.c: fix freeing non-compound pages\u0026quot;):\r\n\r\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u0026gt; 0)\n\t\t\tfree_the_page(page + (1 \u0026lt;\u0026lt; order), order);\r\n\r\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nIB/hfi1: Restore allocated resources on failed copyout\r\n\r\nFix a resource leak if an error occurs.(CVE-2023-52747)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvirtio-blk: fix implicit overflow on virtio_max_dma_size\r\n\r\nThe following codes have an implicit conversion from size_t to u32:\n(u32)max_size = (size_t)virtio_max_dma_size(vdev);\r\n\r\nThis may lead overflow, Ex (size_t)4G -\u0026gt; (u32)0. Once\nvirtio_max_dma_size() has a larger size than U32_MAX, use U32_MAX\ninstead.(CVE-2023-52762)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/jfs: Add check for negative db_l2nbperpage\r\n\r\nl2nbperpage is log2(number of blks per page), and the minimum legal\nvalue should be 0, not negative.\r\n\r\nIn the case of l2nbperpage being negative, an error will occur\nwhen subsequently used as shift exponent.\r\n\r\nSyzbot reported this bug:\r\n\r\nUBSAN: shift-out-of-bounds in fs/jfs/jfs_dmap.c:799:12\nshift exponent -16777216 is negative(CVE-2023-52810)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/panel: fix a possible null pointer dereference\r\n\r\nIn versatile_panel_get_modes(), the return value of drm_mode_duplicate()\nis assigned to mode, which will lead to a NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2023-52821)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: vidtv: mux: Add check and kfree for kstrdup\r\n\r\nAdd check for the return value of kstrdup() and return the error\nif it fails in order to avoid NULL pointer dereference.\nMoreover, use kfree() in the later error handling in order to avoid\nmemory leak.(CVE-2023-52841)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhsr: Prevent use after free in prp_create_tagged_frame()\r\n\r\nThe prp_fill_rct() function can fail. In that situation, it frees the\nskb and returns NULL. Meanwhile on the success path, it returns the\noriginal skb. So it\u0026apos;s straight forward to fix bug by using the returned\nvalue.(CVE-2023-52846)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change\r\n\r\nWhile PLL CPUX clock rate change when CPU is running from it works in\nvast majority of cases, now and then it causes instability. This leads\nto system crashes and other undefined behaviour. After a lot of testing\n(30+ hours) while also doing a lot of frequency switches, we can\u0026apos;t\nobserve any instability issues anymore when doing reparenting to stable\nclock like 24 MHz oscillator.(CVE-2023-52882)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: validate request buffer size in smb2_allocate_rsp_buf()\r\n\r\nThe response buffer should be allocated in smb2_allocate_rsp_buf\nbefore validating request. But the fields in payload as well as smb2 header\nis used in smb2_allocate_rsp_buf(). This patch add simple buffer size\nvalidation to avoid potencial out-of-bounds in request buffer.(CVE-2024-26936)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: 9359/1: flush: check if the folio is reserved for no-mapping addresses\r\n\r\nSince commit a4d5613c4dc6 (\u0026quot;arm: extend pfn_valid to take into account\nfreed memory map alignment\u0026quot;) changes the semantics of pfn_valid() to check\npresence of the memory map for a PFN. A valid page for an address which\nis reserved but not mapped by the kernel[1], the system crashed during\nsome uio test with the following memory layout:\r\n\r\n node 0: [mem 0x00000000c0a00000-0x00000000cc8fffff]\n node 0: [mem 0x00000000d0000000-0x00000000da1fffff]\n the uio layout is\uff1a0xc0900000, 0x100000\r\n\r\nthe crash backtrace like:\r\n\r\n Unable to handle kernel paging request at virtual address bff00000\n [...]\n CPU: 1 PID: 465 Comm: startapp.bin Tainted: G O 5.10.0 #1\n Hardware name: Generic DT based system\n PC is at b15_flush_kern_dcache_area+0x24/0x3c\n LR is at __sync_icache_dcache+0x6c/0x98\n [...]\n (b15_flush_kern_dcache_area) from (__sync_icache_dcache+0x6c/0x98)\n (__sync_icache_dcache) from (set_pte_at+0x28/0x54)\n (set_pte_at) from (remap_pfn_range+0x1a0/0x274)\n (remap_pfn_range) from (uio_mmap+0x184/0x1b8 [uio])\n (uio_mmap [uio]) from (__mmap_region+0x264/0x5f4)\n (__mmap_region) from (__do_mmap_mm+0x3ec/0x440)\n (__do_mmap_mm) from (do_mmap+0x50/0x58)\n (do_mmap) from (vm_mmap_pgoff+0xfc/0x188)\n (vm_mmap_pgoff) from (ksys_mmap_pgoff+0xac/0xc4)\n (ksys_mmap_pgoff) from (ret_fast_syscall+0x0/0x5c)\n Code: e0801001 e2423001 e1c00003 f57ff04f (ee070f3e)\n ---[ end trace 09cf0734c3805d52 ]---\n Kernel panic - not syncing: Fatal exception\r\n\r\nSo check if PG_reserved was set to solve this issue.\r\n\r\n[1]: https://lore.kernel.org/lkml/Zbtdue57RO0QScJM@linux.ibm.com/(CVE-2024-26947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix slab-out-of-bounds in smb_strndup_from_utf16()\r\n\r\nIf -\u0026gt;NameOffset of smb2_create_req is smaller than Buffer offset of\nsmb2_create_req, slab-out-of-bounds read can happen from smb2_open.\nThis patch set the minimum value of the name offset to the buffer offset\nto validate name length of smb2_create_req().(CVE-2024-26954)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm: swap: fix race between free_swap_and_cache() and swapoff()\r\n\r\nThere was previously a theoretical window where swapoff() could run and\nteardown a swap_info_struct while a call to free_swap_and_cache() was\nrunning in another thread. This could cause, amongst other bad\npossibilities, swap_page_trans_huge_swapped() (called by\nfree_swap_and_cache()) to access the freed memory for swap_map.\r\n\r\nThis is a theoretical problem and I haven\u0026apos;t been able to provoke it from a\ntest case. But there has been agreement based on code review that this is\npossible (see link below).\r\n\r\nFix it by using get_swap_device()/put_swap_device(), which will stall\nswapoff(). There was an extra check in _swap_info_get() to confirm that\nthe swap entry was not free. This isn\u0026apos;t present in get_swap_device()\nbecause it doesn\u0026apos;t make sense in general due to the race between getting\nthe reference and swapoff. So I\u0026apos;ve added an equivalent check directly in\nfree_swap_and_cache().\r\n\r\nDetails of how to provoke one possible issue (thanks to David Hildenbrand\nfor deriving this):\r\n\r\n--8\u0026lt;-----\r\n\r\n__swap_entry_free() might be the last user and result in\n\u0026quot;count == SWAP_HAS_CACHE\u0026quot;.\r\n\r\nswapoff-\u0026gt;try_to_unuse() will stop as soon as soon as si-\u0026gt;inuse_pages==0.\r\n\r\nSo the question is: could someone reclaim the folio and turn\nsi-\u0026gt;inuse_pages==0, before we completed swap_page_trans_huge_swapped().\r\n\r\nImagine the following: 2 MiB folio in the swapcache. Only 2 subpages are\nstill references by swap entries.\r\n\r\nProcess 1 still references subpage 0 via swap entry.\nProcess 2 still references subpage 1 via swap entry.\r\n\r\nProcess 1 quits. Calls free_swap_and_cache().\n-\u0026gt; count == SWAP_HAS_CACHE\n[then, preempted in the hypervisor etc.]\r\n\r\nProcess 2 quits. Calls free_swap_and_cache().\n-\u0026gt; count == SWAP_HAS_CACHE\r\n\r\nProcess 2 goes ahead, passes swap_page_trans_huge_swapped(), and calls\n__try_to_reclaim_swap().\r\n\r\n__try_to_reclaim_swap()-\u0026gt;folio_free_swap()-\u0026gt;delete_from_swap_cache()-\u0026gt;\nput_swap_folio()-\u0026gt;free_swap_slot()-\u0026gt;swapcache_free_entries()-\u0026gt;\nswap_entry_free()-\u0026gt;swap_range_free()-\u0026gt;\n...\nWRITE_ONCE(si-\u0026gt;inuse_pages, si-\u0026gt;inuse_pages - nr_entries);\r\n\r\nWhat stops swapoff to succeed after process 2 reclaimed the swap cache\nbut before process1 finished its call to swap_page_trans_huge_swapped()?\r\n\r\n--8\u0026lt;-----(CVE-2024-26960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5e: Prevent deadlock while disabling aRFS\r\n\r\nWhen disabling aRFS under the `priv-\u0026gt;state_lock`, any scheduled\naRFS works are canceled using the `cancel_work_sync` function,\nwhich waits for the work to end if it has already started.\nHowever, while waiting for the work handler, the handler will\ntry to acquire the `state_lock` which is already acquired.\r\n\r\nThe worker acquires the lock to delete the rules if the state\nis down, which is not the worker\u0026apos;s responsibility since\ndisabling aRFS deletes the rules.\r\n\r\nAdd an aRFS state variable, which indicates whether the aRFS is\nenabled and prevent adding rules when the aRFS is disabled.\r\n\r\nKernel log:\r\n\r\n======================================================\nWARNING: possible circular locking dependency detected\n6.7.0-rc4_net_next_mlx5_5483eb2 #1 Tainted: G I\n------------------------------------------------------\nethtool/386089 is trying to acquire lock:\nffff88810f21ce68 ((work_completion)(\u0026amp;rule-\u0026gt;arfs_work)){+.+.}-{0:0}, at: __flush_work+0x74/0x4e0\r\n\r\nbut task is already holding lock:\nffff8884a1808cc0 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]\r\n\r\nwhich lock already depends on the new lock.\r\n\r\nthe existing dependency chain (in reverse order) is:\r\n\r\n-\u0026gt; #1 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}:\n __mutex_lock+0x80/0xc90\n arfs_handle_work+0x4b/0x3b0 [mlx5_core]\n process_one_work+0x1dc/0x4a0\n worker_thread+0x1bf/0x3c0\n kthread+0xd7/0x100\n ret_from_fork+0x2d/0x50\n ret_from_fork_asm+0x11/0x20\r\n\r\n-\u0026gt; #0 ((work_completion)(\u0026amp;rule-\u0026gt;arfs_work)){+.+.}-{0:0}:\n __lock_acquire+0x17b4/0x2c80\n lock_acquire+0xd0/0x2b0\n __flush_work+0x7a/0x4e0\n __cancel_work_timer+0x131/0x1c0\n arfs_del_rules+0x143/0x1e0 [mlx5_core]\n mlx5e_arfs_disable+0x1b/0x30 [mlx5_core]\n mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core]\n ethnl_set_channels+0x28f/0x3b0\n ethnl_default_set_doit+0xec/0x240\n genl_family_rcv_msg_doit+0xd0/0x120\n genl_rcv_msg+0x188/0x2c0\n netlink_rcv_skb+0x54/0x100\n genl_rcv+0x24/0x40\n netlink_unicast+0x1a1/0x270\n netlink_sendmsg+0x214/0x460\n __sock_sendmsg+0x38/0x60\n __sys_sendto+0x113/0x170\n __x64_sys_sendto+0x20/0x30\n do_syscall_64+0x40/0xe0\n entry_SYSCALL_64_after_hwframe+0x46/0x4e\r\n\r\nother info that might help us debug this:\r\n\r\n Possible unsafe locking scenario:\r\n\r\n CPU0 CPU1\n ---- ----\n lock(\u0026amp;priv-\u0026gt;state_lock);\n lock((work_completion)(\u0026amp;rule-\u0026gt;arfs_work));\n lock(\u0026amp;priv-\u0026gt;state_lock);\n lock((work_completion)(\u0026amp;rule-\u0026gt;arfs_work));\r\n\r\n *** DEADLOCK ***\r\n\r\n3 locks held by ethtool/386089:\n #0: ffffffff82ea7210 (cb_lock){++++}-{3:3}, at: genl_rcv+0x15/0x40\n #1: ffffffff82e94c88 (rtnl_mutex){+.+.}-{3:3}, at: ethnl_default_set_doit+0xd3/0x240\n #2: ffff8884a1808cc0 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]\r\n\r\nstack backtrace:\nCPU: 15 PID: 386089 Comm: ethtool Tainted: G I 6.7.0-rc4_net_next_mlx5_5483eb2 #1\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x60/0xa0\n check_noncircular+0x144/0x160\n __lock_acquire+0x17b4/0x2c80\n lock_acquire+0xd0/0x2b0\n ? __flush_work+0x74/0x4e0\n ? save_trace+0x3e/0x360\n ? __flush_work+0x74/0x4e0\n __flush_work+0x7a/0x4e0\n ? __flush_work+0x74/0x4e0\n ? __lock_acquire+0xa78/0x2c80\n ? lock_acquire+0xd0/0x2b0\n ? mark_held_locks+0x49/0x70\n __cancel_work_timer+0x131/0x1c0\n ? mark_held_locks+0x49/0x70\n arfs_del_rules+0x143/0x1e0 [mlx5_core]\n mlx5e_arfs_disable+0x1b/0x30 [mlx5_core]\n mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core]\n ethnl_set_channels+0x28f/0x3b0\n ethnl_default_set_doit+0xec/0x240\n genl_family_rcv_msg_doit+0xd0/0x120\n genl_rcv_msg+0x188/0x2c0\n ? ethn\n---truncated---(CVE-2024-27014)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: Fix potential data-race in __nft_obj_type_get()\r\n\r\nnft_unregister_obj() can concurrent with __nft_obj_type_get(),\nand there is not any protection when iterate over nf_tables_objects\nlist in __nft_obj_type_get(). Therefore, there is potential data-race\nof nf_tables_objects list entry.\r\n\r\nUse list_for_each_entry_rcu() to iterate over nf_tables_objects\nlist in __nft_obj_type_get(), and use rcu_read_lock() in the caller\nnft_obj_type_get() to protect the entire type query process.(CVE-2024-27019)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential NULL pointer dereferences in \u0026apos;dcn10_set_output_transfer_func()\u0026apos;\r\n\r\nThe \u0026apos;stream\u0026apos; pointer is used in dcn10_set_output_transfer_func() before\nthe check if \u0026apos;stream\u0026apos; is NULL.\r\n\r\nFixes the below:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn10/dcn10_hwseq.c:1892 dcn10_set_output_transfer_func() warn: variable dereferenced before check \u0026apos;stream\u0026apos; (see line 1875)(CVE-2024-27044)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: ll_temac: platform_get_resource replaced by wrong function\r\n\r\nThe function platform_get_resource was replaced with\ndevm_platform_ioremap_resource_byname and is called using 0 as name.\r\n\r\nThis eventually ends up in platform_get_resource_byname in the call\nstack, where it causes a null pointer in strcmp.\r\n\r\n\tif (type == resource_type(r) \u0026amp;\u0026amp; !strcmp(r-\u0026gt;name, name))\r\n\r\nIt should have been replaced with devm_platform_ioremap_resource.(CVE-2024-35796)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/aio: Check IOCB_AIO_RW before the struct aio_kiocb conversion\r\n\r\nThe first kiocb_set_cancel_fn() argument may point at a struct kiocb\nthat is not embedded inside struct aio_kiocb. With the current code,\ndepending on the compiler, the req-\u0026gt;ki_ctx read happens either before\nthe IOCB_AIO_RW test or after that test. Move the req-\u0026gt;ki_ctx read such\nthat it is guaranteed that the IOCB_AIO_RW test happens first.(CVE-2024-35815)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsoc: fsl: qbman: Use raw spinlock for cgr_lock\r\n\r\nsmp_call_function always runs its callback in hard IRQ context, even on\nPREEMPT_RT, where spinlocks can sleep. So we need to use a raw spinlock\nfor cgr_lock to ensure we aren\u0026apos;t waiting on a sleeping task.\r\n\r\nAlthough this bug has existed for a while, it was not apparent until\ncommit ef2a8d5478b9 (\u0026quot;net: dpaa: Adjust queue depth on rate change\u0026quot;)\nwhich invokes smp_call_function_single via qman_update_cgr_safe every\ntime a link goes up or down.(CVE-2024-35819)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: libertas: fix some memleaks in lbs_allocate_cmd_buffer()\r\n\r\nIn the for statement of lbs_allocate_cmd_buffer(), if the allocation of\ncmdarray[i].cmdbuf fails, both cmdarray and cmdarray[i].cmdbuf needs to\nbe freed. Otherwise, there will be memleaks in lbs_allocate_cmd_buffer().(CVE-2024-35828)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: bridge: replace physindev with physinif in nf_bridge_info\r\n\r\nAn skb can be added to a neigh-\u0026gt;arp_queue while waiting for an arp\nreply. Where original skb\u0026apos;s skb-\u0026gt;dev can be different to neigh\u0026apos;s\nneigh-\u0026gt;dev. For instance in case of bridging dnated skb from one veth to\nanother, the skb would be added to a neigh-\u0026gt;arp_queue of the bridge.\r\n\r\nAs skb-\u0026gt;dev can be reset back to nf_bridge-\u0026gt;physindev and used, and as\nthere is no explicit mechanism that prevents this physindev from been\nfreed under us (for instance neigh_flush_dev doesn\u0026apos;t cleanup skbs from\ndifferent device\u0026apos;s neigh queue) we can crash on e.g. this stack:\r\n\r\narp_process\n neigh_update\n skb = __skb_dequeue(\u0026amp;neigh-\u0026gt;arp_queue)\n neigh_resolve_output(..., skb)\n ...\n br_nf_dev_xmit\n br_nf_pre_routing_finish_bridge_slow\n skb-\u0026gt;dev = nf_bridge-\u0026gt;physindev\n br_handle_frame_finish\r\n\r\nLet\u0026apos;s use plain ifindex instead of net_device link. To peek into the\noriginal net_device we will use dev_get_by_index_rcu(). Thus either we\nget device and are safe to use it or we don\u0026apos;t get it and drop skb.(CVE-2024-35839)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsmb: client: fix UAF in smb2_reconnect_server()\r\n\r\nThe UAF bug is due to smb2_reconnect_server() accessing a session that\nis already being teared down by another thread that is executing\n__cifs_put_smb_ses(). This can happen when (a) the client has\nconnection to the server but no session or (b) another thread ends up\nsetting @ses-\u0026gt;ses_status again to something different than\nSES_EXITING.\r\n\r\nTo fix this, we need to make sure to unconditionally set\n@ses-\u0026gt;ses_status to SES_EXITING and prevent any other threads from\nsetting a new status while we\u0026apos;re still tearing it down.\r\n\r\nThe following can be reproduced by adding some delay to right after\nthe ipc is freed in __cifs_put_smb_ses() - which will give\nsmb2_reconnect_server() worker a chance to run and then accessing\n@ses-\u0026gt;ipc:\r\n\r\nkinit ...\nmount.cifs //srv/share /mnt/1 -o sec=krb5,nohandlecache,echo_interval=10\n[disconnect srv]\nls /mnt/1 \u0026amp;\u0026gt;/dev/null\nsleep 30\nkdestroy\n[reconnect srv]\nsleep 10\numount /mnt/1\n...\nCIFS: VFS: Verify user has a krb5 ticket and keyutils is installed\nCIFS: VFS: \\\\srv Send error in SessSetup = -126\nCIFS: VFS: Verify user has a krb5 ticket and keyutils is installed\nCIFS: VFS: \\\\srv Send error in SessSetup = -126\ngeneral protection fault, probably for non-canonical address\n0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI\nCPU: 3 PID: 50 Comm: kworker/3:1 Not tainted 6.9.0-rc2 #1\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-1.fc39\n04/01/2014\nWorkqueue: cifsiod smb2_reconnect_server [cifs]\nRIP: 0010:__list_del_entry_valid_or_report+0x33/0xf0\nCode: 4f 08 48 85 d2 74 42 48 85 c9 74 59 48 b8 00 01 00 00 00 00 ad\nde 48 39 c2 74 61 48 b8 22 01 00 00 00 00 74 69 \u0026lt;48\u0026gt; 8b 01 48 39 f8 75\n7b 48 8b 72 08 48 39 c6 0f 85 88 00 00 00 b8\nRSP: 0018:ffffc900001bfd70 EFLAGS: 00010a83\nRAX: dead000000000122 RBX: ffff88810da53838 RCX: 6b6b6b6b6b6b6b6b\nRDX: 6b6b6b6b6b6b6b6b RSI: ffffffffc02f6878 RDI: ffff88810da53800\nRBP: ffff88810da53800 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000001 R12: ffff88810c064000\nR13: 0000000000000001 R14: ffff88810c064000 R15: ffff8881039cc000\nFS: 0000000000000000(0000) GS:ffff888157c00000(0000)\nknlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fe3728b1000 CR3: 000000010caa4000 CR4: 0000000000750ef0\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n ? die_addr+0x36/0x90\n ? exc_general_protection+0x1c1/0x3f0\n ? asm_exc_general_protection+0x26/0x30\n ? __list_del_entry_valid_or_report+0x33/0xf0\n __cifs_put_smb_ses+0x1ae/0x500 [cifs]\n smb2_reconnect_server+0x4ed/0x710 [cifs]\n process_one_work+0x205/0x6b0\n worker_thread+0x191/0x360\n ? __pfx_worker_thread+0x10/0x10\n kthread+0xe2/0x110\n ? __pfx_kthread+0x10/0x10\n ret_from_fork+0x34/0x50\n ? __pfx_kthread+0x10/0x10\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;(CVE-2024-35870)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: fix use-after-free bugs caused by ax25_ds_del_timer\r\n\r\nWhen the ax25 device is detaching, the ax25_dev_device_down()\ncalls ax25_ds_del_timer() to cleanup the slave_timer. When\nthe timer handler is running, the ax25_ds_del_timer() that\ncalls del_timer() in it will return directly. As a result,\nthe use-after-free bugs could happen, one of the scenarios\nis shown below:\r\n\r\n (Thread 1) | (Thread 2)\n | ax25_ds_timeout()\nax25_dev_device_down() |\n ax25_ds_del_timer() |\n del_timer() |\n ax25_dev_put() //FREE |\n | ax25_dev-\u0026gt; //USE\r\n\r\nIn order to mitigate bugs, when the device is detaching, use\ntimer_shutdown_sync() to stop the timer.(CVE-2024-35887)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: properly terminate timers for kernel sockets\r\n\r\nWe had various syzbot reports about tcp timers firing after\nthe corresponding netns has been dismantled.\r\n\r\nFortunately Josef Bacik could trigger the issue more often,\nand could test a patch I wrote two years ago.\r\n\r\nWhen TCP sockets are closed, we call inet_csk_clear_xmit_timers()\nto \u0026apos;stop\u0026apos; the timers.\r\n\r\ninet_csk_clear_xmit_timers() can be called from any context,\nincluding when socket lock is held.\nThis is the reason it uses sk_stop_timer(), aka del_timer().\nThis means that ongoing timers might finish much later.\r\n\r\nFor user sockets, this is fine because each running timer\nholds a reference on the socket, and the user socket holds\na reference on the netns.\r\n\r\nFor kernel sockets, we risk that the netns is freed before\ntimer can complete, because kernel sockets do not hold\nreference on the netns.\r\n\r\nThis patch adds inet_csk_clear_xmit_timers_sync() function\nthat using sk_stop_timer_sync() to make sure all timers\nare terminated before the kernel socket is released.\nModules using kernel sockets close them in their netns exit()\nhandler.\r\n\r\nAlso add sock_not_owned_by_me() helper to get LOCKDEP\nsupport : inet_csk_clear_xmit_timers_sync() must not be called\nwhile socket lock is held.\r\n\r\nIt is very possible we can revert in the future commit\n3a58f13a881e (\u0026quot;net: rds: acquire refcount on TCP sockets\u0026quot;)\nwhich attempted to solve the issue in rds only.\n(net/smc/af_smc.c and net/mptcp/subflow.c have similar code)\r\n\r\nWe probably can remove the check_net() tests from\ntcp_out_of_resources() and __tcp_close() in the future.(CVE-2024-35910)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/vc4: don\u0026apos;t check if plane-\u0026gt;state-\u0026gt;fb == state-\u0026gt;fb\r\n\r\nCurrently, when using non-blocking commits, we can see the following\nkernel warning:\r\n\r\n[ 110.908514] ------------[ cut here ]------------\n[ 110.908529] refcount_t: underflow; use-after-free.\n[ 110.908620] WARNING: CPU: 0 PID: 1866 at lib/refcount.c:87 refcount_dec_not_one+0xb8/0xc0\n[ 110.908664] Modules linked in: rfcomm snd_seq_dummy snd_hrtimer snd_seq snd_seq_device cmac algif_hash aes_arm64 aes_generic algif_skcipher af_alg bnep hid_logitech_hidpp vc4 brcmfmac hci_uart btbcm brcmutil bluetooth snd_soc_hdmi_codec cfg80211 cec drm_display_helper drm_dma_helper drm_kms_helper snd_soc_core snd_compress snd_pcm_dmaengine fb_sys_fops sysimgblt syscopyarea sysfillrect raspberrypi_hwmon ecdh_generic ecc rfkill libaes i2c_bcm2835 binfmt_misc joydev snd_bcm2835(C) bcm2835_codec(C) bcm2835_isp(C) v4l2_mem2mem videobuf2_dma_contig snd_pcm bcm2835_v4l2(C) raspberrypi_gpiomem bcm2835_mmal_vchiq(C) videobuf2_v4l2 snd_timer videobuf2_vmalloc videobuf2_memops videobuf2_common snd videodev vc_sm_cma(C) mc hid_logitech_dj uio_pdrv_genirq uio i2c_dev drm fuse dm_mod drm_panel_orientation_quirks backlight ip_tables x_tables ipv6\n[ 110.909086] CPU: 0 PID: 1866 Comm: kodi.bin Tainted: G C 6.1.66-v8+ #32\n[ 110.909104] Hardware name: Raspberry Pi 3 Model B Rev 1.2 (DT)\n[ 110.909114] pstate: 60000005 (nZCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n[ 110.909132] pc : refcount_dec_not_one+0xb8/0xc0\n[ 110.909152] lr : refcount_dec_not_one+0xb4/0xc0\n[ 110.909170] sp : ffffffc00913b9c0\n[ 110.909177] x29: ffffffc00913b9c0 x28: 000000556969bbb0 x27: 000000556990df60\n[ 110.909205] x26: 0000000000000002 x25: 0000000000000004 x24: ffffff8004448480\n[ 110.909230] x23: ffffff800570b500 x22: ffffff802e03a7bc x21: ffffffecfca68c78\n[ 110.909257] x20: ffffff8002b42000 x19: ffffff802e03a600 x18: 0000000000000000\n[ 110.909283] x17: 0000000000000011 x16: ffffffffffffffff x15: 0000000000000004\n[ 110.909308] x14: 0000000000000fff x13: ffffffed577e47e0 x12: 0000000000000003\n[ 110.909333] x11: 0000000000000000 x10: 0000000000000027 x9 : c912d0d083728c00\n[ 110.909359] x8 : c912d0d083728c00 x7 : 65646e75203a745f x6 : 746e756f63666572\n[ 110.909384] x5 : ffffffed579f62ee x4 : ffffffed579eb01e x3 : 0000000000000000\n[ 110.909409] x2 : 0000000000000000 x1 : ffffffc00913b750 x0 : 0000000000000001\n[ 110.909434] Call trace:\n[ 110.909441] refcount_dec_not_one+0xb8/0xc0\n[ 110.909461] vc4_bo_dec_usecnt+0x4c/0x1b0 [vc4]\n[ 110.909903] vc4_cleanup_fb+0x44/0x50 [vc4]\n[ 110.910315] drm_atomic_helper_cleanup_planes+0x88/0xa4 [drm_kms_helper]\n[ 110.910669] vc4_atomic_commit_tail+0x390/0x9dc [vc4]\n[ 110.911079] commit_tail+0xb0/0x164 [drm_kms_helper]\n[ 110.911397] drm_atomic_helper_commit+0x1d0/0x1f0 [drm_kms_helper]\n[ 110.911716] drm_atomic_commit+0xb0/0xdc [drm]\n[ 110.912569] drm_mode_atomic_ioctl+0x348/0x4b8 [drm]\n[ 110.913330] drm_ioctl_kernel+0xec/0x15c [drm]\n[ 110.914091] drm_ioctl+0x24c/0x3b0 [drm]\n[ 110.914850] __arm64_sys_ioctl+0x9c/0xd4\n[ 110.914873] invoke_syscall+0x4c/0x114\n[ 110.914897] el0_svc_common+0xd0/0x118\n[ 110.914917] do_el0_svc+0x38/0xd0\n[ 110.914936] el0_svc+0x30/0x8c\n[ 110.914958] el0t_64_sync_handler+0x84/0xf0\n[ 110.914979] el0t_64_sync+0x18c/0x190\n[ 110.914996] ---[ end trace 0000000000000000 ]---\r\n\r\nThis happens because, although `prepare_fb` and `cleanup_fb` are\nperfectly balanced, we cannot guarantee consistency in the check\nplane-\u0026gt;state-\u0026gt;fb == state-\u0026gt;fb. This means that sometimes we can increase\nthe refcount in `prepare_fb` and don\u0026apos;t decrease it in `cleanup_fb`. The\nopposite can also be true.\r\n\r\nIn fact, the struct drm_plane .state shouldn\u0026apos;t be accessed directly\nbut instead, the `drm_atomic_get_new_plane_state()` helper function should\nbe used. So, we could stick to this check, but using\n`drm_atomic_get_new_plane_state()`. But actually, this check is not re\n---truncated---(CVE-2024-35932)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: send: handle path ref underflow in header iterate_inode_ref()\r\n\r\nChange BUG_ON to proper error handling if building the path buffer\nfails. The pointers are not printed so we don\u0026apos;t accidentally leak kernel\naddresses.(CVE-2024-35935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: cfg80211: check A-MSDU format more carefully\r\n\r\nIf it looks like there\u0026apos;s another subframe in the A-MSDU\nbut the header isn\u0026apos;t fully there, we can end up reading\ndata out of bounds, only to discard later. Make this a\nbit more careful and check if the subframe header can\neven be present.(CVE-2024-35937)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()\r\n\r\nSubject: [PATCH] drm/panfrost: Fix the error path in\n panfrost_mmu_map_fault_addr()\r\n\r\nIf some the pages or sgt allocation failed, we shouldn\u0026apos;t release the\npages ref we got earlier, otherwise we will end up with unbalanced\nget/put_pages() calls. We should instead leave everything in place\nand let the BO release function deal with extra cleanup when the object\nis destroyed, or let the fault handler try again next time it\u0026apos;s called.(CVE-2024-35951)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: L2CAP: Fix not validating setsockopt user input\r\n\r\nCheck user input length before copying data.(CVE-2024-35965)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: RFCOMM: Fix not validating setsockopt user input\r\n\r\nsyzbot reported rfcomm_sock_setsockopt_old() is copying data without\nchecking user input length.\r\n\r\nBUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset\ninclude/linux/sockptr.h:49 [inline]\nBUG: KASAN: slab-out-of-bounds in copy_from_sockptr\ninclude/linux/sockptr.h:55 [inline]\nBUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt_old\nnet/bluetooth/rfcomm/sock.c:632 [inline]\nBUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt+0x893/0xa70\nnet/bluetooth/rfcomm/sock.c:673\nRead of size 4 at addr ffff8880209a8bc3 by task syz-executor632/5064(CVE-2024-35966)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: Avoid infinite loop trying to resize local TT\r\n\r\nIf the MTU of one of an attached interface becomes too small to transmit\nthe local translation table then it must be resized to fit inside all\nfragments (when enabled) or a single packet.\r\n\r\nBut if the MTU becomes too low to transmit even the header + the VLAN\nspecific part then the resizing of the local TT will never succeed. This\ncan for example happen when the usable space is 110 bytes and 11 VLANs are\non top of batman-adv. In this case, at least 116 byte would be needed.\nThere will just be an endless spam of\r\n\r\n batman_adv: batadv0: Forced to purge local tt entries to fit new maximum fragment MTU (110)\r\n\r\nin the log but the function will never finish. Problem here is that the\ntimeout will be halved all the time and will then stagnate at 0 and\ntherefore never be able to reduce the table even more.\r\n\r\nThere are other scenarios possible with a similar result. The number of\nBATADV_TT_CLIENT_NOPURGE entries in the local TT can for example be too\nhigh to fit inside a packet. Such a scenario can therefore happen also with\nonly a single VLAN + 7 non-purgable addresses - requiring at least 120\nbytes.\r\n\r\nWhile this should be handled proactively when:\r\n\r\n* interface with too low MTU is added\n* VLAN is added\n* non-purgeable local mac is added\n* MTU of an attached interface is reduced\n* fragmentation setting gets disabled (which most likely requires dropping\n attached interfaces)\r\n\r\nnot all of these scenarios can be prevented because batman-adv is only\nconsuming events without the the possibility to prevent these actions\n(non-purgable MAC address added, MTU of an attached interface is reduced).\nIt is therefore necessary to also make sure that the code is able to handle\nalso the situations when there were already incompatible system\nconfiguration are present.(CVE-2024-35982)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntty: n_gsm: fix possible out-of-bounds in gsm0_receive()\r\n\r\nAssuming the following:\n- side A configures the n_gsm in basic option mode\n- side B sends the header of a basic option mode frame with data length 1\n- side A switches to advanced option mode\n- side B sends 2 data bytes which exceeds gsm-\u0026gt;len\n Reason: gsm-\u0026gt;len is not used in advanced option mode.\n- side A switches to basic option mode\n- side B keeps sending until gsm0_receive() writes past gsm-\u0026gt;buf\n Reason: Neither gsm-\u0026gt;state nor gsm-\u0026gt;len have been reset after\n reconfiguration.\r\n\r\nFix this by changing gsm-\u0026gt;count to gsm-\u0026gt;len comparison from equal to less\nthan. Also add upper limit checks against the constant MAX_MRU in\ngsm0_receive() and gsm1_receive() to harden against memory corruption of\ngsm-\u0026gt;len and gsm-\u0026gt;mru.\r\n\r\nAll other checks remain as we still need to limit the data according to the\nuser configuration and actual payload size.(CVE-2024-36016)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblk-iocost: avoid out of bounds shift\r\n\r\nUBSAN catches undefined behavior in blk-iocost, where sometimes\niocg-\u0026gt;delay is shifted right by a number that is too large,\nresulting in undefined behavior on some architectures.\r\n\r\n[ 186.556576] ------------[ cut here ]------------\nUBSAN: shift-out-of-bounds in block/blk-iocost.c:1366:23\nshift exponent 64 is too large for 64-bit type \u0026apos;u64\u0026apos; (aka \u0026apos;unsigned long long\u0026apos;)\nCPU: 16 PID: 0 Comm: swapper/16 Tainted: G S E N 6.9.0-0_fbk700_debug_rc2_kbuilder_0_gc85af715cac0 #1\nHardware name: Quanta Twin Lakes MP/Twin Lakes Passive MP, BIOS F09_3A23 12/08/2020\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n dump_stack_lvl+0x8f/0xe0\n __ubsan_handle_shift_out_of_bounds+0x22c/0x280\n iocg_kick_delay+0x30b/0x310\n ioc_timer_fn+0x2fb/0x1f80\n __run_timer_base+0x1b6/0x250\n...\r\n\r\nAvoid that undefined behavior by simply taking the\n\u0026quot;delay = 0\u0026quot; branch if the shift is too large.\r\n\r\nI am not sure what the symptoms of an undefined value\ndelay will be, but I suspect it could be more than a\nlittle annoying to debug.(CVE-2024-36916)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblock: fix overflow in blk_ioctl_discard()\r\n\r\nThere is no check for overflow of \u0026apos;start + len\u0026apos; in blk_ioctl_discard().\nHung task occurs if submit an discard ioctl with the following param:\n start = 0x80000000000ff000, len = 0x8000000000fff000;\nAdd the overflow validation now.(CVE-2024-36917)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: bnx2fc: Remove spin_lock_bh while releasing resources after upload\r\n\r\nThe session resources are used by FW and driver when session is offloaded,\nonce session is uploaded these resources are not used. The lock is not\nrequired as these fields won\u0026apos;t be used any longer. The offload and upload\ncalls are sequential, hence lock is not required.\r\n\r\nThis will suppress following BUG_ON():\r\n\r\n[ 449.843143] ------------[ cut here ]------------\n[ 449.848302] kernel BUG at mm/vmalloc.c:2727!\n[ 449.853072] invalid opcode: 0000 [#1] PREEMPT SMP PTI\n[ 449.858712] CPU: 5 PID: 1996 Comm: kworker/u24:2 Not tainted 5.14.0-118.el9.x86_64 #1\nRebooting.\n[ 449.867454] Hardware name: Dell Inc. PowerEdge R730/0WCJNT, BIOS 2.3.4 11/08/2016\n[ 449.876966] Workqueue: fc_rport_eq fc_rport_work [libfc]\n[ 449.882910] RIP: 0010:vunmap+0x2e/0x30\n[ 449.887098] Code: 00 65 8b 05 14 a2 f0 4a a9 00 ff ff 00 75 1b 55 48 89 fd e8 34 36 79 00 48 85 ed 74 0b 48 89 ef 31 f6 5d e9 14 fc ff ff 5d c3 \u0026lt;0f\u0026gt; 0b 0f 1f 44 00 00 41 57 41 56 49 89 ce 41 55 49 89 fd 41 54 41\n[ 449.908054] RSP: 0018:ffffb83d878b3d68 EFLAGS: 00010206\n[ 449.913887] RAX: 0000000080000201 RBX: ffff8f4355133550 RCX: 000000000d400005\n[ 449.921843] RDX: 0000000000000001 RSI: 0000000000001000 RDI: ffffb83da53f5000\n[ 449.929808] RBP: ffff8f4ac6675800 R08: ffffb83d878b3d30 R09: 00000000000efbdf\n[ 449.937774] R10: 0000000000000003 R11: ffff8f434573e000 R12: 0000000000001000\n[ 449.945736] R13: 0000000000001000 R14: ffffb83da53f5000 R15: ffff8f43d4ea3ae0\n[ 449.953701] FS: 0000000000000000(0000) GS:ffff8f529fc80000(0000) knlGS:0000000000000000\n[ 449.962732] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 449.969138] CR2: 00007f8cf993e150 CR3: 0000000efbe10003 CR4: 00000000003706e0\n[ 449.977102] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 449.985065] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 449.993028] Call Trace:\n[ 449.995756] __iommu_dma_free+0x96/0x100\n[ 450.000139] bnx2fc_free_session_resc+0x67/0x240 [bnx2fc]\n[ 450.006171] bnx2fc_upload_session+0xce/0x100 [bnx2fc]\n[ 450.011910] bnx2fc_rport_event_handler+0x9f/0x240 [bnx2fc]\n[ 450.018136] fc_rport_work+0x103/0x5b0 [libfc]\n[ 450.023103] process_one_work+0x1e8/0x3c0\n[ 450.027581] worker_thread+0x50/0x3b0\n[ 450.031669] ? rescuer_thread+0x370/0x370\n[ 450.036143] kthread+0x149/0x170\n[ 450.039744] ? set_kthread_struct+0x40/0x40\n[ 450.044411] ret_from_fork+0x22/0x30\n[ 450.048404] Modules linked in: vfat msdos fat xfs nfs_layout_nfsv41_files rpcsec_gss_krb5 auth_rpcgss nfsv4 dns_resolver dm_service_time qedf qed crc8 bnx2fc libfcoe libfc scsi_transport_fc intel_rapl_msr intel_rapl_common x86_pkg_temp_thermal intel_powerclamp dcdbas rapl intel_cstate intel_uncore mei_me pcspkr mei ipmi_ssif lpc_ich ipmi_si fuse zram ext4 mbcache jbd2 loop nfsv3 nfs_acl nfs lockd grace fscache netfs irdma ice sd_mod t10_pi sg ib_uverbs ib_core 8021q garp mrp stp llc mgag200 i2c_algo_bit drm_kms_helper syscopyarea sysfillrect sysimgblt mxm_wmi fb_sys_fops cec crct10dif_pclmul ahci crc32_pclmul bnx2x drm ghash_clmulni_intel libahci rfkill i40e libata megaraid_sas mdio wmi sunrpc lrw dm_crypt dm_round_robin dm_multipath dm_snapshot dm_bufio dm_mirror dm_region_hash dm_log dm_zero dm_mod linear raid10 raid456 async_raid6_recov async_memcpy async_pq async_xor async_tx raid6_pq libcrc32c crc32c_intel raid1 raid0 iscsi_ibft squashfs be2iscsi bnx2i cnic uio cxgb4i cxgb4 tls\n[ 450.048497] libcxgbi libcxgb qla4xxx iscsi_boot_sysfs iscsi_tcp libiscsi_tcp libiscsi scsi_transport_iscsi edd ipmi_devintf ipmi_msghandler\n[ 450.159753] ---[ end trace 712de2c57c64abc8 ]---(CVE-2024-36919)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ns390/qeth: Fix kernel panic after setting hsuid\r\n\r\nSymptom:\nWhen the hsuid attribute is set for the first time on an IQD Layer3\ndevice while the corresponding network interface is already UP,\nthe kernel will try to execute a napi function pointer that is NULL.\r\n\r\nExample:\n---------------------------------------------------------------------------\n[ 2057.572696] illegal operation: 0001 ilc:1 [#1] SMP\n[ 2057.572702] Modules linked in: af_iucv qeth_l3 zfcp scsi_transport_fc sunrpc nft_fib_inet nft_fib_ipv4 nft_fib_ipv6 nft_fib nft_reject_inet nf_reject_ipv4 nf_reject_ipv6\nnft_reject nft_ct nf_tables_set nft_chain_nat nf_nat nf_conntrack nf_defrag_ipv6 nf_defrag_ipv4 ip_set nf_tables libcrc32c nfnetlink ghash_s390 prng xts aes_s390 des_s390 de\ns_generic sha3_512_s390 sha3_256_s390 sha512_s390 vfio_ccw vfio_mdev mdev vfio_iommu_type1 eadm_sch vfio ext4 mbcache jbd2 qeth_l2 bridge stp llc dasd_eckd_mod qeth dasd_mod\n qdio ccwgroup pkey zcrypt\n[ 2057.572739] CPU: 6 PID: 60182 Comm: stress_client Kdump: loaded Not tainted 4.18.0-541.el8.s390x #1\n[ 2057.572742] Hardware name: IBM 3931 A01 704 (LPAR)\n[ 2057.572744] Krnl PSW : 0704f00180000000 0000000000000002 (0x2)\n[ 2057.572748] R:0 T:1 IO:1 EX:1 Key:0 M:1 W:0 P:0 AS:3 CC:3 PM:0 RI:0 EA:3\n[ 2057.572751] Krnl GPRS: 0000000000000004 0000000000000000 00000000a3b008d8 0000000000000000\n[ 2057.572754] 00000000a3b008d8 cb923a29c779abc5 0000000000000000 00000000814cfd80\n[ 2057.572756] 000000000000012c 0000000000000000 00000000a3b008d8 00000000a3b008d8\n[ 2057.572758] 00000000bab6d500 00000000814cfd80 0000000091317e46 00000000814cfc68\n[ 2057.572762] Krnl Code:#0000000000000000: 0000 illegal\n \u0026gt;0000000000000002: 0000 illegal\n 0000000000000004: 0000 illegal\n 0000000000000006: 0000 illegal\n 0000000000000008: 0000 illegal\n 000000000000000a: 0000 illegal\n 000000000000000c: 0000 illegal\n 000000000000000e: 0000 illegal\n[ 2057.572800] Call Trace:\n[ 2057.572801] ([\u0026lt;00000000ec639700\u0026gt;] 0xec639700)\n[ 2057.572803] [\u0026lt;00000000913183e2\u0026gt;] net_rx_action+0x2ba/0x398\n[ 2057.572809] [\u0026lt;0000000091515f76\u0026gt;] __do_softirq+0x11e/0x3a0\n[ 2057.572813] [\u0026lt;0000000090ce160c\u0026gt;] do_softirq_own_stack+0x3c/0x58\n[ 2057.572817] ([\u0026lt;0000000090d2cbd6\u0026gt;] do_softirq.part.1+0x56/0x60)\n[ 2057.572822] [\u0026lt;0000000090d2cc60\u0026gt;] __local_bh_enable_ip+0x80/0x98\n[ 2057.572825] [\u0026lt;0000000091314706\u0026gt;] __dev_queue_xmit+0x2be/0xd70\n[ 2057.572827] [\u0026lt;000003ff803dd6d6\u0026gt;] afiucv_hs_send+0x24e/0x300 [af_iucv]\n[ 2057.572830] [\u0026lt;000003ff803dd88a\u0026gt;] iucv_send_ctrl+0x102/0x138 [af_iucv]\n[ 2057.572833] [\u0026lt;000003ff803de72a\u0026gt;] iucv_sock_connect+0x37a/0x468 [af_iucv]\n[ 2057.572835] [\u0026lt;00000000912e7e90\u0026gt;] __sys_connect+0xa0/0xd8\n[ 2057.572839] [\u0026lt;00000000912e9580\u0026gt;] sys_socketcall+0x228/0x348\n[ 2057.572841] [\u0026lt;0000000091514e1a\u0026gt;] system_call+0x2a6/0x2c8\n[ 2057.572843] Last Breaking-Event-Address:\n[ 2057.572844] [\u0026lt;0000000091317e44\u0026gt;] __napi_poll+0x4c/0x1d8\n[ 2057.572846]\n[ 2057.572847] Kernel panic - not syncing: Fatal exception in interrupt\n-------------------------------------------------------------------------------------------\r\n\r\nAnalysis:\nThere is one napi structure per out_q: card-\u0026gt;qdio.out_qs[i].napi\nThe napi.poll functions are set during qeth_open().\r\n\r\nSince\ncommit 1cfef80d4c2b (\u0026quot;s390/qeth: Don\u0026apos;t call dev_close/dev_open (DOWN/UP)\u0026quot;)\nqeth_set_offline()/qeth_set_online() no longer call dev_close()/\ndev_open(). So if qeth_free_qdio_queues() cleared\ncard-\u0026gt;qdio.out_qs[i].napi.poll while the network interface was UP and the\ncard was offline, they are not set again.\r\n\r\nReproduction:\nchzdev -e $devno layer2=0\nip link set dev $network_interface up\necho 0 \u0026gt; /sys/bus/ccw\n---truncated---(CVE-2024-36928)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: lpfc: Move NPIV\u0026apos;s transport unregistration to after resource clean up\r\n\r\nThere are cases after NPIV deletion where the fabric switch still believes\nthe NPIV is logged into the fabric. This occurs when a vport is\nunregistered before the Remove All DA_ID CT and LOGO ELS are sent to the\nfabric.\r\n\r\nCurrently fc_remove_host(), which calls dev_loss_tmo for all D_IDs including\nthe fabric D_ID, removes the last ndlp reference and frees the ndlp rport\nobject. This sometimes causes the race condition where the final DA_ID and\nLOGO are skipped from being sent to the fabric switch.\r\n\r\nFix by moving the fc_remove_host() and scsi_remove_host() calls after DA_ID\nand LOGO are sent.(CVE-2024-36952)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntipc: fix a possible memleak in tipc_buf_append\r\n\r\n__skb_linearize() doesn\u0026apos;t free the skb when it fails, so move\n\u0026apos;*buf = NULL\u0026apos; after __skb_linearize(), so that the skb can be\nfreed on the err path.(CVE-2024-36954)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/vmwgfx: Fix invalid reads in fence signaled events\r\n\r\nCorrectly set the length of the drm_event to the size of the structure\nthat\u0026apos;s actually used.\r\n\r\nThe length of the drm_event was set to the parent structure instead of\nto the drm_vmw_event_fence which is supposed to be read. drm_read\nuses the length parameter to copy the event to the user space thus\nresuling in oob reads.(CVE-2024-36960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: L2CAP: Fix div-by-zero in l2cap_le_flowctl_init()\r\n\r\nl2cap_le_flowctl_init() can cause both div-by-zero and an integer\noverflow since hdev-\u0026gt;le_mtu may not fall in the valid range.\r\n\r\nMove MTU from hci_dev to hci_conn to validate MTU and stop the connection\nprocess earlier if MTU is invalid.\nAlso, add a missing validation in read_buffer_size() and make it return\nan error value if the validation fails.\nNow hci_conn_add() returns ERR_PTR() as it can fail due to the both a\nkzalloc failure and invalid MTU value.\r\n\r\ndivide error: 0000 [#1] PREEMPT SMP KASAN NOPTI\nCPU: 0 PID: 67 Comm: kworker/u5:0 Tainted: G W 6.9.0-rc5+ #20\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nWorkqueue: hci0 hci_rx_work\nRIP: 0010:l2cap_le_flowctl_init+0x19e/0x3f0 net/bluetooth/l2cap_core.c:547\nCode: e8 17 17 0c 00 66 41 89 9f 84 00 00 00 bf 01 00 00 00 41 b8 02 00 00 00 4c\n89 fe 4c 89 e2 89 d9 e8 27 17 0c 00 44 89 f0 31 d2 \u0026lt;66\u0026gt; f7 f3 89 c3 ff c3 4d 8d\nb7 88 00 00 00 4c 89 f0 48 c1 e8 03 42\nRSP: 0018:ffff88810bc0f858 EFLAGS: 00010246\nRAX: 00000000000002a0 RBX: 0000000000000000 RCX: dffffc0000000000\nRDX: 0000000000000000 RSI: ffff88810bc0f7c0 RDI: ffffc90002dcb66f\nRBP: ffff88810bc0f880 R08: aa69db2dda70ff01 R09: 0000ffaaaaaaaaaa\nR10: 0084000000ffaaaa R11: 0000000000000000 R12: ffff88810d65a084\nR13: dffffc0000000000 R14: 00000000000002a0 R15: ffff88810d65a000\nFS: 0000000000000000(0000) GS:ffff88811ac00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000020000100 CR3: 0000000103268003 CR4: 0000000000770ef0\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n l2cap_le_connect_req net/bluetooth/l2cap_core.c:4902 [inline]\n l2cap_le_sig_cmd net/bluetooth/l2cap_core.c:5420 [inline]\n l2cap_le_sig_channel net/bluetooth/l2cap_core.c:5486 [inline]\n l2cap_recv_frame+0xe59d/0x11710 net/bluetooth/l2cap_core.c:6809\n l2cap_recv_acldata+0x544/0x10a0 net/bluetooth/l2cap_core.c:7506\n hci_acldata_packet net/bluetooth/hci_core.c:3939 [inline]\n hci_rx_work+0x5e5/0xb20 net/bluetooth/hci_core.c:4176\n process_one_work kernel/workqueue.c:3254 [inline]\n process_scheduled_works+0x90f/0x1530 kernel/workqueue.c:3335\n worker_thread+0x926/0xe70 kernel/workqueue.c:3416\n kthread+0x2e3/0x380 kernel/kthread.c:388\n ret_from_fork+0x5c/0x90 arch/x86/kernel/process.c:147\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244\n \u0026lt;/TASK\u0026gt;\nModules linked in:\n---[ end trace 0000000000000000 ]---(CVE-2024-36968)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)",
"id": "OESA-2024-1737",
"modified": "2026-08-06T11:07:12Z",
"published": "2024-06-21T11:07:12Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47366"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48693"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52672"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52693"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52708"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52732"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52747"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52762"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52821"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52841"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52846"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52882"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26936"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26954"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27014"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27019"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27044"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35796"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35815"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35819"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35828"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35839"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35870"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35887"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35910"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35932"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35937"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35951"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35965"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35966"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35982"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36016"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36916"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36917"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36919"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36928"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36952"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36954"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36968"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47366",
"CVE-2022-48673",
"CVE-2022-48693",
"CVE-2023-52670",
"CVE-2023-52672",
"CVE-2023-52693",
"CVE-2023-52708",
"CVE-2023-52732",
"CVE-2023-52739",
"CVE-2023-52747",
"CVE-2023-52762",
"CVE-2023-52810",
"CVE-2023-52821",
"CVE-2023-52841",
"CVE-2023-52846",
"CVE-2023-52882",
"CVE-2024-26936",
"CVE-2024-26947",
"CVE-2024-26954",
"CVE-2024-26960",
"CVE-2024-27014",
"CVE-2024-27019",
"CVE-2024-27044",
"CVE-2024-35796",
"CVE-2024-35815",
"CVE-2024-35819",
"CVE-2024-35828",
"CVE-2024-35839",
"CVE-2024-35870",
"CVE-2024-35887",
"CVE-2024-35910",
"CVE-2024-35932",
"CVE-2024-35935",
"CVE-2024-35937",
"CVE-2024-35951",
"CVE-2024-35965",
"CVE-2024-35966",
"CVE-2024-35982",
"CVE-2024-36016",
"CVE-2024-36916",
"CVE-2024-36917",
"CVE-2024-36919",
"CVE-2024-36928",
"CVE-2024-36952",
"CVE-2024-36954",
"CVE-2024-36960",
"CVE-2024-36968",
"CVE-2024-36971"
]
}
OESA-2024-1767 (CVE-2021-47231)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
can: mcba_usb: fix memory leak in mcba_usb
Syzbot reported memory leak in SocketCAN driver for Microchip CAN BUS Analyzer Tool. The problem was in unfreed usb_coherent.
In mcba_usb_start() 20 coherent buffers are allocated and there is nothing, that frees them:
1) In callback function the urb is resubmitted and that's all 2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER is not set (see mcba_usb_start) and this flag cannot be used with coherent buffers.
Fail log: | [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected | [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)
So, all allocated buffers should be freed with usb_free_coherent() explicitly
NOTE: The same pattern for allocating and freeing coherent buffers is used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)
In the Linux kernel, the following vulnerability has been resolved:
can: j1939: fix Use-after-Free, hold skb ref while in use
This patch fixes a Use-after-Free found by the syzbot.
The problem is that a skb is taken from the per-session skb queue, without incrementing the ref count. This leads to a Use-after-Free if the skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: Avoid WARN_ON timing related checks
The soft/batadv interface for a queued OGM can be changed during the time the OGM was queued for transmission and when the OGM is actually transmitted by the worker.
But WARN_ON must be used to denote kernel bugs and not to print simple warnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)
In the Linux kernel, the following vulnerability has been resolved:
media: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()
Fix an 11-year old bug in ngene_command_config_free_buf() while addressing the following warnings caught with -Warray-bounds:
arch/alpha/include/asm/string.h:22:16: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds] arch/x86/include/asm/string_32.h:182:25: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds]
The problem is that the original code is trying to copy 6 bytes of data into a one-byte size member config of the wrong structue FW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a legitimate compiler warning because memcpy() overruns the length of &com.cmd.ConfigureBuffers.config. It seems that the right structure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains 6 more members apart from the header hdr. Also, the name of the function ngene_command_config_free_buf() suggests that the actual intention is to ConfigureFreeBuffers, instead of ConfigureBuffers (which takes place in the function ngene_command_config_buf(), above).
Fix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS into new struct config, and use &com.cmd.ConfigureFreeBuffers.config as the destination address, instead of &com.cmd.ConfigureBuffers.config, when calling memcpy().
This also helps with the ongoing efforts to globally enable -Warray-bounds and get us closer to being able to tighten the FORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)
In the Linux kernel, the following vulnerability has been resolved:
coresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()
commit 6f755e85c332 ("coresight: Add helper for inserting synchronization packets") removed trailing '\0' from barrier_pkt array and updated the call sites like etb_update_buffer() to have proper checks for barrier_pkt size before read but missed updating tmc_update_etf_buffer() which still reads barrier_pkt past the array size resulting in KASAN out-of-bounds bug. Fix this by adding a check for barrier_pkt size before accessing like it is done in etb_update_buffer().
BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698 Read of size 4 at addr ffffffd05b7d1030 by task perf/2629
Call trace: dump_backtrace+0x0/0x27c show_stack+0x20/0x2c dump_stack+0x11c/0x188 print_address_description+0x3c/0x4a4 __kasan_report+0x140/0x164 kasan_report+0x10/0x18 __asan_report_load4_noabort+0x1c/0x24 tmc_update_etf_buffer+0x4b8/0x698 etm_event_stop+0x248/0x2d8 etm_event_del+0x20/0x2c event_sched_out+0x214/0x6f0 group_sched_out+0xd0/0x270 ctx_sched_out+0x2ec/0x518 __perf_event_task_sched_out+0x4fc/0xe6c __schedule+0x1094/0x16a0 preempt_schedule_irq+0x88/0x170 arm64_preempt_schedule_irq+0xf0/0x18c el1_irq+0xe8/0x180 perf_event_exec+0x4d8/0x56c setup_new_exec+0x204/0x400 load_elf_binary+0x72c/0x18c0 search_binary_handler+0x13c/0x420 load_script+0x500/0x6c4 search_binary_handler+0x13c/0x420 exec_binprm+0x118/0x654 __do_execve_file+0x77c/0xba4 __arm64_compat_sys_execve+0x98/0xac el0_svc_common+0x1f8/0x5e0 el0_svc_compat_handler+0x84/0xb0 el0_svc_compat+0x10/0x50
The buggy address belongs to the variable: barrier_pkt+0x10/0x40
Memory state around the buggy address: ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00 ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 >ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03 ^ ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa ==================================================================(CVE-2021-47346)
In the Linux kernel, the following vulnerability has been resolved:
wl1251: Fix possible buffer overflow in wl1251_cmd_scan
Function wl1251_cmd_scan calls memcpy without checking the length. Harden by checking the length is within the maximum allowed size.(CVE-2021-47347)
In the Linux kernel, the following vulnerability has been resolved:
xhci: Fix command ring pointer corruption while aborting a command
The command ring pointer is located at [6:63] bits of the command ring control register (CRCR). All the control bits like command stop, abort are located at [0:3] bits. While aborting a command, we read the CRCR and set the abort bit and write to the CRCR. The read will always give command ring pointer as all zeros. So we essentially write only the control bits. Since we split the 64 bit write into two 32 bit writes, there is a possibility of xHC command ring stopped before the upper dword (all zeros) is written. If that happens, xHC updates the upper dword of its internal command ring pointer with all zeros. Next time, when the command ring is restarted, we see xHC memory access failures. Fix this issue by only writing to the lower dword of CRCR where all control bits are located.(CVE-2021-47434)
In the Linux kernel, the following vulnerability has been resolved:
mm, slub: fix potential memoryleak in kmem_cache_open()
In error path, the random_seq of slub cache might be leaked. Fix this by using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix race between searching chunks and release journal_head from buffer_head
Encountered a race between ocfs2_test_bg_bit_allocatable() and jbd2_journal_put_journal_head() resulting in the below vmcore.
PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: "loop3" Call trace: panic oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [exception RIP: ocfs2_block_group_find_clear_bits+316] ocfs2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] ocfs2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork
When ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the bg_bh->b_private NULL as jbd2_journal_put_journal_head() raced and released the jounal head from the buffer head. Needed to take bit lock for the bit 'BH_JournalHead' to fix this race.(CVE-2021-47493)
In the Linux kernel, the following vulnerability has been resolved:
iio: mma8452: Fix trigger reference couting
The mma8452 driver directly assigns a trigger to the struct iio_dev. The
IIO core when done using this trigger will call iio_trigger_put() to drop
the reference count by 1.
Without the matching iio_trigger_get() in the driver the reference count
can reach 0 too early, the trigger gets freed while still in use and a
use-after-free occurs.
Fix this by getting a reference to the trigger before assigning it to the IIO device.(CVE-2021-47500)
In the Linux kernel, the following vulnerability has been resolved:
can: sja1000: fix use after free in ems_pcmcia_add_card()
If the last channel is not available then "dev" is freed. Fortunately, we can just use "pdev->irq" instead.
Also we should check if at least one channel was set up.(CVE-2021-47521)
In the Linux kernel, the following vulnerability has been resolved:
scsi: mpt3sas: Fix kernel panic during drive powercycle test
While looping over shost's sdev list it is possible that one of the drives is getting removed and its sas_target object is freed but its sdev object remains intact.
Consequently, a kernel panic can occur while the driver is trying to access the sas_address field of sas_target object without also checking the sas_target object for NULL.(CVE-2021-47565)
In the Linux kernel, the following vulnerability has been resolved:
inet_diag: fix kernel-infoleak for UDP sockets
KMSAN reported a kernel-infoleak [1], that can exploited by unpriv users.
After analysis it turned out UDP was not initializing r->idiag_expires. Other users of inet_sk_diag_fill() might make the same mistake in the future, so fix this in inet_sk_diag_fill().
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline] BUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 instrument_copy_to_user include/linux/instrumented.h:121 [inline] copyout lib/iov_iter.c:156 [inline] _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 copy_to_iter include/linux/uio.h:155 [inline] simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519 __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425 skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533 skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline] netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974 sock_recvmsg_nosec net/socket.c:944 [inline] sock_recvmsg net/socket.c:962 [inline] sock_read_iter+0x5a9/0x630 net/socket.c:1035 call_read_iter include/linux/fs.h:2156 [inline] new_sync_read fs/read_write.c:400 [inline] vfs_read+0x1631/0x1980 fs/read_write.c:481 ksys_read+0x28c/0x520 fs/read_write.c:619 __do_sys_read fs/read_write.c:629 [inline] __se_sys_read fs/read_write.c:627 [inline] __x64_sys_read+0xdb/0x120 fs/read_write.c:627 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Uninit was created at: slab_post_alloc_hook mm/slab.h:524 [inline] slab_alloc_node mm/slub.c:3251 [inline] __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974 kmalloc_reserve net/core/skbuff.c:354 [inline] __alloc_skb+0x545/0xf90 net/core/skbuff.c:426 alloc_skb include/linux/skbuff.h:1126 [inline] netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245 __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370 netlink_dump_start include/linux/netlink.h:254 [inline] inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343 sock_diag_rcv_msg+0x24a/0x620 netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491 sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916 sock_sendmsg_nosec net/socket.c:704 [inline] sock_sendmsg net/socket.c:724 [inline] sock_write_iter+0x594/0x690 net/socket.c:1057 do_iter_readv_writev+0xa7f/0xc70 do_iter_write+0x52c/0x1500 fs/read_write.c:851 vfs_writev fs/read_write.c:924 [inline] do_writev+0x63f/0xe30 fs/read_write.c:967 __do_sys_writev fs/read_write.c:1040 [inline] __se_sys_writev fs/read_write.c:1037 [inline] __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Bytes 68-71 of 312 are uninitialized Memory access of size 312 starts at ffff88812ab54000 Data copied to user address 0000000020001440
CPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)
In the Linux kernel, the following vulnerability has been resolved:
firmware: arm_scpi: Fix string overflow in SCPI genpd driver
Without the bound checks for scpi_pd->name, it could result in the buffer overflow when copying the SCPI device name from the corresponding device tree node as the name string is set at maximum size of 30.
Let us fix it by using devm_kasprintf so that the string buffer is allocated dynamically.(CVE-2021-47609)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()
We don't currently validate that the values being set are within the range we advertised to userspace as being valid, do so and reject any values that are out of range.(CVE-2022-48737)
In the Linux kernel, the following vulnerability has been resolved:
powerpc64/bpf: Limit 'ldbrx' to processors compliant with ISA v2.06
Johan reported the below crash with test_bpf on ppc64 e5500:
test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -> 0x67452301 jited:1 Oops: Exception in kernel mode, sig: 4 [#1] BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500 Modules linked in: test_bpf(+) CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1 NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18 REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty) MSR: 0000000080089000 <EE,ME> CR: 88002822 XER: 20000000 IRQMASK: 0 <...> NIP [8000000000061c3c] 0x8000000000061c3c LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf] Call Trace: .__run_one+0x60/0x17c [test_bpf] (unreliable) .test_bpf_init+0x6a8/0xdc8 [test_bpf] .do_one_initcall+0x6c/0x28c .do_init_module+0x68/0x28c .load_module+0x2460/0x2abc .__do_sys_init_module+0x120/0x18c .system_call_exception+0x110/0x1b8 system_call_common+0xf0/0x210 --- interrupt: c00 at 0x101d0acc <...> ---[ end trace 47b2bf19090bb3d0 ]---
Illegal instruction
The illegal instruction turned out to be 'ldbrx' emitted for BPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of the same and implement an alternative approach for older processors.(CVE-2022-48755)
In the Linux kernel, the following vulnerability has been resolved:
drm/msm/dsi: invalid parameter check in msm_dsi_phy_enable
The function performs a check on the "phy" input parameter, however, it is used before the check.
Initialize the "dev" variable after the sanity check to avoid a possible NULL pointer dereference.
Addresses-Coverity-ID: 1493860 ("Null pointer dereference")(CVE-2022-48756)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)
In the Linux kernel, the following vulnerability has been resolved:
atl1c: Work around the DMA RX overflow issue
This is based on alx driver commit 881d0327db37 ("net: alx: Work around the DMA RX overflow issue").
The alx and atl1c drivers had RX overflow error which was why a custom allocator was created to avoid certain addresses. The simpler workaround then created for alx driver, but not for atl1c due to lack of tester.
Instead of using a custom allocator, check the allocated skb address and use skb_reserve() to move away from problematic 0x...fc0 address.
Tested on AR8131 on Acer 4540.(CVE-2023-52834)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Stop parsing channels bits when all channels are found.
If a usb audio device sets more bits than the amount of channels it could write outside of the map array.(CVE-2024-27436)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete
FFS based applications can utilize the aio_cancel() callback to dequeue pending USB requests submitted to the UDC. There is a scenario where the FFS application issues an AIO cancel call, while the UDC is handling a soft disconnect. For a DWC3 based implementation, the callstack looks like the following:
DWC3 Gadget FFS Application
dwc3_gadget_soft_disconnect() ... --> dwc3_stop_active_transfers() --> dwc3_gadget_giveback(-ESHUTDOWN) --> ffs_epfile_async_io_complete() ffs_aio_cancel() --> usb_ep_free_request() --> usb_ep_dequeue()
There is currently no locking implemented between the AIO completion handler and AIO cancel, so the issue occurs if the completion routine is running in parallel to an AIO cancel call coming from the FFS application. As the completion call frees the USB request (io_data->req) the FFS application is also referencing it for the usb_ep_dequeue() call. This can lead to accessing a stale/hanging pointer.
commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently") relocated the usb_ep_free_request() into ffs_epfile_async_io_complete(). However, in order to properly implement locking to mitigate this issue, the spinlock can't be added to ffs_epfile_async_io_complete(), as usb_ep_dequeue() (if successfully dequeuing a USB request) will call the function driver's completion handler in the same context. Hence, leading into a deadlock.
Fix this issue by moving the usb_ep_free_request() back to ffs_user_copy_worker(), and ensuring that it explicitly sets io_data->req to NULL after freeing it within the ffs->eps_lock. This resolves the race condition above, as the ffs_aio_cancel() routine will not continue attempting to dequeue a request that has already been freed, or the ffs_user_copy_work() not freeing the USB request until the AIO cancel is done referencing it.
This fix depends on commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently")(CVE-2024-36894)
In the Linux kernel, the following vulnerability has been resolved:
wifi: nl80211: don't free NULL coalescing rule
If the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
of: module: add buffer overflow check in of_modalias()
In of_modalias(), if the buffer happens to be too small even for the 1st snprintf() call, the len parameter will become negative and str parameter (if not NULL initially) will point beyond the buffer's end. Add the buffer overflow check after the 1st snprintf() call and fix such check after the strlen() call (accounting for the terminating NUL char).(CVE-2024-38541)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ftrace: Fix possible use-after-free issue in ftrace_location()
KASAN reports a bug:
BUG: KASAN: use-after-free in ftrace_location+0x90/0x120 Read of size 8 at addr ffff888141d40010 by task insmod/424 CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+ [...] Call Trace: <TASK> dump_stack_lvl+0x68/0xa0 print_report+0xcf/0x610 kasan_report+0xb5/0xe0 ftrace_location+0x90/0x120 register_kprobe+0x14b/0xa40 kprobe_init+0x2d/0xff0 [kprobe_example] do_one_initcall+0x8f/0x2d0 do_init_module+0x13a/0x3c0 load_module+0x3082/0x33d0 init_module_from_file+0xd2/0x130 __x64_sys_finit_module+0x306/0x440 do_syscall_64+0x68/0x140 entry_SYSCALL_64_after_hwframe+0x71/0x79
The root cause is that, in lookup_rec(), ftrace record of some address is being searched in ftrace pages of some module, but those ftrace pages at the same time is being freed in ftrace_release_mod() as the corresponding module is being deleted:
CPU1 | CPU2
register_kprobes() { | delete_module() { check_kprobe_address_safe() { | arch_check_ftrace_location() { | ftrace_location() { | lookup_rec() // USE! | ftrace_release_mod() // Free!
To fix this issue: 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range(); 2. Use ftrace_location_range() instead of lookup_rec() in ftrace_location(); 3. Call synchronize_rcu() before freeing any ftrace pages both in ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)
In the Linux kernel, the following vulnerability has been resolved:
af_unix: Fix data races in unix_release_sock/unix_stream_sendmsg
A data-race condition has been identified in af_unix. In one data path, the write function unix_release_sock() atomically writes to sk->sk_shutdown using WRITE_ONCE. However, on the reader side, unix_stream_sendmsg() does not read it atomically. Consequently, this issue is causing the following KCSAN splat to occur:
BUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg
write (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:
unix_release_sock (net/unix/af_unix.c:640)
unix_release (net/unix/af_unix.c:1050)
sock_close (net/socket.c:659 net/socket.c:1421)
__fput (fs/file_table.c:422)
__fput_sync (fs/file_table.c:508)
__se_sys_close (fs/open.c:1559 fs/open.c:1541)
__x64_sys_close (fs/open.c:1541)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
read to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:
unix_stream_sendmsg (net/unix/af_unix.c:2273)
__sock_sendmsg (net/socket.c:730 net/socket.c:745)
____sys_sendmsg (net/socket.c:2584)
__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)
__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
value changed: 0x01 -> 0x03
The line numbers are related to commit dd5a440a31fa ("Linux 6.9-rc7").
Commit e1d09c2c2f57 ("af_unix: Fix data races around sk->sk_shutdown.") addressed a comparable issue in the past regarding sk->sk_shutdown. However, it overlooked resolving this particular data path. This patch only offending unix_stream_sendmsg() function, since the other reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.src.rpm"
],
"x86_64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2406.4.0.0283.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: mcba_usb: fix memory leak in mcba_usb\r\n\r\nSyzbot reported memory leak in SocketCAN driver for Microchip CAN BUS\nAnalyzer Tool. The problem was in unfreed usb_coherent.\r\n\r\nIn mcba_usb_start() 20 coherent buffers are allocated and there is\nnothing, that frees them:\r\n\r\n1) In callback function the urb is resubmitted and that\u0026apos;s all\n2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER\n is not set (see mcba_usb_start) and this flag cannot be used with\n coherent buffers.\r\n\r\nFail log:\n| [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected\n| [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)\r\n\r\nSo, all allocated buffers should be freed with usb_free_coherent()\nexplicitly\r\n\r\nNOTE:\nThe same pattern for allocating and freeing coherent buffers\nis used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: j1939: fix Use-after-Free, hold skb ref while in use\r\n\r\nThis patch fixes a Use-after-Free found by the syzbot.\r\n\r\nThe problem is that a skb is taken from the per-session skb queue,\nwithout incrementing the ref count. This leads to a Use-after-Free if\nthe skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: Avoid WARN_ON timing related checks\r\n\r\nThe soft/batadv interface for a queued OGM can be changed during the time\nthe OGM was queued for transmission and when the OGM is actually\ntransmitted by the worker.\r\n\r\nBut WARN_ON must be used to denote kernel bugs and not to print simple\nwarnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()\r\n\r\nFix an 11-year old bug in ngene_command_config_free_buf() while\naddressing the following warnings caught with -Warray-bounds:\r\n\r\narch/alpha/include/asm/string.h:22:16: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\narch/x86/include/asm/string_32.h:182:25: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\r\n\r\nThe problem is that the original code is trying to copy 6 bytes of\ndata into a one-byte size member _config_ of the wrong structue\nFW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a\nlegitimate compiler warning because memcpy() overruns the length\nof \u0026amp;com.cmd.ConfigureBuffers.config. It seems that the right\nstructure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains\n6 more members apart from the header _hdr_. Also, the name of\nthe function ngene_command_config_free_buf() suggests that the actual\nintention is to ConfigureFreeBuffers, instead of ConfigureBuffers\n(which takes place in the function ngene_command_config_buf(), above).\r\n\r\nFix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS\ninto new struct config, and use \u0026amp;com.cmd.ConfigureFreeBuffers.config as\nthe destination address, instead of \u0026amp;com.cmd.ConfigureBuffers.config,\nwhen calling memcpy().\r\n\r\nThis also helps with the ongoing efforts to globally enable\n-Warray-bounds and get us closer to being able to tighten the\nFORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncoresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()\r\n\r\ncommit 6f755e85c332 (\u0026quot;coresight: Add helper for inserting synchronization\npackets\u0026quot;) removed trailing \u0026apos;\\0\u0026apos; from barrier_pkt array and updated the\ncall sites like etb_update_buffer() to have proper checks for barrier_pkt\nsize before read but missed updating tmc_update_etf_buffer() which still\nreads barrier_pkt past the array size resulting in KASAN out-of-bounds\nbug. Fix this by adding a check for barrier_pkt size before accessing\nlike it is done in etb_update_buffer().\r\n\r\n BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698\n Read of size 4 at addr ffffffd05b7d1030 by task perf/2629\r\n\r\n Call trace:\n dump_backtrace+0x0/0x27c\n show_stack+0x20/0x2c\n dump_stack+0x11c/0x188\n print_address_description+0x3c/0x4a4\n __kasan_report+0x140/0x164\n kasan_report+0x10/0x18\n __asan_report_load4_noabort+0x1c/0x24\n tmc_update_etf_buffer+0x4b8/0x698\n etm_event_stop+0x248/0x2d8\n etm_event_del+0x20/0x2c\n event_sched_out+0x214/0x6f0\n group_sched_out+0xd0/0x270\n ctx_sched_out+0x2ec/0x518\n __perf_event_task_sched_out+0x4fc/0xe6c\n __schedule+0x1094/0x16a0\n preempt_schedule_irq+0x88/0x170\n arm64_preempt_schedule_irq+0xf0/0x18c\n el1_irq+0xe8/0x180\n perf_event_exec+0x4d8/0x56c\n setup_new_exec+0x204/0x400\n load_elf_binary+0x72c/0x18c0\n search_binary_handler+0x13c/0x420\n load_script+0x500/0x6c4\n search_binary_handler+0x13c/0x420\n exec_binprm+0x118/0x654\n __do_execve_file+0x77c/0xba4\n __arm64_compat_sys_execve+0x98/0xac\n el0_svc_common+0x1f8/0x5e0\n el0_svc_compat_handler+0x84/0xb0\n el0_svc_compat+0x10/0x50\r\n\r\n The buggy address belongs to the variable:\n barrier_pkt+0x10/0x40\r\n\r\n Memory state around the buggy address:\n ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00\n ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00\n \u0026gt;ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03\n ^\n ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa\n ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa\n ==================================================================(CVE-2021-47346)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwl1251: Fix possible buffer overflow in wl1251_cmd_scan\r\n\r\nFunction wl1251_cmd_scan calls memcpy without checking the length.\nHarden by checking the length is within the maximum allowed size.(CVE-2021-47347)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxhci: Fix command ring pointer corruption while aborting a command\r\n\r\nThe command ring pointer is located at [6:63] bits of the command\nring control register (CRCR). All the control bits like command stop,\nabort are located at [0:3] bits. While aborting a command, we read the\nCRCR and set the abort bit and write to the CRCR. The read will always\ngive command ring pointer as all zeros. So we essentially write only\nthe control bits. Since we split the 64 bit write into two 32 bit writes,\nthere is a possibility of xHC command ring stopped before the upper\ndword (all zeros) is written. If that happens, xHC updates the upper\ndword of its internal command ring pointer with all zeros. Next time,\nwhen the command ring is restarted, we see xHC memory access failures.\nFix this issue by only writing to the lower dword of CRCR where all\ncontrol bits are located.(CVE-2021-47434)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm, slub: fix potential memoryleak in kmem_cache_open()\r\n\r\nIn error path, the random_seq of slub cache might be leaked. Fix this\nby using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix race between searching chunks and release journal_head from buffer_head\r\n\r\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\r\n\r\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \u0026quot;loop3\u0026quot;\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\r\n\r\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u0026gt;b_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0026apos;BH_JournalHead\u0026apos; to fix this race.(CVE-2021-47493)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: mma8452: Fix trigger reference couting\r\n\r\nThe mma8452 driver directly assigns a trigger to the struct iio_dev. The\nIIO core when done using this trigger will call `iio_trigger_put()` to drop\nthe reference count by 1.\r\n\r\nWithout the matching `iio_trigger_get()` in the driver the reference count\ncan reach 0 too early, the trigger gets freed while still in use and a\nuse-after-free occurs.\r\n\r\nFix this by getting a reference to the trigger before assigning it to the\nIIO device.(CVE-2021-47500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: sja1000: fix use after free in ems_pcmcia_add_card()\r\n\r\nIf the last channel is not available then \u0026quot;dev\u0026quot; is freed. Fortunately,\nwe can just use \u0026quot;pdev-\u0026gt;irq\u0026quot; instead.\r\n\r\nAlso we should check if at least one channel was set up.(CVE-2021-47521)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: mpt3sas: Fix kernel panic during drive powercycle test\r\n\r\nWhile looping over shost\u0026apos;s sdev list it is possible that one\nof the drives is getting removed and its sas_target object is\nfreed but its sdev object remains intact.\r\n\r\nConsequently, a kernel panic can occur while the driver is trying to access\nthe sas_address field of sas_target object without also checking the\nsas_target object for NULL.(CVE-2021-47565)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet_diag: fix kernel-infoleak for UDP sockets\r\n\r\nKMSAN reported a kernel-infoleak [1], that can exploited\nby unpriv users.\r\n\r\nAfter analysis it turned out UDP was not initializing\nr-\u0026gt;idiag_expires. Other users of inet_sk_diag_fill()\nmight make the same mistake in the future, so fix this\nin inet_sk_diag_fill().\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline]\nBUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline]\nBUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n instrument_copy_to_user include/linux/instrumented.h:121 [inline]\n copyout lib/iov_iter.c:156 [inline]\n _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n copy_to_iter include/linux/uio.h:155 [inline]\n simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519\n __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425\n skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533\n skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline]\n netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974\n sock_recvmsg_nosec net/socket.c:944 [inline]\n sock_recvmsg net/socket.c:962 [inline]\n sock_read_iter+0x5a9/0x630 net/socket.c:1035\n call_read_iter include/linux/fs.h:2156 [inline]\n new_sync_read fs/read_write.c:400 [inline]\n vfs_read+0x1631/0x1980 fs/read_write.c:481\n ksys_read+0x28c/0x520 fs/read_write.c:619\n __do_sys_read fs/read_write.c:629 [inline]\n __se_sys_read fs/read_write.c:627 [inline]\n __x64_sys_read+0xdb/0x120 fs/read_write.c:627\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:524 [inline]\n slab_alloc_node mm/slub.c:3251 [inline]\n __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974\n kmalloc_reserve net/core/skbuff.c:354 [inline]\n __alloc_skb+0x545/0xf90 net/core/skbuff.c:426\n alloc_skb include/linux/skbuff.h:1126 [inline]\n netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245\n __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370\n netlink_dump_start include/linux/netlink.h:254 [inline]\n inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343\n sock_diag_rcv_msg+0x24a/0x620\n netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491\n sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916\n sock_sendmsg_nosec net/socket.c:704 [inline]\n sock_sendmsg net/socket.c:724 [inline]\n sock_write_iter+0x594/0x690 net/socket.c:1057\n do_iter_readv_writev+0xa7f/0xc70\n do_iter_write+0x52c/0x1500 fs/read_write.c:851\n vfs_writev fs/read_write.c:924 [inline]\n do_writev+0x63f/0xe30 fs/read_write.c:967\n __do_sys_writev fs/read_write.c:1040 [inline]\n __se_sys_writev fs/read_write.c:1037 [inline]\n __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nBytes 68-71 of 312 are uninitialized\nMemory access of size 312 starts at ffff88812ab54000\nData copied to user address 0000000020001440\r\n\r\nCPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirmware: arm_scpi: Fix string overflow in SCPI genpd driver\r\n\r\nWithout the bound checks for scpi_pd-\u0026gt;name, it could result in the buffer\noverflow when copying the SCPI device name from the corresponding device\ntree node as the name string is set at maximum size of 30.\r\n\r\nLet us fix it by using devm_kasprintf so that the string buffer is\nallocated dynamically.(CVE-2021-47609)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()\r\n\r\nWe don\u0026apos;t currently validate that the values being set are within the range\nwe advertised to userspace as being valid, do so and reject any values\nthat are out of range.(CVE-2022-48737)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc64/bpf: Limit \u0026apos;ldbrx\u0026apos; to processors compliant with ISA v2.06\r\n\r\nJohan reported the below crash with test_bpf on ppc64 e5500:\r\n\r\n test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -\u0026gt; 0x67452301 jited:1\n Oops: Exception in kernel mode, sig: 4 [#1]\n BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500\n Modules linked in: test_bpf(+)\n CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1\n NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18\n REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty)\n MSR: 0000000080089000 \u0026lt;EE,ME\u0026gt; CR: 88002822 XER: 20000000 IRQMASK: 0\n \u0026lt;...\u0026gt;\n NIP [8000000000061c3c] 0x8000000000061c3c\n LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf]\n Call Trace:\n .__run_one+0x60/0x17c [test_bpf] (unreliable)\n .test_bpf_init+0x6a8/0xdc8 [test_bpf]\n .do_one_initcall+0x6c/0x28c\n .do_init_module+0x68/0x28c\n .load_module+0x2460/0x2abc\n .__do_sys_init_module+0x120/0x18c\n .system_call_exception+0x110/0x1b8\n system_call_common+0xf0/0x210\n --- interrupt: c00 at 0x101d0acc\n \u0026lt;...\u0026gt;\n ---[ end trace 47b2bf19090bb3d0 ]---\r\n\r\n Illegal instruction\r\n\r\nThe illegal instruction turned out to be \u0026apos;ldbrx\u0026apos; emitted for\nBPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of\nthe same and implement an alternative approach for older processors.(CVE-2022-48755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/msm/dsi: invalid parameter check in msm_dsi_phy_enable\r\n\r\nThe function performs a check on the \u0026quot;phy\u0026quot; input parameter, however, it\nis used before the check.\r\n\r\nInitialize the \u0026quot;dev\u0026quot; variable after the sanity check to avoid a possible\nNULL pointer dereference.\r\n\r\nAddresses-Coverity-ID: 1493860 (\u0026quot;Null pointer dereference\u0026quot;)(CVE-2022-48756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nFix page corruption caused by racy check in __free_pages\r\n\r\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\r\n\r\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\r\n\r\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\r\n\r\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\u0026quot;mm/page_alloc.c: fix freeing non-compound pages\u0026quot;):\r\n\r\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u0026gt; 0)\n\t\t\tfree_the_page(page + (1 \u0026lt;\u0026lt; order), order);\r\n\r\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\natl1c: Work around the DMA RX overflow issue\r\n\r\nThis is based on alx driver commit 881d0327db37 (\u0026quot;net: alx: Work around\nthe DMA RX overflow issue\u0026quot;).\r\n\r\nThe alx and atl1c drivers had RX overflow error which was why a custom\nallocator was created to avoid certain addresses. The simpler workaround\nthen created for alx driver, but not for atl1c due to lack of tester.\r\n\r\nInstead of using a custom allocator, check the allocated skb address and\nuse skb_reserve() to move away from problematic 0x...fc0 address.\r\n\r\nTested on AR8131 on Acer 4540.(CVE-2023-52834)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: usb-audio: Stop parsing channels bits when all channels are found.\r\n\r\nIf a usb audio device sets more bits than the amount of channels\nit could write outside of the map array.(CVE-2024-27436)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete\r\n\r\nFFS based applications can utilize the aio_cancel() callback to dequeue\npending USB requests submitted to the UDC. There is a scenario where the\nFFS application issues an AIO cancel call, while the UDC is handling a\nsoft disconnect. For a DWC3 based implementation, the callstack looks\nlike the following:\r\n\r\n DWC3 Gadget FFS Application\ndwc3_gadget_soft_disconnect() ...\n --\u0026gt; dwc3_stop_active_transfers()\n --\u0026gt; dwc3_gadget_giveback(-ESHUTDOWN)\n --\u0026gt; ffs_epfile_async_io_complete() ffs_aio_cancel()\n --\u0026gt; usb_ep_free_request() --\u0026gt; usb_ep_dequeue()\r\n\r\nThere is currently no locking implemented between the AIO completion\nhandler and AIO cancel, so the issue occurs if the completion routine is\nrunning in parallel to an AIO cancel call coming from the FFS application.\nAs the completion call frees the USB request (io_data-\u0026gt;req) the FFS\napplication is also referencing it for the usb_ep_dequeue() call. This can\nlead to accessing a stale/hanging pointer.\r\n\r\ncommit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status consistently\u0026quot;)\nrelocated the usb_ep_free_request() into ffs_epfile_async_io_complete().\nHowever, in order to properly implement locking to mitigate this issue, the\nspinlock can\u0026apos;t be added to ffs_epfile_async_io_complete(), as\nusb_ep_dequeue() (if successfully dequeuing a USB request) will call the\nfunction driver\u0026apos;s completion handler in the same context. Hence, leading\ninto a deadlock.\r\n\r\nFix this issue by moving the usb_ep_free_request() back to\nffs_user_copy_worker(), and ensuring that it explicitly sets io_data-\u0026gt;req\nto NULL after freeing it within the ffs-\u0026gt;eps_lock. This resolves the race\ncondition above, as the ffs_aio_cancel() routine will not continue\nattempting to dequeue a request that has already been freed, or the\nffs_user_copy_work() not freeing the USB request until the AIO cancel is\ndone referencing it.\r\n\r\nThis fix depends on\n commit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status\n consistently\u0026quot;)(CVE-2024-36894)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: nl80211: don\u0026apos;t free NULL coalescing rule\r\n\r\nIf the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: module: add buffer overflow check in of_modalias()\r\n\r\nIn of_modalias(), if the buffer happens to be too small even for the 1st\nsnprintf() call, the len parameter will become negative and str parameter\n(if not NULL initially) will point beyond the buffer\u0026apos;s end. Add the buffer\noverflow check after the 1st snprintf() call and fix such check after the\nstrlen() call (accounting for the terminating NUL char).(CVE-2024-38541)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nftrace: Fix possible use-after-free issue in ftrace_location()\r\n\r\nKASAN reports a bug:\r\n\r\n BUG: KASAN: use-after-free in ftrace_location+0x90/0x120\n Read of size 8 at addr ffff888141d40010 by task insmod/424\n CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x68/0xa0\n print_report+0xcf/0x610\n kasan_report+0xb5/0xe0\n ftrace_location+0x90/0x120\n register_kprobe+0x14b/0xa40\n kprobe_init+0x2d/0xff0 [kprobe_example]\n do_one_initcall+0x8f/0x2d0\n do_init_module+0x13a/0x3c0\n load_module+0x3082/0x33d0\n init_module_from_file+0xd2/0x130\n __x64_sys_finit_module+0x306/0x440\n do_syscall_64+0x68/0x140\n entry_SYSCALL_64_after_hwframe+0x71/0x79\r\n\r\nThe root cause is that, in lookup_rec(), ftrace record of some address\nis being searched in ftrace pages of some module, but those ftrace pages\nat the same time is being freed in ftrace_release_mod() as the\ncorresponding module is being deleted:\r\n\r\n CPU1 | CPU2\n register_kprobes() { | delete_module() {\n check_kprobe_address_safe() { |\n arch_check_ftrace_location() { |\n ftrace_location() { |\n lookup_rec() // USE! | ftrace_release_mod() // Free!\r\n\r\nTo fix this issue:\n 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range();\n 2. Use ftrace_location_range() instead of lookup_rec() in\n ftrace_location();\n 3. Call synchronize_rcu() before freeing any ftrace pages both in\n ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\naf_unix: Fix data races in unix_release_sock/unix_stream_sendmsg\r\n\r\nA data-race condition has been identified in af_unix. In one data path,\nthe write function unix_release_sock() atomically writes to\nsk-\u0026gt;sk_shutdown using WRITE_ONCE. However, on the reader side,\nunix_stream_sendmsg() does not read it atomically. Consequently, this\nissue is causing the following KCSAN splat to occur:\r\n\r\n\tBUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg\r\n\r\n\twrite (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:\n\tunix_release_sock (net/unix/af_unix.c:640)\n\tunix_release (net/unix/af_unix.c:1050)\n\tsock_close (net/socket.c:659 net/socket.c:1421)\n\t__fput (fs/file_table.c:422)\n\t__fput_sync (fs/file_table.c:508)\n\t__se_sys_close (fs/open.c:1559 fs/open.c:1541)\n\t__x64_sys_close (fs/open.c:1541)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tread to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:\n\tunix_stream_sendmsg (net/unix/af_unix.c:2273)\n\t__sock_sendmsg (net/socket.c:730 net/socket.c:745)\n\t____sys_sendmsg (net/socket.c:2584)\n\t__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)\n\t__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tvalue changed: 0x01 -\u0026gt; 0x03\r\n\r\nThe line numbers are related to commit dd5a440a31fa (\u0026quot;Linux 6.9-rc7\u0026quot;).\r\n\r\nCommit e1d09c2c2f57 (\u0026quot;af_unix: Fix data races around sk-\u0026gt;sk_shutdown.\u0026quot;)\naddressed a comparable issue in the past regarding sk-\u0026gt;sk_shutdown.\nHowever, it overlooked resolving this particular data path.\nThis patch only offending unix_stream_sendmsg() function, since the\nother reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)",
"id": "OESA-2024-1767",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1767"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47231"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47232"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47252"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47288"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47346"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47347"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47434"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47493"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47521"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47565"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47597"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47609"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52834"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27436"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38541"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38596"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47231",
"CVE-2021-47232",
"CVE-2021-47252",
"CVE-2021-47288",
"CVE-2021-47346",
"CVE-2021-47347",
"CVE-2021-47434",
"CVE-2021-47466",
"CVE-2021-47469",
"CVE-2021-47493",
"CVE-2021-47500",
"CVE-2021-47521",
"CVE-2021-47565",
"CVE-2021-47597",
"CVE-2021-47609",
"CVE-2022-48737",
"CVE-2022-48755",
"CVE-2022-48756",
"CVE-2023-52670",
"CVE-2023-52739",
"CVE-2023-52834",
"CVE-2023-52853",
"CVE-2024-27436",
"CVE-2024-35830",
"CVE-2024-36894",
"CVE-2024-36941",
"CVE-2024-36950",
"CVE-2024-36971",
"CVE-2024-38538",
"CVE-2024-38541",
"CVE-2024-38552",
"CVE-2024-38588",
"CVE-2024-38596",
"CVE-2024-38607"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.