Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-53380 (GCVE-0-2023-53380)
Vulnerability from cvelistv5 – Published: 2025-09-18 13:33 – Updated: 2026-05-11 19:43- CWE-476 - NULL Pointer Dereference
| Vendor | Product | Version | |
|---|---|---|---|
| Linux | Linux |
Affected:
ee37d7314a32ab6809eacc3389bad0406c69a81f , < 45fa023b3334a7ae6f6c4eb977295804222dfa28
(git)
Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < 2990e2ece18dd4cca71b3109c80517ad94adb065 (git) Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f (git) Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < 222cc459d59857ee28a5366dc225ab42b22f9272 (git) Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < b5015b97adda6a24dd3e713c63e521ecbeff25c6 (git) Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < 144c7fd008e0072b0b565f1157eec618de54ca8a (git) Affected: ee37d7314a32ab6809eacc3389bad0406c69a81f , < 34817a2441747b48e444cb0e05d84e14bc9443da (git) |
|
| Linux | Linux |
Affected:
4.20
Unaffected: 0 , < 4.20 (semver) Unaffected: 5.4.251 , ≤ 5.4.* (semver) Unaffected: 5.10.188 , ≤ 5.10.* (semver) Unaffected: 5.15.121 , ≤ 5.15.* (semver) Unaffected: 6.1.39 , ≤ 6.1.* (semver) Unaffected: 6.3.13 , ≤ 6.3.* (semver) Unaffected: 6.4.4 , ≤ 6.4.* (semver) Unaffected: 6.5 , ≤ * (original_commit_for_fix) |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53380",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:56:06.480784Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-476",
"description": "CWE-476 NULL Pointer Dereference",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T19:03:04.150Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "45fa023b3334a7ae6f6c4eb977295804222dfa28",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "2990e2ece18dd4cca71b3109c80517ad94adb065",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "222cc459d59857ee28a5366dc225ab42b22f9272",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "b5015b97adda6a24dd3e713c63e521ecbeff25c6",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "144c7fd008e0072b0b565f1157eec618de54ca8a",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "34817a2441747b48e444cb0e05d84e14bc9443da",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.20"
},
{
"lessThan": "4.20",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.251",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.188",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.121",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.39",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.3.*",
"status": "unaffected",
"version": "6.3.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.251",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.188",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.121",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.39",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3.13",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.4.4",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5",
"versionStartIncluding": "4.20",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0027mreplace\u0027 in raid10_sync_request(). In the first\ncheck, \u0027need_replace\u0027 will be set and \u0027mreplace\u0027 will be used later if\nno-Faulty \u0027mreplace\u0027 exists, In the second check, \u0027mreplace\u0027 will be\nset to NULL if it is Faulty, but \u0027need_replace\u0027 will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0027need_replace\u0027 with\n\u0027mreplace\u0027 because their values are always the same."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:43:49.796Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28"
},
{
"url": "https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065"
},
{
"url": "https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f"
},
{
"url": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272"
},
{
"url": "https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6"
},
{
"url": "https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a"
},
{
"url": "https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da"
}
],
"title": "md/raid10: fix null-ptr-deref of mreplace in raid10_sync_request",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53380",
"datePublished": "2025-09-18T13:33:25.383Z",
"dateReserved": "2025-09-17T14:54:09.736Z",
"dateUpdated": "2026-05-11T19:43:49.796Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-53380",
"date": "2026-10-02",
"epss": "0.00145",
"percentile": "0.03229"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "45fa023b3334a7ae6f6c4eb977295804222dfa28",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "2990e2ece18dd4cca71b3109c80517ad94adb065",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "222cc459d59857ee28a5366dc225ab42b22f9272",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "b5015b97adda6a24dd3e713c63e521ecbeff25c6",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "144c7fd008e0072b0b565f1157eec618de54ca8a",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "34817a2441747b48e444cb0e05d84e14bc9443da",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.20"
},
{
"lessThan": "4.20",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.251",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.188",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.121",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.39",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.3.*",
"status": "unaffected",
"version": "6.3.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7FA663C4-CA72-4B5A-8592-7354D978F58E",
"versionEndExcluding": "5.4.251",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "43CAE50A-4A6C-488E-813C-F8DB77C13C8B",
"versionEndExcluding": "5.10.188",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EC77775B-EC31-4966-966C-1286C02B2A85",
"versionEndExcluding": "5.15.121",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9BD1D4A1-304D-4187-8178-6D7C0050B1AF",
"versionEndExcluding": "6.1.39",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "95CB4836-7F5D-4C20-B025-8E046EC87B78",
"versionEndExcluding": "6.3.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6AB81046-CB69-4115-924C-963B37C41385",
"versionEndExcluding": "6.4.4",
"versionStartIncluding": "6.4",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0027mreplace\u0027 in raid10_sync_request(). In the first\ncheck, \u0027need_replace\u0027 will be set and \u0027mreplace\u0027 will be used later if\nno-Faulty \u0027mreplace\u0027 exists, In the second check, \u0027mreplace\u0027 will be\nset to NULL if it is Faulty, but \u0027need_replace\u0027 will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0027need_replace\u0027 with\n\u0027mreplace\u0027 because their values are always the same."
}
],
"id": "CVE-2023-53380",
"lastModified": "2026-06-17T06:45:09.573",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53380",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:56:06.480784Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-18T14:15:40.953",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-06-29T22:19:54+00:00",
"cve": "CVE-2023-53380",
"id": "CVE-2023-53380",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:fixed": "399",
"product_status:known_affected": "52",
"product_status:known_not_affected": "104",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: md/raid10: fix null-ptr-deref of mreplace in raid10_sync_request",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-53380.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53380",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:56:06.480784Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-476",
"description": "CWE-476 NULL Pointer Dereference",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T18:56:00.843Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "45fa023b3334a7ae6f6c4eb977295804222dfa28",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "2990e2ece18dd4cca71b3109c80517ad94adb065",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "222cc459d59857ee28a5366dc225ab42b22f9272",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "b5015b97adda6a24dd3e713c63e521ecbeff25c6",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "144c7fd008e0072b0b565f1157eec618de54ca8a",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "34817a2441747b48e444cb0e05d84e14bc9443da",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.20"
},
{
"lessThan": "4.20",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.251",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.188",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.121",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.39",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.3.*",
"status": "unaffected",
"version": "6.3.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.251",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.188",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.121",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.39",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3.13",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.4.4",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5",
"versionStartIncluding": "4.20",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0027mreplace\u0027 in raid10_sync_request(). In the first\ncheck, \u0027need_replace\u0027 will be set and \u0027mreplace\u0027 will be used later if\nno-Faulty \u0027mreplace\u0027 exists, In the second check, \u0027mreplace\u0027 will be\nset to NULL if it is Faulty, but \u0027need_replace\u0027 will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0027need_replace\u0027 with\n\u0027mreplace\u0027 because their values are always the same."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:43:49.796Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28"
},
{
"url": "https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065"
},
{
"url": "https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f"
},
{
"url": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272"
},
{
"url": "https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6"
},
{
"url": "https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a"
},
{
"url": "https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da"
}
],
"title": "md/raid10: fix null-ptr-deref of mreplace in raid10_sync_request",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53380",
"datePublished": "2025-09-18T13:33:25.383Z",
"dateReserved": "2025-09-17T14:54:09.736Z",
"dateUpdated": "2026-05-11T19:43:49.796Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
BDU:2026-03360 (CVE-2023-53380)
Vulnerability from fstec – Published: 2026-03-19 – Updated: 2026-03-19 – View on bdu.fstec.ru Fixed{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Red Hat, Inc., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "8 (Red Hat Enterprise Linux), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 9 (Red Hat Enterprise Linux), \u043e\u0442 5.5 \u0434\u043e 5.10.187 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.120 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.38 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.2 \u0434\u043e 6.3.12 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.20 \u0434\u043e 5.4.250 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.4 \u0434\u043e 6.4.3 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\n\u0414\u043b\u044f Linux:\nhttps://lore.kernel.org/linux-cve-announce/2025091856-CVE-2023-53380-b2e0@gregkh/\nhttps://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272\nhttps://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065\nhttps://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28\nhttps://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f\nhttps://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6\nhttps://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a\nhttps://git.kernel.org/linus/34817a2441747b48e444cb0e05d84e14bc9443da\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-53380\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/cve-2023-53380",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "27.05.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "19.03.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "19.03.2026",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2026-03360",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-53380",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Red Hat Enterprise Linux, Debian GNU/Linux, Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Red Hat, Inc. Red Hat Enterprise Linux 8 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.5 \u0434\u043e 5.10.187 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.11 \u0434\u043e 5.15.120 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.16 \u0434\u043e 6.1.38 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.2 \u0434\u043e 6.3.12 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.20 \u0434\u043e 5.4.250 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.4 \u0434\u043e 6.4.3 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 raid10_sync_request() \u043c\u043e\u0434\u0443\u043b\u044f drivers/md/raid10.c \u0434\u0440\u0430\u0439\u0432\u0435\u0440\u0430 \u043d\u0435\u0441\u043a\u043e\u043b\u044c\u043a\u0438\u0445 \u0443\u0441\u0442\u0440\u043e\u0439\u0441\u0442\u0432 (RAID \u0438 LVM) \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0421\u0438\u0442\u0443\u0430\u0446\u0438\u044f \u0433\u043e\u043d\u043a\u0438 Time-of-check Time-of-use (TOCTOU) (CWE-367), \u0420\u0430\u0437\u044b\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u043a\u0430\u0437\u0430\u0442\u0435\u043b\u044f NULL (CWE-476)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 raid10_sync_request() \u043c\u043e\u0434\u0443\u043b\u044f drivers/md/raid10.c \u0434\u0440\u0430\u0439\u0432\u0435\u0440\u0430 \u043d\u0435\u0441\u043a\u043e\u043b\u044c\u043a\u0438\u0445 \u0443\u0441\u0442\u0440\u043e\u0439\u0441\u0442\u0432 (RAID \u0438 LVM) \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043e\u0448\u0438\u0431\u043a\u0430\u043c\u0438 \u043e\u0442\u043e\u0431\u0440\u0430\u0436\u0435\u043d\u0438\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438 \u043e \u0441\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0438 \u0440\u0435\u0441\u0443\u0440\u0441\u0430 \u0432 \u0440\u0435\u0437\u0443\u043b\u044c\u0442\u0430\u0442\u0435 \u043d\u0435\u0441\u043e\u0433\u043b\u0430\u0441\u043e\u0432\u0430\u043d\u043d\u043e\u0441\u0442\u0438 \u043f\u0440\u043e\u0432\u0435\u0440\u043e\u043a. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0440\u043e\u043a\u0430\u043c\u0438 \u0438 \u0441\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435\u043c, \u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272\nhttps://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065\nhttps://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28\nhttps://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f\nhttps://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6\nhttps://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a\nhttps://www.cve.org/CVERecord?id=CVE-2023-53380\nhttps://git.kernel.org/linus/34817a2441747b48e444cb0e05d84e14bc9443da\nhttps://lore.kernel.org/linux-cve-announce/2025091856-CVE-2023-53380-b2e0@gregkh/\nhttps://security-tracker.debian.org/tracker/CVE-2023-53380\nhttps://access.redhat.com/security/cve/cve-2023-53380",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-367, CWE-476",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
BELL-CVE-2023-53380 (CVE-2023-53380)
Vulnerability from osv_bellsoft – Published: 2025-09-19 06:04 – Updated: 2025-09-19 06:04 – Source website| URL | Type | |
|---|---|---|
{
"affected": [
{
"package": {
"ecosystem": "Alpaquita:23",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=23"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.38-r0"
},
{
"fixed": "6.1.42-r0"
}
],
"type": "ECOSYSTEM"
}
]
},
{
"package": {
"ecosystem": "Alpaquita:stream",
"name": "linux-lts",
"purl": "pkg:apk/alpaquita/linux-lts?arch=source\u0026distro=stream"
},
"ranges": [
{
"events": [
{
"introduced": "6.1.112-r0"
},
{
"fixed": "6.6.58-r0"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"id": "BELL-CVE-2023-53380",
"modified": "2025-09-19T06:04:54.134306Z",
"published": "2025-09-19T06:04:54.134304Z",
"references": [
{
"type": "ADVISORY",
"url": "https://docs.bell-sw.com/security/cves/CVE-2023-53380"
}
],
"schema_version": "1.7.4",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
],
"upstream": [
"CVE-2023-53380"
]
}
CERTFR-2025-AVI-0895
Vulnerability from certfr_avis - Published: 2025-10-17 - Updated: 2025-10-17
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | Confidential Computing Module | Confidential Computing Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.2 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.2 | ||
| SUSE | Legacy Module | Legacy Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Enterprise Storage | SUSE Enterprise Storage 7.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "Confidential Computing Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "SUSE Enterprise Storage",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2021-4460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4460"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50242"
},
{
"name": "CVE-2022-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50244"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50253",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50253"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50265"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50285"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50287"
},
{
"name": "CVE-2022-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50288"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50291"
},
{
"name": "CVE-2022-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50292"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50311",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50311"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50323"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50325",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50325"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50339"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50352"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50356"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50360"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50365"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50378"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50396",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50396"
},
{
"name": "CVE-2022-50398",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50398"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50405",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50405"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50412",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50412"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50433"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50441"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50447"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50452",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50452"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53193"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53232"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53237"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53284"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53308"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53340"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53378"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53398"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53482",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53482"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53489"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53511",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53511"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2023-53532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53532"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21969"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-22023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22023"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2022-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49975"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-17T00:00:00",
"last_revision_date": "2025-10-17T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0895",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-17T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
},
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03615-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503615-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03553-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503553-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03557-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503557-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03539-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503539-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03543-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503543-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03580-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503580-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03613-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503613-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03600-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503600-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03602-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503602-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03561-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503561-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03614-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503614-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03567-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503567-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03554-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503554-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03576-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503576-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03626-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503626-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03548-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503548-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03551-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503551-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03601-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503601-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03578-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503578-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03575-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503575-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03562-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503562-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03572-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503572-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03550-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503550-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03568-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503568-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03569-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503569-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03563-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503563-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03566-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503566-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03555-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503555-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03529-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503529-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03538-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503538-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03571-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503571-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03559-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503559-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03528-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503528-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03583-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503583-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03552-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503552-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03577-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503577-1"
}
]
}
CERTFR-2025-AVI-0921
Vulnerability from certfr_avis - Published: 2025-10-24 - Updated: 2025-10-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2023-53513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53513"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-24T00:00:00",
"last_revision_date": "2025-10-24T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0921",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-24T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03650-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503650-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03636-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503636-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03648-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503648-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03652-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503652-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253761-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253761-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3736-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253736-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3772-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253772-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03663-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503663-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03634-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503634-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3703-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253703-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03643-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503643-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03646-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503646-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3720-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253720-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3712-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253712-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3734-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253734-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03672-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503672-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3748-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253748-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3770-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253770-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3751-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253751-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03638-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503638-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03628-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503628-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3679-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253679-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3704-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253704-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3684-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253684-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3733-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253733-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03671-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503671-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3675-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253675-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03664-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503664-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03633-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503633-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3755-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253755-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3683-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253683-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3716-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253716-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03653-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503653-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03666-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503666-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3725-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253725-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3771-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253771-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03656-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503656-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03662-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503662-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3705-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253705-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3764-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253764-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3721-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253721-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3768-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253768-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3717-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253717-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3769-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253769-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3740-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253740-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253762-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253762-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3741-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253741-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3742-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253742-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3731-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253731-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3765-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253765-1"
}
]
}
CERTFR-2025-AVI-1009
Vulnerability from certfr_avis - Published: 2025-11-14 - Updated: 2025-11-14
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2586"
},
{
"name": "CVE-2022-3640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3640"
},
{
"name": "CVE-2022-3619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3619"
},
{
"name": "CVE-2022-1679",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1679"
},
{
"name": "CVE-2022-2905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2905"
},
{
"name": "CVE-2022-3564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3564"
},
{
"name": "CVE-2022-4095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4095"
},
{
"name": "CVE-2022-3903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3903"
},
{
"name": "CVE-2022-2585",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2585"
},
{
"name": "CVE-2022-4662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4662"
},
{
"name": "CVE-2023-28866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28866"
},
{
"name": "CVE-2023-1990",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1990"
},
{
"name": "CVE-2023-3111",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3111"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26808"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39697"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39812"
},
{
"name": "CVE-2025-39813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39813"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39841"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39866"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-39881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39881"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39898",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39898"
},
{
"name": "CVE-2025-39902",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39902"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-39938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39938"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-39965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39965"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-39981",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39981"
},
{
"name": "CVE-2025-39982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39982"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-40018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40018"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2025-40051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40051"
},
{
"name": "CVE-2025-40052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40052"
},
{
"name": "CVE-2025-40056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40056"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2025-40061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40061"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40096"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2023-53541",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53541"
},
{
"name": "CVE-2023-53543",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53543"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53546"
},
{
"name": "CVE-2023-53548",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53548"
},
{
"name": "CVE-2023-53550",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53550"
},
{
"name": "CVE-2023-53552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53552"
},
{
"name": "CVE-2023-53553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53553"
},
{
"name": "CVE-2023-53554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53554"
},
{
"name": "CVE-2023-53555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53555"
},
{
"name": "CVE-2023-53556",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53556"
},
{
"name": "CVE-2023-53557",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53557"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2023-53559",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53559"
},
{
"name": "CVE-2023-53560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53560"
},
{
"name": "CVE-2023-53563",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53563"
},
{
"name": "CVE-2023-53568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53568"
},
{
"name": "CVE-2023-53570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53570"
},
{
"name": "CVE-2023-53572",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53572"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2023-53577",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53577"
},
{
"name": "CVE-2023-53579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53579"
},
{
"name": "CVE-2023-53580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53580"
},
{
"name": "CVE-2023-53581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53581"
},
{
"name": "CVE-2023-53583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53583"
},
{
"name": "CVE-2023-53585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53585"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2023-53593",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53593"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2023-53597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53597"
},
{
"name": "CVE-2023-53599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53599"
},
{
"name": "CVE-2023-53600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53600"
},
{
"name": "CVE-2023-53601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53601"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-53603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53603"
},
{
"name": "CVE-2023-53611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53611"
},
{
"name": "CVE-2023-53613",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53613"
},
{
"name": "CVE-2023-53615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53615"
},
{
"name": "CVE-2023-53616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53616"
},
{
"name": "CVE-2023-53617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53617"
},
{
"name": "CVE-2023-53618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53618"
},
{
"name": "CVE-2023-53619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53619"
},
{
"name": "CVE-2023-53621",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53621"
},
{
"name": "CVE-2023-53622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53622"
},
{
"name": "CVE-2023-53631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53631"
},
{
"name": "CVE-2023-53632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53632"
},
{
"name": "CVE-2023-53633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53633"
},
{
"name": "CVE-2023-53638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53638"
},
{
"name": "CVE-2023-53645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53645"
},
{
"name": "CVE-2023-53646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53646"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2023-53648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53648"
},
{
"name": "CVE-2023-53649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53649"
},
{
"name": "CVE-2023-53650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53650"
},
{
"name": "CVE-2023-53652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53652"
},
{
"name": "CVE-2023-53653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53653"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2023-53654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53654"
},
{
"name": "CVE-2023-53656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53656"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2023-53658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53658"
},
{
"name": "CVE-2023-53659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53659"
},
{
"name": "CVE-2023-53660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53660"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2023-53663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53663"
},
{
"name": "CVE-2023-53665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53665"
},
{
"name": "CVE-2023-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53666"
},
{
"name": "CVE-2023-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53668"
},
{
"name": "CVE-2023-53670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53670"
},
{
"name": "CVE-2023-53672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53672"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2023-53674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53674"
},
{
"name": "CVE-2023-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53681"
},
{
"name": "CVE-2023-53686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53686"
},
{
"name": "CVE-2023-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53687"
},
{
"name": "CVE-2023-53693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53693"
},
{
"name": "CVE-2023-53697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53697"
},
{
"name": "CVE-2023-53698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53698"
},
{
"name": "CVE-2023-53699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53699"
},
{
"name": "CVE-2023-53703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53703"
},
{
"name": "CVE-2023-53704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53704"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53708"
},
{
"name": "CVE-2023-53711",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53711"
},
{
"name": "CVE-2023-53713",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53713"
},
{
"name": "CVE-2023-53718",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53718"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2023-53722",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53722"
},
{
"name": "CVE-2023-53725",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53725"
},
{
"name": "CVE-2023-53726",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53726"
},
{
"name": "CVE-2023-53727",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53727"
},
{
"name": "CVE-2023-53728",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53728"
},
{
"name": "CVE-2023-53729",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53729"
},
{
"name": "CVE-2023-53730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53730"
},
{
"name": "CVE-2023-53731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53731"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-39895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39895"
},
{
"name": "CVE-2025-39900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39900"
},
{
"name": "CVE-2025-39948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39948"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2025-39984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39984"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2025-39991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39991"
},
{
"name": "CVE-2025-39993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39993"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-39997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39997"
},
{
"name": "CVE-2025-40000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40000"
},
{
"name": "CVE-2025-40010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40010"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40013"
},
{
"name": "CVE-2025-40037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40037"
},
{
"name": "CVE-2025-40058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40058"
},
{
"name": "CVE-2025-40062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40062"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-40091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40091"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2024-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53141"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53164"
},
{
"name": "CVE-2023-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52924"
},
{
"name": "CVE-2023-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52925"
},
{
"name": "CVE-2025-21700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21700"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2025-21703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21703"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2025-21756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21756"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21999",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21999"
},
{
"name": "CVE-2025-22056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22056"
},
{
"name": "CVE-2025-37785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37785"
},
{
"name": "CVE-2024-28956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28956"
},
{
"name": "CVE-2024-35840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35840"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-37798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37798"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37752"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2025-37890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37890"
},
{
"name": "CVE-2025-37932",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37932"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2025-37953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37953"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2022-49769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49769"
},
{
"name": "CVE-2022-49770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49770"
},
{
"name": "CVE-2022-49771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49771"
},
{
"name": "CVE-2022-49772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49772"
},
{
"name": "CVE-2022-49775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49775"
},
{
"name": "CVE-2022-49776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49776"
},
{
"name": "CVE-2022-49777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49777"
},
{
"name": "CVE-2022-49779",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49779"
},
{
"name": "CVE-2022-49783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49783"
},
{
"name": "CVE-2022-49787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49787"
},
{
"name": "CVE-2022-49788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49788"
},
{
"name": "CVE-2022-49789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49789"
},
{
"name": "CVE-2022-49790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49790"
},
{
"name": "CVE-2022-49792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49792"
},
{
"name": "CVE-2022-49793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49793"
},
{
"name": "CVE-2022-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49794"
},
{
"name": "CVE-2022-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49796"
},
{
"name": "CVE-2022-49797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49797"
},
{
"name": "CVE-2022-49799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49799"
},
{
"name": "CVE-2022-49800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49800"
},
{
"name": "CVE-2022-49801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49801"
},
{
"name": "CVE-2022-49802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49802"
},
{
"name": "CVE-2022-49807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49807"
},
{
"name": "CVE-2022-49809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49809"
},
{
"name": "CVE-2022-49810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49810"
},
{
"name": "CVE-2022-49812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49812"
},
{
"name": "CVE-2022-49813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49813"
},
{
"name": "CVE-2022-49818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49818"
},
{
"name": "CVE-2022-49821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49821"
},
{
"name": "CVE-2022-49822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49822"
},
{
"name": "CVE-2022-49823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49823"
},
{
"name": "CVE-2022-49824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49824"
},
{
"name": "CVE-2022-49825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49825"
},
{
"name": "CVE-2022-49826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49826"
},
{
"name": "CVE-2022-49827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49827"
},
{
"name": "CVE-2022-49830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49830"
},
{
"name": "CVE-2022-49832",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49832"
},
{
"name": "CVE-2022-49834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49834"
},
{
"name": "CVE-2022-49835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49835"
},
{
"name": "CVE-2022-49836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49836"
},
{
"name": "CVE-2022-49839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49839"
},
{
"name": "CVE-2022-49841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49841"
},
{
"name": "CVE-2022-49842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49842"
},
{
"name": "CVE-2022-49845",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49845"
},
{
"name": "CVE-2022-49846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49846"
},
{
"name": "CVE-2022-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49850"
},
{
"name": "CVE-2022-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49853"
},
{
"name": "CVE-2022-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49858"
},
{
"name": "CVE-2022-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49860"
},
{
"name": "CVE-2022-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49861"
},
{
"name": "CVE-2022-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49863"
},
{
"name": "CVE-2022-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49864"
},
{
"name": "CVE-2022-49865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49865"
},
{
"name": "CVE-2022-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49868"
},
{
"name": "CVE-2022-49869",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49869"
},
{
"name": "CVE-2022-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49870"
},
{
"name": "CVE-2022-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49871"
},
{
"name": "CVE-2022-49874",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49874"
},
{
"name": "CVE-2022-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49879"
},
{
"name": "CVE-2022-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49880"
},
{
"name": "CVE-2022-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49881"
},
{
"name": "CVE-2022-49885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49885"
},
{
"name": "CVE-2022-49887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49887"
},
{
"name": "CVE-2022-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49888"
},
{
"name": "CVE-2022-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49889"
},
{
"name": "CVE-2022-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49890"
},
{
"name": "CVE-2022-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49891"
},
{
"name": "CVE-2022-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49892"
},
{
"name": "CVE-2022-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49900"
},
{
"name": "CVE-2022-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49905"
},
{
"name": "CVE-2022-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49906"
},
{
"name": "CVE-2022-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49908"
},
{
"name": "CVE-2022-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49909"
},
{
"name": "CVE-2022-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49910"
},
{
"name": "CVE-2022-49915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49915"
},
{
"name": "CVE-2022-49916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49916"
},
{
"name": "CVE-2022-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49922"
},
{
"name": "CVE-2022-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49923"
},
{
"name": "CVE-2022-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49924"
},
{
"name": "CVE-2022-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49925"
},
{
"name": "CVE-2022-49927",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49927"
},
{
"name": "CVE-2022-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49928"
},
{
"name": "CVE-2022-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49931"
},
{
"name": "CVE-2023-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53035"
},
{
"name": "CVE-2023-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53038"
},
{
"name": "CVE-2023-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53039"
},
{
"name": "CVE-2023-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53040"
},
{
"name": "CVE-2023-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53041"
},
{
"name": "CVE-2023-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53044"
},
{
"name": "CVE-2023-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53045"
},
{
"name": "CVE-2023-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53049"
},
{
"name": "CVE-2023-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53052"
},
{
"name": "CVE-2023-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53054"
},
{
"name": "CVE-2023-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53056"
},
{
"name": "CVE-2023-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53058"
},
{
"name": "CVE-2023-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53059"
},
{
"name": "CVE-2023-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53060"
},
{
"name": "CVE-2023-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53062"
},
{
"name": "CVE-2023-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53064"
},
{
"name": "CVE-2023-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53065"
},
{
"name": "CVE-2023-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53066"
},
{
"name": "CVE-2023-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53068"
},
{
"name": "CVE-2023-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53075"
},
{
"name": "CVE-2023-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53077"
},
{
"name": "CVE-2023-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53078"
},
{
"name": "CVE-2023-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53079"
},
{
"name": "CVE-2023-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53081"
},
{
"name": "CVE-2023-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53084"
},
{
"name": "CVE-2023-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53087"
},
{
"name": "CVE-2023-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53089"
},
{
"name": "CVE-2023-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53090"
},
{
"name": "CVE-2023-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53091"
},
{
"name": "CVE-2023-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53092"
},
{
"name": "CVE-2023-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53093"
},
{
"name": "CVE-2023-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53096"
},
{
"name": "CVE-2023-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53098"
},
{
"name": "CVE-2023-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53099"
},
{
"name": "CVE-2023-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53100"
},
{
"name": "CVE-2023-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53101"
},
{
"name": "CVE-2023-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53106"
},
{
"name": "CVE-2023-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53108"
},
{
"name": "CVE-2023-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53111"
},
{
"name": "CVE-2023-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53114"
},
{
"name": "CVE-2023-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53116"
},
{
"name": "CVE-2023-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53118"
},
{
"name": "CVE-2023-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53119"
},
{
"name": "CVE-2023-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53123"
},
{
"name": "CVE-2023-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53124"
},
{
"name": "CVE-2023-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53125"
},
{
"name": "CVE-2023-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53131"
},
{
"name": "CVE-2023-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53134"
},
{
"name": "CVE-2023-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53137"
},
{
"name": "CVE-2023-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53139"
},
{
"name": "CVE-2023-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53140"
},
{
"name": "CVE-2023-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53142"
},
{
"name": "CVE-2023-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53143"
},
{
"name": "CVE-2023-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53145"
},
{
"name": "CVE-2022-49762",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49762"
},
{
"name": "CVE-2022-49763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49763"
},
{
"name": "CVE-2022-49773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49773"
},
{
"name": "CVE-2022-49781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49781"
},
{
"name": "CVE-2022-49784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49784"
},
{
"name": "CVE-2022-49786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49786"
},
{
"name": "CVE-2022-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49795"
},
{
"name": "CVE-2022-49837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49837"
},
{
"name": "CVE-2022-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49886"
},
{
"name": "CVE-2022-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49901"
},
{
"name": "CVE-2022-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49902"
},
{
"name": "CVE-2022-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49917"
},
{
"name": "CVE-2022-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49918"
},
{
"name": "CVE-2022-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49921"
},
{
"name": "CVE-2022-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49929"
},
{
"name": "CVE-2023-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53036"
},
{
"name": "CVE-2023-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53042"
},
{
"name": "CVE-2023-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53057"
},
{
"name": "CVE-2023-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53070"
},
{
"name": "CVE-2023-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53071"
},
{
"name": "CVE-2023-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53073"
},
{
"name": "CVE-2023-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53074"
},
{
"name": "CVE-2023-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53082"
},
{
"name": "CVE-2023-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53095"
},
{
"name": "CVE-2023-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53102"
},
{
"name": "CVE-2023-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53105"
},
{
"name": "CVE-2023-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53109"
},
{
"name": "CVE-2023-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53112"
},
{
"name": "CVE-2023-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53128"
},
{
"name": "CVE-2025-37997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37997"
},
{
"name": "CVE-2025-38000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38000"
},
{
"name": "CVE-2025-38001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38001"
},
{
"name": "CVE-2022-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49934"
},
{
"name": "CVE-2022-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49935"
},
{
"name": "CVE-2022-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49936"
},
{
"name": "CVE-2022-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49937"
},
{
"name": "CVE-2022-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49938"
},
{
"name": "CVE-2022-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49940"
},
{
"name": "CVE-2022-49942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49942"
},
{
"name": "CVE-2022-49943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49943"
},
{
"name": "CVE-2022-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49944"
},
{
"name": "CVE-2022-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49945"
},
{
"name": "CVE-2022-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49946"
},
{
"name": "CVE-2022-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49948"
},
{
"name": "CVE-2022-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49949"
},
{
"name": "CVE-2022-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49950"
},
{
"name": "CVE-2022-49951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49951"
},
{
"name": "CVE-2022-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49952"
},
{
"name": "CVE-2022-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49954"
},
{
"name": "CVE-2022-49956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49956"
},
{
"name": "CVE-2022-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49957"
},
{
"name": "CVE-2022-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49958"
},
{
"name": "CVE-2022-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49960"
},
{
"name": "CVE-2022-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49962"
},
{
"name": "CVE-2022-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49963"
},
{
"name": "CVE-2022-49964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49964"
},
{
"name": "CVE-2022-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49965"
},
{
"name": "CVE-2022-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49966"
},
{
"name": "CVE-2022-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49968"
},
{
"name": "CVE-2022-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49969"
},
{
"name": "CVE-2022-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49971"
},
{
"name": "CVE-2022-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49972"
},
{
"name": "CVE-2022-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49977"
},
{
"name": "CVE-2022-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49978"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2022-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49981"
},
{
"name": "CVE-2022-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49982"
},
{
"name": "CVE-2022-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49983"
},
{
"name": "CVE-2022-49984",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49984"
},
{
"name": "CVE-2022-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49985"
},
{
"name": "CVE-2022-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49986"
},
{
"name": "CVE-2022-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49987"
},
{
"name": "CVE-2022-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49989"
},
{
"name": "CVE-2022-49990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49990"
},
{
"name": "CVE-2022-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49993"
},
{
"name": "CVE-2022-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49995"
},
{
"name": "CVE-2022-49999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49999"
},
{
"name": "CVE-2022-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50002"
},
{
"name": "CVE-2022-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50003"
},
{
"name": "CVE-2022-50005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50005"
},
{
"name": "CVE-2022-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50006"
},
{
"name": "CVE-2022-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50008"
},
{
"name": "CVE-2022-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50010"
},
{
"name": "CVE-2022-50011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50011"
},
{
"name": "CVE-2022-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50012"
},
{
"name": "CVE-2022-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50015"
},
{
"name": "CVE-2022-50016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50016"
},
{
"name": "CVE-2022-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50019"
},
{
"name": "CVE-2022-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50020"
},
{
"name": "CVE-2022-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50021"
},
{
"name": "CVE-2022-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50022"
},
{
"name": "CVE-2022-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50023"
},
{
"name": "CVE-2022-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50024"
},
{
"name": "CVE-2022-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50026"
},
{
"name": "CVE-2022-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50027"
},
{
"name": "CVE-2022-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50028"
},
{
"name": "CVE-2022-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50029"
},
{
"name": "CVE-2022-50030",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50030"
},
{
"name": "CVE-2022-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50031"
},
{
"name": "CVE-2022-50032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50032"
},
{
"name": "CVE-2022-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50033"
},
{
"name": "CVE-2022-50034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50034"
},
{
"name": "CVE-2022-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50035"
},
{
"name": "CVE-2022-50036",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50036"
},
{
"name": "CVE-2022-50037",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50037"
},
{
"name": "CVE-2022-50038",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50038"
},
{
"name": "CVE-2022-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50039"
},
{
"name": "CVE-2022-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50040"
},
{
"name": "CVE-2022-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50041"
},
{
"name": "CVE-2022-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50044"
},
{
"name": "CVE-2022-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50045"
},
{
"name": "CVE-2022-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50046"
},
{
"name": "CVE-2022-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50047"
},
{
"name": "CVE-2022-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50049"
},
{
"name": "CVE-2022-50050",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50050"
},
{
"name": "CVE-2022-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50051"
},
{
"name": "CVE-2022-50052",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50052"
},
{
"name": "CVE-2022-50053",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50053"
},
{
"name": "CVE-2022-50054",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50054"
},
{
"name": "CVE-2022-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50055"
},
{
"name": "CVE-2022-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50059"
},
{
"name": "CVE-2022-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50060"
},
{
"name": "CVE-2022-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50061"
},
{
"name": "CVE-2022-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50062"
},
{
"name": "CVE-2022-50065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50065"
},
{
"name": "CVE-2022-50066",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50066"
},
{
"name": "CVE-2022-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50067"
},
{
"name": "CVE-2022-50068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50068"
},
{
"name": "CVE-2022-50072",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50072"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2022-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50074"
},
{
"name": "CVE-2022-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50076"
},
{
"name": "CVE-2022-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50077"
},
{
"name": "CVE-2022-50079",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50079"
},
{
"name": "CVE-2022-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50083"
},
{
"name": "CVE-2022-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50084"
},
{
"name": "CVE-2022-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50085"
},
{
"name": "CVE-2022-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50086"
},
{
"name": "CVE-2022-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50087"
},
{
"name": "CVE-2022-50092",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50092"
},
{
"name": "CVE-2022-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50093"
},
{
"name": "CVE-2022-50094",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50094"
},
{
"name": "CVE-2022-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50095"
},
{
"name": "CVE-2022-50097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50097"
},
{
"name": "CVE-2022-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50098"
},
{
"name": "CVE-2022-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50099"
},
{
"name": "CVE-2022-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50100"
},
{
"name": "CVE-2022-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50101"
},
{
"name": "CVE-2022-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50102"
},
{
"name": "CVE-2022-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50103"
},
{
"name": "CVE-2022-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50104"
},
{
"name": "CVE-2022-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50108"
},
{
"name": "CVE-2022-50109",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50109"
},
{
"name": "CVE-2022-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50110"
},
{
"name": "CVE-2022-50111",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50111"
},
{
"name": "CVE-2022-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50112"
},
{
"name": "CVE-2022-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50115"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2022-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50117"
},
{
"name": "CVE-2022-50118",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50118"
},
{
"name": "CVE-2022-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50120"
},
{
"name": "CVE-2022-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50121"
},
{
"name": "CVE-2022-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50124"
},
{
"name": "CVE-2022-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50125"
},
{
"name": "CVE-2022-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50126"
},
{
"name": "CVE-2022-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50127"
},
{
"name": "CVE-2022-50129",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50129"
},
{
"name": "CVE-2022-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50131"
},
{
"name": "CVE-2022-50132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50132"
},
{
"name": "CVE-2022-50133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50133"
},
{
"name": "CVE-2022-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50134"
},
{
"name": "CVE-2022-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50135"
},
{
"name": "CVE-2022-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50136"
},
{
"name": "CVE-2022-50137",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50137"
},
{
"name": "CVE-2022-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50138"
},
{
"name": "CVE-2022-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50139"
},
{
"name": "CVE-2022-50140",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50140"
},
{
"name": "CVE-2022-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50141"
},
{
"name": "CVE-2022-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50142"
},
{
"name": "CVE-2022-50143",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50143"
},
{
"name": "CVE-2022-50144",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50144"
},
{
"name": "CVE-2022-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50145"
},
{
"name": "CVE-2022-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50146"
},
{
"name": "CVE-2022-50149",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50149"
},
{
"name": "CVE-2022-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50151"
},
{
"name": "CVE-2022-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50152"
},
{
"name": "CVE-2022-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50153"
},
{
"name": "CVE-2022-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50154"
},
{
"name": "CVE-2022-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50155"
},
{
"name": "CVE-2022-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50156"
},
{
"name": "CVE-2022-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50157"
},
{
"name": "CVE-2022-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50158"
},
{
"name": "CVE-2022-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50160"
},
{
"name": "CVE-2022-50161",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50161"
},
{
"name": "CVE-2022-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50162"
},
{
"name": "CVE-2022-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50164"
},
{
"name": "CVE-2022-50165",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50165"
},
{
"name": "CVE-2022-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50166"
},
{
"name": "CVE-2022-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50169"
},
{
"name": "CVE-2022-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50171"
},
{
"name": "CVE-2022-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50172"
},
{
"name": "CVE-2022-50173",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50173"
},
{
"name": "CVE-2022-50175",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50175"
},
{
"name": "CVE-2022-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50176"
},
{
"name": "CVE-2022-50178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50178"
},
{
"name": "CVE-2022-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50179"
},
{
"name": "CVE-2022-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50181"
},
{
"name": "CVE-2022-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50183"
},
{
"name": "CVE-2022-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50184"
},
{
"name": "CVE-2022-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50185"
},
{
"name": "CVE-2022-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50186"
},
{
"name": "CVE-2022-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50187"
},
{
"name": "CVE-2022-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50188"
},
{
"name": "CVE-2022-50190",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50190"
},
{
"name": "CVE-2022-50191",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50191"
},
{
"name": "CVE-2022-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50192"
},
{
"name": "CVE-2022-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50194"
},
{
"name": "CVE-2022-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50196"
},
{
"name": "CVE-2022-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50197"
},
{
"name": "CVE-2022-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50198"
},
{
"name": "CVE-2022-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50199"
},
{
"name": "CVE-2022-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50200"
},
{
"name": "CVE-2022-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50201"
},
{
"name": "CVE-2022-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50202"
},
{
"name": "CVE-2022-50203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50203"
},
{
"name": "CVE-2022-50204",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50204"
},
{
"name": "CVE-2022-50206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50206"
},
{
"name": "CVE-2022-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50207"
},
{
"name": "CVE-2022-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50208"
},
{
"name": "CVE-2022-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50209"
},
{
"name": "CVE-2022-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50211"
},
{
"name": "CVE-2022-50212",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50212"
},
{
"name": "CVE-2022-50213",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50213"
},
{
"name": "CVE-2022-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50215"
},
{
"name": "CVE-2022-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50218"
},
{
"name": "CVE-2022-50220",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50220"
},
{
"name": "CVE-2022-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50221"
},
{
"name": "CVE-2022-50222",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50222"
},
{
"name": "CVE-2022-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50226"
},
{
"name": "CVE-2022-50228",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50228"
},
{
"name": "CVE-2022-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50229"
},
{
"name": "CVE-2022-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50231"
},
{
"name": "CVE-2023-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53046"
},
{
"name": "CVE-2023-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53048"
},
{
"name": "CVE-2023-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53076"
},
{
"name": "CVE-2023-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53097"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-38083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38083"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38453",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38453"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
}
],
"initial_release_date": "2025-11-14T00:00:00",
"last_revision_date": "2025-11-14T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1009",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20959-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520959-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4059-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254059-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3987-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253987-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4064-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254064-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20989-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520989-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4001-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254001-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4046-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254046-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4040-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254040-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4043-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254043-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4062-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254062-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3995-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253995-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20958-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520958-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4057-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254057-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4050-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254050-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:2264-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20252264-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20990-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520990-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4036-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254036-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:2173-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20252173-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4003-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254003-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4056-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254056-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4004-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254004-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20980-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520980-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4058-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254058-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4016-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254016-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4031-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254031-1"
},
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20991-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520991-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20981-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520981-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4078-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254078-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4063-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254063-1"
},
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20960-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520960-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4000-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254000-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4024-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254024-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3998-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253998-1"
}
]
}
CERTFR-2025-AVI-1032
Vulnerability from certfr_avis - Published: 2025-11-21 - Updated: 2025-11-21
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | Public Cloud Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Manager Server 4.3 LTS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39697"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39812"
},
{
"name": "CVE-2025-39813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39813"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39841"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39866"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2022-50327",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50327"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-39881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39881"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39902",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39902"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-39938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39938"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-39965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39965"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-39981",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39981"
},
{
"name": "CVE-2025-39982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39982"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-40018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40018"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2025-40051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40051"
},
{
"name": "CVE-2025-40052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40052"
},
{
"name": "CVE-2025-40056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40056"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2025-40061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40061"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-40080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40080"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40096"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2025-40102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40102"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2023-53541",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53541"
},
{
"name": "CVE-2023-53543",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53543"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53546"
},
{
"name": "CVE-2023-53548",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53548"
},
{
"name": "CVE-2023-53550",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53550"
},
{
"name": "CVE-2023-53552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53552"
},
{
"name": "CVE-2023-53553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53553"
},
{
"name": "CVE-2023-53554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53554"
},
{
"name": "CVE-2023-53555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53555"
},
{
"name": "CVE-2023-53556",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53556"
},
{
"name": "CVE-2023-53557",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53557"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2023-53559",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53559"
},
{
"name": "CVE-2023-53560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53560"
},
{
"name": "CVE-2023-53563",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53563"
},
{
"name": "CVE-2023-53568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53568"
},
{
"name": "CVE-2023-53570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53570"
},
{
"name": "CVE-2023-53572",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53572"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2023-53577",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53577"
},
{
"name": "CVE-2023-53579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53579"
},
{
"name": "CVE-2023-53580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53580"
},
{
"name": "CVE-2023-53581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53581"
},
{
"name": "CVE-2023-53583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53583"
},
{
"name": "CVE-2023-53585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53585"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2023-53593",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53593"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2023-53597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53597"
},
{
"name": "CVE-2023-53599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53599"
},
{
"name": "CVE-2023-53600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53600"
},
{
"name": "CVE-2023-53601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53601"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-53603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53603"
},
{
"name": "CVE-2023-53611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53611"
},
{
"name": "CVE-2023-53613",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53613"
},
{
"name": "CVE-2023-53615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53615"
},
{
"name": "CVE-2023-53616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53616"
},
{
"name": "CVE-2023-53617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53617"
},
{
"name": "CVE-2023-53618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53618"
},
{
"name": "CVE-2023-53619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53619"
},
{
"name": "CVE-2023-53621",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53621"
},
{
"name": "CVE-2023-53622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53622"
},
{
"name": "CVE-2023-53631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53631"
},
{
"name": "CVE-2023-53632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53632"
},
{
"name": "CVE-2023-53633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53633"
},
{
"name": "CVE-2023-53638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53638"
},
{
"name": "CVE-2023-53645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53645"
},
{
"name": "CVE-2023-53646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53646"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2023-53648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53648"
},
{
"name": "CVE-2023-53649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53649"
},
{
"name": "CVE-2023-53650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53650"
},
{
"name": "CVE-2023-53652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53652"
},
{
"name": "CVE-2023-53653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53653"
},
{
"name": "CVE-2023-53637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53637"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2023-53654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53654"
},
{
"name": "CVE-2023-53656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53656"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2023-53658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53658"
},
{
"name": "CVE-2023-53659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53659"
},
{
"name": "CVE-2023-53660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53660"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2023-53663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53663"
},
{
"name": "CVE-2023-53665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53665"
},
{
"name": "CVE-2023-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53666"
},
{
"name": "CVE-2023-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53668"
},
{
"name": "CVE-2023-53670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53670"
},
{
"name": "CVE-2023-53672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53672"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2023-53674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53674"
},
{
"name": "CVE-2023-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53681"
},
{
"name": "CVE-2023-53686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53686"
},
{
"name": "CVE-2023-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53687"
},
{
"name": "CVE-2023-53693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53693"
},
{
"name": "CVE-2023-53697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53697"
},
{
"name": "CVE-2023-53698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53698"
},
{
"name": "CVE-2023-53699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53699"
},
{
"name": "CVE-2023-53703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53703"
},
{
"name": "CVE-2023-53704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53704"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53708"
},
{
"name": "CVE-2023-53711",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53711"
},
{
"name": "CVE-2023-53713",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53713"
},
{
"name": "CVE-2023-53718",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53718"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2023-53722",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53722"
},
{
"name": "CVE-2023-53725",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53725"
},
{
"name": "CVE-2023-53726",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53726"
},
{
"name": "CVE-2023-53727",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53727"
},
{
"name": "CVE-2023-53728",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53728"
},
{
"name": "CVE-2023-53729",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53729"
},
{
"name": "CVE-2023-53730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53730"
},
{
"name": "CVE-2023-53731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53731"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-39895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39895"
},
{
"name": "CVE-2025-39900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39900"
},
{
"name": "CVE-2025-39948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39948"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2025-39984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39984"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2025-39991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39991"
},
{
"name": "CVE-2025-39993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39993"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-39997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39997"
},
{
"name": "CVE-2025-40000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40000"
},
{
"name": "CVE-2025-40010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40010"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40013"
},
{
"name": "CVE-2025-40037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40037"
},
{
"name": "CVE-2025-40058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40058"
},
{
"name": "CVE-2025-40062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40062"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-40091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40091"
},
{
"name": "CVE-2022-50334",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50334"
},
{
"name": "CVE-2022-50470",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50470"
},
{
"name": "CVE-2022-50471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50471"
},
{
"name": "CVE-2022-50472",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50472"
},
{
"name": "CVE-2022-50475",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50475"
},
{
"name": "CVE-2022-50478",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50478"
},
{
"name": "CVE-2022-50479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50479"
},
{
"name": "CVE-2022-50480",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50480"
},
{
"name": "CVE-2022-50482",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50482"
},
{
"name": "CVE-2022-50484",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50484"
},
{
"name": "CVE-2022-50485",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50485"
},
{
"name": "CVE-2022-50487",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50487"
},
{
"name": "CVE-2022-50488",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50488"
},
{
"name": "CVE-2022-50489",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50489"
},
{
"name": "CVE-2022-50490",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50490"
},
{
"name": "CVE-2022-50492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50492"
},
{
"name": "CVE-2022-50493",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50493"
},
{
"name": "CVE-2022-50494",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50494"
},
{
"name": "CVE-2022-50496",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50496"
},
{
"name": "CVE-2022-50497",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50497"
},
{
"name": "CVE-2022-50498",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50498"
},
{
"name": "CVE-2022-50499",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50499"
},
{
"name": "CVE-2022-50501",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50501"
},
{
"name": "CVE-2022-50503",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50503"
},
{
"name": "CVE-2022-50504",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50504"
},
{
"name": "CVE-2022-50505",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50505"
},
{
"name": "CVE-2022-50509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50509"
},
{
"name": "CVE-2022-50511",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50511"
},
{
"name": "CVE-2022-50512",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50512"
},
{
"name": "CVE-2022-50513",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50513"
},
{
"name": "CVE-2022-50514",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50514"
},
{
"name": "CVE-2022-50515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50515"
},
{
"name": "CVE-2022-50516",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50516"
},
{
"name": "CVE-2022-50519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50519"
},
{
"name": "CVE-2022-50520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50520"
},
{
"name": "CVE-2022-50521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50521"
},
{
"name": "CVE-2022-50523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50523"
},
{
"name": "CVE-2022-50524",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50524"
},
{
"name": "CVE-2022-50525",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50525"
},
{
"name": "CVE-2022-50526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50526"
},
{
"name": "CVE-2022-50527",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50527"
},
{
"name": "CVE-2022-50528",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50528"
},
{
"name": "CVE-2022-50529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50529"
},
{
"name": "CVE-2022-50530",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50530"
},
{
"name": "CVE-2022-50532",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50532"
},
{
"name": "CVE-2022-50534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50534"
},
{
"name": "CVE-2022-50535",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50535"
},
{
"name": "CVE-2022-50537",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50537"
},
{
"name": "CVE-2022-50541",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50541"
},
{
"name": "CVE-2022-50542",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50542"
},
{
"name": "CVE-2022-50543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50543"
},
{
"name": "CVE-2022-50544",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50544"
},
{
"name": "CVE-2022-50545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50545"
},
{
"name": "CVE-2022-50546",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50546"
},
{
"name": "CVE-2022-50549",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50549"
},
{
"name": "CVE-2022-50551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50551"
},
{
"name": "CVE-2022-50553",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50553"
},
{
"name": "CVE-2022-50556",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50556"
},
{
"name": "CVE-2022-50559",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50559"
},
{
"name": "CVE-2022-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50560"
},
{
"name": "CVE-2022-50561",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50561"
},
{
"name": "CVE-2022-50562",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50562"
},
{
"name": "CVE-2022-50563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50563"
},
{
"name": "CVE-2022-50564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50564"
},
{
"name": "CVE-2022-50566",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50566"
},
{
"name": "CVE-2022-50567",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50567"
},
{
"name": "CVE-2022-50568",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50568"
},
{
"name": "CVE-2022-50570",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50570"
},
{
"name": "CVE-2022-50572",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50572"
},
{
"name": "CVE-2022-50574",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50574"
},
{
"name": "CVE-2022-50575",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50575"
},
{
"name": "CVE-2022-50576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50576"
},
{
"name": "CVE-2022-50577",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50577"
},
{
"name": "CVE-2022-50578",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50578"
},
{
"name": "CVE-2022-50579",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50579"
},
{
"name": "CVE-2022-50580",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50580"
},
{
"name": "CVE-2022-50581",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50581"
},
{
"name": "CVE-2022-50582",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50582"
},
{
"name": "CVE-2023-53533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53533"
},
{
"name": "CVE-2023-53534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53534"
},
{
"name": "CVE-2023-53542",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53542"
},
{
"name": "CVE-2023-53547",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53547"
},
{
"name": "CVE-2023-53551",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53551"
},
{
"name": "CVE-2023-53562",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53562"
},
{
"name": "CVE-2023-53564",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53564"
},
{
"name": "CVE-2023-53566",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53566"
},
{
"name": "CVE-2023-53567",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53567"
},
{
"name": "CVE-2023-53571",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53571"
},
{
"name": "CVE-2023-53576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53576"
},
{
"name": "CVE-2023-53578",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53578"
},
{
"name": "CVE-2023-53582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53582"
},
{
"name": "CVE-2023-53587",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53587"
},
{
"name": "CVE-2023-53589",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53589"
},
{
"name": "CVE-2023-53591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53591"
},
{
"name": "CVE-2023-53592",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53592"
},
{
"name": "CVE-2023-53594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53594"
},
{
"name": "CVE-2023-53598",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53598"
},
{
"name": "CVE-2023-53604",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53604"
},
{
"name": "CVE-2023-53605",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53605"
},
{
"name": "CVE-2023-53607",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53607"
},
{
"name": "CVE-2023-53608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53608"
},
{
"name": "CVE-2023-53612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53612"
},
{
"name": "CVE-2023-53625",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53625"
},
{
"name": "CVE-2023-53626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53626"
},
{
"name": "CVE-2023-53639",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53639"
},
{
"name": "CVE-2023-53640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53640"
},
{
"name": "CVE-2023-53641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53641"
},
{
"name": "CVE-2023-53644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53644"
},
{
"name": "CVE-2023-53651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53651"
},
{
"name": "CVE-2023-53667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53667"
},
{
"name": "CVE-2023-53675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53675"
},
{
"name": "CVE-2023-53679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53679"
},
{
"name": "CVE-2023-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53680"
},
{
"name": "CVE-2023-53683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53683"
},
{
"name": "CVE-2023-53692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53692"
},
{
"name": "CVE-2023-53695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53695"
},
{
"name": "CVE-2023-53696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53696"
},
{
"name": "CVE-2023-53700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53700"
},
{
"name": "CVE-2023-53705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53705"
},
{
"name": "CVE-2023-53709",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53709"
},
{
"name": "CVE-2023-53715",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53715"
},
{
"name": "CVE-2023-53716",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53716"
},
{
"name": "CVE-2023-53717",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53717"
},
{
"name": "CVE-2023-53719",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53719"
},
{
"name": "CVE-2023-53723",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53723"
},
{
"name": "CVE-2023-53724",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53724"
},
{
"name": "CVE-2023-7324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7324"
},
{
"name": "CVE-2022-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48956"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-8805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8805"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-56664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56664"
},
{
"name": "CVE-2024-57893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57893"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2022-49080",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49080"
},
{
"name": "CVE-2022-49179",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49179"
},
{
"name": "CVE-2022-49545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49545"
},
{
"name": "CVE-2022-49563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49563"
},
{
"name": "CVE-2022-49564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49564"
},
{
"name": "CVE-2024-57996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57996"
},
{
"name": "CVE-2025-21772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21772"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2022-49053",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49053"
},
{
"name": "CVE-2022-49465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49465"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-37752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37752"
},
{
"name": "CVE-2025-37797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37797"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38000"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-38083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38083"
},
{
"name": "CVE-2025-38177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38177"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-38498",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38498"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
}
],
"initial_release_date": "2025-11-21T00:00:00",
"last_revision_date": "2025-11-21T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1032",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-21T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4128-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254128-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4123-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254123-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4140-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254140-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4141-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254141-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4139-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254139-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4135-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254135-1"
},
{
"published_at": "2025-11-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4111-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254111-1"
},
{
"published_at": "2025-11-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4149-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254149-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4132-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254132-1"
}
]
}
EUVD-2026-312018
European Vulnerability Database identifier assigned by ENISA{
"assigner": "ENISA",
"date_reserved": "2026-10-02T07:20:26.383102+00:00",
"id": "EUVD-2026-312018"
}
FKIE_CVE-2023-53380
Vulnerability from fkie_nvd - Published: 2025-09-18 14:15 - Updated: 2026-06-17 06:455.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "45fa023b3334a7ae6f6c4eb977295804222dfa28",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "2990e2ece18dd4cca71b3109c80517ad94adb065",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "222cc459d59857ee28a5366dc225ab42b22f9272",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "b5015b97adda6a24dd3e713c63e521ecbeff25c6",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "144c7fd008e0072b0b565f1157eec618de54ca8a",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
},
{
"lessThan": "34817a2441747b48e444cb0e05d84e14bc9443da",
"status": "affected",
"version": "ee37d7314a32ab6809eacc3389bad0406c69a81f",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/md/raid10.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.20"
},
{
"lessThan": "4.20",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.251",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.188",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.121",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.39",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.3.*",
"status": "unaffected",
"version": "6.3.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.4",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7FA663C4-CA72-4B5A-8592-7354D978F58E",
"versionEndExcluding": "5.4.251",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "43CAE50A-4A6C-488E-813C-F8DB77C13C8B",
"versionEndExcluding": "5.10.188",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EC77775B-EC31-4966-966C-1286C02B2A85",
"versionEndExcluding": "5.15.121",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9BD1D4A1-304D-4187-8178-6D7C0050B1AF",
"versionEndExcluding": "6.1.39",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "95CB4836-7F5D-4C20-B025-8E046EC87B78",
"versionEndExcluding": "6.3.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "6AB81046-CB69-4115-924C-963B37C41385",
"versionEndExcluding": "6.4.4",
"versionStartIncluding": "6.4",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0027mreplace\u0027 in raid10_sync_request(). In the first\ncheck, \u0027need_replace\u0027 will be set and \u0027mreplace\u0027 will be used later if\nno-Faulty \u0027mreplace\u0027 exists, In the second check, \u0027mreplace\u0027 will be\nset to NULL if it is Faulty, but \u0027need_replace\u0027 will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0027need_replace\u0027 with\n\u0027mreplace\u0027 because their values are always the same."
}
],
"id": "CVE-2023-53380",
"lastModified": "2026-06-17T06:45:09.573",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53380",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:56:06.480784Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-18T14:15:40.953",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
GHSA-9G3F-FGM8-4CGM
Vulnerability from github – Published: 2025-09-18 15:30 – Updated: 2025-12-11 18:30In the Linux kernel, the following vulnerability has been resolved:
md/raid10: fix null-ptr-deref of mreplace in raid10_sync_request
There are two check of 'mreplace' in raid10_sync_request(). In the first check, 'need_replace' will be set and 'mreplace' will be used later if no-Faulty 'mreplace' exists, In the second check, 'mreplace' will be set to NULL if it is Faulty, but 'need_replace' will not be changed accordingly. null-ptr-deref occurs if Faulty is set between two check.
Fix it by merging two checks into one. And replace 'need_replace' with 'mreplace' because their values are always the same.
{
"affected": [],
"aliases": [
"CVE-2023-53380"
],
"database_specific": {
"cwe_ids": [
"CWE-476"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-09-18T14:15:40Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0027mreplace\u0027 in raid10_sync_request(). In the first\ncheck, \u0027need_replace\u0027 will be set and \u0027mreplace\u0027 will be used later if\nno-Faulty \u0027mreplace\u0027 exists, In the second check, \u0027mreplace\u0027 will be\nset to NULL if it is Faulty, but \u0027need_replace\u0027 will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0027need_replace\u0027 with\n\u0027mreplace\u0027 because their values are always the same.",
"id": "GHSA-9g3f-fgm8-4cgm",
"modified": "2025-12-11T18:30:33Z",
"published": "2025-09-18T15:30:34Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53380"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/144c7fd008e0072b0b565f1157eec618de54ca8a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/222cc459d59857ee28a5366dc225ab42b22f9272"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2990e2ece18dd4cca71b3109c80517ad94adb065"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/34817a2441747b48e444cb0e05d84e14bc9443da"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/45fa023b3334a7ae6f6c4eb977295804222dfa28"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b5015b97adda6a24dd3e713c63e521ecbeff25c6"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f4368a462b1f9a8ecc2fdb09a28c3d4cad302a4f"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2025-2533 (CVE-2022-50299)
Vulnerability from osv_openeuler – Published: 2025-10-24 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
md: Replace snprintf with scnprintf
Current code produces a warning as shown below when total characters in the constituent block device names plus the slashes exceeds 200. snprintf() returns the number of characters generated from the given input, which could cause the expression “200 – len” to wrap around to a large positive number. Fix this by using scnprintf() instead, which returns the actual number of characters written into the buffer.
[ 1513.267938] ------------[ cut here ]------------ [ 1513.267943] WARNING: CPU: 15 PID: 37247 at <snip>/lib/vsprintf.c:2509 vsnprintf+0x2c8/0x510 [ 1513.267944] Modules linked in: <snip> [ 1513.267969] CPU: 15 PID: 37247 Comm: mdadm Not tainted 5.4.0-1085-azure #90~18.04.1-Ubuntu [ 1513.267969] Hardware name: Microsoft Corporation Virtual Machine/Virtual Machine, BIOS Hyper-V UEFI Release v4.1 05/09/2022 [ 1513.267971] RIP: 0010:vsnprintf+0x2c8/0x510 <-snip-> [ 1513.267982] Call Trace: [ 1513.267986] snprintf+0x45/0x70 [ 1513.267990] ? disk_name+0x71/0xa0 [ 1513.267993] dump_zones+0x114/0x240 [raid0] [ 1513.267996] ? _cond_resched+0x19/0x40 [ 1513.267998] raid0_run+0x19e/0x270 [raid0] [ 1513.268000] md_run+0x5e0/0xc50 [ 1513.268003] ? security_capable+0x3f/0x60 [ 1513.268005] do_md_run+0x19/0x110 [ 1513.268006] md_ioctl+0x195e/0x1f90 [ 1513.268007] blkdev_ioctl+0x91f/0x9f0 [ 1513.268010] block_ioctl+0x3d/0x50 [ 1513.268012] do_vfs_ioctl+0xa9/0x640 [ 1513.268014] ? __fput+0x162/0x260 [ 1513.268016] ksys_ioctl+0x75/0x80 [ 1513.268017] __x64_sys_ioctl+0x1a/0x20 [ 1513.268019] do_syscall_64+0x5e/0x200 [ 1513.268021] entry_SYSCALL_64_after_hwframe+0x44/0xa9(CVE-2022-50299)
In the Linux kernel, the following vulnerability has been resolved:
nbd: Fix hung when signal interrupts nbd_start_device_ioctl()
syzbot reported hung task [1]. The following program is a simplified version of the reproducer:
int main(void) { int sv[2], fd;
if (socketpair(AF_UNIX, SOCK_STREAM, 0, sv) < 0)
return 1;
if ((fd = open("/dev/nbd0", 0)) < 0)
return 1;
if (ioctl(fd, NBD_SET_SIZE_BLOCKS, 0x81) < 0)
return 1;
if (ioctl(fd, NBD_SET_SOCK, sv[0]) < 0)
return 1;
if (ioctl(fd, NBD_DO_IT) < 0)
return 1;
return 0;
}
When signal interrupt nbd_start_device_ioctl() waiting the condition atomic_read(&config->recv_threads) == 0, the task can hung because it waits the completion of the inflight IOs.
This patch fixes the issue by clearing queue, not just shutdown, when signal interrupt nbd_start_device_ioctl().(CVE-2022-50314)
In the Linux kernel, the following vulnerability has been resolved:
cifs: fix oops during encryption
When running xfstests against Azure the following oops occurred on an arm64 system
Unable to handle kernel write to read-only memory at virtual address ffff0001221cf000 Mem abort info: ESR = 0x9600004f EC = 0x25: DABT (current EL), IL = 32 bits SET = 0, FnV = 0 EA = 0, S1PTW = 0 FSC = 0x0f: level 3 permission fault Data abort info: ISV = 0, ISS = 0x0000004f CM = 0, WnR = 1 swapper pgtable: 4k pages, 48-bit VAs, pgdp=00000000294f3000 [ffff0001221cf000] pgd=18000001ffff8003, p4d=18000001ffff8003, pud=18000001ff82e003, pmd=18000001ff71d003, pte=00600001221cf787 Internal error: Oops: 9600004f [#1] PREEMPT SMP ... pstate: 80000005 (Nzcv daif -PAN -UAO -TCO BTYPE=--) pc : __memcpy+0x40/0x230 lr : scatterwalk_copychunks+0xe0/0x200 sp : ffff800014e92de0 x29: ffff800014e92de0 x28: ffff000114f9de80 x27: 0000000000000008 x26: 0000000000000008 x25: ffff800014e92e78 x24: 0000000000000008 x23: 0000000000000001 x22: 0000040000000000 x21: ffff000000000000 x20: 0000000000000001 x19: ffff0001037c4488 x18: 0000000000000014 x17: 235e1c0d6efa9661 x16: a435f9576b6edd6c x15: 0000000000000058 x14: 0000000000000001 x13: 0000000000000008 x12: ffff000114f2e590 x11: ffffffffffffffff x10: 0000040000000000 x9 : ffff8000105c3580 x8 : 2e9413b10000001a x7 : 534b4410fb86b005 x6 : 534b4410fb86b005 x5 : ffff0001221cf008 x4 : ffff0001037c4490 x3 : 0000000000000001 x2 : 0000000000000008 x1 : ffff0001037c4488 x0 : ffff0001221cf000 Call trace: __memcpy+0x40/0x230 scatterwalk_map_and_copy+0x98/0x100 crypto_ccm_encrypt+0x150/0x180 crypto_aead_encrypt+0x2c/0x40 crypt_message+0x750/0x880 smb3_init_transform_rq+0x298/0x340 smb_send_rqst.part.11+0xd8/0x180 smb_send_rqst+0x3c/0x100 compound_send_recv+0x534/0xbc0 smb2_query_info_compound+0x32c/0x440 smb2_set_ea+0x438/0x4c0 cifs_xattr_set+0x5d4/0x7c0
This is because in scatterwalk_copychunks(), we attempted to write to a buffer (@sign) that was allocated in the stack (vmalloc area) by crypt_message() and thus accessing its remaining 8 (x2) bytes ended up crossing a page boundary.
To simply fix it, we could just pass @sign kmalloc'd from crypt_message() and then we're done. Luckily, we don't seem to pass any other vmalloc'd buffers in smb_rqst::rq_iov...
Instead, let's map the correct pages and offsets from vmalloc buffers as well in cifs_sg_set_buf() and then avoiding such oopses.(CVE-2022-50341)
In the Linux kernel, the following vulnerability has been resolved:
drivers/md/md-bitmap: check the return value of md_bitmap_get_counter()
Check the return value of md_bitmap_get_counter() in case it returns NULL pointer, which will result in a null pointer dereference.
v2: update the check to include other dereference(CVE-2022-50402)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: ac97: fix possible memory leak in snd_ac97_dev_register()
If device_register() fails in snd_ac97_dev_register(), it should call put_device() to give up reference, or the name allocated in dev_set_name() is leaked.(CVE-2022-50427)
In the Linux kernel, the following vulnerability has been resolved:
mmc: vub300: fix warning - do not call blocking ops when !TASK_RUNNING
vub300_enable_sdio_irq() works with mutex and need TASK_RUNNING here. Ensure that we mark current as TASK_RUNNING for sleepable context.
[ 77.554641] do not call blocking ops when !TASK_RUNNING; state=1 set at [<ffffffff92a72c1d>] sdio_irq_thread+0x17d/0x5b0 [ 77.554652] WARNING: CPU: 2 PID: 1983 at kernel/sched/core.c:9813 __might_sleep+0x116/0x160 [ 77.554905] CPU: 2 PID: 1983 Comm: ksdioirqd/mmc1 Tainted: G OE 6.1.0-rc5 #1 [ 77.554910] Hardware name: Intel(R) Client Systems NUC8i7BEH/NUC8BEB, BIOS BECFL357.86A.0081.2020.0504.1834 05/04/2020 [ 77.554912] RIP: 0010:__might_sleep+0x116/0x160 [ 77.554920] RSP: 0018:ffff888107b7fdb8 EFLAGS: 00010282 [ 77.554923] RAX: 0000000000000000 RBX: ffff888118c1b740 RCX: 0000000000000000 [ 77.554926] RDX: 0000000000000001 RSI: 0000000000000004 RDI: ffffed1020f6ffa9 [ 77.554928] RBP: ffff888107b7fde0 R08: 0000000000000001 R09: ffffed1043ea60ba [ 77.554930] R10: ffff88821f5305cb R11: ffffed1043ea60b9 R12: ffffffff93aa3a60 [ 77.554932] R13: 000000000000011b R14: 7fffffffffffffff R15: ffffffffc0558660 [ 77.554934] FS: 0000000000000000(0000) GS:ffff88821f500000(0000) knlGS:0000000000000000 [ 77.554937] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 77.554939] CR2: 00007f8a44010d68 CR3: 000000024421a003 CR4: 00000000003706e0 [ 77.554942] Call Trace: [ 77.554944] <TASK> [ 77.554952] mutex_lock+0x78/0xf0 [ 77.554973] vub300_enable_sdio_irq+0x103/0x3c0 [vub300] [ 77.554981] sdio_irq_thread+0x25c/0x5b0 [ 77.555006] kthread+0x2b8/0x370 [ 77.555017] ret_from_fork+0x1f/0x30 [ 77.555023] </TASK> [ 77.555025] ---[ end trace 0000000000000000 ]---(CVE-2022-50430)
In the Linux kernel, the following vulnerability has been resolved:
clk: samsung: Fix memory leak in _samsung_clk_register_pll()
If clk_register() fails, @pll->rate_table may have allocated memory by kmemdup(), so it needs to be freed, otherwise will cause memory leak issue, this patch fixes it.(CVE-2022-50449)
In the Linux kernel, the following vulnerability has been resolved:
binfmt_misc: fix shift-out-of-bounds in check_special_flags
UBSAN reported a shift-out-of-bounds warning:
left shift of 1 by 31 places cannot be represented in type 'int' Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x8d/0xcf lib/dump_stack.c:106 ubsan_epilogue+0xa/0x44 lib/ubsan.c:151 __ubsan_handle_shift_out_of_bounds+0x1e7/0x208 lib/ubsan.c:322 check_special_flags fs/binfmt_misc.c:241 [inline] create_entry fs/binfmt_misc.c:456 [inline] bm_register_write+0x9d3/0xa20 fs/binfmt_misc.c:654 vfs_write+0x11e/0x580 fs/read_write.c:582 ksys_write+0xcf/0x120 fs/read_write.c:637 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x34/0x80 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd RIP: 0033:0x4194e1
Since the type of Node's flags is unsigned long, we should define these macros with same type too.(CVE-2022-50497)
In the Linux kernel, the following vulnerability has been resolved:
md/raid10: prevent soft lockup while flush writes
Currently, there is no limit for raid1/raid10 plugged bio. While flushing writes, raid1 has cond_resched() while raid10 doesn't, and too many writes can cause soft lockup.
Follow up soft lockup can be triggered easily with writeback test for raid10 with ramdisks:
watchdog: BUG: soft lockup - CPU#10 stuck for 27s! [md0_raid10:1293] Call Trace: <TASK> call_rcu+0x16/0x20 put_object+0x41/0x80 __delete_object+0x50/0x90 delete_object_full+0x2b/0x40 kmemleak_free+0x46/0xa0 slab_free_freelist_hook.constprop.0+0xed/0x1a0 kmem_cache_free+0xfd/0x300 mempool_free_slab+0x1f/0x30 mempool_free+0x3a/0x100 bio_free+0x59/0x80 bio_put+0xcf/0x2c0 free_r10bio+0xbf/0xf0 raid_end_bio_io+0x78/0xb0 one_write_done+0x8a/0xa0 raid10_end_write_request+0x1b4/0x430 bio_endio+0x175/0x320 brd_submit_bio+0x3b9/0x9b7 [brd] __submit_bio+0x69/0xe0 submit_bio_noacct_nocheck+0x1e6/0x5a0 submit_bio_noacct+0x38c/0x7e0 flush_pending_writes+0xf0/0x240 raid10d+0xac/0x1ed0
Fix the problem by adding cond_resched() to raid10 like what raid1 did.
Note that unlimited plugged bio still need to be optimized, for example, in the case of lots of dirty pages writeback, this will take lots of memory and io will spend a long time in plug, hence io latency is bad.(CVE-2023-53151)
In the Linux kernel, the following vulnerability has been resolved:
md/raid10: fix leak of 'r10bio->remaining' for recovery
raid10_sync_request() will add 'r10bio->remaining' for both rdev and replacement rdev. However, if the read io fails, recovery_request_write() returns without issuing the write io, in this case, end_sync_request() is only called once and 'remaining' is leaked, cause an io hang.
Fix the problem by decreasing 'remaining' according to if 'bio' and 'repl_bio' is valid.(CVE-2023-53299)
In the Linux kernel, the following vulnerability has been resolved:
md/raid10: fix wrong setting of max_corr_read_errors
There is no input check when echo md/max_read_errors and overflow might occur. Add check of input number.(CVE-2023-53313)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla2xxx: Wait for io return on terminate rport
System crash due to use after free. Current code allows terminate_rport_io to exit before making sure all IOs has returned. For FCP-2 device, IO's can hang on in HW because driver has not tear down the session in FW at first sign of cable pull. When dev_loss_tmo timer pops, terminate_rport_io is called and upper layer is about to free various resources. Terminate_rport_io trigger qla to do the final cleanup, but the cleanup might not be fast enough where it leave qla still holding on to the same resource.
Wait for IO's to return to upper layer before resources are freed.(CVE-2023-53322)
In the Linux kernel, the following vulnerability has been resolved:
md/raid10: check slab-out-of-bounds in md_bitmap_get_counter
If we write a large number to md/bitmap_set_bits, md_bitmap_checkpage() will return -EINVAL because 'page >= bitmap->pages', but the return value was not checked immediately in md_bitmap_get_counter() in order to set *blocks value and slab-out-of-bounds occurs.
Move check of 'page >= bitmap->pages' to md_bitmap_get_counter() and return directly if true.(CVE-2023-53357)
In the Linux kernel, the following vulnerability has been resolved:
md/raid10: fix null-ptr-deref of mreplace in raid10_sync_request
There are two check of 'mreplace' in raid10_sync_request(). In the first check, 'need_replace' will be set and 'mreplace' will be used later if no-Faulty 'mreplace' exists, In the second check, 'mreplace' will be set to NULL if it is Faulty, but 'need_replace' will not be changed accordingly. null-ptr-deref occurs if Faulty is set between two check.
Fix it by merging two checks into one. And replace 'need_replace' with 'mreplace' because their values are always the same.(CVE-2023-53380)
In the Linux kernel, the following vulnerability has been resolved:
scsi: ses: Handle enclosure with just a primary component gracefully
This reverts commit 3fe97ff3d949 ("scsi: ses: Don't attach if enclosure has no components") and introduces proper handling of case where there are no detected secondary components, but primary component (enumerated in num_enclosures) does exist. That fix was originally proposed by Ding Hui <(CVE-2023-53431)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla4xxx: Add length check when parsing nlattrs
There are three places that qla4xxx parses nlattrs:
-
qla4xxx_set_chap_entry()
-
qla4xxx_iface_set_param()
-
qla4xxx_sysfs_ddb_set_param()
and each of them directly converts the nlattr to specific pointer of structure without length checking. This could be dangerous as those attributes are not validated and a malformed nlattr (e.g., length 0) could result in an OOB read that leaks heap dirty data.
Add the nla_len check before accessing the nlattr data and return EINVAL if the length check fails.(CVE-2023-53456)
In the Linux kernel, the following vulnerability has been resolved:
udf: Do not bother merging very long extents
When merging very long extents we try to push as much length as possible to the first extent. However this is unnecessarily complicated and not really worth the trouble. Furthermore there was a bug in the logic resulting in corrupting extents in the file as syzbot reproducer shows. So just don't bother with the merging of extents that are too long together.(CVE-2023-53506)
In the Linux kernel, the following vulnerability has been resolved:
tracing/histograms: Add histograms to hist_vars if they have referenced variables
Hist triggers can have referenced variables without having direct variables fields. This can be the case if referenced variables are added for trigger actions. In this case the newly added references will not have field variables. Not taking such referenced variables into consideration can result in a bug where it would be possible to remove hist trigger with variables being refenced. This will result in a bug that is easily reproducable like so
$ cd /sys/kernel/tracing $ echo 'synthetic_sys_enter char[] comm; long id' >> synthetic_events $ echo 'hist:keys=common_pid.execname,id.syscall:vals=hitcount:comm=common_pid.execname' >> events/raw_syscalls/sys_enter/trigger $ echo 'hist:keys=common_pid.execname,id.syscall:onmatch(raw_syscalls.sys_enter).synthetic_sys_enter($comm, id)' >> events/raw_syscalls/sys_enter/trigger $ echo '!hist:keys=common_pid.execname,id.syscall:vals=hitcount:comm=common_pid.execname' >> events/raw_syscalls/sys_enter/trigger
[ 100.263533] ================================================================== [ 100.264634] BUG: KASAN: slab-use-after-free in resolve_var_refs+0xc7/0x180 [ 100.265520] Read of size 8 at addr ffff88810375d0f0 by task bash/439 [ 100.266320] [ 100.266533] CPU: 2 PID: 439 Comm: bash Not tainted 6.5.0-rc1 #4 [ 100.267277] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.0-20220807_005459-localhost 04/01/2014 [ 100.268561] Call Trace: [ 100.268902] <TASK> [ 100.269189] dump_stack_lvl+0x4c/0x70 [ 100.269680] print_report+0xc5/0x600 [ 100.270165] ? resolve_var_refs+0xc7/0x180 [ 100.270697] ? kasan_complete_mode_report_info+0x80/0x1f0 [ 100.271389] ? resolve_var_refs+0xc7/0x180 [ 100.271913] kasan_report+0xbd/0x100 [ 100.272380] ? resolve_var_refs+0xc7/0x180 [ 100.272920] __asan_load8+0x71/0xa0 [ 100.273377] resolve_var_refs+0xc7/0x180 [ 100.273888] event_hist_trigger+0x749/0x860 [ 100.274505] ? kasan_save_stack+0x2a/0x50 [ 100.275024] ? kasan_set_track+0x29/0x40 [ 100.275536] ? __pfx_event_hist_trigger+0x10/0x10 [ 100.276138] ? ksys_write+0xd1/0x170 [ 100.276607] ? do_syscall_64+0x3c/0x90 [ 100.277099] ? entry_SYSCALL_64_after_hwframe+0x6e/0xd8 [ 100.277771] ? destroy_hist_data+0x446/0x470 [ 100.278324] ? event_hist_trigger_parse+0xa6c/0x3860 [ 100.278962] ? __pfx_event_hist_trigger_parse+0x10/0x10 [ 100.279627] ? __kasan_check_write+0x18/0x20 [ 100.280177] ? mutex_unlock+0x85/0xd0 [ 100.280660] ? __pfx_mutex_unlock+0x10/0x10 [ 100.281200] ? kfree+0x7b/0x120 [ 100.281619] ? _kasanslab_free+0x15d/0x1d0 [ 100.282197] ? event_trigger_write+0xac/0x100 [ 100.282764] ? kasan_slab_free+0x16/0x20 [ 100.283293] ? __kmem_cache_free+0x153/0x2f0 [ 100.283844] ? sched_mm_cid_remote_clear+0xb1/0x250 [ 100.284550] ? __pfx_sched_mm_cid_remote_clear+0x10/0x10 [ 100.285221] ? event_trigger_write+0xbc/0x100 [ 100.285781] ? __kasan_check_read+0x15/0x20 [ 100.286321] ? __bitmap_weight+0x66/0xa0 [ 100.286833] ? _find_next_bit+0x46/0xe0 [ 100.287334] ? task_mm_cid_work+0x37f/0x450 [ 100.287872] event_triggers_call+0x84/0x150 [ 100.288408] trace_event_buffer_commit+0x339/0x430 [ 100.289073] ? ring_buffer_event_data+0x3f/0x60 [ 100.292189] trace_event_raw_event_sys_enter+0x8b/0xe0 [ 100.295434] syscall_trace_enter.constprop.0+0x18f/0x1b0 [ 100.298653] syscall_enter_from_user_mode+0x32/0x40 [ 100.301808] do_syscall_64+0x1a/0x90 [ 100.304748] entry_SYSCALL_64_after_hwframe+0x6e/0xd8 [ 100.307775] RIP: 0033:0x7f686c75c1cb [ 100.310617] Code: 73 01 c3 48 8b 0d 65 3c 10 00 f7 d8 64 89 01 48 83 c8 ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa b8 21 00 00 00 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 8b 0d 35 3c 10 00 f7 d8 64 89 01 48 [ 100.317847] RSP: 002b:00007ffc60137a38 EFLAGS: 00000246 ORIG_RAX: 0000000000000021 [ 100.321200] RA ---truncated---(CVE-2023-53560)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: btrtl: Prevent potential NULL dereference
The btrtl_initialize() function checks that rtl_load_file() either had an error or it loaded a zero length file. However, if it loaded a zero length file then the error code is not set correctly. It results in an error pointer vs NULL bug, followed by a NULL pointer dereference. This was detected by Smatch:
drivers/bluetooth/btrtl.c:592 btrtl_initialize() warn: passing zero to 'ERR_PTR'(CVE-2025-37792)
In the Linux kernel, the following vulnerability has been resolved:
drm/gem: Acquire references on GEM handles for framebuffers
A GEM handle can be released while the GEM buffer object is attached to a DRM framebuffer. This leads to the release of the dma-buf backing the buffer object, if any. [1] Trying to use the framebuffer in further mode-setting operations leads to a segmentation fault. Most easily happens with driver that use shadow planes for vmap-ing the dma-buf during a page flip. An example is shown below.
[ 156.791968] ------------[ cut here ]------------ [ 156.796830] WARNING: CPU: 2 PID: 2255 at drivers/dma-buf/dma-buf.c:1527 dma_buf_vmap+0x224/0x430 [...] [ 156.942028] RIP: 0010:dma_buf_vmap+0x224/0x430 [ 157.043420] Call Trace: [ 157.045898] <TASK> [ 157.048030] ? show_trace_log_lvl+0x1af/0x2c0 [ 157.052436] ? show_trace_log_lvl+0x1af/0x2c0 [ 157.056836] ? show_trace_log_lvl+0x1af/0x2c0 [ 157.061253] ? drm_gem_shmem_vmap+0x74/0x710 [ 157.065567] ? dma_buf_vmap+0x224/0x430 [ 157.069446] ? __warn.cold+0x58/0xe4 [ 157.073061] ? dma_buf_vmap+0x224/0x430 [ 157.077111] ? report_bug+0x1dd/0x390 [ 157.080842] ? handle_bug+0x5e/0xa0 [ 157.084389] ? exc_invalid_op+0x14/0x50 [ 157.088291] ? asm_exc_invalid_op+0x16/0x20 [ 157.092548] ? dma_buf_vmap+0x224/0x430 [ 157.096663] ? dma_resv_get_singleton+0x6d/0x230 [ 157.101341] ? __pfx_dma_buf_vmap+0x10/0x10 [ 157.105588] ? __pfx_dma_resv_get_singleton+0x10/0x10 [ 157.110697] drm_gem_shmem_vmap+0x74/0x710 [ 157.114866] drm_gem_vmap+0xa9/0x1b0 [ 157.118763] drm_gem_vmap_unlocked+0x46/0xa0 [ 157.123086] drm_gem_fb_vmap+0xab/0x300 [ 157.126979] drm_atomic_helper_prepare_planes.part.0+0x487/0xb10 [ 157.133032] ? lockdep_init_map_type+0x19d/0x880 [ 157.137701] drm_atomic_helper_commit+0x13d/0x2e0 [ 157.142671] ? drm_atomic_nonblocking_commit+0xa0/0x180 [ 157.147988] drm_mode_atomic_ioctl+0x766/0xe40 [...] [ 157.346424] ---[ end trace 0000000000000000 ]---
Acquiring GEM handles for the framebuffer's GEM buffer objects prevents this from happening. The framebuffer's cleanup later puts the handle references.
Commit 1a148af06000 ("drm/gem-shmem: Use dma_buf from GEM object instance") triggers the segmentation fault easily by using the dma-buf field more widely. The underlying issue with reference counting has been present before.
v2: - acquire the handle instead of the BO (Christian) - fix comment style (Christian) - drop the Fixes tag (Christian) - rename err_ gotos - add missing Link tag(CVE-2025-38449)
In the Linux kernel, the following vulnerability has been resolved:
NFS: Fix a race when updating an existing write
After nfs_lock_and_join_requests() tests for whether the request is still attached to the mapping, nothing prevents a call to nfs_inode_remove_request() from succeeding until we actually lock the page group. The reason is that whoever called nfs_inode_remove_request() doesn't necessarily have a lock on the page group head.
So in order to avoid races, let's take the page group lock earlier in nfs_lock_and_join_requests(), and hold it across the removal of the request in nfs_inode_remove_request().(CVE-2025-39697)
A heap-based buffer overflow vulnerability was found in the e1000_set_eeprom function of the Linux kernel. The vulnerability is caused by lack of input validation for the requested length of EEPROM changes, which may lead to heap overflow. Attackers can exploit this vulnerability to compromise confidentiality, integrity, and availability of memory.(CVE-2025-39898)
In the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer "buf" without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2510.3.0.0348.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2510.3.0.0348.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2510.3.0.0348.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd: Replace snprintf with scnprintf\n\nCurrent code produces a warning as shown below when total characters\nin the constituent block device names plus the slashes exceeds 200.\nsnprintf() returns the number of characters generated from the given\ninput, which could cause the expression \u201c200 \u2013 len\u201d to wrap around\nto a large positive number. Fix this by using scnprintf() instead,\nwhich returns the actual number of characters written into the buffer.\n\n[ 1513.267938] ------------[ cut here ]------------\n[ 1513.267943] WARNING: CPU: 15 PID: 37247 at \u0026lt;snip\u0026gt;/lib/vsprintf.c:2509 vsnprintf+0x2c8/0x510\n[ 1513.267944] Modules linked in: \u0026lt;snip\u0026gt;\n[ 1513.267969] CPU: 15 PID: 37247 Comm: mdadm Not tainted 5.4.0-1085-azure #90~18.04.1-Ubuntu\n[ 1513.267969] Hardware name: Microsoft Corporation Virtual Machine/Virtual Machine, BIOS Hyper-V UEFI Release v4.1 05/09/2022\n[ 1513.267971] RIP: 0010:vsnprintf+0x2c8/0x510\n\u0026lt;-snip-\u0026gt;\n[ 1513.267982] Call Trace:\n[ 1513.267986] snprintf+0x45/0x70\n[ 1513.267990] ? disk_name+0x71/0xa0\n[ 1513.267993] dump_zones+0x114/0x240 [raid0]\n[ 1513.267996] ? _cond_resched+0x19/0x40\n[ 1513.267998] raid0_run+0x19e/0x270 [raid0]\n[ 1513.268000] md_run+0x5e0/0xc50\n[ 1513.268003] ? security_capable+0x3f/0x60\n[ 1513.268005] do_md_run+0x19/0x110\n[ 1513.268006] md_ioctl+0x195e/0x1f90\n[ 1513.268007] blkdev_ioctl+0x91f/0x9f0\n[ 1513.268010] block_ioctl+0x3d/0x50\n[ 1513.268012] do_vfs_ioctl+0xa9/0x640\n[ 1513.268014] ? __fput+0x162/0x260\n[ 1513.268016] ksys_ioctl+0x75/0x80\n[ 1513.268017] __x64_sys_ioctl+0x1a/0x20\n[ 1513.268019] do_syscall_64+0x5e/0x200\n[ 1513.268021] entry_SYSCALL_64_after_hwframe+0x44/0xa9(CVE-2022-50299)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnbd: Fix hung when signal interrupts nbd_start_device_ioctl()\n\nsyzbot reported hung task [1]. The following program is a simplified\nversion of the reproducer:\n\nint main(void)\n{\n\tint sv[2], fd;\n\n\tif (socketpair(AF_UNIX, SOCK_STREAM, 0, sv) \u0026lt; 0)\n\t\treturn 1;\n\tif ((fd = open(\u0026quot;/dev/nbd0\u0026quot;, 0)) \u0026lt; 0)\n\t\treturn 1;\n\tif (ioctl(fd, NBD_SET_SIZE_BLOCKS, 0x81) \u0026lt; 0)\n\t\treturn 1;\n\tif (ioctl(fd, NBD_SET_SOCK, sv[0]) \u0026lt; 0)\n\t\treturn 1;\n\tif (ioctl(fd, NBD_DO_IT) \u0026lt; 0)\n\t\treturn 1;\n\treturn 0;\n}\n\nWhen signal interrupt nbd_start_device_ioctl() waiting the condition\natomic_read(\u0026amp;config-\u0026gt;recv_threads) == 0, the task can hung because it\nwaits the completion of the inflight IOs.\n\nThis patch fixes the issue by clearing queue, not just shutdown, when\nsignal interrupt nbd_start_device_ioctl().(CVE-2022-50314)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncifs: fix oops during encryption\n\nWhen running xfstests against Azure the following oops occurred on an\narm64 system\n\n Unable to handle kernel write to read-only memory at virtual address\n ffff0001221cf000\n Mem abort info:\n ESR = 0x9600004f\n EC = 0x25: DABT (current EL), IL = 32 bits\n SET = 0, FnV = 0\n EA = 0, S1PTW = 0\n FSC = 0x0f: level 3 permission fault\n Data abort info:\n ISV = 0, ISS = 0x0000004f\n CM = 0, WnR = 1\n swapper pgtable: 4k pages, 48-bit VAs, pgdp=00000000294f3000\n [ffff0001221cf000] pgd=18000001ffff8003, p4d=18000001ffff8003,\n pud=18000001ff82e003, pmd=18000001ff71d003, pte=00600001221cf787\n Internal error: Oops: 9600004f [#1] PREEMPT SMP\n ...\n pstate: 80000005 (Nzcv daif -PAN -UAO -TCO BTYPE=--)\n pc : __memcpy+0x40/0x230\n lr : scatterwalk_copychunks+0xe0/0x200\n sp : ffff800014e92de0\n x29: ffff800014e92de0 x28: ffff000114f9de80 x27: 0000000000000008\n x26: 0000000000000008 x25: ffff800014e92e78 x24: 0000000000000008\n x23: 0000000000000001 x22: 0000040000000000 x21: ffff000000000000\n x20: 0000000000000001 x19: ffff0001037c4488 x18: 0000000000000014\n x17: 235e1c0d6efa9661 x16: a435f9576b6edd6c x15: 0000000000000058\n x14: 0000000000000001 x13: 0000000000000008 x12: ffff000114f2e590\n x11: ffffffffffffffff x10: 0000040000000000 x9 : ffff8000105c3580\n x8 : 2e9413b10000001a x7 : 534b4410fb86b005 x6 : 534b4410fb86b005\n x5 : ffff0001221cf008 x4 : ffff0001037c4490 x3 : 0000000000000001\n x2 : 0000000000000008 x1 : ffff0001037c4488 x0 : ffff0001221cf000\n Call trace:\n __memcpy+0x40/0x230\n scatterwalk_map_and_copy+0x98/0x100\n crypto_ccm_encrypt+0x150/0x180\n crypto_aead_encrypt+0x2c/0x40\n crypt_message+0x750/0x880\n smb3_init_transform_rq+0x298/0x340\n smb_send_rqst.part.11+0xd8/0x180\n smb_send_rqst+0x3c/0x100\n compound_send_recv+0x534/0xbc0\n smb2_query_info_compound+0x32c/0x440\n smb2_set_ea+0x438/0x4c0\n cifs_xattr_set+0x5d4/0x7c0\n\nThis is because in scatterwalk_copychunks(), we attempted to write to\na buffer (@sign) that was allocated in the stack (vmalloc area) by\ncrypt_message() and thus accessing its remaining 8 (x2) bytes ended up\ncrossing a page boundary.\n\nTo simply fix it, we could just pass @sign kmalloc\u0026apos;d from\ncrypt_message() and then we\u0026apos;re done. Luckily, we don\u0026apos;t seem to pass\nany other vmalloc\u0026apos;d buffers in smb_rqst::rq_iov...\n\nInstead, let\u0026apos;s map the correct pages and offsets from vmalloc buffers\nas well in cifs_sg_set_buf() and then avoiding such oopses.(CVE-2022-50341)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/md/md-bitmap: check the return value of md_bitmap_get_counter()\n\nCheck the return value of md_bitmap_get_counter() in case it returns\nNULL pointer, which will result in a null pointer dereference.\n\nv2: update the check to include other dereference(CVE-2022-50402)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: ac97: fix possible memory leak in snd_ac97_dev_register()\n\nIf device_register() fails in snd_ac97_dev_register(), it should\ncall put_device() to give up reference, or the name allocated in\ndev_set_name() is leaked.(CVE-2022-50427)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmmc: vub300: fix warning - do not call blocking ops when !TASK_RUNNING\n\nvub300_enable_sdio_irq() works with mutex and need TASK_RUNNING here.\nEnsure that we mark current as TASK_RUNNING for sleepable context.\n\n[ 77.554641] do not call blocking ops when !TASK_RUNNING; state=1 set at [\u0026lt;ffffffff92a72c1d\u0026gt;] sdio_irq_thread+0x17d/0x5b0\n[ 77.554652] WARNING: CPU: 2 PID: 1983 at kernel/sched/core.c:9813 __might_sleep+0x116/0x160\n[ 77.554905] CPU: 2 PID: 1983 Comm: ksdioirqd/mmc1 Tainted: G OE 6.1.0-rc5 #1\n[ 77.554910] Hardware name: Intel(R) Client Systems NUC8i7BEH/NUC8BEB, BIOS BECFL357.86A.0081.2020.0504.1834 05/04/2020\n[ 77.554912] RIP: 0010:__might_sleep+0x116/0x160\n[ 77.554920] RSP: 0018:ffff888107b7fdb8 EFLAGS: 00010282\n[ 77.554923] RAX: 0000000000000000 RBX: ffff888118c1b740 RCX: 0000000000000000\n[ 77.554926] RDX: 0000000000000001 RSI: 0000000000000004 RDI: ffffed1020f6ffa9\n[ 77.554928] RBP: ffff888107b7fde0 R08: 0000000000000001 R09: ffffed1043ea60ba\n[ 77.554930] R10: ffff88821f5305cb R11: ffffed1043ea60b9 R12: ffffffff93aa3a60\n[ 77.554932] R13: 000000000000011b R14: 7fffffffffffffff R15: ffffffffc0558660\n[ 77.554934] FS: 0000000000000000(0000) GS:ffff88821f500000(0000) knlGS:0000000000000000\n[ 77.554937] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 77.554939] CR2: 00007f8a44010d68 CR3: 000000024421a003 CR4: 00000000003706e0\n[ 77.554942] Call Trace:\n[ 77.554944] \u0026lt;TASK\u0026gt;\n[ 77.554952] mutex_lock+0x78/0xf0\n[ 77.554973] vub300_enable_sdio_irq+0x103/0x3c0 [vub300]\n[ 77.554981] sdio_irq_thread+0x25c/0x5b0\n[ 77.555006] kthread+0x2b8/0x370\n[ 77.555017] ret_from_fork+0x1f/0x30\n[ 77.555023] \u0026lt;/TASK\u0026gt;\n[ 77.555025] ---[ end trace 0000000000000000 ]---(CVE-2022-50430)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nclk: samsung: Fix memory leak in _samsung_clk_register_pll()\n\nIf clk_register() fails, @pll-\u0026gt;rate_table may have allocated memory by\nkmemdup(), so it needs to be freed, otherwise will cause memory leak\nissue, this patch fixes it.(CVE-2022-50449)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbinfmt_misc: fix shift-out-of-bounds in check_special_flags\n\nUBSAN reported a shift-out-of-bounds warning:\n\n left shift of 1 by 31 places cannot be represented in type \u0026apos;int\u0026apos;\n Call Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x8d/0xcf lib/dump_stack.c:106\n ubsan_epilogue+0xa/0x44 lib/ubsan.c:151\n __ubsan_handle_shift_out_of_bounds+0x1e7/0x208 lib/ubsan.c:322\n check_special_flags fs/binfmt_misc.c:241 [inline]\n create_entry fs/binfmt_misc.c:456 [inline]\n bm_register_write+0x9d3/0xa20 fs/binfmt_misc.c:654\n vfs_write+0x11e/0x580 fs/read_write.c:582\n ksys_write+0xcf/0x120 fs/read_write.c:637\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x34/0x80 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n RIP: 0033:0x4194e1\n\nSince the type of Node\u0026apos;s flags is unsigned long, we should define these\nmacros with same type too.(CVE-2022-50497)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: prevent soft lockup while flush writes\n\nCurrently, there is no limit for raid1/raid10 plugged bio. While flushing\nwrites, raid1 has cond_resched() while raid10 doesn\u0026apos;t, and too many\nwrites can cause soft lockup.\n\nFollow up soft lockup can be triggered easily with writeback test for\nraid10 with ramdisks:\n\nwatchdog: BUG: soft lockup - CPU#10 stuck for 27s! [md0_raid10:1293]\nCall Trace:\n \u0026lt;TASK\u0026gt;\n call_rcu+0x16/0x20\n put_object+0x41/0x80\n __delete_object+0x50/0x90\n delete_object_full+0x2b/0x40\n kmemleak_free+0x46/0xa0\n slab_free_freelist_hook.constprop.0+0xed/0x1a0\n kmem_cache_free+0xfd/0x300\n mempool_free_slab+0x1f/0x30\n mempool_free+0x3a/0x100\n bio_free+0x59/0x80\n bio_put+0xcf/0x2c0\n free_r10bio+0xbf/0xf0\n raid_end_bio_io+0x78/0xb0\n one_write_done+0x8a/0xa0\n raid10_end_write_request+0x1b4/0x430\n bio_endio+0x175/0x320\n brd_submit_bio+0x3b9/0x9b7 [brd]\n __submit_bio+0x69/0xe0\n submit_bio_noacct_nocheck+0x1e6/0x5a0\n submit_bio_noacct+0x38c/0x7e0\n flush_pending_writes+0xf0/0x240\n raid10d+0xac/0x1ed0\n\nFix the problem by adding cond_resched() to raid10 like what raid1 did.\n\nNote that unlimited plugged bio still need to be optimized, for example,\nin the case of lots of dirty pages writeback, this will take lots of\nmemory and io will spend a long time in plug, hence io latency is bad.(CVE-2023-53151)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix leak of \u0026apos;r10bio-\u0026gt;remaining\u0026apos; for recovery\n\nraid10_sync_request() will add \u0026apos;r10bio-\u0026gt;remaining\u0026apos; for both rdev and\nreplacement rdev. However, if the read io fails, recovery_request_write()\nreturns without issuing the write io, in this case, end_sync_request()\nis only called once and \u0026apos;remaining\u0026apos; is leaked, cause an io hang.\n\nFix the problem by decreasing \u0026apos;remaining\u0026apos; according to if \u0026apos;bio\u0026apos; and\n\u0026apos;repl_bio\u0026apos; is valid.(CVE-2023-53299)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix wrong setting of max_corr_read_errors\n\nThere is no input check when echo md/max_read_errors and overflow might\noccur. Add check of input number.(CVE-2023-53313)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: qla2xxx: Wait for io return on terminate rport\n\nSystem crash due to use after free.\nCurrent code allows terminate_rport_io to exit before making\nsure all IOs has returned. For FCP-2 device, IO\u0026apos;s can hang\non in HW because driver has not tear down the session in FW at\nfirst sign of cable pull. When dev_loss_tmo timer pops,\nterminate_rport_io is called and upper layer is about to\nfree various resources. Terminate_rport_io trigger qla to do\nthe final cleanup, but the cleanup might not be fast enough where it\nleave qla still holding on to the same resource.\n\nWait for IO\u0026apos;s to return to upper layer before resources are freed.(CVE-2023-53322)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: check slab-out-of-bounds in md_bitmap_get_counter\n\nIf we write a large number to md/bitmap_set_bits, md_bitmap_checkpage()\nwill return -EINVAL because \u0026apos;page \u0026gt;= bitmap-\u0026gt;pages\u0026apos;, but the return value\nwas not checked immediately in md_bitmap_get_counter() in order to set\n*blocks value and slab-out-of-bounds occurs.\n\nMove check of \u0026apos;page \u0026gt;= bitmap-\u0026gt;pages\u0026apos; to md_bitmap_get_counter() and\nreturn directly if true.(CVE-2023-53357)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmd/raid10: fix null-ptr-deref of mreplace in raid10_sync_request\n\nThere are two check of \u0026apos;mreplace\u0026apos; in raid10_sync_request(). In the first\ncheck, \u0026apos;need_replace\u0026apos; will be set and \u0026apos;mreplace\u0026apos; will be used later if\nno-Faulty \u0026apos;mreplace\u0026apos; exists, In the second check, \u0026apos;mreplace\u0026apos; will be\nset to NULL if it is Faulty, but \u0026apos;need_replace\u0026apos; will not be changed\naccordingly. null-ptr-deref occurs if Faulty is set between two check.\n\nFix it by merging two checks into one. And replace \u0026apos;need_replace\u0026apos; with\n\u0026apos;mreplace\u0026apos; because their values are always the same.(CVE-2023-53380)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: ses: Handle enclosure with just a primary component gracefully\n\nThis reverts commit 3fe97ff3d949 (\u0026quot;scsi: ses: Don\u0026apos;t attach if enclosure\nhas no components\u0026quot;) and introduces proper handling of case where there are\nno detected secondary components, but primary component (enumerated in\nnum_enclosures) does exist. That fix was originally proposed by Ding Hui\n\u0026lt;(CVE-2023-53431)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: qla4xxx: Add length check when parsing nlattrs\n\nThere are three places that qla4xxx parses nlattrs:\n\n - qla4xxx_set_chap_entry()\n\n - qla4xxx_iface_set_param()\n\n - qla4xxx_sysfs_ddb_set_param()\n\nand each of them directly converts the nlattr to specific pointer of\nstructure without length checking. This could be dangerous as those\nattributes are not validated and a malformed nlattr (e.g., length 0) could\nresult in an OOB read that leaks heap dirty data.\n\nAdd the nla_len check before accessing the nlattr data and return EINVAL if\nthe length check fails.(CVE-2023-53456)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nudf: Do not bother merging very long extents\n\nWhen merging very long extents we try to push as much length as possible\nto the first extent. However this is unnecessarily complicated and not\nreally worth the trouble. Furthermore there was a bug in the logic\nresulting in corrupting extents in the file as syzbot reproducer shows.\nSo just don\u0026apos;t bother with the merging of extents that are too long\ntogether.(CVE-2023-53506)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntracing/histograms: Add histograms to hist_vars if they have referenced variables\n\nHist triggers can have referenced variables without having direct\nvariables fields. This can be the case if referenced variables are added\nfor trigger actions. In this case the newly added references will not\nhave field variables. Not taking such referenced variables into\nconsideration can result in a bug where it would be possible to remove\nhist trigger with variables being refenced. This will result in a bug\nthat is easily reproducable like so\n\n$ cd /sys/kernel/tracing\n$ echo \u0026apos;synthetic_sys_enter char[] comm; long id\u0026apos; \u0026gt;\u0026gt; synthetic_events\n$ echo \u0026apos;hist:keys=common_pid.execname,id.syscall:vals=hitcount:comm=common_pid.execname\u0026apos; \u0026gt;\u0026gt; events/raw_syscalls/sys_enter/trigger\n$ echo \u0026apos;hist:keys=common_pid.execname,id.syscall:onmatch(raw_syscalls.sys_enter).synthetic_sys_enter($comm, id)\u0026apos; \u0026gt;\u0026gt; events/raw_syscalls/sys_enter/trigger\n$ echo \u0026apos;!hist:keys=common_pid.execname,id.syscall:vals=hitcount:comm=common_pid.execname\u0026apos; \u0026gt;\u0026gt; events/raw_syscalls/sys_enter/trigger\n\n[ 100.263533] ==================================================================\n[ 100.264634] BUG: KASAN: slab-use-after-free in resolve_var_refs+0xc7/0x180\n[ 100.265520] Read of size 8 at addr ffff88810375d0f0 by task bash/439\n[ 100.266320]\n[ 100.266533] CPU: 2 PID: 439 Comm: bash Not tainted 6.5.0-rc1 #4\n[ 100.267277] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.0-20220807_005459-localhost 04/01/2014\n[ 100.268561] Call Trace:\n[ 100.268902] \u0026lt;TASK\u0026gt;\n[ 100.269189] dump_stack_lvl+0x4c/0x70\n[ 100.269680] print_report+0xc5/0x600\n[ 100.270165] ? resolve_var_refs+0xc7/0x180\n[ 100.270697] ? kasan_complete_mode_report_info+0x80/0x1f0\n[ 100.271389] ? resolve_var_refs+0xc7/0x180\n[ 100.271913] kasan_report+0xbd/0x100\n[ 100.272380] ? resolve_var_refs+0xc7/0x180\n[ 100.272920] __asan_load8+0x71/0xa0\n[ 100.273377] resolve_var_refs+0xc7/0x180\n[ 100.273888] event_hist_trigger+0x749/0x860\n[ 100.274505] ? kasan_save_stack+0x2a/0x50\n[ 100.275024] ? kasan_set_track+0x29/0x40\n[ 100.275536] ? __pfx_event_hist_trigger+0x10/0x10\n[ 100.276138] ? ksys_write+0xd1/0x170\n[ 100.276607] ? do_syscall_64+0x3c/0x90\n[ 100.277099] ? entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n[ 100.277771] ? destroy_hist_data+0x446/0x470\n[ 100.278324] ? event_hist_trigger_parse+0xa6c/0x3860\n[ 100.278962] ? __pfx_event_hist_trigger_parse+0x10/0x10\n[ 100.279627] ? __kasan_check_write+0x18/0x20\n[ 100.280177] ? mutex_unlock+0x85/0xd0\n[ 100.280660] ? __pfx_mutex_unlock+0x10/0x10\n[ 100.281200] ? kfree+0x7b/0x120\n[ 100.281619] ? ____kasan_slab_free+0x15d/0x1d0\n[ 100.282197] ? event_trigger_write+0xac/0x100\n[ 100.282764] ? __kasan_slab_free+0x16/0x20\n[ 100.283293] ? __kmem_cache_free+0x153/0x2f0\n[ 100.283844] ? sched_mm_cid_remote_clear+0xb1/0x250\n[ 100.284550] ? __pfx_sched_mm_cid_remote_clear+0x10/0x10\n[ 100.285221] ? event_trigger_write+0xbc/0x100\n[ 100.285781] ? __kasan_check_read+0x15/0x20\n[ 100.286321] ? __bitmap_weight+0x66/0xa0\n[ 100.286833] ? _find_next_bit+0x46/0xe0\n[ 100.287334] ? task_mm_cid_work+0x37f/0x450\n[ 100.287872] event_triggers_call+0x84/0x150\n[ 100.288408] trace_event_buffer_commit+0x339/0x430\n[ 100.289073] ? ring_buffer_event_data+0x3f/0x60\n[ 100.292189] trace_event_raw_event_sys_enter+0x8b/0xe0\n[ 100.295434] syscall_trace_enter.constprop.0+0x18f/0x1b0\n[ 100.298653] syscall_enter_from_user_mode+0x32/0x40\n[ 100.301808] do_syscall_64+0x1a/0x90\n[ 100.304748] entry_SYSCALL_64_after_hwframe+0x6e/0xd8\n[ 100.307775] RIP: 0033:0x7f686c75c1cb\n[ 100.310617] Code: 73 01 c3 48 8b 0d 65 3c 10 00 f7 d8 64 89 01 48 83 c8 ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa b8 21 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 8b 0d 35 3c 10 00 f7 d8 64 89 01 48\n[ 100.317847] RSP: 002b:00007ffc60137a38 EFLAGS: 00000246 ORIG_RAX: 0000000000000021\n[ 100.321200] RA\n---truncated---(CVE-2023-53560)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nBluetooth: btrtl: Prevent potential NULL dereference\n\nThe btrtl_initialize() function checks that rtl_load_file() either\nhad an error or it loaded a zero length file. However, if it loaded\na zero length file then the error code is not set correctly. It\nresults in an error pointer vs NULL bug, followed by a NULL pointer\ndereference. This was detected by Smatch:\n\ndrivers/bluetooth/btrtl.c:592 btrtl_initialize() warn: passing zero to \u0026apos;ERR_PTR\u0026apos;(CVE-2025-37792)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/gem: Acquire references on GEM handles for framebuffers\n\nA GEM handle can be released while the GEM buffer object is attached\nto a DRM framebuffer. This leads to the release of the dma-buf backing\nthe buffer object, if any. [1] Trying to use the framebuffer in further\nmode-setting operations leads to a segmentation fault. Most easily\nhappens with driver that use shadow planes for vmap-ing the dma-buf\nduring a page flip. An example is shown below.\n\n[ 156.791968] ------------[ cut here ]------------\n[ 156.796830] WARNING: CPU: 2 PID: 2255 at drivers/dma-buf/dma-buf.c:1527 dma_buf_vmap+0x224/0x430\n[...]\n[ 156.942028] RIP: 0010:dma_buf_vmap+0x224/0x430\n[ 157.043420] Call Trace:\n[ 157.045898] \u0026lt;TASK\u0026gt;\n[ 157.048030] ? show_trace_log_lvl+0x1af/0x2c0\n[ 157.052436] ? show_trace_log_lvl+0x1af/0x2c0\n[ 157.056836] ? show_trace_log_lvl+0x1af/0x2c0\n[ 157.061253] ? drm_gem_shmem_vmap+0x74/0x710\n[ 157.065567] ? dma_buf_vmap+0x224/0x430\n[ 157.069446] ? __warn.cold+0x58/0xe4\n[ 157.073061] ? dma_buf_vmap+0x224/0x430\n[ 157.077111] ? report_bug+0x1dd/0x390\n[ 157.080842] ? handle_bug+0x5e/0xa0\n[ 157.084389] ? exc_invalid_op+0x14/0x50\n[ 157.088291] ? asm_exc_invalid_op+0x16/0x20\n[ 157.092548] ? dma_buf_vmap+0x224/0x430\n[ 157.096663] ? dma_resv_get_singleton+0x6d/0x230\n[ 157.101341] ? __pfx_dma_buf_vmap+0x10/0x10\n[ 157.105588] ? __pfx_dma_resv_get_singleton+0x10/0x10\n[ 157.110697] drm_gem_shmem_vmap+0x74/0x710\n[ 157.114866] drm_gem_vmap+0xa9/0x1b0\n[ 157.118763] drm_gem_vmap_unlocked+0x46/0xa0\n[ 157.123086] drm_gem_fb_vmap+0xab/0x300\n[ 157.126979] drm_atomic_helper_prepare_planes.part.0+0x487/0xb10\n[ 157.133032] ? lockdep_init_map_type+0x19d/0x880\n[ 157.137701] drm_atomic_helper_commit+0x13d/0x2e0\n[ 157.142671] ? drm_atomic_nonblocking_commit+0xa0/0x180\n[ 157.147988] drm_mode_atomic_ioctl+0x766/0xe40\n[...]\n[ 157.346424] ---[ end trace 0000000000000000 ]---\n\nAcquiring GEM handles for the framebuffer\u0026apos;s GEM buffer objects prevents\nthis from happening. The framebuffer\u0026apos;s cleanup later puts the handle\nreferences.\n\nCommit 1a148af06000 (\u0026quot;drm/gem-shmem: Use dma_buf from GEM object\ninstance\u0026quot;) triggers the segmentation fault easily by using the dma-buf\nfield more widely. The underlying issue with reference counting has\nbeen present before.\n\nv2:\n- acquire the handle instead of the BO (Christian)\n- fix comment style (Christian)\n- drop the Fixes tag (Christian)\n- rename err_ gotos\n- add missing Link tag(CVE-2025-38449)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nNFS: Fix a race when updating an existing write\n\nAfter nfs_lock_and_join_requests() tests for whether the request is\nstill attached to the mapping, nothing prevents a call to\nnfs_inode_remove_request() from succeeding until we actually lock the\npage group.\nThe reason is that whoever called nfs_inode_remove_request() doesn\u0026apos;t\nnecessarily have a lock on the page group head.\n\nSo in order to avoid races, let\u0026apos;s take the page group lock earlier in\nnfs_lock_and_join_requests(), and hold it across the removal of the\nrequest in nfs_inode_remove_request().(CVE-2025-39697)\n\nA heap-based buffer overflow vulnerability was found in the e1000_set_eeprom function of the Linux kernel. The vulnerability is caused by lack of input validation for the requested length of EEPROM changes, which may lead to heap overflow. Attackers can exploit this vulnerability to compromise confidentiality, integrity, and availability of memory.(CVE-2025-39898)\n\nIn the Linux kernel, a buffer overflow vulnerability exists in the target_lu_gp_members_show function in target_core_configfs.c. The vulnerability arises from the usage of snprintf to write into the buffer \u0026quot;buf\u0026quot; without checking the return value length. When the total formatted string length exceeds LU_GROUP_NAME_BUF (256 bytes), it may cause a buffer overflow. Since snprintf() returns the total number of bytes that would have been written, this value may exceed the buffer length (256 bytes) passed to memcpy(), ultimately causing the memcpy function to report a buffer overflow error. Adding an additional check of the return value of snprintf() can avoid this buffer overflow.(CVE-2025-39998)",
"id": "OESA-2025-2533",
"modified": "2026-08-06T11:09:37Z",
"published": "2025-10-24T11:09:37Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2533"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50299"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50314"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50341"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50402"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50430"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50449"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50497"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53151"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53299"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53313"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53322"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53357"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53380"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53431"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53456"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53506"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53560"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-37792"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38449"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39697"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39898"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39998"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50299",
"CVE-2022-50314",
"CVE-2022-50341",
"CVE-2022-50402",
"CVE-2022-50427",
"CVE-2022-50430",
"CVE-2022-50449",
"CVE-2022-50497",
"CVE-2023-53151",
"CVE-2023-53299",
"CVE-2023-53313",
"CVE-2023-53322",
"CVE-2023-53357",
"CVE-2023-53380",
"CVE-2023-53431",
"CVE-2023-53456",
"CVE-2023-53506",
"CVE-2023-53560",
"CVE-2025-37792",
"CVE-2025-38449",
"CVE-2025-39697",
"CVE-2025-39898",
"CVE-2025-39998"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.